57 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
7 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC8963
Formula: C23H28O9
Ingredient ID: NPC86412
Formula: C6H14O6
Ingredient ID: NPC86412
| Common Name | Mannitol |
| IUPAC Name | (2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol |
| Canonical SMILES | OC[C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
| Standard InCHI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| Standard InCHIKey | FBPFZTCFMRRESA-KVTDHHQDSA-N |
| Ingredient External Links |
PubChem CID: 6251 ChEMBL ID: CHEMBL689 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC86412] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cistanche deserticola | Cistanche | Orobanchaceae |
  |
| Allium tuberosum | Allium | Amaryllidaceae |
|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Centella asiatica | Centella | Apiaceae |
|
| Juncus effusus | Juncus | Juncaceae |
|
| Crataegus pinnatifida | Crataegus | Rosaceae |
|
| Conyza canadensis | Conyza | Asteraceae |
|
| Coreopsis fasciculata | Coreopsis | Asteraceae | |
| Cneorum pulverulentum | Cneorum | Rutaceae |
|
| Carum carvi | Carum | Apiaceae |
 |
| Balanophora harlandii | Balanophora | Balanophoraceae | |
| Changium smyrnioides | Changium | Apiaceae |
|
| Selinum carvifolium | Selinum | Apiaceae | |
| Rhamnus japonica | Rhamnus | Rhamnaceae |
|
| Fraxinus ornus | Fraxinus | Oleaceae |
 |
| Selaginella tamariscina | Selaginella | Selaginellaceae |
|
| Kandelia candel | Kandelia | Rhizophoraceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Angelica decursiva | Angelica | Apiaceae |
|
| Malus pumila | Malus | Rosaceae |
|
| Thuja plicata | Thuja | Cupressaceae |
|
| Trichosanthes kirilowii maxim | Trichosanthes | Cucurbitaceae | |
| Diospyros verrucosa | Diospyros | Ebenaceae |
|
| Polemonium caeruleum | Polemonium | Polemoniaceae |
|
| Ligustrum lucidum | Ligustrum | Oleaceae |
|
| Crepis foetida | Crepis | Asteraceae |
|
| Cirsium japonicum | Cirsium | Asteraceae |
|
| Dorstenia lindeniana | Dorstenia | Moraceae | |
| Dioscoreophyllum cumminsii | Dioscoreophyllum | Menispermaceae |
|
| Athanasia crithmifolia | Athanasia | Asteraceae | |
| Phytolacca acinosa | Phytolacca | Phytolaccaceae |
|
| Garcinia hombroniana | Garcinia | Clusiaceae |
|
| Cardiospermum halicacabum | Cardiospermum | Sapindaceae |
|
| Combretum indicum | Combretum | Combretaceae |
|
| Aglaia elaeagnoidea | Aglaia | Meliaceae |
|
| Punica granatum | Punica | Lythraceae |
|
| Platycodon grandiflorus | Platycodon | Campanulaceae |
|
| Urtica triangularis | Urtica | Urticaceae |
|
| Strychnos ledermannii | Strychnos | Loganiaceae | |
| Pouzolzia occidentalis | Pouzolzia | Urticaceae | |
| Centaurea nigrescens | Centaurea | Asteraceae |
|
| Piper arboreum | Piper | Piperaceae |
|
| Perovskia abrotanoides | Salvia | Lamiaceae |
|
| Parastrephia lepidophylla | Parastrephia | Asteraceae | |
| Photinia serratifolia | Photinia | Rosaceae |
|
| Phlogacanthus thyrsiflorus | Phlogacanthus | Acanthaceae |
|
| Euphorbia segetalis | Euphorbia | Euphorbiaceae | |
| Sidastrum acuminatum | Sidastrum | Malvaceae | |
| Syncolostemon parviflorus | Syncolostemon | Lamiaceae | |
| Aristolochia elegans | Aristolochia | Aristolochiaceae | |
| Penstemon secundiflorus | Penstemon | Plantaginaceae | |
| Cuphea carthagenensis | Cuphea | Lythraceae | |
| Ozoroa insignis | Ozoroa | Anacardiaceae |
|
| Ruta microcarpa | Ruta | Rutaceae |
|
| Crinum defixum | Crinum | Amaryllidaceae |
|
| Orobanche coerulescens | Orobanche | Orobanchaceae |
|
| Polygala glomerata | Polygala | Polygalaceae |
|
| Hedera rhombea | Hedera | Araliaceae |
|
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Zanthoxylum monophyllum | Zanthoxylum | Rutaceae | |
| Angylocalyx oligophyllus | Angylocalyx | Fabaceae | |
| Salvia mirzayanii | Salvia | Lamiaceae | |
| Tricalysia okelensis | Tricalysia | Rubiaceae |
|
| Euphorbia biglandulosa | Euphorbia | Euphorbiaceae | |
| Abutilon indicum | Abutilon | Malvaceae |
|
| Taxus cuspidata | Taxus | Taxaceae |
|
| Polyalthia nemoralis | Polyalthia | Annonaceae |
|
| Tetraneuris acaulis | Tetraneuris | Asteraceae | |
| Capsella bursa-pastoris | Capsella | Brassicaceae |
|
| Orobanche pycnostachya | Orobanche | Orobanchaceae | |
| Cardamine pinnata | Cardamine | Brassicaceae | |
| Codonocarpus australis | Codonocarpus | Gyrostemonaceae | |
| Schizonepeta multifida | Schizonepeta | Lamiaceae | |
| Swertia japonica | Swertia | Gentianaceae |
|
| Quercus serrata | Quercus | Fagaceae |
|
| Crateva nurvala | Crateva | Capparaceae |
|
| Tamarix gallica | Tamarix | Tamaricaceae |
|
| Polygala amara | Polygala | Polygalaceae |
|
| Stephania sutchuenensis | Stephania | Menispermaceae | |
| Unonopsis glaucopetala | Unonopsis | Annonaceae | |
| Rubus rosa | Rubus | Rosaceae |
|
| Pleogyne cunninghamii | Pleogyne | Menispermaceae | |
| Pyrola decorata | Pyrola | Ericaceae |
|
| Pleogyne cunninghami | Pleogyne | Menispermaceae | |
| Euonymus nanoides | Euonymus | Celastraceae | |
| Selaginella pulvinata | Selaginella | Selaginellaceae |
|
| Cerbera dilatata | Cerbera | Apocynaceae | |
| Achillea clypeolata | Achillea | Asteraceae | |
| Bridelia ferruginea | Bridelia | Phyllanthaceae |
|
| Berberis julianae | Berberis | Berberidaceae |
|
| Zieria smithii | Zieria | Rutaceae | |
| Bystropogon origanifolius | Bystropogon | Lamiaceae | |
| Astragalus gummifer | Astragalus | Fabaceae |
|
| Coptis teeta | Coptis | Ranunculaceae |
|
| Origanum vulgare | Origanum | Lamiaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Triglochin maritima | Triglochin | Juncaginaceae |
|
| Lupinus cosentinii | Lupinus | Fabaceae | |
| Rheum maximowiczii | Rheum | Polygonaceae |
|
| Morinda citrifolia | Morinda | Rubiaceae |
|
| Peucedanum praeruptorum | Peucedanum | Apiaceae |
|
| Hypericum perforatum | Hypericum | Hypericaceae |
|
| Prunus armeniaca | Prunus | Rosaceae |
|
| Viburnum davidii | Viburnum | Adoxaceae | |
| Agathosma scaberula | Agathosma | Rutaceae | |
| Typha angustata | Typha | Typhaceae |
|
| Eupatorium fortunei turcz | Eupatorium | Asteraceae | |
| Jacobaea subalpina | Jacobaea | Asteraceae | |
| Phedimus kamtschaticus | Phedimus | Crassulaceae |
|
| Dolichos lablab l | Dolichos | Fabaceae | |
| Cistanche tubulosa | Cistanche | Orobanchaceae |
|
| Brandisia hancei | Brandisia | Orobanchaceae |
|
| Commelina communis | Commelina | Commelinaceae |
|
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Vaccaria hispanica | Vaccaria | Caryophyllaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Gardenia jasminoides | Gardenia | Rubiaceae |
|
| Cichorium intybus | Cichorium | Asteraceae |
|
Ingredient ID: NPC86191
Formula: C5H10O5
Ingredient ID: NPC86191
| Common Name | n.a. |
| IUPAC Name | (3R,4S,5R)-oxane-2,3,4,5-tetrol |
| Canonical SMILES | O[C@@H]1COC([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5?/m1/s1 |
| Standard InCHIKey | SRBFZHDQGSBBOR-IOVATXLUSA-N |
| Ingredient External Links |
PubChem CID: 135191 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC86191] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Bupleurum scorzonerifolium | Bupleurum | Apiaceae |
|
| Plantago major | Plantago | Plantaginaceae |
|
| Rubia akane | Rubia | Rubiaceae |
|
| Bupleurum chinense | Bupleurum | Apiaceae |
|
| Bupleurum falcatum | Bupleurum | Apiaceae |
|
| Allium macrostemon | Allium | Amaryllidaceae |
|
| Allium chinense | Allium | Amaryllidaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC82448
Formula: C37H50O21
Ingredient ID: NPC82448
| Common Name | n.a. |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,5-dihydroxy-6-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]oxan-2-yl]methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](COC(=O)/C=C/c3ccc(c(c3)OC)O)O[C@H]([C@@H]2O)OCCc2ccc(c(c2)O)OC)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C37H50O21/c1-50-20-7-4-17(11-19(20)41)9-10-52-35-32(49)33(28(45)24(56-35)15-53-25(42)8-5-16-3-6-18(40)21(12-16)51-2)57-37-34(30(47)27(44)23(14-39)55-37)58-36-31(48)29(46)26(43)22(13-38)54-36/h3-8,11-12,22-24,26-41,43-49H,9-10,13-15H2,1-2H3/b8-5+/t22-,23-,24-,26-,27-,28-,29+,30+,31-,32-,33+,34-,35-,36+,37+/m1/s1 |
| Standard InCHIKey | YZESEXGNLJTMTQ-UTHVASKGSA-N |
| Ingredient External Links |
PubChem CID: 102316527 |
| Plant-Ingredient Association Reference |
Database: TM-MC |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC76684
Formula: C23H28O13
Ingredient ID: NPC76684
| Common Name | n.a. |
| IUPAC Name | [1a-(hydroxymethyl)-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5a,6,6a-tetrahydro-1bH-oxireno[5,6]cyclopenta[1,3-c]pyran-6-yl] 4-hydroxy-3-methoxybenzoate |
| Canonical SMILES | OCC1OC(OC2OC=CC3C2C2(CO)OC2C3OC(=O)c2ccc(c(c2)OC)O)C(C(C1O)O)O |
| Standard InCHI | InChI=1S/C23H28O13/c1-31-12-6-9(2-3-11(12)26)20(30)34-18-10-4-5-32-21(14(10)23(8-25)19(18)36-23)35-22-17(29)16(28)15(27)13(7-24)33-22/h2-6,10,13-19,21-22,24-29H,7-8H2,1H3 |
| Standard InCHIKey | AKNILCMFRRDTEY-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 3081484 |
| Plant-Ingredient Association Reference |
Database: TM-MC |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC75839
Formula: C11H17N3O7
Ingredient ID: NPC75839
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | N=C1N[C@H](O)[C@@H]2[C@@]3(N1)[C@H](O)[C@H]1[C@@]([C@@H]2O[C@@]([C@H]3O)(O1)O)(C)O |
| Standard InCHI | InChI=1S/C11H17N3O7/c1-9(18)4-2-6(16)13-8(12)14-10(2)3(15)5(9)21-11(19,20-4)7(10)17/h2-7,15-19H,1H3,(H3,12,13,14)/t2-,3-,4-,5+,6-,7+,9+,10-,11+/m1/s1 |
| Standard InCHIKey | XXUFXWUHBMGUMY-QOZOJKKESA-N |
| Ingredient External Links |
PubChem CID: 90669995 ChEMBL ID: CHEMBL3233265 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD13339] Database: NPASS [NPC75839] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Tadehagi triquetrum | Tadehagi | Fabaceae |
|
Ingredient ID: NPC71996
Formula: C20H32O5
Ingredient ID: NPC7190
Formula: C24H28O11
Ingredient ID: NPC7190
| Common Name | n.a. |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[[(1aR,1bS,5aR,6S,6aS)-6-hydroxy-1a-(hydroxymethyl)-2,5a,6,6a-tetrahydro-1bH-oxireno[5,6]cyclopenta[1,3-c]pyran-2-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-phenylprop-2-enoate |
| Canonical SMILES | OC[C@]12O[C@H]2[C@H]([C@H]2[C@@H]1C(OC=C2)O[C@@H]1O[C@H](COC(=O)/C=C/c2ccccc2)[C@H]([C@@H]([C@H]1O)O)O)O |
| Standard InCHI | InChI=1S/C24H28O11/c25-11-24-16-13(17(27)21(24)35-24)8-9-31-22(16)34-23-20(30)19(29)18(28)14(33-23)10-32-15(26)7-6-12-4-2-1-3-5-12/h1-9,13-14,16-23,25,27-30H,10-11H2/b7-6+/t13-,14-,16-,17+,18-,19+,20-,21+,22?,23+,24+/m1/s1 |
| Standard InCHIKey | XZGPUOQGERGURE-XAJLVDHKSA-N |
| Ingredient External Links |
PubChem CID: 45358142 |
| Plant-Ingredient Association Reference |
Database: TCMID [17330] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Panax quinquefolius | Panax | Araliaceae |
|
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC68327
Formula: C11H17N3O8
Ingredient ID: NPC68327
| Common Name | Tetrodotoxin |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@@]1(O)[C@H]2O[C@]3(O[C@@H]1[C@H]1[C@@]([C@@H]2O)([C@@H]3O)NC(=N)N[C@@H]1O)O |
| Standard InCHI | InChI=1S/C11H17N3O8/c12-8-13-6(17)2-4-9(19,1-15)5-3(16)10(2,14-8)7(18)11(20,21-4)22-5/h2-7,15-20H,1H2,(H3,12,13,14)/t2-,3-,4-,5+,6-,7+,9+,10-,11+/m1/s1 |
| Standard InCHIKey | CFMYXEVWODSLAX-QOZOJKKESA-N |
| Ingredient External Links |
PubChem CID: 11174599 ChEMBL ID: CHEMBL507974 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD112774] Database: NPASS [NPC68327] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Tadehagi triquetrum | Tadehagi | Fabaceae |
|
Ingredient ID: NPC67118
Formula: C5H10O5
Ingredient ID: NPC67118
| Common Name | n.a. |
| IUPAC Name | 2,3,4,5-tetrahydroxypentanal |
| Canonical SMILES | OCC(C(C(C=O)O)O)O |
| Standard InCHI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2 |
| Standard InCHIKey | PYMYPHUHKUWMLA-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 854 |
| Plant-Ingredient Association Reference |
Database: TM-MC |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Bupleurum scorzonerifolium | Bupleurum | Apiaceae |
|
| Rubia akane | Rubia | Rubiaceae |
|
| Bupleurum chinense | Bupleurum | Apiaceae |
|
| Bupleurum falcatum | Bupleurum | Apiaceae |
|
| Allium macrostemon | Allium | Amaryllidaceae |
|
| Allium chinense | Allium | Amaryllidaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC66090
Formula: C31H40O16
Ingredient ID: NPC66090
| Common Name | n.a. |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](COC(=O)/C=C/c3ccc(c(c3)OC)O)O[C@H]([C@@H]2O)OCCc2ccc(c(c2)O)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C31H40O16/c1-41-19-7-4-16(11-18(19)34)9-10-43-30-28(40)29(47-31-27(39)26(38)24(36)21(13-32)45-31)25(37)22(46-30)14-44-23(35)8-5-15-3-6-17(33)20(12-15)42-2/h3-8,11-12,21-22,24-34,36-40H,9-10,13-14H2,1-2H3/b8-5+/t21-,22-,24-,25-,26+,27-,28-,29+,30-,31+/m1/s1 |
| Standard InCHIKey | MTKGYCQUEWGDQW-CRVIUCGDSA-N |
| Ingredient External Links |
PubChem CID: 9831187 |
| Plant-Ingredient Association Reference |
Database: TM-MC |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Euphorbia antiquorum | Euphorbia | Euphorbiaceae |
|
| Cyathula tomentosa | Cyathula | Amaranthaceae |
|
| Scapania aequiloba | Scapania | Scapaniaceae | |
| Exochorda giraldii | Exochorda | Rosaceae | |
| Artemisia argentea | Artemisia | Asteraceae | |
| Brodiaea californica | Brodiaea | Asparagaceae | |
| Allium stipitatum | Allium | Amaryllidaceae |
|
| Spergula japonica | Spergula | Caryophyllaceae | |
| Asphodeline damascena | Asphodeline | Asphodelaceae | |
| Populus yunnanensis | Populus | Salicaceae | |
| Scabiosa comosa | Scabiosa | Caprifoliaceae |
|
| Plectranthus lanuginosus | Plectranthus | Lamiaceae |
|
| Kopsia longiflora | Kopsia | Apocynaceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Lepidophorum repandum | Lepidophorum | Asteraceae | |
| Alstonia pittieri | Alstonia | Apocynaceae | |
| Angiopteris evecta | Angiopteris | Marattiaceae |
|
| Rhododendron campylocarpum | Rhododendron | Ericaceae | |
| Stephania aculeata | Stephania | Menispermaceae | |
| Toddalia aculeata | Toddalia | Rutaceae |
|
| Himantoglossum hircinum | Himantoglossum | Orchidaceae | |
| Solanum pseudopersicum | Solanum | Solanaceae | |
| Acacia lasiopetala | Acacia | Fabaceae | |
| Euphrasia rubra | Euphrasia | Orobanchaceae | |
| Notholaena lemmonii | Notholaena | Pteridaceae | |
| Rhodanthe maryonii | Rhodanthe | Asteraceae | |
| Plantago asiatica | Plantago | Plantaginaceae |
|
| Myristica malabarica | Myristica | Myristicaceae |
|
| Spartium junceum | Spartium | Fabaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Eucalyptus kitsoniana | Eucalyptus | Myrtaceae | |
| Plagiomnium cuspidatum | Plagiomnium | Mniaceae |
Ingredient ID: NPC60689
Formula: C21H26O8
Ingredient ID: NPC53028
Formula: C7H14O7
Ingredient ID: NPC53028
| Common Name | n.a. |
| IUPAC Name | (3S,4R,5R,6R)-1,3,4,5,6,7-hexahydroxyheptan-2-one |
| Canonical SMILES | OC[C@H]([C@H]([C@H]([C@@H](C(=O)CO)O)O)O)O |
| Standard InCHI | InChI=1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3,5-10,12-14H,1-2H2/t3-,5-,6-,7-/m1/s1 |
| Standard InCHIKey | HSNZZMHEPUFJNZ-SHUUEZRQSA-N |
| Ingredient External Links |
PubChem CID: 5459879 |
| Plant-Ingredient Association Reference |
Database: TCMID [13498] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Chrozophora prostrata | Chrozophora | Euphorbiaceae |
|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Phedimus aizoon | Phedimus | Crassulaceae | |
| Fraxinus ornus | Fraxinus | Oleaceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Medicago sativa | Medicago | Fabaceae |
|
| Ligustrum lucidum | Ligustrum | Oleaceae |
|
| Punica granatum | Punica | Lythraceae |
|
| Aloe microstigma | Aloe | Asphodelaceae | |
| Eriobotrya japonica | Eriobotrya | Rosaceae |
|
| Capsella bursa-pastoris | Capsella | Brassicaceae |
|
| Tamarix gallica | Tamarix | Tamaricaceae |
|
| Typha angustata | Typha | Typhaceae |
|
| Cocos nucifera | Cocos | Arecaceae |
|
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Papaver somniferum | Papaver | Papaveraceae |
|
Ingredient ID: NPC42562
Formula: C11H17N3O6
Ingredient ID: NPC42562
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | N=C1N[C@H](O)[C@@H]2[C@]3(N1)[C@H](O)C(=O)O[C@@H]([C@H]3O)[C@@](C2)(C)O |
| Standard InCHI | InChI=1S/C11H17N3O6/c1-10(19)2-3-7(17)13-9(12)14-11(3)4(15)6(10)20-8(18)5(11)16/h3-7,15-17,19H,2H2,1H3,(H3,12,13,14)/t3-,4-,5-,6+,7-,10+,11-/m1/s1 |
| Standard InCHIKey | BYZDMEGVRYTGTF-IWVBRRTNSA-N |
| Ingredient External Links |
PubChem CID: 10860951 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD222224] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Tadehagi triquetrum | Tadehagi | Fabaceae |
|
Ingredient ID: NPC41010
Formula: C23H28O13
Ingredient ID: NPC41010
| Common Name | n.a. |
| IUPAC Name | [(1aS,1bS,2S,5aR,6S,6aS)-1a-(hydroxymethyl)-2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5a,6,6a-tetrahydro-1bH-oxireno[5,6]cyclopenta[1,3-c]pyran-6-yl] 4-hydroxy-3-methoxybenzoate |
| Canonical SMILES | OC[C@H]1OC(O[C@@H]2OC=C[C@@H]3[C@H]2[C@@]2(CO)O[C@H]2[C@H]3OC(=O)c2ccc(c(c2)OC)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C23H28O13/c1-31-12-6-9(2-3-11(12)26)20(30)34-18-10-4-5-32-21(14(10)23(8-25)19(18)36-23)35-22-17(29)16(28)15(27)13(7-24)33-22/h2-6,10,13-19,21-22,24-29H,7-8H2,1H3/t10-,13-,14-,15-,16+,17-,18+,19+,21+,22?,23-/m1/s1 |
| Standard InCHIKey | AKNILCMFRRDTEY-LCABTXCLSA-N |
| Ingredient External Links |
PubChem CID: 45358143 |
| Plant-Ingredient Association Reference |
Database: TM-MC |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC3780
Formula: C25H32O12
Ingredient ID: NPC3780
| Common Name | n.a. |
| IUPAC Name | [(1S,4aR,7S,7aS)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-5-yl] (Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@@H]2OC=C[C@@H]3[C@H]2[C@@](C)(O)CC3OC(=O)/C=Cc2ccc(c(c2)OC)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C25H32O12/c1-25(32)10-16(35-18(28)6-4-12-3-5-14(27)15(9-12)33-2)13-7-8-34-23(19(13)25)37-24-22(31)21(30)20(29)17(11-26)36-24/h3-9,13,16-17,19-24,26-27,29-32H,10-11H2,1-2H3/b6-4-/t13-,16?,17+,19+,20+,21-,22+,23-,24-,25-/m0/s1 |
| Standard InCHIKey | LOCASNZLOPRAJY-ULTVMYMVSA-N |
| Ingredient External Links |
PubChem CID: 6325178 |
| Plant-Ingredient Association Reference |
Database: TCMID [7768] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Equisetum hyemale | Equisetum | Equisetaceae |
|
| Capparis spinosa | Capparis | Capparaceae |
|
| Corydalis decumbens | Corydalis | Papaveraceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Actaea dahurica | Actaea | Ranunculaceae |
|
| Chamaemelum nobile | Chamaemelum | Asteraceae |
|
| Angelica sinensis | Angelica | Apiaceae |
|
| Actaea cimicifuga | Actaea | Ranunculaceae |
|
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Tsuga heterophylla | Tsuga | Pinaceae |
|
| Plantago major | Plantago | Plantaginaceae |
|
| Urtica dioica | Urtica | Urticaceae |
|
| Allium cepa | Allium | Amaryllidaceae |
|
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Lycopodium japonicum | Lycopodium | Lycopodiaceae |
|
| Beta vulgaris | Beta | Chenopodiaceae |
|
| Taraxacum officinale | Taraxacum | Asteraceae |
|
| Huperzia selago | Huperzia | Lycopodiaceae |
|
| Foeniculum vulgare | Foeniculum | Apiaceae |
|
| Citrus limon | Citrus | Rutaceae |
|
| Coptis chinensis | Coptis | Ranunculaceae |
|
| Citrus limonia | Citrus | Rutaceae |
|
| Raphanus sativus | Raphanus | Brassicaceae |
|
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Oryza sativa | Oryza | Poaceae |
|
| Catalpa ovata | Catalpa | Bignoniaceae |
|
Ingredient ID: NPC35555
Formula: C20H30O13
Ingredient ID: NPC32163
Formula: C9H10O3
Ingredient ID: NPC32163
| Common Name | Apocynin |
| IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)ethanone |
| Canonical SMILES | COc1cc(ccc1O)C(=O)C |
| Standard InCHI | InChI=1S/C9H10O3/c1-6(10)7-3-4-8(11)9(5-7)12-2/h3-5,11H,1-2H3 |
| Standard InCHIKey | DFYRUELUNQRZTB-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 2214 ChEMBL ID: CHEMBL346919 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC32163] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tripteris microcarpa | Tripteris | Asteraceae | |
| Lupinus pilosus | Lupinus | Fabaceae | |
| Sargentodoxa cuneata | Sargentodoxa | Lardizabalaceae |
|
| Fabiana imbricata | Fabiana | Solanaceae |
|
| Gossypium herbaceum | Gossypium | Malvaceae |
|
| Stellaria dichotoma | Stellaria | Caryophyllaceae | |
| Cylindropuntia leptocaulis | Cylindropuntia | Cactaceae |
|
| Mesembryanthemum tortuosum | Mesembryanthemum | Aizoaceae |
|
| Iris tectorum | Iris | Iridaceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Paeonia rockii | Paeonia | Paeoniaceae | |
| Artemisia giraldii | Artemisia | Asteraceae | |
| Calystegia pubescens | Calystegia | Convolvulaceae |
|
| Conocarpus erectus | Conocarpus | Combretaceae |
|
| Millettia pinnata | Millettia | Fabaceae |
|
| Zingiber officinale | Zingiber | Zingiberaceae |
|
| Anastatica hierochuntica | Anastatica | Brassicaceae |
|
| Imperata cylindrica | Imperata | Poaceae |
|
| Picea glauca | Picea | Pinaceae |
|
| Maackia floribunda | Maackia | Fabaceae | |
| Trichilia catigua | Trichilia | Meliaceae |
|
| Philadelphus coronarius | Philadelphus | Hydrangeaceae |
|
| Pterocarpus macrocarpus | Pterocarpus | Fabaceae |
|
| Meliosma wightii | Meliosma | Sabiaceae | |
| Simaba cuneata | Simaba | Simaroubaceae |
|
| Thalictrum podocarpum | Thalictrum | Ranunculaceae | |
| Polygala fruticosa | Polygala | Polygalaceae |
|
| Huperzia selago | Huperzia | Lycopodiaceae |
|
| Kielmeyera rubriflora | Kielmeyera | Calophyllaceae | |
| Turbina corymbosa | Turbina | Convolvulaceae |
|
| Sorbaria arborea | Sorbaria | Rosaceae | |
| Scandix pecten-veneris | Scandix | Apiaceae |
|
| Syzygium levinei | Syzygium | Myrtaceae | |
| Corydalis pallida | Corydalis | Papaveraceae |
|
| Albizia procera | Albizia | Fabaceae |
|
| Chasmanthera dependens | Chasmanthera | Menispermaceae |
|
| Senecio miser | Senecio | Asteraceae | |
| Larix lyallii | Larix | Pinaceae |
|
| Crepis czerepanovii | Crepis | Asteraceae | |
| Campanula hypopolia | Campanula | Campanulaceae | |
| Hymenoxys grandiflora | Hymenoxys | Asteraceae | |
| Urginea riparia | Urginea | Hyacinthaceae | |
| Oroxylum indicum | Oroxylum | Bignoniaceae |
|
| Pteris pedata | Pteris | Pteridaceae | |
| Othonna tagetes | Othonna | Asteraceae | |
| Agave cocui | Agave | Asparagaceae | |
| Vincetoxicum atratum | Vincetoxicum | Apocynaceae |
|
| Diospyros glaucifolia | Diospyros | Ebenaceae | |
| Lampranthus sociorum | Lampranthus | Aizoaceae | |
| Perymenium mendezii | Perymenium | Asteraceae | |
| Hortonia floribunda | Hortonia | Monimiaceae | |
| Flemingia philippinensis | Flemingia | Fabaceae |
|
| Nauclea rhynchophylla | Nauclea | Rubiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Isatis tinctoria | Isatis | Brassicaceae |
|
| Bursera tonkinensis | Bursera | Burseraceae |
|
| Achlys triphylla | Achlys | Berberidaceae |
|
| Magnolia fraseri | Magnolia | Magnoliaceae | |
| Bulbophyllum protractum | Bulbophyllum | Orchidaceae | |
| Tarchonanthus camphoratus | Tarchonanthus | Asteraceae |
|
| Cypripedium calceolus | Cypripedium | Orchidaceae |
|
| Lactuca laciniata | Lactuca | Asteraceae |
|
| Gypsophila licentiana hand.-mazz. | Gypsophila | Caryophyllaceae | |
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Chiloscyphus rivularis | Chiloscyphus | Lophocoleaceae | |
| Rubus occidentalis | Rubus | Rosaceae |
|
| Ventilago madraspatana | Ventilago | Rhamnaceae |
|
| Artemisia porrecta | Artemisia | Asteraceae |
|
Ingredient ID: NPC289758
Formula: C6H12O6
Ingredient ID: NPC289758
| Common Name | n.a. |
| IUPAC Name | (3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| Canonical SMILES | OC[C@H]1OC(O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m1/s1 |
| Standard InCHIKey | WQZGKKKJIJFFOK-GASJEMHNSA-N |
| Ingredient External Links |
PubChem CID: 5793 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC289758] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Angelica gigas | Angelica | Apiaceae |
|
| Juncus effusus | Juncus | Juncaceae |
|
| Aloe vera | Aloe | Xanthorrhoeaceae |
|
| Changium smyrnioides | Changium | Apiaceae |
|
| Taraxacum platycarpum | Taraxacum | Asteraceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Aloe ferox | Aloe | Asphodelaceae |
|
| Hippophae rhamnoides | Hippophae | Elaeagnaceae |
|
| Angelica sinensis | Angelica | Apiaceae |
|
| Taraxacum borealisinense | Taraxacum | Asteraceae | |
| Morus bombycis | Morus | Moraceae |
|
| Malus pumila | Malus | Rosaceae |
|
| Citrus wilsonii | Citrus | Rutaceae |
|
| Lycium chinense | Lycium | Solanaceae |
|
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Rubus idaeus | Rubus | Rosaceae |
|
| Curculigo orchioides | Curculigo | Hypoxidaceae |
|
| Plantago major | Plantago | Plantaginaceae |
|
| Cnidium officinale | Cnidium | Apiaceae |
|
| Gastrodia elata | Gastrodia | Orchidaceae |
|
| Bistorta officinalis | Bistorta | Polygonaceae |
|
| Taraxacum coreanum | Taraxacum | Asteraceae | |
| Lycium barbarum | Lycium | Solanaceae |
|
| Levisticum officinale | Levisticum | Apiaceae |
|
| Saussurea costus | Saussurea | Asteraceae |
|
| Taraxacum officinale | Taraxacum | Asteraceae |
|
| Taraxacum mongolicum | Taraxacum | Asteraceae |
|
| Citrus maxima | Citrus | Rutaceae |
|
| Rubia akane | Rubia | Rubiaceae |
|
| Morus alba | Morus | Moraceae |
|
| Aloe spicata | Aloe | Asphodelaceae |
|
| Eucalyptus viminalis | Eucalyptus | Myrtaceae |
|
| Angelica acutiloba | Angelica | Apiaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Aloe africana | Aloe | Xanthorrhoeaceae |
|
| Pyrus communis | Pyrus | Rosaceae |
|
| Chlamydomonas reinhardtii | Chlamydomonas | Chlamydomonadaceae | |
| Morinda citrifolia | Morinda | Rubiaceae |
|
| Allium macrostemon | Allium | Amaryllidaceae |
|
| Scrophularia ningpoensis | Scrophularia | Scrophulariaceae |
|
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Pseudostellaria heterophylla | Pseudostellaria | Caryophyllaceae |
|
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Allium chinense | Allium | Amaryllidaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Triticum aestivum | Triticum | Poaceae |
|
Ingredient ID: NPC282956
Formula: C14H18O7
Ingredient ID: NPC282956
| Common Name | n.a. |
| IUPAC Name | 1-[4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanone |
| Canonical SMILES | OC[C@@H]1O[C@H](Oc2ccc(cc2)C(=O)C)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C14H18O7/c1-7(16)8-2-4-9(5-3-8)20-14-13(19)12(18)11(17)10(6-15)21-14/h2-5,10-15,17-19H,6H2,1H3/t10-,11-,12+,13-,14-/m0/s1 |
| Standard InCHIKey | GOZCEKPKECLKNO-HPCHECBXSA-N |
| Ingredient External Links |
PubChem CID: 10447381 |
| Plant-Ingredient Association Reference |
Database: TCMID [17273] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Salix babylonica | Salix | Salicaceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC255581
Formula: C24H26O10
Ingredient ID: NPC238678
Formula: C23H28O13
Ingredient ID: NPC238678
| Common Name | n.a. |
| IUPAC Name | [(1aS,1bR,5aS)-1a-(hydroxymethyl)-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5a,6,6a-tetrahydro-1bH-oxireno[5,6]cyclopenta[1,3-c]pyran-6-yl] 4-hydroxy-3-methoxybenzoate |
| Canonical SMILES | OCC1OC(OC2OC=C[C@H]3[C@@H]2[C@@]2(CO)OC2C3OC(=O)c2ccc(c(c2)OC)O)C(C(C1O)O)O |
| Standard InCHI | InChI=1S/C23H28O13/c1-31-12-6-9(2-3-11(12)26)20(30)34-18-10-4-5-32-21(14(10)23(8-25)19(18)36-23)35-22-17(29)16(28)15(27)13(7-24)33-22/h2-6,10,13-19,21-22,24-29H,7-8H2,1H3/t10-,13?,14-,15?,16?,17?,18?,19?,21?,22?,23+/m0/s1 |
| Standard InCHIKey | AKNILCMFRRDTEY-KAPZOGEHSA-N |
| Ingredient External Links |
PubChem CID: 74787566 |
| Plant-Ingredient Association Reference |
Database: TM-MC |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC234132
Formula: C15H22O10
Ingredient ID: NPC234132
| Common Name | n.a. |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-[[(1aR,1bR,2R,5aS,6R,6aR)-6-hydroxy-1a-(hydroxymethyl)-2,5a,6,6a-tetrahydro-1bH-oxireno[5,6]cyclopenta[1,3-c]pyran-2-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Canonical SMILES | OC[C@@H]1O[C@H](O[C@H]2OC=C[C@H]3[C@@H]2[C@]2(CO)O[C@@H]2[C@@H]3O)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C15H22O10/c16-3-6-9(19)10(20)11(21)14(23-6)24-13-7-5(1-2-22-13)8(18)12-15(7,4-17)25-12/h1-2,5-14,16-21H,3-4H2/t5-,6-,7-,8+,9-,10+,11-,12+,13+,14+,15-/m0/s1 |
| Standard InCHIKey | LHDWRKICQLTVDL-ROGNWKECSA-N |
| Ingredient External Links |
PubChem CID: 53297354 |
| Plant-Ingredient Association Reference |
Database: TCMID [3306] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Buddleja officinalis | Buddleja | Scrophulariaceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Plantago major | Plantago | Plantaginaceae |
|
| Paulownia tomentosa | Paulownia | Paulowniaceae |
|
| Adonis sutchuenensis | Adonis | Ranunculaceae |
|
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Catalpa ovata | Catalpa | Bignoniaceae |
|
Ingredient ID: NPC230488
Formula: C15H18O7
Ingredient ID: NPC230488
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O=C1O[C@H]2[C@H]([C@@H]1[C@]1(O)C[C@H]3[C@]4([C@@]1([C@@H]2OC4=O)C)O3)C(O)(C)C |
| Standard InCHI | InChI=1S/C15H18O7/c1-12(2,18)6-7-10(16)20-8(6)9-13(3)14(7,19)4-5-15(13,22-5)11(17)21-9/h5-9,18-19H,4H2,1-3H3/t5-,6-,7-,8-,9+,13+,14+,15-/m0/s1 |
| Standard InCHIKey | RYEFFICCPKWYML-IQXTXZJXSA-N |
| Ingredient External Links |
PubChem CID: 24884080 |
| Plant-Ingredient Association Reference |
Database: TCMID [17333] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Diphylleia grayi | Diphylleia | Berberidaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC229548
Formula: C25H30O13
Ingredient ID: NPC229548
| Common Name | n.a. |
| IUPAC Name | [(1aS,1bS,2S,5aR,6S,6aS)-1a-(hydroxymethyl)-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5a,6,6a-tetrahydro-1bH-oxireno[5,6]cyclopenta[1,3-c]pyran-6-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@@H]2OC=C[C@@H]3[C@H]2[C@@]2(CO)O[C@H]2[C@H]3OC(=O)/C=C/c2ccc(c(c2)OC)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C25H30O13/c1-33-14-8-11(2-4-13(14)28)3-5-16(29)36-21-12-6-7-34-23(17(12)25(10-27)22(21)38-25)37-24-20(32)19(31)18(30)15(9-26)35-24/h2-8,12,15,17-24,26-28,30-32H,9-10H2,1H3/b5-3+/t12-,15-,17-,18-,19+,20-,21+,22+,23+,24+,25-/m1/s1 |
| Standard InCHIKey | RMSKZOXJAHOIER-GGKKSNITSA-N |
| Ingredient External Links |
PubChem CID: 24121289 ZINC ID: ZINC000038139690 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC229548] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Panax quinquefolius | Panax | Araliaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC216546
Formula: C23H28O13
Ingredient ID: NPC216546
| Common Name | n.a. |
| IUPAC Name | [6-hydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5a,6,6a-tetrahydro-1bH-oxireno[5,6]cyclopenta[1,3-c]pyran-1a-yl]methyl 4-hydroxy-3-methoxybenzoate |
| Canonical SMILES | OCC1OC(OC2OC=CC3C2C2(COC(=O)c4ccc(c(c4)OC)O)OC2C3O)C(C(C1O)O)O |
| Standard InCHI | InChI=1S/C23H28O13/c1-31-12-6-9(2-3-11(12)25)20(30)33-8-23-14-10(15(26)19(23)36-23)4-5-32-21(14)35-22-18(29)17(28)16(27)13(7-24)34-22/h2-6,10,13-19,21-22,24-29H,7-8H2,1H3 |
| Standard InCHIKey | JANLDILJJLTVDB-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 182265 |
| Plant-Ingredient Association Reference |
Database: TM-MC |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC213935
Formula: C12H22O11
Ingredient ID: NPC213935
| Common Name | n.a. |
| IUPAC Name | (2R,4S,5S)-2-[(2S,4R,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Canonical SMILES | OC[C@H]1O[C@@](C([C@H]1O)O)(CO)O[C@H]1OC(CO)[C@H]([C@@H](C1O)O)O |
| Standard InCHI | InChI=1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4?,5-,6-,7+,8+,9?,10?,11-,12+/m1/s1 |
| Standard InCHIKey | CZMRCDWAGMRECN-MPZPMKCMSA-N |
| Ingredient External Links |
PubChem CID: 46782954 |
| Plant-Ingredient Association Reference |
Database: TM-MC |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dipsacus asper | Dipsacus | Caprifoliaceae | |
| Sinopodophyllum hexandrum | Sinopodophyllum | Berberidaceae |
|
| Ligusticum jeholense | Ligusticum | Apiaceae |
|
| Aloe vera | Aloe | Xanthorrhoeaceae |
|
| Stellaria dichotoma | Stellaria | Caryophyllaceae | |
| Cirsium setosum | Cirsium | Asteraceae |
|
| Dendrobium chrysanthum | Dendrobium | Orchidaceae |
|
| Pleione yunnanensis | Pleione | Orchidaceae | |
| Taraxacum platycarpum | Taraxacum | Asteraceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Aloe ferox | Aloe | Asphodelaceae |
|
| Bupleurum scorzonerifolium | Bupleurum | Apiaceae |
|
| Astragalus mongholicus | Astragalus | Fabaceae |
|
| Taraxacum borealisinense | Taraxacum | Asteraceae | |
| Broussonetia kazinoki | Broussonetia | Moraceae |
|
| Morus bombycis | Morus | Moraceae |
|
| Eucommia ulmoides | Eucommia | Eucommiaceae |
|
| Lonicera macranthoides | Lonicera | Caprifoliaceae |
|
| Pleione bulbocodioides | Pleione | Orchidaceae | |
| Cremastra appendiculata | Cremastra | Orchidaceae |
|
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Sophora flavescens | Sophora | Fabaceae |
|
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Dendrobium chrysotoxum | Dendrobium | Orchidaceae |
|
| Lonicera hypoglauca | Lonicera | Caprifoliaceae |
|
| Ligusticum tenuissimum | Ligusticum | Apiaceae |
|
| Dendrobium candidum | Dendrobium | Orchidaceae | |
| Chrysanthemum indicum | Chrysanthemum | Asteraceae |
|
| Gastrodia elata | Gastrodia | Orchidaceae |
|
| Paeonia suffruticosa | Paeonia | Paeoniaceae |
|
| Taraxacum coreanum | Taraxacum | Asteraceae | |
| Dendrobium fimbriatum | Dendrobium | Orchidaceae |
|
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Hansenia forbesii | Hansenia | Apiaceae | |
| Lonicera fulvotomentosa | Lonicera | Caprifoliaceae |
|
| Astragalus membranaceus | Astragalus | Fabaceae |
|
| Saussurea costus | Saussurea | Asteraceae |
|
| Taraxacum officinale | Taraxacum | Asteraceae |
|
| Taraxacum mongolicum | Taraxacum | Asteraceae |
|
| Gynochthodes officinalis | Gynochthodes | Rubiaceae | |
| Rubia akane | Rubia | Rubiaceae |
|
| Senna alexandrina | Senna | Fabaceae |
|
| Morus alba | Morus | Moraceae |
|
| Aloe spicata | Aloe | Asphodelaceae |
|
| Bupleurum chinense | Bupleurum | Apiaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Ostericum grosseserratum | Ostericum | Apiaceae |
|
| Aloe africana | Aloe | Xanthorrhoeaceae |
|
| Bupleurum falcatum | Bupleurum | Apiaceae |
|
| Dendrobium nobile | Dendrobium | Orchidaceae |
|
| Phlomoides rotata | Phlomoides | Lamiaceae | |
| Lonicera confusa | Lonicera | Caprifoliaceae |
|
| Tussilago farfara | Tussilago | Asteraceae |
|
| Broussonetia papyrifera | Broussonetia | Moraceae |
|
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Pseudostellaria heterophylla | Pseudostellaria | Caryophyllaceae |
|
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Dendrobium loddigesii | Dendrobium | Orchidaceae |
|
| Perilla frutescens | Perilla | Lamiaceae |
|
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
Ingredient ID: NPC20852
Formula: C22H34O6
Ingredient ID: NPC20820
Formula: C14H20O8
Ingredient ID: NPC20820
| Common Name | n.a. |
| IUPAC Name | (2R,3R,4R,5S,6R)-2-[2-(3,4-dihydroxyphenyl)ethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Canonical SMILES | OC[C@H]1O[C@@H](OCCc2ccc(c(c2)O)O)[C@@H]([C@@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C14H20O8/c15-6-10-11(18)12(19)13(20)14(22-10)21-4-3-7-1-2-8(16)9(17)5-7/h1-2,5,10-20H,3-4,6H2/t10-,11-,12-,13-,14-/m1/s1 |
| Standard InCHIKey | PQQITYGQJLPDFC-DHGKCCLASA-N |
| Ingredient External Links |
PubChem CID: 6915839 |
| Plant-Ingredient Association Reference |
Database: TCMID [6080] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Coptis chinensis | Coptis | Ranunculaceae |
|
Ingredient ID: NPC206114
Formula: C11H17N3O5
Ingredient ID: NPC206114
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | N=C1N[C@H](O)[C@@H]2[C@@]3(N1)[C@@H](O)[C@@H]([C@@H](C2)C)OC(=O)[C@H]3O |
| Standard InCHI | InChI=1S/C11H17N3O5/c1-3-2-4-8(17)13-10(12)14-11(4)6(15)5(3)19-9(18)7(11)16/h3-8,15-17H,2H2,1H3,(H3,12,13,14)/t3-,4-,5-,6+,7-,8-,11-/m1/s1 |
| Standard InCHIKey | XKPWNEDMIHIMHY-RIFQBPJOSA-N |
| Ingredient External Links |
PubChem CID: 101548057 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD213102] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Tadehagi triquetrum | Tadehagi | Fabaceae |
|
Ingredient ID: NPC205195
Formula: C29H36O16
Ingredient ID: NPC205195
| Common Name | Plantainoside D |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](COC(=O)/C=C/c3ccc(c(c3)O)O)O[C@H]([C@@H]2O)OCCc2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C29H36O16/c30-11-19-22(36)24(38)25(39)29(43-19)45-27-23(37)20(12-42-21(35)6-3-13-1-4-15(31)17(33)9-13)44-28(26(27)40)41-8-7-14-2-5-16(32)18(34)10-14/h1-6,9-10,19-20,22-34,36-40H,7-8,11-12H2/b6-3+/t19-,20-,22-,23-,24+,25-,26-,27+,28-,29+/m1/s1 |
| Standard InCHIKey | CBZYUWGJNYOKHT-ZKDZFUIGSA-N |
| Ingredient External Links |
PubChem CID: 9986606 ChEMBL ID: CHEMBL452413 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC205195] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Plantago lanceolata | Plantago | Plantaginaceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Penstemon linarioides | Penstemon | Plantaginaceae | |
| Plantago asiatica | Plantago | Plantaginaceae |
|
| Digitalis purpurea | Digitalis | Plantaginaceae |
|
| Hemiphragma heterophyllum | Hemiphragma | Plantaginaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
Ingredient ID: NPC200137
Formula: C5H10O5
Ingredient ID: NPC200137
| Common Name | n.a. |
| IUPAC Name | (2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
| Canonical SMILES | OC[C@H]([C@@H]([C@H](C=O)O)O)O |
| Standard InCHI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5+/m0/s1 |
| Standard InCHIKey | PYMYPHUHKUWMLA-VPENINKCSA-N |
| Ingredient External Links |
PubChem CID: 644160 |
| Plant-Ingredient Association Reference |
Database: TM-MC |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Bupleurum scorzonerifolium | Bupleurum | Apiaceae |
|
| Hedysarum multijugum maxim | Hedysarum | Fabaceae | |
| Rubia akane | Rubia | Rubiaceae |
|
| Bupleurum chinense | Bupleurum | Apiaceae |
|
| Hippophae fructus | Hippophae | Elaeagnaceae | |
| Bupleurum falcatum | Bupleurum | Apiaceae |
|
| Allium macrostemon | Allium | Amaryllidaceae |
|
| Allium chinense | Allium | Amaryllidaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC199043
Formula: C31H40O16
Ingredient ID: NPC199043
| Common Name | n.a. |
| IUPAC Name | [(2R,3R,4R,5R,6R)-5-hydroxy-6-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]-2-(hydroxymethyl)-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Canonical SMILES | OC[C@H]1O[C@@H](OCCc2ccc(c(c2)O)OC)[C@@H]([C@H]([C@@H]1OC(=O)/C=C/c1ccc(c(c1)OC)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O |
| Standard InCHI | InChI=1S/C31H40O16/c1-41-19-7-4-16(11-18(19)35)9-10-43-30-27(40)29(47-31-26(39)25(38)24(37)21(13-32)44-31)28(22(14-33)45-30)46-23(36)8-5-15-3-6-17(34)20(12-15)42-2/h3-8,11-12,21-22,24-35,37-40H,9-10,13-14H2,1-2H3/b8-5+/t21-,22-,24-,25+,26-,27-,28-,29-,30-,31+/m1/s1 |
| Standard InCHIKey | VKUXVDUAEAQCSK-MJLPRLLOSA-N |
| Ingredient External Links |
PubChem CID: 91884993 ZINC ID: ZINC000095911856 |
| Plant-Ingredient Association Reference |
Database: TM-MC |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC187058
Formula: C5H12O5
Ingredient ID: NPC187058
| Common Name | n.a. |
| IUPAC Name | (2S,4R)-pentane-1,2,3,4,5-pentol |
| Canonical SMILES | OC[C@H](C([C@H](CO)O)O)O |
| Standard InCHI | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5? |
| Standard InCHIKey | HEBKCHPVOIAQTA-NGQZWQHPSA-N |
| Ingredient External Links |
PubChem CID: 6912 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC187058] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Bupleurum scorzonerifolium | Bupleurum | Apiaceae |
|
| Anthriscus sylvestris | Anthriscus | Apiaceae |
|
| Capsella bursa-pastoris | Capsella | Brassicaceae |
|
| Bupleurum chinense | Bupleurum | Apiaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Bupleurum falcatum | Bupleurum | Apiaceae |
|
| Ruta graveolens | Ruta | Rutaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC181214
Formula: C11H17N3O5
Ingredient ID: NPC181214
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | [NH2+]=C1N[C@H](O)[C@@H]2[C@@]3(N1)[C@H](O)[C@@H]([C@@H](C2)C)OC(=O)[C@H]3O |
| Standard InCHI | InChI=1S/C11H17N3O5/c1-3-2-4-8(17)13-10(12)14-11(4)6(15)5(3)19-9(18)7(11)16/h3-8,15-17H,2H2,1H3,(H3,12,13,14)/p+1/t3-,4-,5-,6-,7-,8-,11-/m1/s1 |
| Standard InCHIKey | XKPWNEDMIHIMHY-YXACIJIASA-O |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD78365] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Tadehagi triquetrum | Tadehagi | Fabaceae |
|
Ingredient ID: NPC175333
Formula: C24H28O11
Ingredient ID: NPC175333
| Common Name | n.a. |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[[(1aS,1bS,2S,5aR,6S,6aS)-6-hydroxy-1a-(hydroxymethyl)-2,5a,6,6a-tetrahydro-1bH-oxireno[5,6]cyclopenta[1,3-c]pyran-2-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-phenylprop-2-enoate |
| Canonical SMILES | OC[C@@]12O[C@H]2[C@H]([C@H]2[C@@H]1[C@@H](OC=C2)O[C@@H]1O[C@H](COC(=O)/C=C/c2ccccc2)[C@H]([C@@H]([C@H]1O)O)O)O |
| Standard InCHI | InChI=1S/C24H28O11/c25-11-24-16-13(17(27)21(24)35-24)8-9-31-22(16)34-23-20(30)19(29)18(28)14(33-23)10-32-15(26)7-6-12-4-2-1-3-5-12/h1-9,13-14,16-23,25,27-30H,10-11H2/b7-6+/t13-,14-,16-,17+,18-,19+,20-,21+,22+,23+,24-/m1/s1 |
| Standard InCHIKey | XZGPUOQGERGURE-LUVHZPKESA-N |
| Ingredient External Links |
PubChem CID: 6440892 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC175333] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC16728
Formula: C12H22O11
Ingredient ID: NPC16728
| Common Name | n.a. |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Canonical SMILES | OCC1OC(C(C1O)O)(CO)O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5?,6-,7?,8+,9-,10?,11-,12?/m1/s1 |
| Standard InCHIKey | CZMRCDWAGMRECN-GCGUNJLOSA-N |
| Ingredient External Links |
PubChem CID: 91692850 |
| Plant-Ingredient Association Reference |
Database: TM-MC |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dipsacus asper | Dipsacus | Caprifoliaceae | |
| Sinopodophyllum hexandrum | Sinopodophyllum | Berberidaceae |
|
| Ligusticum jeholense | Ligusticum | Apiaceae |
|
| Aloe vera | Aloe | Xanthorrhoeaceae |
|
| Stellaria dichotoma | Stellaria | Caryophyllaceae | |
| Cirsium setosum | Cirsium | Asteraceae |
|
| Dendrobium chrysanthum | Dendrobium | Orchidaceae |
|
| Pleione yunnanensis | Pleione | Orchidaceae | |
| Taraxacum platycarpum | Taraxacum | Asteraceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Aloe ferox | Aloe | Asphodelaceae |
|
| Bupleurum scorzonerifolium | Bupleurum | Apiaceae |
|
| Astragalus mongholicus | Astragalus | Fabaceae |
|
| Taraxacum borealisinense | Taraxacum | Asteraceae | |
| Broussonetia kazinoki | Broussonetia | Moraceae |
|
| Morus bombycis | Morus | Moraceae |
|
| Eucommia ulmoides | Eucommia | Eucommiaceae |
|
| Lonicera macranthoides | Lonicera | Caprifoliaceae |
|
| Pleione bulbocodioides | Pleione | Orchidaceae | |
| Cremastra appendiculata | Cremastra | Orchidaceae |
|
| Xanthium sibiricum | Xanthium | Asteraceae |
|
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Sophora flavescens | Sophora | Fabaceae |
|
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Dendrobium chrysotoxum | Dendrobium | Orchidaceae |
|
| Lonicera hypoglauca | Lonicera | Caprifoliaceae |
|
| Ligusticum tenuissimum | Ligusticum | Apiaceae |
|
| Dendrobium candidum | Dendrobium | Orchidaceae | |
| Chrysanthemum indicum | Chrysanthemum | Asteraceae |
|
| Gastrodia elata | Gastrodia | Orchidaceae |
|
| Paeonia suffruticosa | Paeonia | Paeoniaceae |
|
| Taraxacum coreanum | Taraxacum | Asteraceae | |
| Dendrobium fimbriatum | Dendrobium | Orchidaceae |
|
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Hansenia forbesii | Hansenia | Apiaceae | |
| Lonicera fulvotomentosa | Lonicera | Caprifoliaceae |
|
| Astragalus membranaceus | Astragalus | Fabaceae |
|
| Xanthium strumarium | Xanthium | Asteraceae |
|
| Saussurea costus | Saussurea | Asteraceae |
|
| Taraxacum officinale | Taraxacum | Asteraceae |
|
| Taraxacum mongolicum | Taraxacum | Asteraceae |
|
| Gynochthodes officinalis | Gynochthodes | Rubiaceae | |
| Rubia akane | Rubia | Rubiaceae |
|
| Senna alexandrina | Senna | Fabaceae |
|
| Morus alba | Morus | Moraceae |
|
| Aloe spicata | Aloe | Asphodelaceae |
|
| Bupleurum chinense | Bupleurum | Apiaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Ostericum grosseserratum | Ostericum | Apiaceae |
|
| Aloe africana | Aloe | Xanthorrhoeaceae |
|
| Bupleurum falcatum | Bupleurum | Apiaceae |
|
| Dendrobium nobile | Dendrobium | Orchidaceae |
|
| Phlomoides rotata | Phlomoides | Lamiaceae | |
| Lonicera confusa | Lonicera | Caprifoliaceae |
|
| Tussilago farfara | Tussilago | Asteraceae |
|
| Broussonetia papyrifera | Broussonetia | Moraceae |
|
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Pseudostellaria heterophylla | Pseudostellaria | Caryophyllaceae |
|
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Dendrobium loddigesii | Dendrobium | Orchidaceae |
|
| Perilla frutescens | Perilla | Lamiaceae |
|
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
Ingredient ID: NPC162819
Formula: C24H28O11
Ingredient ID: NPC162819
| Common Name | n.a. |
| IUPAC Name | [(1aS,1bS,2S,5aR,6S,6aS)-1a-(hydroxymethyl)-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5a,6,6a-tetrahydro-1bH-oxireno[5,6]cyclopenta[1,3-c]pyran-6-yl] (E)-3-phenylprop-2-enoate |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@@H]2OC=C[C@@H]3[C@H]2[C@@]2(CO)O[C@H]2[C@H]3OC(=O)/C=C/c2ccccc2)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C24H28O11/c25-10-14-17(28)18(29)19(30)23(32-14)34-22-16-13(8-9-31-22)20(21-24(16,11-26)35-21)33-15(27)7-6-12-4-2-1-3-5-12/h1-9,13-14,16-23,25-26,28-30H,10-11H2/b7-6+/t13-,14-,16-,17-,18+,19-,20+,21+,22+,23+,24-/m1/s1 |
| Standard InCHIKey | BSYHSWKTXMTFNF-NTLZGZQOSA-N |
| Ingredient External Links |
PubChem CID: 71307080 ZINC ID: ZINC000096023873 |
| Plant-Ingredient Association Reference |
Database: TM-MC |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC158290
Formula: C23H28O13
Ingredient ID: NPC158290
| Common Name | n.a. |
| IUPAC Name | [1a-(hydroxymethyl)-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5a,6,6a-tetrahydro-1bH-oxireno[5,6]cyclopenta[1,3-c]pyran-6-yl] 4-hydroxy-3-methoxybenzoate |
| Canonical SMILES | OC[C@H]1O[C@@H](OC2OC=CC3C2C2(CO)OC2C3OC(=O)c2ccc(c(c2)OC)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C23H28O13/c1-31-12-6-9(2-3-11(12)26)20(30)34-18-10-4-5-32-21(14(10)23(8-25)19(18)36-23)35-22-17(29)16(28)15(27)13(7-24)33-22/h2-6,10,13-19,21-22,24-29H,7-8H2,1H3/t10?,13-,14?,15-,16+,17-,18?,19?,21?,22+,23?/m1/s1 |
| Standard InCHIKey | AKNILCMFRRDTEY-MRFBWRKESA-N |
| Ingredient External Links |
PubChem CID: 9849283 |
| Plant-Ingredient Association Reference |
Database: TM-MC |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC144326
Formula: C11H15N3O7
Ingredient ID: NPC144326
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@@]1(O)[C@H]2O[C@]3(O[C@@H]1[C@H]1[C@@]4([C@@H]2O)[C@@H]3O[C@@H]1NC(=N)N4)O |
| Standard InCHI | InChI=1S/C11H15N3O7/c12-8-13-6-2-4-9(17,1-15)5-3(16)10(2,14-8)7(19-6)11(18,20-4)21-5/h2-7,15-18H,1H2,(H3,12,13,14)/t2-,3-,4-,5+,6+,7+,9+,10-,11+/m1/s1 |
| Standard InCHIKey | STNXQECXKDMLJK-PZKHIREQSA-N |
| Ingredient External Links |
PubChem CID: 11243537 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD54173] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Tadehagi triquetrum | Tadehagi | Fabaceae |
|
Ingredient ID: NPC139857
Formula: C11H17N3O6
Ingredient ID: NPC139857
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | N=C1N[C@H](O)[C@@H]2[C@@]3(N1)[C@H](O)[C@H]1[C@@H]([C@@H]2O[C@@]([C@H]3O)(O1)O)C |
| Standard InCHI | InChI=1S/C11H17N3O6/c1-2-4-3-7(16)13-9(12)14-10(3)6(15)5(2)20-11(18,19-4)8(10)17/h2-8,15-18H,1H3,(H3,12,13,14)/t2-,3-,4+,5-,6-,7-,8+,10-,11+/m1/s1 |
| Standard InCHIKey | RMAHGNDIHNOZMD-LJQSUJOQSA-N |
| Ingredient External Links |
PubChem CID: 90669996 ChEMBL ID: CHEMBL3233266 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD210973] Database: NPASS [NPC139857] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Tadehagi triquetrum | Tadehagi | Fabaceae |
|
Ingredient ID: NPC138041
Formula: C11H17N3O5
Ingredient ID: NPC138041
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | [NH2+]=C1N[C@@H](O)[C@@H]2[C@@]3(N1)[C@H](O)[C@@H]([C@@H](C2)C)OC(=O)[C@H]3O |
| Standard InCHI | InChI=1S/C11H17N3O5/c1-3-2-4-8(17)13-10(12)14-11(4)6(15)5(3)19-9(18)7(11)16/h3-8,15-17H,2H2,1H3,(H3,12,13,14)/p+1/t3-,4-,5-,6-,7-,8+,11-/m1/s1 |
| Standard InCHIKey | XKPWNEDMIHIMHY-UTDLPTRGSA-O |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD41036] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Tadehagi triquetrum | Tadehagi | Fabaceae |
|
Ingredient ID: NPC136280
Formula: C11H17N3O7
Ingredient ID: NPC136280
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@]1(O)C[C@@H]2[C@@H](O)NC(=N)N[C@]32[C@@H]([C@@H]1OC(=O)[C@H]3O)O |
| Standard InCHI | InChI=1S/C11H17N3O7/c12-9-13-7(18)3-1-10(20,2-15)6-4(16)11(3,14-9)5(17)8(19)21-6/h3-7,15-18,20H,1-2H2,(H3,12,13,14)/t3-,4-,5-,6+,7-,10-,11-/m1/s1 |
| Standard InCHIKey | MUWJNPOMZLQMND-YPAKJVKUSA-N |
| Ingredient External Links |
PubChem CID: 100969537 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD176989] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Tadehagi triquetrum | Tadehagi | Fabaceae |
|
Ingredient ID: NPC130730
Formula: C23H28O13
Ingredient ID: NPC130730
| Common Name | n.a. |
| IUPAC Name | [(1aS,1bS,2S,5aR,6S,6aS)-1a-(hydroxymethyl)-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5a,6,6a-tetrahydro-1bH-oxireno[5,6]cyclopenta[1,3-c]pyran-6-yl] 4-hydroxy-3-methoxybenzoate |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@@H]2OC=C[C@@H]3[C@H]2[C@@]2(CO)O[C@H]2[C@H]3OC(=O)c2ccc(c(c2)OC)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C23H28O13/c1-31-12-6-9(2-3-11(12)26)20(30)34-18-10-4-5-32-21(14(10)23(8-25)19(18)36-23)35-22-17(29)16(28)15(27)13(7-24)33-22/h2-6,10,13-19,21-22,24-29H,7-8H2,1H3/t10-,13-,14-,15-,16+,17-,18+,19+,21+,22+,23-/m1/s1 |
| Standard InCHIKey | AKNILCMFRRDTEY-NUGKWEEESA-N |
| Ingredient External Links |
PubChem CID: 11944602 ZINC ID: ZINC000008382348 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC130730] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Juncus effusus | Juncus | Juncaceae |
|
| Myroxylon peruiferum | Myroxylon | Fabaceae | |
| Kandelia candel | Kandelia | Rhizophoraceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Garcinia subelliptica | Garcinia | Clusiaceae | |
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC130683
Formula: C12H22O11
Ingredient ID: NPC130683
| Common Name | n.a. |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Canonical SMILES | OC[C@H]1O[C@@]([C@H]([C@@H]1O)O)(CO)O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
| Standard InCHIKey | CZMRCDWAGMRECN-UGDNZRGBSA-N |
| Ingredient External Links |
PubChem CID: 5988 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC130683] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Euphorbia antiquorum | Euphorbia | Euphorbiaceae |
|
| Cyathula tomentosa | Cyathula | Amaranthaceae |
|
| Passiflora incarnata | Passiflora | Passifloraceae |
|
| Centaurea solstitialis | Centaurea | Asteraceae |
|
| Dipsacus asper | Dipsacus | Caprifoliaceae | |
| Xanthorrhoea resinosa | Xanthorrhoea | Asphodelaceae |
|
| Sinopodophyllum hexandrum | Sinopodophyllum | Berberidaceae |
|
| Maackia tashiroi | Maackia | Fabaceae | |
| Ocimum pilosum | Ocimum | Lamiaceae |
|
| Scapania aequiloba | Scapania | Scapaniaceae | |
| Exochorda giraldii | Exochorda | Rosaceae | |
| Ligusticum jeholense | Ligusticum | Apiaceae |
|
| Alstonia muelleriana | Alstonia | Apocynaceae | |
| Aloe vera | Aloe | Xanthorrhoeaceae |
|
| Artemisia argentea | Artemisia | Asteraceae | |
| Stellaria dichotoma | Stellaria | Caryophyllaceae | |
| Dacrydium cupressinum | Dacrydium | Podocarpaceae |
|
| Cirsium setosum | Cirsium | Asteraceae |
|
| Amomum villosum | Amomum | Zingiberaceae |
|
| Dendrobium chrysanthum | Dendrobium | Orchidaceae |
|
| Artemisia incanescens | Artemisia | Asteraceae | |
| Rhododendron ungerni | Rhododendron | Ericaceae | |
| Lagochilus leiacanthus | Lagochilus | Lamiaceae | |
| Perriera orientalis | Perriera | Simaroubaceae | |
| Brodiaea californica | Brodiaea | Asparagaceae | |
| Strychnos tricalysioides | Strychnos | Loganiaceae | |
| Trigonella grandiflora | Trigonella | Fabaceae | |
| Piptostigma fugax | Piptostigma | Annonaceae | |
| Pleione yunnanensis | Pleione | Orchidaceae | |
| Allium stipitatum | Allium | Amaryllidaceae |
|
| Nicotiana undulata | Nicotiana | Solanaceae | |
| Chara ceratophylla | Chara | Characeae | |
| Spergula japonica | Spergula | Caryophyllaceae | |
| Asphodeline damascena | Asphodeline | Asphodelaceae | |
| Ichthyothere latifolia | Ichthyothere | Asteraceae | |
| Taraxacum platycarpum | Taraxacum | Asteraceae |
|
| Cosmos diversifolius | Cosmos | Asteraceae | |
| Scrophularia umbrosa | Scrophularia | Scrophulariaceae |
|
| Populus yunnanensis | Populus | Salicaceae | |
| Trichodesma incanum | Trichodesma | Boraginaceae | |
| Solanum sublobatum | Solanum | Solanaceae | |
| Rhododendron mucronatum | Rhododendron | Ericaceae |
|
| Scabiosa comosa | Scabiosa | Caprifoliaceae |
|
| Artemisia cina | Artemisia | Asteraceae |
|
| Onobrychis viciifolia | Onobrychis | Fabaceae |
|
| Swertia pseudochinensis | Swertia | Gentianaceae |
|
| Plectranthus lanuginosus | Plectranthus | Lamiaceae |
|
| Kopsia longiflora | Kopsia | Apocynaceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Aloe ferox | Aloe | Asphodelaceae |
|
| Bupleurum scorzonerifolium | Bupleurum | Apiaceae |
|
| Lepidophorum repandum | Lepidophorum | Asteraceae | |
| Alstonia pittieri | Alstonia | Apocynaceae | |
| Angiopteris evecta | Angiopteris | Marattiaceae |
|
| Astragalus mongholicus | Astragalus | Fabaceae |
|
| Rhododendron campylocarpum | Rhododendron | Ericaceae | |
| Taraxacum borealisinense | Taraxacum | Asteraceae | |
| Inga velutina | Inga | Fabaceae |
|
| Broussonetia kazinoki | Broussonetia | Moraceae |
|
| Stephania aculeata | Stephania | Menispermaceae | |
| Morus bombycis | Morus | Moraceae |
|
| Curcuma caesia | Curcuma | Zingiberaceae |
|
| Scopolia parviflora | Scopolia | Solanaceae |
|
| Codonopsis pilosula | Codonopsis | Campanulaceae |
|
| Eucommia ulmoides | Eucommia | Eucommiaceae |
|
| Lonicera macranthoides | Lonicera | Caprifoliaceae |
|
| Pleione bulbocodioides | Pleione | Orchidaceae | |
| Cremastra appendiculata | Cremastra | Orchidaceae |
|
| Toddalia aculeata | Toddalia | Rutaceae |
|
| Ligustrum lucidum | Ligustrum | Oleaceae |
|
| Tripolium pannonicum | Tripolium | Asteraceae | |
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Sophora flavescens | Sophora | Fabaceae |
|
| Tadehagi triquetrum | Tadehagi | Fabaceae |
|
| Coreopsis nodosa | Coreopsis | Asteraceae | |
| Turnera diffusa | Turnera | Passifloraceae |
|
| Croton ruizianus | Croton | Euphorbiaceae | |
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Cathormion altissimum | Cathormion | Fabaceae | |
| Urochloa decumbens | Urochloa | Poaceae | |
| Dendrobium chrysotoxum | Dendrobium | Orchidaceae |
|
| Uvaria calamistrata | Uvaria | Annonaceae |
|
| Lonicera hypoglauca | Lonicera | Caprifoliaceae |
|
| Ligusticum tenuissimum | Ligusticum | Apiaceae |
|
| Dendrobium candidum | Dendrobium | Orchidaceae | |
| Himantoglossum hircinum | Himantoglossum | Orchidaceae | |
| Chrysanthemum indicum | Chrysanthemum | Asteraceae |
|
| Gastrodia elata | Gastrodia | Orchidaceae |
|
| Paeonia suffruticosa | Paeonia | Paeoniaceae |
|
| Haematococcus lacustris | Haematococcus | Haematococcaceae | |
| Pseudofumaria lutea | Pseudofumaria | Papaveraceae | |
| Actinidia chinensis planch | Actinidia | Actinidiaceae | |
| Taraxacum coreanum | Taraxacum | Asteraceae | |
| Dendrobium fimbriatum | Dendrobium | Orchidaceae |
|
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Oxytropis muricata | Oxytropis | Fabaceae | |
| Adesmia boronioides | Adesmia | Fabaceae |
|
| Paeonia veitchii | Paeonia | Paeoniaceae |
|
| Hansenia forbesii | Hansenia | Apiaceae | |
| Lycopodium japonicum | Lycopodium | Lycopodiaceae |
|
| Erythrophleum couminga | Erythrophleum | Fabaceae |
|
| Lonicera fulvotomentosa | Lonicera | Caprifoliaceae |
|
| Astragalus membranaceus | Astragalus | Fabaceae |
|
| Agave xylonacantha | Agave | Asparagaceae | |
| Cyperus papyrus | Cyperus | Cyperaceae |
|
| Sabal blackburniana | Sabal | Arecaceae | |
| Solanum pseudopersicum | Solanum | Solanaceae | |
| Saussurea costus | Saussurea | Asteraceae |
|
| Taraxacum officinale | Taraxacum | Asteraceae |
|
| Acacia lasiopetala | Acacia | Fabaceae | |
| Lachnophyllum gossypinum | Lachnophyllum | Asteraceae | |
| Taraxacum mongolicum | Taraxacum | Asteraceae |
|
| Euphrasia rubra | Euphrasia | Orobanchaceae | |
| Daiswa dunniana | Daiswa | Melanthiaceae | |
| Gynochthodes officinalis | Gynochthodes | Rubiaceae | |
| Pteris cretica var. nervosa | Pteris | Pteridaceae |
|
| Calophyllum inophyllum | Calophyllum | Calophyllaceae |
|
| Rubia akane | Rubia | Rubiaceae |
|
| Notholaena lemmonii | Notholaena | Pteridaceae | |
| Senna alexandrina | Senna | Fabaceae |
|
| Morus alba | Morus | Moraceae |
|
| Aloe spicata | Aloe | Asphodelaceae |
|
| Afrocarpus gracilior | Afrocarpus | Podocarpaceae | |
| Rhodanthe maryonii | Rhodanthe | Asteraceae | |
| Bupleurum chinense | Bupleurum | Apiaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Ostericum grosseserratum | Ostericum | Apiaceae |
|
| Hippophae fructus | Hippophae | Elaeagnaceae | |
| Aloe africana | Aloe | Xanthorrhoeaceae |
|
| Erythrina pallida | Erythrina | Fabaceae | |
| Dimorphotheca aurantiaca | Dimorphotheca | Asteraceae | |
| Arachniodes exilis | Arachniodes | Dryopteridaceae |
|
| Bupleurum falcatum | Bupleurum | Apiaceae |
|
| Anthemis cretica | Anthemis | Asteraceae |
|
| Plantago asiatica | Plantago | Plantaginaceae |
|
| Dendrobium nobile | Dendrobium | Orchidaceae |
|
| Chlamydomonas reinhardtii | Chlamydomonas | Chlamydomonadaceae | |
| Phlomoides rotata | Phlomoides | Lamiaceae | |
| Lonicera confusa | Lonicera | Caprifoliaceae |
|
| Myristica malabarica | Myristica | Myristicaceae |
|
| Glycine tomentella | Glycine | Fabaceae |
|
| Tussilago farfara | Tussilago | Asteraceae |
|
| Salvia oxyodon | Salvia | Lamiaceae | |
| Eucalyptus australiana | Eucalyptus | Myrtaceae | |
| Othonna dentata | Othonna | Asteraceae | |
| Broussonetia papyrifera | Broussonetia | Moraceae |
|
| Salvia miltiorrhiza | Salvia | Lamiaceae |
|
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Spartium junceum | Spartium | Fabaceae |
|
| Acacia mearnsii | Acacia | Fabaceae |
|
| Neorautanenia ficifolia | Neorautanenia | Fabaceae | |
| Pseudostellaria heterophylla | Pseudostellaria | Caryophyllaceae |
|
| Antiphiona pinnatisecta | Antiphiona | Asteraceae | |
| Echium italicum | Echium | Boraginaceae |
|
| Panax schinseng | Panax | Araliaceae | |
| Raphanus sativus | Raphanus | Brassicaceae |
|
| Phelline lucida | Phelline | Phellinaceae | |
| Sophora tonkinensis | Sophora | Fabaceae | |
| Lactuca serriola | Lactuca | Asteraceae |
|
| Agathis macrophylla | Agathis | Araucariaceae |
|
| Senecio paludaffinis | Senecio | Asteraceae | |
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Artocarpus altilis | Artocarpus | Moraceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Eucalyptus kitsoniana | Eucalyptus | Myrtaceae | |
| Strychnos erichsonii | Strychnos | Loganiaceae |
|
| Dendrobium loddigesii | Dendrobium | Orchidaceae |
|
| Perilla frutescens | Perilla | Lamiaceae |
|
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
| Cryptocarya oblata | Cryptocarya | Lauraceae | |
| Fagus grandifolia | Fagus | Fagaceae |
|
| Pseudocyclosorus subochthodes | Pseudocyclosorus | Thelypteridaceae | |
| Epimedium wushanense | Epimedium | Berberidaceae |
|
| Solenopsis punctaticeps | Solenopsis | Campanulaceae | |
| Mitragyna inermis | Mitragyna | Rubiaceae |
|
| Rosa transmorrisonensis | Rosa | Rosaceae | |
| Enicosanthum cupulare | Enicosanthum | Annonaceae | |
| Plagiomnium cuspidatum | Plagiomnium | Mniaceae |
Ingredient ID: NPC130085
Formula: C11H17N3O7
Ingredient ID: NPC130085
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@]1(O)C[C@@H]2[C@@H](O)NC(=N)N[C@]32[C@H]([C@@H]1OC(=O)[C@H]3O)O |
| Standard InCHI | InChI=1S/C11H17N3O7/c12-9-13-7(18)3-1-10(20,2-15)6-4(16)11(3,14-9)5(17)8(19)21-6/h3-7,15-18,20H,1-2H2,(H3,12,13,14)/t3-,4+,5-,6+,7-,10-,11-/m1/s1 |
| Standard InCHIKey | MUWJNPOMZLQMND-WFBDQOJQSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD217272] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Tadehagi triquetrum | Tadehagi | Fabaceae |
|
Ingredient ID: NPC12853
Formula: C23H28O9
Ingredient ID: NPC120454
Formula: C9H10O
Ingredient ID: NPC120454
| Common Name | n.a. |
| IUPAC Name | (E)-1,1-dideuterio-3-phenylprop-2-en-1-ol |
| Canonical SMILES | C([2H])(/C=C/c1ccccc1)(O)[2H] |
| Standard InCHI | InChI=1S/C9H10O/c10-8-4-7-9-5-2-1-3-6-9/h1-7,10H,8H2/b7-4+/i8D2 |
| Standard InCHIKey | OOCCDEMITAIZTP-LJSJBYNUSA-N |
| Ingredient External Links |
PubChem CID: 10534709 |
| Plant-Ingredient Association Reference |
Database: TCMID [30783] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Liquidambar orientalis | Liquidambar | Altingiaceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Lycium chinense | Lycium | Solanaceae |
|
| Plantago major | Plantago | Plantaginaceae |
|
| Ephedra equisetina | Ephedra | Ephedraceae |
|
| Foeniculum vulgare | Foeniculum | Apiaceae |
|
| Myroxylon pereirae | Myroxylon | Fabaceae | |
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Cinnamomum aromaticum | Cinnamomum | Lauraceae |
|
Ingredient ID: NPC11848
Formula: C22H26O12
Ingredient ID: NPC11848
| Common Name | n.a. |
| IUPAC Name | [(1aS,1bS,5aR,6S,6aS)-1a-(hydroxymethyl)-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5a,6,6a-tetrahydro-1bH-oxireno[5,6]cyclopenta[1,3-c]pyran-6-yl] 4-hydroxybenzoate |
| Canonical SMILES | OC[C@H]1O[C@@H](OC2OC=C[C@@H]3[C@H]2[C@@]2(CO)O[C@H]2[C@H]3OC(=O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C22H26O12/c23-7-12-14(26)15(27)16(28)21(31-12)33-20-13-11(5-6-30-20)17(18-22(13,8-24)34-18)32-19(29)9-1-3-10(25)4-2-9/h1-6,11-18,20-21,23-28H,7-8H2/t11-,12-,13-,14-,15+,16-,17+,18+,20?,21+,22-/m1/s1 |
| Standard InCHIKey | UXSACQOOWZMGSE-HWUWICDZSA-N |
| Ingredient External Links |
PubChem CID: 53297355 |
| Plant-Ingredient Association Reference |
Database: TCMID [3307] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Buddleja officinalis | Buddleja | Scrophulariaceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Paulownia tomentosa | Paulownia | Paulowniaceae |
|
| Veronica persica | Veronica | Plantaginaceae |
|
| Adonis sutchuenensis | Adonis | Ranunculaceae |
|
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Catalpa bignonioides | Catalpa | Bignoniaceae |
|
| Catalpa ovata | Catalpa | Bignoniaceae |
|
Ingredient ID: NPC111888
Formula: C8H8O4
Ingredient ID: NPC111888
| Common Name | Vanillic Acid |
| IUPAC Name | 4-hydroxy-3-methoxybenzoic acid |
| Canonical SMILES | COc1cc(ccc1O)C(=O)O |
| Standard InCHI | InChI=1S/C8H8O4/c1-12-7-4-5(8(10)11)2-3-6(7)9/h2-4,9H,1H3,(H,10,11) |
| Standard InCHIKey | WKOLLVMJNQIZCI-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 8468 ChEMBL ID: CHEMBL120568 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC111888] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Euphorbia antiquorum | Euphorbia | Euphorbiaceae |
|
| Diospyros canaliculata | Diospyros | Ebenaceae |
|
| Citrus unshiu | Citrus | Rutaceae |
|
| Teucrium pernyi | Teucrium | Lamiaceae | |
| Chrozophora prostrata | Chrozophora | Euphorbiaceae |
|
| Cryptocarya infectoria | Cryptocarya | Lauraceae | |
| Liquidambar orientalis | Liquidambar | Altingiaceae |
|
| Cyathula tomentosa | Cyathula | Amaranthaceae |
|
| Lindera obtusiloba | Lindera | Lauraceae |
|
| Asteriscus aquaticus | Asteriscus | Asteraceae | |
| Vachellia karroo | Vachellia | Fabaceae |
|
| Clematis hexapetala | Clematis | Ranunculaceae |
|
| Cinnamomum subavenium | Cinnamomum | Lauraceae |
|
| Machilus odoratissima | Machilus | Lauraceae |
|
| Epimedium sagittatum | Epimedium | Berberidaceae |
|
| Euclea crispa | Euclea | Ebenaceae |
|
| Sargentodoxa cuneata | Sargentodoxa | Lardizabalaceae |
|
| Dioscorea japonica | Dioscorea | Dioscoreaceae |
|
| Callicarpa japonica | Callicarpa | Lamiaceae |
|
| Geigeria schinzii | Geigeria | Asteraceae | |
| Baccharis grandicapitulata | Baccharis | Asteraceae | |
| Avrainvillea longicaulis | Avrainvillea | Udoteaceae | |
| Himalaiella deltoidea | Himalaiella | Asteraceae | |
| Sideritis perfoliata | Sideritis | Lamiaceae |
|
| Renealmia alpinia | Renealmia | Zingiberaceae |
|
| Impatiens balsamina | Impatiens | Balsaminaceae |
|
| Scapania aequiloba | Scapania | Scapaniaceae | |
| Exochorda giraldii | Exochorda | Rosaceae | |
| Pseudowintera colorata | Pseudowintera | Winteraceae | |
| Styrax benzoin | Styrax | Styracaceae |
|
| Hymenidium lindleyanum | Hymenidium | Apiaceae | |
| Ranunculus ternatus | Ranunculus | Ranunculaceae | |
| Tiliacora racemosa | Tiliacora | Menispermaceae |
|
| Angelica gigas | Angelica | Apiaceae |
|
| Arachniodes mutica | Arachniodes | Dryopteridaceae | |
| Phebalium dentatum | Phebalium | Rutaceae | |
| Aloe vera | Aloe | Xanthorrhoeaceae |
|
| Artemisia argentea | Artemisia | Asteraceae | |
| Stellaria dichotoma | Stellaria | Caryophyllaceae | |
| Morella pensylvanica | Morella | Myricaceae | |
| Aeonium cuneatum | Aeonium | Crassulaceae | |
| Ecballium elaterium | Ecballium | Cucurbitaceae |
|
| Capparis ovata | Capparis | Capparaceae |
|
| Croton montevidensis | Croton | Euphorbiaceae | |
| Amomum villosum | Amomum | Zingiberaceae |
|
| Eleutherococcus senticosus | Eleutherococcus | Araliaceae |
|
| Dendrobium chrysanthum | Dendrobium | Orchidaceae |
|
| Delphinium giraldii | Delphinium | Ranunculaceae |
|
| Papaver radicatum | Papaver | Papaveraceae | |
| Hemerocallis radix | Hemerocallis | Asphodelaceae | |
| Jasione montana | Jasione | Campanulaceae | |
| Datisca glomerata | Datisca | Datiscaceae | |
| Stellaria media | Stellaria | Caryophyllaceae |
|
| Aphelandra chamissoniana | Aphelandra | Acanthaceae | |
| Quercus imbricaria | Quercus | Fagaceae |
|
| Brodiaea californica | Brodiaea | Asparagaceae | |
| Psiadia anchusifolia | Psiadia | Asteraceae | |
| Dioscorea olfersiana | Dioscorea | Dioscoreaceae |
|
| Pinus glauca | Pinus | Pinaceae | |
| Cassine papillosa | Cassine | Celastraceae |
|
| Acronychia laurifolia | Acronychia | Rutaceae |
|
| Lithospermum canescens | Lithospermum | Boraginaceae |
|
| Ajuga australis | Ajuga | Lamiaceae |
|
| Styrax tonkinensis | Styrax | Styracaceae |
|
| Curcuma aeruginosa | Curcuma | Zingiberaceae |
|
| Pleione yunnanensis | Pleione | Orchidaceae | |
| Ophryosporus charua | Ophryosporus | Asteraceae | |
| Thymus quinquecostatus | Thymus | Lamiaceae |
|
| Blainvillea latifolia | Blainvillea | Asteraceae | |
| Allium stipitatum | Allium | Amaryllidaceae |
|
| Rhodomyrtus tomentosa | Rhodomyrtus | Myrtaceae |
|
| Balanophora harlandii | Balanophora | Balanophoraceae | |
| Spergula japonica | Spergula | Caryophyllaceae | |
| Changium smyrnioides | Changium | Apiaceae |
|
| Talipariti tiliaceum | Talipariti | Malvaceae |
|
| Bryopsis pennata | Bryopsis | Bryopsidaceae | |
| Helichrysum cephaloideum | Helichrysum | Asteraceae |
|
| Piper brachystachyum | Piper | Piperaceae |
|
| Epimedium sempervirens | Epimedium | Berberidaceae | |
| Elaeagnus pungens | Elaeagnus | Elaeagnaceae |
|
| Pseudotsuga japonica | Pseudotsuga | Pinaceae | |
| Asphodeline damascena | Asphodeline | Asphodelaceae | |
| Prosopis kuntzei | Prosopis | Fabaceae |
|
| Trichosanthes bracteata | Trichosanthes | Cucurbitaceae |
|
| Leontice kiangnanensis | Leontice | Berberidaceae | |
| Hemionitis japonica | Hemionitis | Pteridaceae | |
| Tephroseris kirilowii | Tephroseris | Asteraceae |
|
| Populus yunnanensis | Populus | Salicaceae | |
| Coptis japonica | Coptis | Ranunculaceae |
|
| Cheilanthes marantae | Cheilanthes | Pteridaceae | |
| Selaginella tamariscina | Selaginella | Selaginellaceae |
|
| Sedum obtuso-lineare | Sedum | Crassulaceae | |
| Helichrysum angustifolium | Helichrysum | Asteraceae | |
| Scabiosa comosa | Scabiosa | Caprifoliaceae |
|
| Dalbergia ecastaphyllum | Dalbergia | Fabaceae |
|
| Dioscorea nipponica | Dioscorea | Dioscoreaceae |
|
| Cedronella canariensis | Cedronella | Lamiaceae |
|
| Plectranthus lanuginosus | Plectranthus | Lamiaceae |
|
| Vitex negundo | Vitex | Lamiaceae |
|
| Kopsia longiflora | Kopsia | Apocynaceae |
|
| Trollius chinensis | Trollius | Ranunculaceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Aloe ferox | Aloe | Asphodelaceae |
|
| Amomum longiligulare | Amomum | Zingiberaceae |
|
| Aristolochia contorta | Aristolochia | Aristolochiaceae |
|
| Brucea javanica | Brucea | Simaroubaceae |
|
| Lepidophorum repandum | Lepidophorum | Asteraceae | |
| Scrophularia nodosa | Scrophularia | Scrophulariaceae |
|
| Amomum tsao-ko | Amomum | Zingiberaceae |
|
| Alstonia pittieri | Alstonia | Apocynaceae | |
| Angiopteris evecta | Angiopteris | Marattiaceae |
|
| Senecio congestus | Senecio | Asteraceae |
|
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Paeonia rockii | Paeonia | Paeoniaceae | |
| Solanum americanum | Solanum | Solanaceae |
|
| Artemisia giraldii | Artemisia | Asteraceae | |
| Ailanthus altissima | Ailanthus | Simaroubaceae |
|
| Vitex rotundifolia | Vitex | Lamiaceae |
|
| Angelica sinensis | Angelica | Apiaceae |
|
| Hypericum balearicum | Hypericum | Hypericaceae | |
| Calystegia pubescens | Calystegia | Convolvulaceae |
|
| Astragalus mongholicus | Astragalus | Fabaceae |
|
| Larix laricina | Larix | Pinaceae |
|
| Humata pectinata | Humata | Davalliaceae | |
| Papaver pseudocanescens | Papaver | Papaveraceae | |
| Rhododendron campylocarpum | Rhododendron | Ericaceae | |
| Zea mays | Zea | Poaceae |
|
| Scutellaria barbata | Scutellaria | Lamiaceae |
|
| Cephalaria leucantha | Cephalaria | Caprifoliaceae | |
| Atractylodes lancea | Atractylodes | Asteraceae |
|
| Bryum argenteum | Bryum | Bryaceae |
|
| Stephania aculeata | Stephania | Menispermaceae | |
| Phlojodicarpus sibiricus | Phlojodicarpus | Apiaceae |
|
| Amomum xanthioides | Amomum | Zingiberaceae |
|
| Clematis terniflora var. mandshurica | Clematis | Ranunculaceae |
|
| Sideritis dasygnaphala | Sideritis | Lamiaceae | |
| Rumex chalepensis | Rumex | Polygonaceae | |
| Trichosanthes kirilowii maxim | Trichosanthes | Cucurbitaceae | |
| Chenopodium formosanum | Chenopodium | Chenopodiaceae | |
| Euphorbia amygdaloides | Euphorbia | Euphorbiaceae |
|
| Andrographis viscosula | Andrographis | Acanthaceae |
|
| Epimedium pubescens | Epimedium | Berberidaceae |
|
| Entada phaseoloides | Entada | Fabaceae |
|
| Gutierrezia dracunculoides | Gutierrezia | Asteraceae | |
| Pithecellobium racemosum | Pithecellobium | Fabaceae | |
| Hesperis matronalis | Hesperis | Brassicaceae |
|
| Psidium acutangulum | Psidium | Myrtaceae |
|
| Ephedra herba | Ephedra | Ephedraceae | |
| Beesia calthifolia | Beesia | Ranunculaceae | |
| Strychnos henningsii | Strychnos | Loganiaceae |
|
| Jatropha macrorhiza | Jatropha | Euphorbiaceae | |
| Sambucus williamsii | Sambucus | Adoxaceae |
|
| Sparganium stoloniferum | Sparganium | Typhaceae |
|
| Aconitum tanguticum | Aconitum | Ranunculaceae |
|
| Bursera kerberi | Bursera | Burseraceae | |
| Uvaria chamae | Uvaria | Annonaceae |
|
| Ajuga decumbens | Ajuga | Lamiaceae |
|
| Polemonium caeruleum | Polemonium | Polemoniaceae |
|
| Senecio flammeus | Senecio | Asteraceae | |
| Pleione bulbocodioides | Pleione | Orchidaceae | |
| Cremastra appendiculata | Cremastra | Orchidaceae |
|
| Helenium integrifolium | Helenium | Asteraceae | |
| Santalum album | Santalum | Santalaceae |
|
| Jackiella javanica | Jackiella | Jackiellaceae |
|
| Rhododendron mucronulatum | Rhododendron | Ericaceae |
|
| Toddalia aculeata | Toddalia | Rutaceae |
|
| Dysosma versipellis | Dysosma | Berberidaceae |
|
| Lycium chinense | Lycium | Solanaceae |
|
| Euonymus fortunei | Euonymus | Celastraceae |
|
| Rhus vulgaris | Rhus | Anacardiaceae |
|
| Cladrastis platycarpa | Cladrastis | Fabaceae | |
| Phlomis crinita | Phlomis | Lamiaceae |
|
| Physalis edulis | Physalis | Solanaceae | |
| Dalbergia odorifera | Dalbergia | Fabaceae |
|
| Acanthophyllum sordidum | Acanthophyllum | Caryophyllaceae | |
| Eremanthus seidelii | Eremanthus | Asteraceae | |
| Diospyros kaki | Diospyros | Ebenaceae |
|
| Carthamus tinctorius | Carthamus | Asteraceae |
|
| Crotalaria stolzii | Crotalaria | Fabaceae | |
| Selinum libanotis | Selinum | Apiaceae | |
| Vernonia scorpioides | Vernonia | Asteraceae | |
| Pangium edule | Pangium | Achariaceae |
|
| Melampodium leucanthum | Melampodium | Asteraceae | |
| Clerodendranthus spicatus | Clerodendranthus | Lamiaceae | |
| Prunus japonica | Prunus | Rosaceae |
|
| Senecio adenophyllus | Senecio | Asteraceae | |
| Clerodendrum trichotomum | Clerodendrum | Lamiaceae |
|
| Polyalthia stenopetala | Polyalthia | Annonaceae | |
| Juniperus scopulorum | Juniperus | Cupressaceae |
|
| Diplacus aurantiacus | Diplacus | Phrymaceae | |
| Lilium umbellatum | Lilium | Liliaceae | |
| Artemisia rehan | Artemisia | Asteraceae | |
| Clinacanthus nutans | Clinacanthus | Acanthaceae |
|
| Rubus coreanus | Rubus | Rosaceae |
|
| Melia azedarach | Melia | Meliaceae |
|
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Elephantopus hirtiflorus | Elephantopus | Asteraceae | |
| Alstonia angustiloba | Alstonia | Apocynaceae | |
| Nematolepis phebalioides | Nematolepis | Rutaceae | |
| Polygonatum zanlanscianense | Polygonatum | Asparagaceae |
|
| Solidago flexicaulis | Solidago | Asteraceae |
|
| Lasianthaea podocephala | Lasianthaea | Asteraceae | |
| Gleditsia caspica | Gleditsia | Fabaceae |
|
| Ligularia cymbulifera | Ligularia | Asteraceae | |
| Eucalyptus albens | Eucalyptus | Myrtaceae | |
| Bulbinella floribunda | Bulbinella | Asphodelaceae | |
| Coprosma areolata | Coprosma | Rubiaceae |
|
| Roemeria refracta | Roemeria | Papaveraceae | |
| Epimedium grandiflorum | Epimedium | Berberidaceae |
|
| Millettia pinnata | Millettia | Fabaceae |
|
| Annona cherimola | Annona | Annonaceae |
|
| Thymus vulgaris | Thymus | Lamiaceae |
|
| Lepisorus contortus | Lepisorus | Polypodiaceae | |
| Garcinia conrauana | Garcinia | Clusiaceae |
|
| Oreopteris quelpaertensis | Oreopteris | Thelypteridaceae | |
| Pellacalyx axillaris | Pellacalyx | Rhizophoraceae | |
| Bougainvillea glabra | Bougainvillea | Nyctaginaceae |
|
| Hosta sieboldiana | Hosta | Asparagaceae |
|
| Senecio scandens | Senecio | Asteraceae |
|
| Viguiera linearis | Viguiera | Asteraceae | |
| Boschniakia rossica | Boschniakia | Orobanchaceae |
|
| Forsythia viridissima | Forsythia | Oleaceae |
|
| Croton ruizianus | Croton | Euphorbiaceae | |
| Phyllanthus oligospermus | Phyllanthus | Phyllanthaceae | |
| Stenocereus thurberi | Stenocereus | Cactaceae |
|
| Buxus wallichiana | Buxus | Buxaceae |
|
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Flueggea microcarpa | Flueggea | Phyllanthaceae |
|
| Zingiber officinale | Zingiber | Zingiberaceae |
|
| Myoporum platycarpum | Myoporum | Scrophulariaceae |
|
| Achyranthes aspera | Achyranthes | Amaranthaceae |
|
| Dendrobium chrysotoxum | Dendrobium | Orchidaceae |
|
| Rhododendron dauricum | Rhododendron | Ericaceae |
|
| Morus macroura | Morus | Moraceae |
|
| Punica granatum | Punica | Lythraceae |
|
| Anastatica hierochuntica | Anastatica | Brassicaceae |
|
| Vitex trifolia | Vitex | Lamiaceae |
|
| Forsythia suspensa | Forsythia | Oleaceae |
|
| Blumea eriantha | Blumea | Asteraceae |
|
| Strychnos ledermannii | Strychnos | Loganiaceae | |
| Pometia eximia | Pometia | Sapindaceae | |
| Magnolia montana | Michelia | Magnoliaceae |
|
| Trichosanthes kirilowii | Trichosanthes | Cucurbitaceae |
|
| Sesbania grandiflora | Sesbania | Fabaceae |
|
| Dendrobium candidum | Dendrobium | Orchidaceae | |
| Cipadessa fruticosa | Cipadessa | Meliaceae | |
| Cnidium officinale | Cnidium | Apiaceae |
|
| Himantoglossum hircinum | Himantoglossum | Orchidaceae | |
| Solanum nigrum | Solanum | Solanaceae |
|
| Rhizophora mangle | Rhizophora | Rhizophoraceae |
|
| Rhodiola crenulata | Rhodiola | Crassulaceae |
|
| Chrysanthemum indicum | Chrysanthemum | Asteraceae |
|
| Inula salsoloides | Inula | Asteraceae | |
| Raphanus raphanistrum | Raphanus | Brassicaceae |
|
| Gastrodia elata | Gastrodia | Orchidaceae |
|
| Microtropis japonica | Microtropis | Celastraceae | |
| Microtropis fokienensis | Microtropis | Celastraceae | |
| Senna spectabilis | Senna | Fabaceae |
|
| Coptis deltoidea | Coptis | Ranunculaceae |
|
| Sterculia foetida | Sterculia | Malvaceae |
|
| Phebalium bilobum | Phebalium | Rutaceae | |
| Neopringlea integrifolia | Neopringlea | Salicaceae | |
| Actinidia chinensis planch | Actinidia | Actinidiaceae | |
| Eutrochium purpureum | Eutrochium | Asteraceae |
|
| Epimedium koreanum | Epimedium | Berberidaceae |
|
| Aesculus hippocastanum | Aesculus | Sapindaceae |
|
| Bistorta officinalis | Bistorta | Polygonaceae |
|
| Dendrobium fimbriatum | Dendrobium | Orchidaceae |
|
| Lycium barbarum | Lycium | Solanaceae |
|
| Schisandra sphaerandra | Schisandra | Schisandraceae |
|
| Palaquium canaliculatum | Palaquium | Sapotaceae | |
| Physalis sordida | Physalis | Solanaceae | |
| Imperata cylindrica | Imperata | Poaceae |
|
| Oxytropis muricata | Oxytropis | Fabaceae | |
| Adesmia boronioides | Adesmia | Fabaceae |
|
| Alcea rosea | Alcea | Malvaceae |
|
| Picea glauca | Picea | Pinaceae |
|
| Taxus drupacea | Taxus | Taxaceae | |
| Ilex brevicuspis | Ilex | Aquifoliaceae |
|
| Coffea liberica var. dewevrei | Coffea | Rubiaceae |
|
| Morinda coreia | Morinda | Rubiaceae |
|
| Acrisione denticulata | Acrisione | Asteraceae | |
| Euphorbia biglandulosa | Euphorbia | Euphorbiaceae | |
| Senecio heliopsis | Senecio | Asteraceae | |
| Thermopsis mollis | Thermopsis | Fabaceae | |
| Berberis orthobotrys | Berberis | Berberidaceae |
|
| Aloe microstigma | Aloe | Asphodelaceae | |
| Codium dwarkense | Codium | Codiaceae | |
| Vincetoxicum pycnostelma | Vincetoxicum | Apocynaceae | |
| Achillea biebersteinii | Achillea | Asteraceae |
|
| Sesamum indicum | Sesamum | Pedaliaceae |
|
| Dioscorea polystachya | Dioscorea | Dioscoreaceae |
|
| Astragalus membranaceus | Astragalus | Fabaceae |
|
| Euphorbia formosana | Euphorbia | Euphorbiaceae | |
| Hedysarum multijugum maxim | Hedysarum | Fabaceae | |
| Diplazium esculentum | Diplazium | Athyriaceae |
|
| Aristolochia debilis | Aristolochia | Aristolochiaceae |
|
| Jacobaea cannabifolia | Jacobaea | Asteraceae | |
| Xanthium strumarium | Xanthium | Asteraceae |
|
| Pachycereus pringlei | Pachycereus | Cactaceae |
|
| Mycetia nutans | Mycetia | Rubiaceae |
|
| Ongokea gore | Ongokea | Aptandraceae |
|
| Sanicula epipactis | Sanicula | Apiaceae | |
| Euonymus laxiflorus | Euonymus | Celastraceae | |
| Conium maculatum | Conium | Apiaceae |
|
| Aglaia pyramidata | Aglaia | Meliaceae | |
| Cucurbita moschata | Cucurbita | Cucurbitaceae |
|
| Angelica saxatilis | Angelica | Apiaceae | |
| Scopolia atropoides | Scopolia | Solanaceae | |
| Schrebera swietenoides | Schrebera | Oleaceae |
|
| Caryocar villosum | Caryocar | Caryocaraceae |
|
| Bistorta vivipara | Bistorta | Polygonaceae |
|
| Senecio gilliesi | Senecio | Asteraceae | |
| Botrychium ternatum | Botrychium | Ophioglossaceae |
|
| Ocimum gratissimum | Ocimum | Lamiaceae |
|
| Glochidion philippicum | Glochidion | Phyllanthaceae | |
| Celastrus monospermus | Celastrus | Celastraceae | |
| Ceriops decandra | Ceriops | Rhizophoraceae |
|
| Citrus reticulata | Citrus | Rutaceae |
|
| Solidago petiolaris | Solidago | Asteraceae | |
| Zaluzania grayana | Zaluzania | Asteraceae | |
| Solanum pseudopersicum | Solanum | Solanaceae | |
| Zanthoxylum acutifolium | Zanthoxylum | Rutaceae |
|
| Smilax china | Smilax | Smilacaceae |
|
| Euphorbia latazi | Euphorbia | Euphorbiaceae | |
| Spatholobus suberectus | Spatholobus | Fabaceae |
|
| Rumex japonicus | Rumex | Polygonaceae |
|
| Archidendron ellipticum | Archidendron | Fabaceae | |
| Solanum spirale | Solanum | Solanaceae |
|
| Tabernaemontana divaricata | Tabernaemontana | Apocynaceae |
|
| Agave deserti | Agave | Asparagaceae |
|
| Asclepias subulata | Asclepias | Apocynaceae |
|
| Solanum andigena | Solanum | Solanaceae | |
| Panax spinosus | Panax | Araliaceae | |
| Ginkgo biloba | Ginkgo | Ginkgoaceae |
|
| Zanthoxylum simulans | Zanthoxylum | Rutaceae |
|
| Chaenomeles sinensis | Chaenomeles | Rosaceae |
|
| Bistorta manshuriensis | Bistorta | Polygonaceae | |
| Rubus chingii | Rubus | Rosaceae |
|
| Gmelina asiatica | Gmelina | Lamiaceae |
|
| Polanisia trachysperma | Polanisia | Cleomaceae |
|
| Acacia lasiopetala | Acacia | Fabaceae | |
| Eupatorium rebaudianum | Eupatorium | Asteraceae |
|
| Swertia swertopsis | Swertia | Gentianaceae | |
| Premna tomentosa | Premna | Lamiaceae |
|
| Sagittaria sagittifolia | Sagittaria | Alismataceae |
|
| Sophora leachiana | Sophora | Fabaceae |
|
| Cunonia macrophylla | Cunonia | Cunoniaceae |
|
| Veratrum sabadilla | Veratrum | Melanthiaceae | |
| Tsuga chinensis | Tsuga | Pinaceae |
|
| Taxus brevifolia | Taxus | Taxaceae |
|
| Virgilia divaricata | Virgilia | Fabaceae | |
| Aconitum habaense | Aconitum | Ranunculaceae | |
| Euphrasia rubra | Euphrasia | Orobanchaceae | |
| Entada rheedei | Entada | Fabaceae |
|
| Aucuba chinensis | Aucuba | Garryaceae | |
| Utricularia australis | Utricularia | Lentibulariaceae | |
| Solanum boerhaavii | Solanum | Solanaceae | |
| Amsinckia tessellata | Amsinckia | Boraginaceae | |
| Carica dodecaphylla | Carica | Caricaceae | |
| Citrus tangerina | Citrus | Rutaceae |
|
| Crocus minimus | Crocus | Iridaceae |
|
| Curculigo pilosa | Curculigo | Hypoxidaceae |
|
| Sideritis euboea | Sideritis | Lamiaceae | |
| Osteospermum muricatum | Osteospermum | Asteraceae | |
| Centaurea huber-morathii | Centaurea | Asteraceae | |
| Baccharis dracunculifolia | Baccharis | Asteraceae |
|
| Sisyrinchium californicum | Sisyrinchium | Iridaceae | |
| Crinum latifolium | Crinum | Amaryllidaceae |
|
| Saussurea amara | Saussurea | Asteraceae | |
| Coleus wulfenioides | Coleus | Lamiaceae | |
| Lysiana subfalcata | Lysiana | Loranthaceae |
|
| Haplophyllum ramosissimum | Haplophyllum | Rutaceae | |
| Peperomia vulcanica | Peperomia | Piperaceae |
|
| Sorbus tianschanica | Sorbus | Rosaceae |
|
| Platycarya strobilacea | Platycarya | Juglandaceae |
|
| Helichrysum mixtum | Helichrysum | Asteraceae | |
| Polygala senega | Polygala | Polygalaceae |
|
| Cynometra lujae | Cynometra | Fabaceae | |
| Aspalathus linearis | Aspalathus | Fabaceae |
|
| Eupatorium areolare | Eupatorium | Asteraceae | |
| Stephania elegans | Stephania | Menispermaceae |
|
| Bursera simaruba | Bursera | Burseraceae |
|
| Delphinium denudatum | Delphinium | Ranunculaceae |
|
| Vigna mungo | Vigna | Fabaceae |
|
| Solanum nigrum linn | Solanum | Solanaceae | |
| Notholaena lemmonii | Notholaena | Pteridaceae | |
| Senna alexandrina | Senna | Fabaceae |
|
| Morus alba | Morus | Moraceae |
|
| Aloe spicata | Aloe | Asphodelaceae |
|
| Albizia procera | Albizia | Fabaceae |
|
| Selaginella pulvinata | Selaginella | Selaginellaceae |
|
| Phyllanthus emblica | Phyllanthus | Phyllanthaceae |
|
| Mentha incana | Mentha | Lamiaceae | |
| Vernonia lilacina | Vernonia | Asteraceae | |
| Allium fistulosum | Allium | Amaryllidaceae |
|
| Ericameria laricifolia | Ericameria | Asteraceae | |
| Cissus quadrangularis | Cissus | Vitaceae |
|
| Coptis teeta | Coptis | Ranunculaceae |
|
| Litsea cubeba | Litsea | Lauraceae |
|
| Euonymus alatus | Euonymus | Celastraceae |
|
| Ormosia fordiana | Ormosia | Fabaceae | |
| Angelica acutiloba | Angelica | Apiaceae |
|
| Brickellia vernicosa | Brickellia | Asteraceae | |
| Macaranga peltata | Macaranga | Euphorbiaceae |
|
| Loranthus longiflorus | Loranthus | Loranthaceae |
|
| Rhodanthe maryonii | Rhodanthe | Asteraceae | |
| Callistemon speciosus | Callistemon | Myrtaceae | |
| Fallopia multiflora | Fallopia | Polygonaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Lupinus cosentinii | Lupinus | Fabaceae | |
| Diospyros glaucifolia | Diospyros | Ebenaceae | |
| Corydalis rhizoma | Corydalis | Papaveraceae | |
| Aloe africana | Aloe | Xanthorrhoeaceae |
|
| Passiflora morifolia | Passiflora | Passifloraceae |
|
| Strophanthus hispidus | Strophanthus | Apocynaceae |
|
| Rhinacanthus nasutus | Rhinacanthus | Acanthaceae |
|
| Carthamus oxyacantha | Carthamus | Asteraceae | |
| Verbascum laxum | Verbascum | Scrophulariaceae | |
| Lampranthus sociorum | Lampranthus | Aizoaceae | |
| erycibe hainanesis | Erycibe | Convolvulaceae | |
| Salix alba | Salix | Salicaceae |
|
| Desmodium styracifolium | Desmodium | Fabaceae |
|
| Alnus cordata | Alnus | Betulaceae |
|
| Alstonia undulifolia | Alstonia | Apocynaceae | |
| Perymenium mendezii | Perymenium | Asteraceae | |
| Plantago asiatica | Plantago | Plantaginaceae |
|
| Nelumbo nucifera | Nelumbo | Nelumbonaceae |
|
| Bersama swinnyi | Bersama | Melianthaceae | |
| Amomum neoaurantiacum | Amomum | Zingiberaceae | |
| Scrophularia koelzii | Scrophularia | Scrophulariaceae |
|
| Durio oxleyanus | Durio | Malvaceae |
|
| Dendrobium nobile | Dendrobium | Orchidaceae |
|
| Hortonia floribunda | Hortonia | Monimiaceae | |
| Berberis koreana | Berberis | Berberidaceae |
|
| Homalomena occulta | Homalomena | Araceae |
|
| Nauclea rhynchophylla | Nauclea | Rubiaceae | |
| Machilus zuihoensis | Machilus | Lauraceae |
|
| Betula platyphylla | Betula | Betulaceae |
|
| Polygonum flaccidum | Polygonum | Polygonaceae |
|
| Aglaia formosana | Aglaia | Meliaceae | |
| Aloe deltoideodonta | Aloe | Asphodelaceae | |
| Hedysarum gmelini | Hedysarum | Fabaceae | |
| Trichosanthes rosthornii | Trichosanthes | Cucurbitaceae |
|
| Arum ternatum thunb | Arum | Araceae | |
| Phlomis umbrosa | Phlomis | Lamiaceae |
|
| Tabebuia avellanedae | Tabebuia | Bignoniaceae |
|
| Viburnum davidii | Viburnum | Adoxaceae | |
| Epimedium brevicornu | Epimedium | Berberidaceae | |
| Hubertia tomentosa | Hubertia | Asteraceae | |
| Agathosma scaberula | Agathosma | Rutaceae | |
| Myristica malabarica | Myristica | Myristicaceae |
|
| Typha angustata | Typha | Typhaceae |
|
| Ligustrum obtusifolium | Ligustrum | Oleaceae |
|
| Euploca racemosa | Euploca | Heliotropiaceae | |
| Bursera tonkinensis | Bursera | Burseraceae |
|
| Bauhinia purpurea | Bauhinia | Fabaceae |
|
| Coptis chinensis | Coptis | Ranunculaceae |
|
| Salvia miltiorrhiza | Salvia | Lamiaceae |
|
| Helichrysum auriceps | Helichrysum | Asteraceae | |
| Eriostemon crowei | Eriostemon | Rutaceae | |
| Anthocercis albicans | Anthocercis | Solanaceae | |
| Drimia fugax | Drimia | Hyacinthaceae | |
| Achlys triphylla | Achlys | Berberidaceae |
|
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Spartium junceum | Spartium | Fabaceae |
|
| Goniothalamus undulatus | Goniothalamus | Annonaceae | |
| Zanthoxylum chiloperone | Zanthoxylum | Rutaceae | |
| Glinus oppositifolius | Glinus | Molluginaceae |
|
| Betula davurica | Betula | Betulaceae | |
| Clematis chinensis | Clematis | Ranunculaceae |
|
| Pteris spinulosa | Pteris | Pteridaceae | |
| Pseudostellaria heterophylla | Pseudostellaria | Caryophyllaceae |
|
| Hedysarum polybotrys | Hedysarum | Fabaceae |
|
| Jurinea maxima | Jurinea | Asteraceae | |
| Bulbophyllum protractum | Bulbophyllum | Orchidaceae | |
| Tarchonanthus camphoratus | Tarchonanthus | Asteraceae |
|
| Kali turgidum | Kali | Chenopodiaceae |
|
| Allium sativum | Allium | Amaryllidaceae |
|
| Pilocarpus grandiflorus | Pilocarpus | Rutaceae | |
| Smilax glabra | Smilax | Smilacaceae |
|
| Cypripedium calceolus | Cypripedium | Orchidaceae |
|
| Fagus fusca | Fagus | Fagaceae | |
| Spiracantha cornifolia | Spiracantha | Asteraceae | |
| Lactuca laciniata | Lactuca | Asteraceae |
|
| Dioscorea opposita | Dioscorea | Dioscoreaceae |
|
| Gypsophila licentiana hand.-mazz. | Gypsophila | Caryophyllaceae | |
| Tylophora tanakae | Tylophora | Apocynaceae | |
| Leitneria floridana | Leitneria | Simaroubaceae | |
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Myristica cagayanensis | Myristica | Myristicaceae | |
| Gentiana strictiflora | Gentiana | Gentianaceae | |
| Oryza sativa | Oryza | Poaceae |
|
| Eucalyptus kitsoniana | Eucalyptus | Myrtaceae | |
| Podocarpus elatus | Podocarpus | Podocarpaceae |
|
| Nemuaron humboldtii | Nemuaron | Atherospermataceae | |
| Dendrobium loddigesii | Dendrobium | Orchidaceae |
|
| Perilla frutescens | Perilla | Lamiaceae |
|
| Lophocereus marginatus | Lophocereus | Cactaceae |
|
| Glehnia littoralis | Glehnia | Apiaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
| Helichrysum sutherlandii | Helichrysum | Asteraceae |
|
| Notholaena aschenborniana | Notholaena | Pteridaceae | |
| Aralidium pinnatifidum | Aralidium | Torricelliaceae | |
| Epimedium wushanense | Epimedium | Berberidaceae |
|
| Flemingia rhodocarpa | Flemingia | Fabaceae | |
| Crocus sativus | Crocus | Iridaceae |
|
| Papaver somniferum | Papaver | Papaveraceae |
|
| Charpentiera obovata | Charpentiera | Amaranthaceae | |
| Gardenia jasminoides | Gardenia | Rubiaceae |
|
| Euphorbia resinifera | Euphorbia | Euphorbiaceae |
|
| Lotus ucrainicus | Lotus | Fabaceae | |
| Artemisia pectinata | Artemisia | Asteraceae | |
| Clematis manshurica | Clematis | Ranunculaceae | |
| Parablechnum minus | Parablechnum | Blechnaceae | |
| Cichorium intybus | Cichorium | Asteraceae |
|
| Artemisia porrecta | Artemisia | Asteraceae |
|
| Zephyranthes flava | Zephyranthes | Amaryllidaceae | |
| Plagiomnium cuspidatum | Plagiomnium | Mniaceae | |
| Eurycoma longifolia | Eurycoma | Simaroubaceae |
|
Ingredient ID: NPC111625
Formula: C15H20O8
Ingredient ID: NPC111625
| Common Name | n.a. |
| IUPAC Name | 1-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanone |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2ccc(cc2OC)C(=O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C15H20O8/c1-7(17)8-3-4-9(10(5-8)21-2)22-15-14(20)13(19)12(18)11(6-16)23-15/h3-5,11-16,18-20H,6H2,1-2H3/t11-,12-,13+,14-,15-/m1/s1 |
| Standard InCHIKey | QUOZWMJFTQUXON-UXXRCYHCSA-N |
| Ingredient External Links |
PubChem CID: 164648 ZINC ID: ZINC000005167579 |
| Plant-Ingredient Association Reference |
Database: TM-MC |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cistanche deserticola | Cistanche | Orobanchaceae |
|
| Iris tectorum | Iris | Iridaceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Artemisia giraldii | Artemisia | Asteraceae | |
| Calystegia pubescens | Calystegia | Convolvulaceae |
|
| Millettia pinnata | Millettia | Fabaceae |
|
| Picea glauca | Picea | Pinaceae |
|
| Albizia procera | Albizia | Fabaceae |
|
| Diospyros glaucifolia | Diospyros | Ebenaceae | |
| Lampranthus sociorum | Lampranthus | Aizoaceae | |
| Perymenium mendezii | Perymenium | Asteraceae | |
| Hortonia floribunda | Hortonia | Monimiaceae | |
| Nauclea rhynchophylla | Nauclea | Rubiaceae | |
| Bursera tonkinensis | Bursera | Burseraceae |
|
| Achlys triphylla | Achlys | Berberidaceae |
|
| Bulbophyllum protractum | Bulbophyllum | Orchidaceae | |
| Tarchonanthus camphoratus | Tarchonanthus | Asteraceae |
|
| Cistanche tubulosa | Cistanche | Orobanchaceae |
|
| Cypripedium calceolus | Cypripedium | Orchidaceae |
|
| Iris domestica | Iris | Iridaceae |
|
| Lactuca laciniata | Lactuca | Asteraceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Artemisia porrecta | Artemisia | Asteraceae |
|
Ingredient ID: NPC110954
Formula: C9H10O5
Ingredient ID: NPC107334
Formula: C15H24O9
Ingredient ID: NPC107334
| Common Name | n.a. |
| IUPAC Name | (3R,4S,5S,6R)-2-[[5-hydroxy-7-(hydroxymethyl)-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Canonical SMILES | OC[C@H]1OC(OC2OC=CC3C2C(CO)CC3O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C15H24O9/c16-4-6-3-8(18)7-1-2-22-14(10(6)7)24-15-13(21)12(20)11(19)9(5-17)23-15/h1-2,6-21H,3-5H2/t6?,7?,8?,9-,10?,11-,12+,13-,14?,15?/m1/s1 |
| Standard InCHIKey | SXPWHBXTTWFWMH-BIRDSZKRSA-N |
| Ingredient External Links |
PubChem CID: 45358109 |
| Plant-Ingredient Association Reference |
Database: TCMID [2004] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Buddleja officinalis | Buddleja | Scrophulariaceae |
|
| Plantago lanceolata | Plantago | Plantaginaceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Vitex rotundifolia | Vitex | Lamiaceae |
|
| Eucommia ulmoides | Eucommia | Eucommiaceae |
|
| Plantago major | Plantago | Plantaginaceae |
|
| Plantago asiatica | Plantago | Plantaginaceae |
|
| Veronica persica | Veronica | Plantaginaceae |
|
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Veronica arvensis | Veronica | Plantaginaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
| Catalpa ovata | Catalpa | Bignoniaceae |
|
Ingredient ID: NPC107049
Formula: C31H38O17
Ingredient ID: NPC105927
Formula: C10H15N3O7
Ingredient ID: NPC105927
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | N=C1N[C@H](O)[C@@H]2[C@@]3(N1)[C@H](O)[C@H]1[C@H]([C@@H]2O[C@@]([C@H]3O)(O1)O)O |
| Standard InCHI | InChI=1S/C10H15N3O7/c11-8-12-6(16)1-3-2(14)4-5(15)9(1,13-8)7(17)10(18,19-3)20-4/h1-7,14-18H,(H3,11,12,13)/t1-,2+,3-,4-,5-,6-,7+,9-,10+/m1/s1 |
| Standard InCHIKey | LSXWHXRWALCZSK-WSXHEACLSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD215198] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Tadehagi triquetrum | Tadehagi | Fabaceae |
|
Ingredient ID: NPC105904
Formula: C15H20O8
Ingredient ID: NPC105904
| Common Name | n.a. |
| IUPAC Name | 1-[3-methoxy-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanone |
| Canonical SMILES | OC[C@H]1OC(Oc2ccc(cc2OC)C(=O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C15H20O8/c1-7(17)8-3-4-9(10(5-8)21-2)22-15-14(20)13(19)12(18)11(6-16)23-15/h3-5,11-16,18-20H,6H2,1-2H3/t11-,12-,13+,14-,15?/m1/s1 |
| Standard InCHIKey | QUOZWMJFTQUXON-HHHGZCDHSA-N |
| Ingredient External Links |
PubChem CID: 10336601 |
| Plant-Ingredient Association Reference |
Database: TCMID [1162] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Solanum lycopersicum | Solanum | Solanaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC10205
Formula: C24H26O10
