37 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
6 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC93317
Formula: C16H28O2
Ingredient ID: NPC93317
| Common Name | n.a. |
| IUPAC Name | (1R,3aR,4R,8aS)-1-methoxy-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulen-4-ol |
| Canonical SMILES | CO[C@]1(C)CC[C@@H]2[C@@H]1C=C(CC[C@@]2(C)O)C(C)C |
| Standard InCHI | InChI=1S/C16H28O2/c1-11(2)12-6-8-15(3,17)13-7-9-16(4,18-5)14(13)10-12/h10-11,13-14,17H,6-9H2,1-5H3/t13-,14+,15-,16-/m1/s1 |
| Standard InCHIKey | XIEPKGKUTCZHLV-QKPAOTATSA-N |
| Ingredient External Links |
PubChem CID: 15896127 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD110356] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
  |
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC92642
Formula: C18H24O5
Ingredient ID: NPC92642
| Common Name | n.a. |
| IUPAC Name | [(5R,6S,8S,9Z)-8-methoxy-3,6,10-trimethyl-4-oxo-6,7,8,11-tetrahydro-5H-cyclodeca[b]furan-5-yl] acetate |
| Canonical SMILES | CO[C@@H]1/C=C(/C)Cc2occ(c2C(=O)[C@@H]([C@H](C1)C)OC(=O)C)C |
| Standard InCHI | InChI=1S/C18H24O5/c1-10-6-14(21-5)8-11(2)18(23-13(4)19)17(20)16-12(3)9-22-15(16)7-10/h6,9,11,14,18H,7-8H2,1-5H3/b10-6-/t11-,14+,18+/m0/s1 |
| Standard InCHIKey | DCFSJMWNJKXQCQ-UYFSGCAKSA-N |
| Ingredient External Links |
PubChem CID: 101149318 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD45749] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC90809
Formula: C15H16O3
Ingredient ID: NPC90809
| Common Name | n.a. |
| IUPAC Name | (9aS)-9a-hydroxy-3,5,8-trimethyl-4,9-dihydrobenzo[f][1]benzofuran-2-one |
| Canonical SMILES | Cc1ccc(c2c1C[C@]1(O)OC(=O)C(=C1C2)C)C |
| Standard InCHI | InChI=1S/C15H16O3/c1-8-4-5-9(2)12-7-15(17)13(6-11(8)12)10(3)14(16)18-15/h4-5,17H,6-7H2,1-3H3/t15-/m0/s1 |
| Standard InCHIKey | DVZUGUCJUJYKHS-HNNXBMFYSA-N |
| Ingredient External Links |
PubChem CID: 42632428 ZINC ID: ZINC000070451213 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC88805
Formula: C17H24O4
Ingredient ID: NPC88805
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=C[C@H](c1c(O)cc(c(c1CC(OC(=O)C)(C)C)O)C)C |
| Standard InCHI | InChI=1S/C17H24O4/c1-7-10(2)15-13(9-17(5,6)21-12(4)18)16(20)11(3)8-14(15)19/h7-8,10,19-20H,1,9H2,2-6H3/t10-/m1/s1 |
| Standard InCHIKey | FTYKOXXPLGRWCF-SNVBAGLBSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD160202] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC76145
Formula: C10H16
Ingredient ID: NPC76145
| Common Name | Limonene |
| IUPAC Name | (4R)-1-methyl-4-prop-1-en-2-ylcyclohexene |
| Canonical SMILES | CC1=CC[C@@H](CC1)C(=C)C |
| Standard InCHI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
| Standard InCHIKey | XMGQYMWWDOXHJM-JTQLQIEISA-N |
| Ingredient External Links |
PubChem CID: 440917 ChEMBL ID: CHEMBL449062 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD77338] Database: NPASS [NPC76145] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pyrus bourgaeana | Pyrus | Rosaceae |
|
| Citrus unshiu | Citrus | Rutaceae |
 |
| Strophanthus eminii | Strophanthus | Apocynaceae |
|
| Ajuga reptans | Ajuga | Lamiaceae |
|
| Artemisia montana | Artemisia | Asteraceae |
|
| Artemisia apiacea | Artemisia | Asteraceae |
|
| Pinus edulis | Pinus | Pinaceae |
|
| Artemisia hanseniana | Artemisia | Asteraceae | |
| Syncarpia hillii | Syncarpia | Myrtaceae | |
| Vachellia karroo | Vachellia | Fabaceae |
|
| Sinopodophyllum hexandrum | Sinopodophyllum | Berberidaceae |
|
| Baccharis truncata | Baccharis | Asteraceae | |
| Pinus koraiensis | Pinus | Pinaceae |
|
| Moringa oleifera | Moringa | Moringaceae |
 |
| Artemisia capillaris | Artemisia | Asteraceae |
|
| Stevia alpina | Stevia | Asteraceae | |
| Ratibida mexicana | Ratibida | Asteraceae |
|
| Piper cubeba | Piper | Piperaceae |
|
| Akebia trifoliata | Akebia | Lardizabalaceae |
|
| Ononis viscosa | Ononis | Fabaceae | |
| Juniperus chinensis | Juniperus | Cupressaceae | |
| Echinops grijsii | Echinops | Asteraceae |
|
| Trapa japonica | Trapa | Lythraceae |
|
| Angelica gigas | Angelica | Apiaceae |
|
| Kopsia grandifolia | Kopsia | Apocynaceae | |
| Aloe vera | Aloe | Xanthorrhoeaceae |
|
| Cuphea hyssopifolia | Cuphea | Lythraceae |
|
| Ocimum tenuiflorum | Ocimum | Lamiaceae |
|
| Magnolia obovata | Magnolia | Magnoliaceae |
|
| Amomum villosum | Amomum | Zingiberaceae |
|
| Lemaireocereus griseus | Lemaireocereus | Cactaceae |
|
| Illicium difengpi | Illicium | Schisandraceae |
|
| Peltogyne porphyrocardia | Peltogyne | Fabaceae | |
| Ledebouria socialis | Ledebouria | Hyacinthaceae | |
| Firmiana simplex | Firmiana | Malvaceae |
|
| Diospyros peregrina | Diospyros | Ebenaceae |
|
| Lycopus europaeus | Lycopus | Lamiaceae |
|
| Diospyros elliptifolia | Diospyros | Ebenaceae | |
| Balanops australiana | Balanops | Balanopaceae | |
| Asarum heterotropoides | Asarum | Aristolochiaceae | |
| Holarrhena floribunda | Holarrhena | Apocynaceae |
|
| Dipterocarpus dyeri | Dipterocarpus | Dipterocarpaceae | |
| Waitzia acuminata | Waitzia | Asteraceae | |
| Atractylodes chinensis | Atractylodes | Asteraceae |
|
| Carum carvi | Carum | Apiaceae |
|
| Torilis japonica | Torilis | Apiaceae |
|
| Diospyros eriantha | Diospyros | Ebenaceae | |
| Alkanna cappadocica | Alkanna | Boraginaceae |
|
| Thymus quinquecostatus | Thymus | Lamiaceae |
|
| Ipomoea cairica | Ipomoea | Convolvulaceae |
|
| Artemisia dentata | Artemisia | Asteraceae | |
| Diospyros abyssinica | Diospyros | Ebenaceae |
|
| Garcinia xipshuanbannaensis | Garcinia | Clusiaceae |
|
| Farfugium japonicum | Farfugium | Asteraceae |
|
| Cratystylis conocephala | Cratystylis | Asteraceae | |
| Illicium verum | Illicium | Schisandraceae |
|
| Salvia hispanica | Salvia | Lamiaceae |
|
| Sedum sarmentosum | Sedum | Crassulaceae |
|
| Salvia broussonetii | Salvia | Lamiaceae | |
| Scorzonera pseudodivaricata | Scorzonera | Asteraceae | |
| Beaucarnea recurvata | Beaucarnea | Asparagaceae | |
| Rapanea lancifolia | Rapanea | Primulaceae | |
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Eria rigida | Eria | Orchidaceae | |
| Ononis vaginalis | Ononis | Fabaceae | |
| Gynoxys verrucosa | Gynoxys | Asteraceae | |
| Ceanothus velutinus | Ceanothus | Rhamnaceae |
|
| Mentha canadensis | Mentha | Lamiaceae |
|
| Humulus lupulus | Humulus | Cannabaceae |
|
| Garcinia scortechinii | Garcinia | Clusiaceae | |
| Caulerpa serrulata | Caulerpa | Caulerpaceae |
|
| Cryptotaenia japonica | Cryptotaenia | Apiaceae |
|
| Apollonias barbujana | Apollonias | Lauraceae | |
| Centaurea zuccariniana | Centaurea | Asteraceae | |
| Garcinia oligantha | Garcinia | Clusiaceae | |
| Phagnalon rupestre | Phagnalon | Asteraceae |
|
| Chlorophytum borivilianum | Chlorophytum | Asparagaceae |
|
| Leonurus persicus | Leonurus | Lamiaceae |
|
| Delphinium shawurense | Delphinium | Ranunculaceae | |
| Houttuynia cordata | Houttuynia | Saururaceae |
|
| Triunia erythrocarpa | Triunia | Proteaceae | |
| Vitex negundo | Vitex | Lamiaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Lathyrus nissolia | Lathyrus | Fabaceae |
|
| Aloe ferox | Aloe | Asphodelaceae |
|
| Amomum longiligulare | Amomum | Zingiberaceae |
|
| Bupleurum scorzonerifolium | Bupleurum | Apiaceae |
|
| Pelargonium x hortorum | Pelargonium | Geraniaceae |
|
| Magnolia denudata | Magnolia | Magnoliaceae |
|
| Hippophae rhamnoides | Hippophae | Elaeagnaceae |
|
| Chromolaena odorata | Chromolaena | Asteraceae |
|
| Gutierrezia lucida | Gutierrezia | Asteraceae | |
| Chloranthus fortunei | Chloranthus | Chloranthaceae | |
| Helichrysum graveolens | Helichrysum | Asteraceae | |
| Magnolia salicifolia | Magnolia | Magnoliaceae |
|
| Polyachyrus sphaerocephalus | Polyachyrus | Asteraceae | |
| Sandoricum koetjape | Sandoricum | Meliaceae |
|
| Boswellia carterii | Boswellia | Burseraceae |
|
| Suaeda maritima | Suaeda | Chenopodiaceae |
|
| Magnolia sieboldii | Magnolia | Magnoliaceae |
|
| Angelica sinensis | Angelica | Apiaceae |
|
| Oldenlandia diffusa | Oldenlandia | Rubiaceae |
|
| Pedicularis rex | Pedicularis | Orobanchaceae | |
| Cnidium monnieri | Cnidium | Apiaceae |
|
| Citrus medica | Citrus | Rutaceae |
|
| Iris spuria | Iris | Iridaceae |
|
| Scutellaria barbata | Scutellaria | Lamiaceae |
|
| Cephalaria leucantha | Cephalaria | Caprifoliaceae | |
| Atractylodes lancea | Atractylodes | Asteraceae |
|
| Eucalyptus hybrid | Eucalyptus | Myrtaceae | |
| Daucus carota | Daucus | Apiaceae |
|
| Amomum xanthioides | Amomum | Zingiberaceae |
|
| Capsicum annuum | Capsicum | Solanaceae |
|
| Isodon lophanthoides | Isodon | Lamiaceae |
|
| Pandanus tectorius | Pandanus | Pandanaceae |
|
| Codonopsis pilosula | Codonopsis | Campanulaceae |
|
| Euodia bodinieri | Euodia | Rutaceae | |
| Aconitum episcopale | Aconitum | Ranunculaceae | |
| Persea obovatifolia | Persea | Lauraceae | |
| Pittocaulon bombycophole | Pittocaulon | Asteraceae | |
| Euphorbia palustris | Euphorbia | Euphorbiaceae |
|
| Bidens andicola | Bidens | Asteraceae | |
| Piliostigma thonningii | Piliostigma | Fabaceae |
|
| Pluchea dioscoridis | Pluchea | Asteraceae |
|
| Benincasa hispida | Benincasa | Cucurbitaceae |
|
| Sorbus torminalis | Sorbus | Rosaceae |
|
| Ribes nigrum | Ribes | Grossulariaceae |
|
| Pinus sylvestris | Pinus | Pinaceae |
|
| Santalum album | Santalum | Santalaceae |
|
| Inula helenium | Inula | Asteraceae |
|
| Lycium chinense | Lycium | Solanaceae |
|
| Ilex affinis | Ilex | Aquifoliaceae |
|
| Fragaria vesca | Fragaria | Rosaceae |
|
| Agrimonia pilosa | Agrimonia | Rosaceae |
|
| Curcuma phaeocaulis | Curcuma | Zingiberaceae | |
| Liquidambar formosana | Liquidambar | Altingiaceae |
|
| Medicago sativa | Medicago | Fabaceae |
|
| Atalantia racemosa | Atalantia | Rutaceae |
|
| Anaxagorea clavata | Anaxagorea | Annonaceae | |
| Ligularia hodgsonii | Ligularia | Asteraceae |
|
| Abies alba | Abies | Pinaceae |
|
| Diplacus aurantiacus | Diplacus | Phrymaceae | |
| Schizonepeta tenuisfolia | Schizonepeta | Lamiaceae | |
| Magnolia biondii | Magnolia | Magnoliaceae |
|
| Melia azedarach | Melia | Meliaceae |
|
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Araiostegiella perdurans | Araiostegiella | Davalliaceae | |
| Pinellia ternata | Pinellia | Araceae |
|
| Magnolia kobus | Magnolia | Magnoliaceae |
|
| Thymus vulgaris | Thymus | Lamiaceae |
|
| Akebia quinata | Akebia | Lardizabalaceae |
|
| Citrus sinensis | Citrus | Rutaceae |
|
| Forsythia viridissima | Forsythia | Oleaceae |
|
| Tetradium ruticarpum | Tetradium | Rutaceae |
|
| Afraegle paniculata | Afraegle | Rutaceae |
|
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Cratoxylum pruniflorum | Cratoxylum | Hypericaceae |
|
| Lasianthus fordii | Lasianthus | Rubiaceae | |
| Zingiber officinale | Zingiber | Zingiberaceae |
|
| Mosla dianthera | Mosla | Lamiaceae |
|
| Panax quinquefolius | Panax | Araliaceae |
|
| Stenostomum lucidum | Stenostomum | Rubiaceae | |
| Beyeria brevifolia | Beyeria | Euphorbiaceae | |
| Atractylodes macrocephala | Atractylodes | Asteraceae |
|
| Plantago major | Plantago | Plantaginaceae |
|
| Punica granatum | Punica | Lythraceae |
|
| Forsythia suspensa | Forsythia | Oleaceae |
|
| Anethum graveolens | Anethum | Apiaceae |
|
| Crinum giganteum | Crinum | Amaryllidaceae | |
| Titanotrichum oldhamii | Titanotrichum | Gesneriaceae | |
| Citrus trifoliata | Citrus | Rutaceae |
|
| Buddleja cordata | Buddleja | Scrophulariaceae | |
| Panax notoginseng | Panax | Araliaceae |
|
| Cnidium officinale | Cnidium | Apiaceae |
|
| Kaempferia pulchra | Kaempferia | Zingiberaceae |
|
| Pyrola rotundifolia | Pyrola | Ericaceae |
|
| Hylocomium splendens | Hylocomium | Hylocomiaceae | |
| Bombax ceiba | Bombax | Malvaceae |
|
| Atractylodes macrocephala koidz | Atractylodes | Asteraceae | |
| Drosera peltata | Drosera | Droseraceae |
|
| Curcuma kwangsiensis | Curcuma | Zingiberaceae |
|
| Cyperus rotundus | Cyperus | Cyperaceae |
|
| Ammodendron karelinii | Ammodendron | Fabaceae | |
| Bistorta officinalis | Bistorta | Polygonaceae |
|
| Mentha arvensis | Mentha | Lamiaceae |
|
| Cassinia subtropica | Cassinia | Asteraceae | |
| Lycium barbarum | Lycium | Solanaceae |
|
| Coriandrum sativum | Coriandrum | Apiaceae |
|
| Arnica nevadensis | Arnica | Asteraceae | |
| Elsholtzia splendens | Elsholtzia | Lamiaceae |
|
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Odixia angusta | Odixia | Asteraceae | |
| Millettia erythrocalyx | Millettia | Fabaceae |
|
| Buglossoides arvensis | Buglossoides | Boraginaceae |
|
| Prunus laurocerasus | Prunus | Rosaceae |
|
| Girgensohnia diptera | Girgensohnia | Chenopodiaceae | |
| Millettia laurentii | Millettia | Fabaceae |
|
| Alcea rosea | Alcea | Malvaceae |
|
| Curcuma longa | Curcuma | Zingiberaceae |
|
| Ficus formosana | Ficus | Moraceae |
|
| Juniperus rigida var. conferta | Juniperus | Cupressaceae |
|
| Dipterocarpus alatus | Dipterocarpus | Dipterocarpaceae |
|
| Aconitum violaceum | Aconitum | Ranunculaceae |
|
| Echinops amplexicaulis | Echinops | Asteraceae |
|
| Hansenia forbesii | Hansenia | Apiaceae | |
| Quercus aegilops | Quercus | Fagaceae |
|
| Chloranthus tianmushanensis | Chloranthus | Chloranthaceae | |
| Prosopis glandulosa | Prosopis | Fabaceae |
|
| Aria pallescens | Aria | Rosaceae | |
| Simira eliezeriana | Simira | Rubiaceae | |
| Senecio squalidus | Senecio | Asteraceae |
|
| Araujia sericifera | Araujia | Apocynaceae |
|
| Artemisia princeps | Artemisia | Asteraceae |
|
| Centaurea benedicta | Centaurea | Asteraceae |
|
| Artemisia monogyna | Artemisia | Asteraceae | |
| Magnolia sprengeri | Magnolia | Magnoliaceae |
|
| Hoffmannia strigillosa | Hoffmannia | Rubiaceae | |
| Epaltes gariepina | Epaltes | Asteraceae | |
| Seriphidium cinum | Seriphidium | Asteraceae |
|
| Dendrosenecio kilimanjari | Dendrosenecio | Asteraceae | |
| Isodon kameba | Isodon | Lamiaceae |
|
| Pterocarpus grandiflorus | Pterocarpus | Fabaceae | |
| Citrus reticulata | Citrus | Rutaceae |
|
| Chromolaena pulchella | Chromolaena | Asteraceae | |
| Bursaria spinosa | Bursaria | Pittosporaceae |
|
| Taxodium mucronatum | Taxodium | Cupressaceae |
|
| Bunium paucifolium | Bunium | Apiaceae | |
| Spatholobus suberectus | Spatholobus | Fabaceae |
|
| Gardenia fosbergii | Gardenia | Rubiaceae | |
| Posidonia oceanica | Posidonia | Posidoniaceae | |
| Acorus calamus | Acorus | Acoraceae |
|
| Vitex madiensis | Vitex | Lamiaceae |
|
| Erysimum odoratum | Erysimum | Brassicaceae | |
| Heterotheca inuloides | Heterotheca | Asteraceae |
|
| Delphinium andersoni | Delphinium | Ranunculaceae | |
| Saussurea costus | Saussurea | Asteraceae |
|
| Vaccinium vitis-idaea | Vaccinium | Ericaceae |
|
| Vismia jefensis | Vismia | Hypericaceae | |
| Angelica tarokoensis | Angelica | Apiaceae | |
| Agnorhiza bolanderi | Agnorhiza | Asteraceae | |
| Swertia delavayi | Swertia | Gentianaceae | |
| Epimedium davidii | Epimedium | Berberidaceae |
|
| Globba malaccensis | Globba | Zingiberaceae |
|
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Diphasia angolensis | Diphasia | Rutaceae | |
| Knightia excelsa | Knightia | Proteaceae |
|
| Isodon japonicus | Isodon | Lamiaceae |
|
| Solanum acaule | Solanum | Solanaceae | |
| Frullania tamarisci | Frullania | Frullaniaceae | |
| Agastache rugosa | Agastache | Lamiaceae |
|
| Alangium premnifolium | Alangium | Cornaceae | |
| Bistorta manshuriensis | Bistorta | Polygonaceae | |
| Saussurea carthamoides | Saussurea | Asteraceae | |
| Galenia africana | Galenia | Aizoaceae |
|
| Polanisia trachysperma | Polanisia | Cleomaceae |
|
| Micromeria pineolens | Micromeria | Lamiaceae | |
| Gnidia lamprantha | Gnidia | Thymelaeaceae |
|
| Artemisia annua | Artemisia | Asteraceae |
|
| Ilex amara | Ilex | Aquifoliaceae | |
| Bowdichia virgilioides | Bowdichia | Fabaceae |
|
| Leonurus glaucescens | Leonurus | Lamiaceae |
|
| Rhododendron micranthum | Rhododendron | Ericaceae |
|
| Eupatorium rebaudianum | Eupatorium | Asteraceae |
|
| Salacia madagascariensis | Salacia | Celastraceae |
|
| Maba buxifolia | Maba | Ebenaceae |
|
| Monodora tenuifolia | Monodora | Annonaceae |
|
| Chuquiraga erinacea | Chuquiraga | Asteraceae | |
| Murraya paniculata | Murraya | Rutaceae |
|
| Centaurea cheiranthifolia | Centaurea | Asteraceae | |
| Solanum boerhaavii | Solanum | Solanaceae | |
| Citrus maxima | Citrus | Rutaceae |
|
| Sideritis lanata | Sideritis | Lamiaceae | |
| Lamprolobium fruticosum | Lamprolobium | Fabaceae | |
| Coleus wulfenioides | Coleus | Lamiaceae | |
| Erythrina burttii | Erythrina | Fabaceae |
|
| Mikania grazielae | Mikania | Asteraceae | |
| Mentha pulegium | Mentha | Lamiaceae |
|
| Polygala senega | Polygala | Polygalaceae |
|
| Laggera aurita | Laggera | Asteraceae |
|
| Viola hondoensis | Viola | Violaceae | |
| Mimusops laurifolia | Mimusops | Sapotaceae |
|
| Bursera simaruba | Bursera | Burseraceae |
|
| Rubus pungens | Rubus | Rosaceae |
|
| Delphinium denudatum | Delphinium | Ranunculaceae |
|
| Salvia pisidica | Salvia | Lamiaceae |
|
| Pinus pumila | Pinus | Pinaceae |
|
| Piper callosum | Piper | Piperaceae |
|
| Gyrothyra underwoodiana | Gyrothyra | Gyrothyraceae | |
| Pentachondra pumila | Pentachondra | Ericaceae |
|
| Dianella revoluta | Dianella | Xanthorrhoeaceae |
|
| Tamarix gallica | Tamarix | Tamaricaceae |
|
| Ursinia speciosa | Ursinia | Asteraceae | |
| Anacyclus pyrethrum | Anacyclus | Asteraceae |
|
| Poterium sanguisorba | Poterium | Rosaceae |
|
| Hardwickia pinnata | Hardwickia | Fabaceae | |
| Brachylaena perrieri | Brachylaena | Asteraceae | |
| Salvia dichroa | Salvia | Lamiaceae | |
| Valeriana jatamansii | Valeriana | Caprifoliaceae |
|
| Diplotropis ferruginea | Diplotropis | Fabaceae | |
| Platycladus orientalis | Platycladus | Cupressaceae |
|
| Senna alexandrina | Senna | Fabaceae |
|
| Phlomis ostrowskiana | Phlomis | Lamiaceae | |
| Artemisia argyi | Artemisia | Asteraceae |
|
| Foeniculum vulgare | Foeniculum | Apiaceae |
|
| Daphnandra johnsonii | Daphnandra | Atherospermataceae | |
| Uncaria longiflora | Uncaria | Rubiaceae |
|
| Colchicum arenarium | Colchicum | Colchicaceae | |
| Pimpinella peregrina | Pimpinella | Apiaceae |
|
| Cladanthus arabicus | Cladanthus | Asteraceae | |
| Aloe spicata | Aloe | Asphodelaceae |
|
| Kokoona ochracea | Kokoona | Celastraceae |
|
| Medicosma fareana | Medicosma | Rutaceae | |
| Solanum crinitum | Solanum | Solanaceae | |
| Phyllanthus emblica | Phyllanthus | Phyllanthaceae |
|
| Mentha sylvestris | Mentha | Lamiaceae |
|
| Euphrasia regelii | Euphrasia | Orobanchaceae |
|
| Hortonia angustifolia | Hortonia | Monimiaceae | |
| Astragalus glycyphyllos | Astragalus | Fabaceae |
|
| Athrixia elata | Athrixia | Asteraceae |
|
| Mentha incana | Mentha | Lamiaceae | |
| Adina trichotoma | Adina | Rubiaceae | |
| Julbernardia globifera | Julbernardia | Fabaceae | |
| Hippeastrum aulicum | Hippeastrum | Amaryllidaceae | |
| Phlox decussata | Phlox | Polemoniaceae | |
| Isodon rubescens | Isodon | Lamiaceae | |
| Tubocapsicum anomalum | Tubocapsicum | Solanaceae |
|
| Sesbania punicea | Sesbania | Fabaceae | |
| Cuscuta australis | Cuscuta | Convolvulaceae |
|
| Aster tataricus | Aster | Asteraceae |
|
| Salvia lanigera | Salvia | Lamiaceae |
|
| Othonna macrophylla | Othonna | Asteraceae | |
| Miliusa balansae | Miliusa | Annonaceae | |
| Eucalyptus viminalis | Eucalyptus | Myrtaceae |
|
| Laggera pterodonta | Laggera | Asteraceae |
|
| Acronychia haplophylla | Acronychia | Rutaceae |
|
| Salix petiolaris | Salix | Salicaceae | |
| Scutellaria baicalensis | Scutellaria | Lamiaceae |
|
| Pinus monticola | Pinus | Pinaceae |
|
| Piper nigrum | Piper | Piperaceae |
|
| Myrrhis odorata | Myrrhis | Apiaceae |
|
| Ericameria laricifolia | Ericameria | Asteraceae | |
| Cissus quadrangularis | Cissus | Vitaceae |
|
| Quercus sessiliflora | Quercus | Fagaceae | |
| Tinospora hainanensis | Tinospora | Menispermaceae |
|
| Litsea cubeba | Litsea | Lauraceae |
|
| Panax ginseng | Panax | Araliaceae |
|
| Ormosia fordiana | Ormosia | Fabaceae | |
| Angelica acutiloba | Angelica | Apiaceae |
|
| Loranthus longiflorus | Loranthus | Loranthaceae |
|
| Oplopanax elatus | Oplopanax | Araliaceae |
|
| Callistemon speciosus | Callistemon | Myrtaceae | |
| Bupleurum chinense | Bupleurum | Apiaceae |
|
| Kokoona reflexa | Kokoona | Celastraceae | |
| Ostericum grosseserratum | Ostericum | Apiaceae |
|
| Echinopsis radix | Echinopsis | Cactaceae | |
| Aloe africana | Aloe | Xanthorrhoeaceae |
|
| Mentha haplocalyx | Mentha | Lamiaceae |
|
| Bupleurum falcatum | Bupleurum | Apiaceae |
|
| Citrus limon | Citrus | Rutaceae |
|
| Agastache rugosus | Agastache | Lamiaceae |
|
| Viguiera decurrens | Viguiera | Asteraceae |
|
| Wrightia tinctoria | Wrightia | Apocynaceae |
|
| Aconitum leucostomum | Aconitum | Ranunculaceae |
|
| Alpinia flabellata | Alpinia | Zingiberaceae |
|
| Eleutherococcus giraldii | Eleutherococcus | Araliaceae | |
| Sideritis brevibracteata | Sideritis | Lamiaceae |
|
| Smallanthus glabratus | Smallanthus | Asteraceae | |
| Ardisia arborescens | Ardisia | Primulaceae |
|
| Maesa ramentacea | Maesa | Primulaceae |
|
| Syzygium aromaticum | Syzygium | Myrtaceae |
|
| Aquilegia ecalcarata | Aquilegia | Ranunculaceae |
|
| Veronica anagallis | Veronica | Plantaginaceae |
|
| Homalomena occulta | Homalomena | Araceae |
|
| Euphorbia cornigera | Euphorbia | Euphorbiaceae | |
| Fouquieria diguetii | Fouquieria | Fouquieriaceae | |
| Asterolasia squamuligera | Asterolasia | Rutaceae | |
| Magnolia officinalis | Magnolia | Magnoliaceae |
|
| Hypericum perforatum | Hypericum | Hypericaceae |
|
| Fagraea gracilipes | Fagraea | Gentianaceae |
|
| Allium macrostemon | Allium | Amaryllidaceae |
|
| Persea mexicana | Persea | Lauraceae | |
| Lindera aggregata | Lindera | Lauraceae | |
| Centaurea arenaria | Centaurea | Asteraceae | |
| Acacia simplicifolia | Acacia | Fabaceae | |
| Euodia officinalis | Euodia | Rutaceae | |
| Salvia yosgadensis | Salvia | Lamiaceae | |
| Traversia baccharoides | Traversia | Asteraceae | |
| Scorzonera hispanica | Scorzonera | Asteraceae |
|
| Catha edulis | Catha | Celastraceae |
|
| Myristica fragrans | Myristica | Myristicaceae |
|
| Sideroxylon cubense | Sideroxylon | Sapotaceae | |
| Citrus natsudaidai | Citrus | Rutaceae |
|
| Zanthoxylum bungeanum | Zanthoxylum | Rutaceae |
|
| Tetradenia glauca | Tetradenia | Lamiaceae | |
| Citrus x paradisi | Citrus | Rutaceae |
|
| Campsis flos | Campsis | Bignoniaceae | |
| Cinnamomum tenuifolium | Cinnamomum | Lauraceae |
|
| Lepidium draba | Lepidium | Brassicaceae |
|
| Eupatorium fortunei turcz | Eupatorium | Asteraceae | |
| Catharanthus roseus | Catharanthus | Apocynaceae |
|
| Crambe tatarica | Crambe | Brassicaceae |
|
| Salvia officinalis | Salvia | Lamiaceae |
|
| Chamaecyparis pisifera | Chamaecyparis | Cupressaceae |
|
| Asarum sieboldii | Asarum | Aristolochiaceae |
|
| Iryanthera paraensis | Iryanthera | Myristicaceae |
|
| Gutenbergia cordifolia | Gutenbergia | Asteraceae |
|
| Pinus strobus | Pinus | Pinaceae |
|
| Pinus bungeana | Pinus | Pinaceae |
|
| Euphorbia pithyusa | Euphorbia | Euphorbiaceae | |
| Securidaca inappendiculata | Securidaca | Polygalaceae |
|
| Alpinia blepharocalyx | Alpinia | Zingiberaceae |
|
| Eucalyptus jenseni | Eucalyptus | Myrtaceae | |
| Gardenia tubifera | Gardenia | Rubiaceae |
|
| Citrus aurantium | Citrus | Rutaceae |
|
| Pteris prolifera | Pteris | Pteridaceae | |
| Rubus trifidus | Rubus | Rosaceae |
|
| Panax innovans | Panax | Araliaceae | |
| Salacia lehmbachii | Salacia | Celastraceae |
|
| Elettaria cardamomum | Elettaria | Zingiberaceae |
|
| Fritillaria hupehensis | Fritillaria | Liliaceae |
|
| Curcuma zedoaria | Curcuma | Zingiberaceae |
|
| Pluchea odorata | Pluchea | Asteraceae | |
| Blumea mollis | Blumea | Asteraceae |
|
| Nauclea parva | Nauclea | Rubiaceae | |
| Schisandra chinensis | Schisandra | Schisandraceae |
|
| Cinnamomum aromaticum | Cinnamomum | Lauraceae |
|
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
| Euodia ruticarpa | Euodia | Rutaceae | |
| Allium chinense | Allium | Amaryllidaceae |
|
| Uvaria microcarpa | Uvaria | Annonaceae |
|
| Magnolia officinalis rehd et wils | Magnolia | Magnoliaceae | |
| Euonymus tingens | Euonymus | Celastraceae |
|
| Citrus junos | Citrus | Rutaceae |
|
| Angelica japonica | Angelica | Apiaceae |
|
| Podocarpus elatus | Podocarpus | Podocarpaceae |
|
| Perilla frutescens | Perilla | Lamiaceae |
|
| Zanthoxylum schinifolium | Zanthoxylum | Rutaceae |
|
| Schizonepeta tenuifolia | Schizonepeta | Lamiaceae |
|
| Glehnia littoralis | Glehnia | Apiaceae |
|
| Pteris semipinnata | Pteris | Pteridaceae | |
| Cousinia canescens | Cousinia | Asteraceae | |
| Cnidium monieri | Cnidium | Apiaceae | |
| Lathyrus latifolius | Lathyrus | Fabaceae |
|
| Syzygium cumini | Syzygium | Myrtaceae |
|
| Fritillaria ningguoensis | Fritillaria | Liliaceae |
|
| Jacobaea argunensis | Jacobaea | Asteraceae | |
| Crocus sativus | Crocus | Iridaceae |
|
| Pterocarpus erinaceus | Pterocarpus | Fabaceae |
|
| Phyllodium pulchellum | Phyllodium | Fabaceae |
|
| Mikania scandens | Mikania | Asteraceae |
|
| Pinus brutia var. eldarica | Pinus | Pinaceae |
|
| Teucrium scorodonia | Teucrium | Lamiaceae |
|
| Cotylelobium scabriusculum | Cotylelobium | Dipterocarpaceae |
Ingredient ID: NPC71258
Formula: C17H22O3
Ingredient ID: NPC71258
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC(=O)O[C@H]1C/C(=C/Cc2c(CC(=C1)C)occ2C)/C |
| Standard InCHI | InChI=1S/C17H22O3/c1-11-5-6-16-13(3)10-19-17(16)9-12(2)8-15(7-11)20-14(4)18/h5,8,10,15H,6-7,9H2,1-4H3/b11-5+,12-8?/t15-/m0/s1 |
| Standard InCHIKey | VIAGREYUICSQGX-APQLGWMJSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD215890] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC70271
Formula: C15H18O2
Ingredient ID: NPC70271
| Common Name | n.a. |
| IUPAC Name | (5S,6S)-6-ethenyl-3,6-dimethyl-5-prop-1-en-2-yl-5,7-dihydro-1-benzofuran-4-one |
| Canonical SMILES | C=C[C@]1(C)Cc2occ(c2C(=O)[C@H]1C(=C)C)C |
| Standard InCHI | InChI=1S/C15H18O2/c1-6-15(5)7-11-12(10(4)8-17-11)14(16)13(15)9(2)3/h6,8,13H,1-2,7H2,3-5H3/t13-,15-/m1/s1 |
| Standard InCHIKey | ZVMJXSJCBLRAPD-UKRRQHHQSA-N |
| Ingredient External Links |
PubChem CID: 10376566 ZINC ID: ZINC000013412803 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Angelica genuflexa | Angelica | Apiaceae |
|
| Commiphora myrrha | Commiphora | Burseraceae |
|
| Curcuma zedoaria | Curcuma | Zingiberaceae |
|
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC45947
Formula: C15H18O3
Ingredient ID: NPC45947
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C[C@@H]1C[C@@H]2O[C@H]2C(=C)Cc2c(C(=O)C1)c(C)co2 |
| Standard InCHI | InChI=1S/C15H18O3/c1-8-4-11(16)14-10(3)7-17-12(14)6-9(2)15-13(5-8)18-15/h7-8,13,15H,2,4-6H2,1,3H3/t8-,13-,15-/m0/s1 |
| Standard InCHIKey | DHQZOOQNUWHCML-IIRLODAESA-N |
| Ingredient External Links |
PubChem CID: 10444597 ZINC ID: ZINC000013456540 ChEMBL ID: CHEMBL484254 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC45947] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Angelica genuflexa | Angelica | Apiaceae |
|
| Commiphora myrrha | Commiphora | Burseraceae |
|
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC45655
Formula: C15H16O2
Ingredient ID: NPC45655
| Common Name | n.a. |
| IUPAC Name | (8S)-1,5,8-trimethyl-8,9-dihydro-7H-benzo[e][1]benzofuran-6-one |
| Canonical SMILES | C[C@@H]1CC(=O)c2c(C1)c1c(C)coc1cc2C |
| Standard InCHI | InChI=1S/C15H16O2/c1-8-4-11-14(12(16)5-8)9(2)6-13-15(11)10(3)7-17-13/h6-8H,4-5H2,1-3H3/t8-/m0/s1 |
| Standard InCHIKey | SHEOKDCVBGTHJG-QMMMGPOBSA-N |
| Ingredient External Links |
PubChem CID: 71349601 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD181921] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Angelica genuflexa | Angelica | Apiaceae |
|
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC31238
Formula: C15H20O3
Ingredient ID: NPC31238
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O[C@H]1CC(=C)[C@@H]2[C@@](C1)(C)C[C@H]1C(=C(C(=O)O1)C)C2 |
| Standard InCHI | InChI=1S/C15H20O3/c1-8-4-10(16)6-15(3)7-13-11(5-12(8)15)9(2)14(17)18-13/h10,12-13,16H,1,4-7H2,2-3H3/t10-,12+,13-,15+/m0/s1 |
| Standard InCHIKey | VPOHGVWBUPKXAL-QMPIGLIWSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD74245] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC303304
Formula: C16H20O3
Ingredient ID: NPC303304
| Common Name | n.a. |
| IUPAC Name | (6S,7R,8E)-7-methoxy-3,6-dimethyl-10-methylidene-5,6,7,11-tetrahydrocyclodeca[b]furan-4-one |
| Canonical SMILES | CO[C@H]1/C=C/C(=C)Cc2c(C(=O)C[C@@H]1C)c(C)co2 |
| Standard InCHI | InChI=1S/C16H20O3/c1-10-5-6-14(18-4)11(2)8-13(17)16-12(3)9-19-15(16)7-10/h5-6,9,11,14H,1,7-8H2,2-4H3/b6-5+/t11-,14-/m0/s1 |
| Standard InCHIKey | KYVMPRMAGALGDM-CCJKYYKNSA-N |
| Ingredient External Links |
PubChem CID: 10923274 ZINC ID: ZINC000101528276 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Angelica genuflexa | Angelica | Apiaceae |
|
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC29652
Formula: C15H18O2
Ingredient ID: NPC29652
| Common Name | n.a. |
| IUPAC Name | (5E,9E)-3,6,10-trimethyl-8,11-dihydro-7H-cyclodeca[b]furan-4-one |
| Canonical SMILES | C/C/1=CC(=O)c2c(C/C(=C/CC1)/C)occ2C |
| Standard InCHI | InChI=1S/C15H18O2/c1-10-5-4-6-11(2)8-14-15(13(16)7-10)12(3)9-17-14/h6-7,9H,4-5,8H2,1-3H3/b10-7+,11-6+ |
| Standard InCHIKey | XVOHELPNOXGRBQ-NXAIOARDSA-N |
| Ingredient External Links |
PubChem CID: 6506548 ZINC ID: ZINC000100898573 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Ligularia macrophylla | Ligularia | Asteraceae | |
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Curcuma phaeocaulis | Curcuma | Zingiberaceae | |
| Curcuma kwangsiensis | Curcuma | Zingiberaceae |
|
| Curcuma longa | Curcuma | Zingiberaceae |
|
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Traversia baccharoides | Traversia | Asteraceae | |
| Curcuma zedoaria | Curcuma | Zingiberaceae |
|
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC292967
Formula: C15H26O2
Ingredient ID: NPC292967
| Common Name | n.a. |
| IUPAC Name | (1S,5R,6R)-5-[(2R)-2-hydroxybutan-2-yl]-2-methyl-6-(2-methylprop-1-enyl)cyclohex-2-en-1-ol |
| Canonical SMILES | CC[C@]([C@@H]1CC=C([C@H]([C@@H]1C=C(C)C)O)C)(O)C |
| Standard InCHI | InChI=1S/C15H26O2/c1-6-15(5,17)13-8-7-11(4)14(16)12(13)9-10(2)3/h7,9,12-14,16-17H,6,8H2,1-5H3/t12-,13-,14-,15-/m1/s1 |
| Standard InCHIKey | CJDZRSPYLGEJSX-KBUPBQIOSA-N |
| Ingredient External Links |
PubChem CID: 11843778 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD37930] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC289764
Formula: C30H60
Ingredient ID: NPC289764
| Common Name | n.a. |
| IUPAC Name | triacont-1-ene |
| Canonical SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCCCCC=C |
| Standard InCHI | InChI=1S/C30H60/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3H,1,4-30H2,2H3 |
| Standard InCHIKey | WMZHDICSCDKPFS-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 87639 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD6828] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC262766
Formula: C15H18O4
Ingredient ID: NPC262766
| Common Name | n.a. |
| IUPAC Name | (3aS,5S,8S)-3a-hydroxy-1,5,8-trimethyl-5,7,8,9-tetrahydro-4H-benzo[e][1]benzofuran-2,6-dione |
| Canonical SMILES | C[C@@H]1CC(=O)C2=C(C1)C1=C(C)C(=O)O[C@]1(C[C@@H]2C)O |
| Standard InCHI | InChI=1S/C15H18O4/c1-7-4-10-12(11(16)5-7)8(2)6-15(18)13(10)9(3)14(17)19-15/h7-8,18H,4-6H2,1-3H3/t7-,8-,15-/m0/s1 |
| Standard InCHIKey | GOVDXHQBFLNYLG-VQLIFVOLSA-N |
| Ingredient External Links |
PubChem CID: 42636912 ZINC ID: ZINC000070451211 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC257124
Formula: C10H12O2
Ingredient ID: NPC257124
| Common Name | Eugenol |
| IUPAC Name | 2-methoxy-4-prop-2-enylphenol |
| Canonical SMILES | C=CCc1ccc(c(c1)OC)O |
| Standard InCHI | InChI=1S/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3,5-7,11H,1,4H2,2H3 |
| Standard InCHIKey | RRAFCDWBNXTKKO-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 3314 ChEMBL ID: CHEMBL42710 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD45145] Database: NPASS [NPC257124] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper attenuatum | Piper | Piperaceae |
|
| Artemisia montana | Artemisia | Asteraceae |
|
| Artemisia hanseniana | Artemisia | Asteraceae | |
| Caesalpinia bonducella | Caesalpinia | Fabaceae |
|
| Cistanche deserticola | Cistanche | Orobanchaceae |
|
| Asteriscus aquaticus | Asteriscus | Asteraceae | |
| Cinnamomum subavenium | Cinnamomum | Lauraceae |
|
| Artemisia capillaris | Artemisia | Asteraceae |
|
| Piper cubeba | Piper | Piperaceae |
|
| Akebia trifoliata | Akebia | Lardizabalaceae |
|
| Pseudowintera colorata | Pseudowintera | Winteraceae | |
| Arnebia euchroma | Arnebia | Boraginaceae |
|
| Kopsia grandifolia | Kopsia | Apocynaceae | |
| Strophanthus sarmentosus var. senegambiae | Strophanthus | Apocynaceae | |
| Phebalium dentatum | Phebalium | Rutaceae | |
| Ecballium elaterium | Ecballium | Cucurbitaceae |
|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Lithospermum erythrorhizon | Lithospermum | Boraginaceae |
|
| Capparis ovata | Capparis | Capparaceae |
|
| Croton montevidensis | Croton | Euphorbiaceae | |
| Illicium difengpi | Illicium | Schisandraceae |
|
| Ledebouria socialis | Ledebouria | Hyacinthaceae | |
| Murraya exotica | Murraya | Rutaceae |
|
| Datisca glomerata | Datisca | Datiscaceae | |
| Lycopus europaeus | Lycopus | Lamiaceae |
|
| Artemisia jacutica | Artemisia | Asteraceae | |
| Quercus imbricaria | Quercus | Fagaceae |
|
| Dipterocarpus dyeri | Dipterocarpus | Dipterocarpaceae | |
| Dioscorea olfersiana | Dioscorea | Dioscoreaceae |
|
| Cornus officinalis | Cornus | Cornaceae |
|
| Cassine papillosa | Cassine | Celastraceae |
|
| Siphonostegia chinensis | Siphonostegia | Orobanchaceae |
|
| Thymus quinquecostatus | Thymus | Lamiaceae |
|
| Ipomoea cairica | Ipomoea | Convolvulaceae |
|
| Rhodomyrtus tomentosa | Rhodomyrtus | Myrtaceae |
|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Magnolia liliiflora | Magnolia | Magnoliaceae | |
| Coptis japonica | Coptis | Ranunculaceae |
|
| Ceanothus velutinus | Ceanothus | Rhamnaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Mentha canadensis | Mentha | Lamiaceae |
|
| Humulus lupulus | Humulus | Cannabaceae |
|
| Garcinia scortechinii | Garcinia | Clusiaceae | |
| Uncaria macrophylla | Uncaria | Rubiaceae |
|
| Apollonias barbujana | Apollonias | Lauraceae | |
| Chlorophytum borivilianum | Chlorophytum | Asparagaceae |
|
| Bersama abyssinica | Bersama | Melianthaceae |
|
| Vitex negundo | Vitex | Lamiaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Prunus persica | Prunus | Rosaceae |
|
| Rumex obtusifolius | Rumex | Polygonaceae |
|
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Artemisia afra | Artemisia | Asteraceae |
|
| Actaea dahurica | Actaea | Ranunculaceae |
|
| Zea mays | Zea | Poaceae |
|
| Actaea cimicifuga | Actaea | Ranunculaceae |
|
| Scutellaria barbata | Scutellaria | Lamiaceae |
|
| Daucus carota | Daucus | Apiaceae |
|
| Isodon lophanthoides | Isodon | Lamiaceae |
|
| Elsholtzia bodinieri | Elsholtzia | Lamiaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Aconitum sajanense | Aconitum | Ranunculaceae | |
| Fragaria vesca | Fragaria | Rosaceae |
|
| Mosla chinensis | Mosla | Lamiaceae |
|
| Rosa chinensis | Rosa | Rosaceae |
|
| Solanum torvum | Solanum | Solanaceae |
|
| Diospyros kaki | Diospyros | Ebenaceae |
|
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Artemisia scoparia | Artemisia | Asteraceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Pinellia ternata | Pinellia | Araceae |
|
| Podocarpus elongata | Podocarpus | Podocarpaceae | |
| Strychnos triplinervia | Strychnos | Loganiaceae |
|
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Thymus vulgaris | Thymus | Lamiaceae |
|
| Akebia quinata | Akebia | Lardizabalaceae |
|
| Palicourea alpina | Palicourea | Rubiaceae | |
| Lupinus formosus | Lupinus | Fabaceae | |
| Wunderlichia mirabilis | Wunderlichia | Asteraceae | |
| Posoqueria latifolia | Posoqueria | Rubiaceae |
|
| Dicliptera riparia | Dicliptera | Acanthaceae |
|
| Oxandra xylopioides | Oxandra | Annonaceae | |
| Phyllanthus oligospermus | Phyllanthus | Phyllanthaceae | |
| Arnebia guttata | Arnebia | Boraginaceae |
|
| Ocimum basilicum | Ocimum | Lamiaceae |
|
| Lasianthus fordii | Lasianthus | Rubiaceae | |
| Ilex kaushue | Ilex | Aquifoliaceae |
|
| Zingiber officinale | Zingiber | Zingiberaceae |
|
| Dalbergia frutescens | Dalbergia | Fabaceae | |
| Colchicum macedonicum | Colchicum | Colchicaceae | |
| Euphorbia caducifolia | Euphorbia | Euphorbiaceae |
|
| Boronia muelleri | Boronia | Rutaceae | |
| Coprosma acerosa | Coprosma | Rubiaceae |
|
| Astilbe koreana | Astilbe | Saxifragaceae | |
| Scrophularia smithii | Scrophularia | Scrophulariaceae | |
| Artemisia dracunculus | Artemisia | Asteraceae |
|
| Eupatorium fortunei | Eupatorium | Asteraceae |
|
| Elsholtzia ciliata | Elsholtzia | Lamiaceae |
|
| Anethum graveolens | Anethum | Apiaceae |
|
| Hypericum papuanum | Hypericum | Hypericaceae |
|
| Zilla spinosa | Zilla | Brassicaceae |
|
| Cnidium officinale | Cnidium | Apiaceae |
|
| Kaunia arbuscularis | Kaunia | Asteraceae | |
| Trifolium pratense | Trifolium | Fabaceae |
|
| Sambucus ebulus | Sambucus | Adoxaceae |
|
| Ficus carica | Ficus | Moraceae |
|
| Inula thapsoides | Inula | Asteraceae | |
| Tylophora flava | Tylophora | Apocynaceae | |
| Limeum pterocarpum | Limeum | Limeaceae | |
| Coptis omeiensis | Coptis | Ranunculaceae |
|
| Trifolium alexandrium | Trifolium | Fabaceae |
|
| Coptis deltoidea | Coptis | Ranunculaceae |
|
| Cassia carnaval | Cassia | Fabaceae | |
| Salix sieboldiana | Salix | Salicaceae | |
| Bistorta officinalis | Bistorta | Polygonaceae |
|
| Mentha arvensis | Mentha | Lamiaceae |
|
| Camellia saluenensis | Camellia | Theaceae |
|
| Elsholtzia splendens | Elsholtzia | Lamiaceae |
|
| Alpinia officinarum | Alpinia | Zingiberaceae |
|
| Paeonia veitchii | Paeonia | Paeoniaceae |
|
| Dillenia papuana | Dillenia | Dilleniaceae | |
| Polyalthia nemoralis | Polyalthia | Annonaceae |
|
| Achillea millefolium | Achillea | Asteraceae |
|
| Nepeta cataria | Nepeta | Lamiaceae |
|
| Artemisia princeps | Artemisia | Asteraceae |
|
| Ocimum gratissimum | Ocimum | Lamiaceae |
|
| Acorus calamus | Acorus | Acoraceae |
|
| Solanum andigena | Solanum | Solanaceae | |
| Chaenomeles sinensis | Chaenomeles | Rosaceae |
|
| Agastache rugosa | Agastache | Lamiaceae |
|
| Bistorta manshuriensis | Bistorta | Polygonaceae | |
| Piper betle | Piper | Piperaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Actaea simplex | Actaea | Ranunculaceae | |
| Achillea moschata | Achillea | Asteraceae | |
| Jacaranda caucana | Jacaranda | Bignoniaceae | |
| Senna alexandrina | Senna | Fabaceae |
|
| Morus alba | Morus | Moraceae |
|
| Artemisia argyi | Artemisia | Asteraceae |
|
| Foeniculum vulgare | Foeniculum | Apiaceae |
|
| Bowdichia nitida | Bowdichia | Fabaceae | |
| Phyllanthus emblica | Phyllanthus | Phyllanthaceae |
|
| Eschweilera coriacea | Eschweilera | Lecythidaceae |
|
| Prunus mume | Prunus | Rosaceae |
|
| Piper nigrum | Piper | Piperaceae |
|
| Artemisia coerulescens | Artemisia | Asteraceae | |
| Coptis teeta | Coptis | Ranunculaceae |
|
| Litsea cubeba | Litsea | Lauraceae |
|
| Panax ginseng | Panax | Araliaceae |
|
| Cranfillia vulcanica | Cranfillia | Blechnaceae | |
| Bupleurum chinense | Bupleurum | Apiaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Laurus nobilis | Laurus | Lauraceae |
|
| Andrographis herba | Andrographis | Acanthaceae | |
| Magnolia liliflora | Magnolia | Magnoliaceae |
|
| Eugenia caryopyhllata | Eugenia | Myrtaceae | |
| Artemisia capillaries | Artemisia | Asteraceae | |
| Psidium guajava | Psidium | Myrtaceae |
|
| Alstonia undulifolia | Alstonia | Apocynaceae | |
| Aconitum leucostomum | Aconitum | Ranunculaceae |
|
| Amomum neoaurantiacum | Amomum | Zingiberaceae | |
| Scrophularia koelzii | Scrophularia | Scrophulariaceae |
|
| Eucalyptus cladocalyx | Eucalyptus | Myrtaceae |
|
| Syzygium aromaticum | Syzygium | Myrtaceae |
|
| Aquilegia ecalcarata | Aquilegia | Ranunculaceae |
|
| Betula platyphylla | Betula | Betulaceae |
|
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Polygonum flaccidum | Polygonum | Polygonaceae |
|
| Cassia jahnii | Cassia | Fabaceae | |
| Isatis tinctoria | Isatis | Brassicaceae |
|
| Persea mexicana | Persea | Lauraceae | |
| Tanacetum santolinoides | Tanacetum | Asteraceae |
|
| Persicaria thunbergii | Persicaria | Polygonaceae |
|
| Scrophularia ningpoensis | Scrophularia | Scrophulariaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Hubertia tomentosa | Hubertia | Asteraceae | |
| Alpinia galanga | Alpinia | Zingiberaceae |
|
| Myristica fragrans | Myristica | Myristicaceae |
|
| Zanthoxylum bungeanum | Zanthoxylum | Rutaceae |
|
| Ligustrum obtusifolium | Ligustrum | Oleaceae |
|
| Campsis flos | Campsis | Bignoniaceae | |
| Coptis chinensis | Coptis | Ranunculaceae |
|
| Ulva pertusa | Ulva | Ulvaceae |
|
| Helichrysum auriceps | Helichrysum | Asteraceae | |
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Asarum sieboldii | Asarum | Aristolochiaceae |
|
| Scrophularia buergeriana | Scrophularia | Scrophulariaceae |
|
| Salvadora persica | Salvadora | Salvadoraceae |
|
| Artemisia klotzchiana | Artemisia | Asteraceae | |
| Cinnamomum camphora | Cinnamomum | Lauraceae |
|
| Avrainvillea rawsonii | Avrainvillea | Udoteaceae | |
| Salvia xalapensis | Salvia | Lamiaceae | |
| Gardenia tubifera | Gardenia | Rubiaceae |
|
| Toddalia asiatica | Toddalia | Rutaceae |
|
| Panax innovans | Panax | Araliaceae | |
| Cannabis sativa | Cannabis | Cannabaceae |
|
| Fagus fusca | Fagus | Fagaceae | |
| Damnacanthus major | Damnacanthus | Rubiaceae | |
| Elettaria cardamomum | Elettaria | Zingiberaceae |
|
| Spiracantha cornifolia | Spiracantha | Asteraceae | |
| Commiphora myrrha | Commiphora | Burseraceae |
|
| Tylophora tanakae | Tylophora | Apocynaceae | |
| Blumea mollis | Blumea | Asteraceae |
|
| Cinnamomum aromaticum | Cinnamomum | Lauraceae |
|
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
| Magnolia officinalis rehd et wils | Magnolia | Magnoliaceae | |
| Myristica cagayanensis | Myristica | Myristicaceae | |
| Ficus elastica | Ficus | Moraceae |
|
| Stauntonia hexaphylla | Stauntonia | Lardizabalaceae |
|
| Perilla frutescens | Perilla | Lamiaceae |
|
| Acorus tatarinowii | Acorus | Acoraceae |
|
| Epipactis palustris | Epipactis | Orchidaceae | |
| Rubus sanctus | Rubus | Rosaceae |
|
| Charpentiera obovata | Charpentiera | Amaranthaceae | |
| Lotus ucrainicus | Lotus | Fabaceae | |
| Peltodon longipes | Peltodon | Lamiaceae |
Ingredient ID: NPC252067
Formula: C10H12O
Ingredient ID: NPC252067
| Common Name | Cuminaldehyde |
| IUPAC Name | 4-propan-2-ylbenzaldehyde |
| Canonical SMILES | O=Cc1ccc(cc1)C(C)C |
| Standard InCHI | InChI=1S/C10H12O/c1-8(2)10-5-3-9(7-11)4-6-10/h3-8H,1-2H3 |
| Standard InCHIKey | WTWBUQJHJGUZCY-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 326 ChEMBL ID: CHEMBL161577 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD164911] Database: NPASS [NPC252067] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Akebia trifoliata | Akebia | Lardizabalaceae |
|
| Amomum villosum | Amomum | Zingiberaceae |
|
| Illicium difengpi | Illicium | Schisandraceae |
|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Magnolia liliiflora | Magnolia | Magnoliaceae | |
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Angelica sinensis | Angelica | Apiaceae |
|
| Daucus carota | Daucus | Apiaceae |
|
| Ephedra herba | Ephedra | Ephedraceae | |
| Corydalis claviculata | Corydalis | Papaveraceae |
|
| Cicuta virosa | Cicuta | Apiaceae |
|
| Ephedra sinica | Ephedra | Ephedraceae |
|
| Akebia quinata | Akebia | Lardizabalaceae |
|
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Centranthus longiflorus ssp. longiflorus | Centranthus | Caprifoliaceae | |
| Chrysanthemum indicum | Chrysanthemum | Asteraceae |
|
| Cyperus rotundus | Cyperus | Cyperaceae |
|
| Artemisia annua | Artemisia | Asteraceae |
|
| Citrus maxima | Citrus | Rutaceae |
|
| Artemisia argyi | Artemisia | Asteraceae |
|
| Foeniculum vulgare | Foeniculum | Apiaceae |
|
| Magnolia liliflora | Magnolia | Magnoliaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Zanthoxylum bungeanum | Zanthoxylum | Rutaceae |
|
| Elettaria cardamomum | Elettaria | Zingiberaceae |
|
| Commiphora myrrha | Commiphora | Burseraceae |
|
| Schisandra chinensis | Schisandra | Schisandraceae |
|
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
| Magnolia officinalis rehd et wils | Magnolia | Magnoliaceae | |
| Zanthoxylum schinifolium | Zanthoxylum | Rutaceae |
|
| Crocus sativus | Crocus | Iridaceae |
|
Ingredient ID: NPC247983
Formula: C18H24O5
Ingredient ID: NPC247983
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@@H]1/C=C(/C)Cc2occ(c2C(=O)[C@H]([C@@H](C1)C)OC(=O)C)C |
| Standard InCHI | InChI=1S/C18H24O5/c1-10-6-14(21-5)8-11(2)18(23-13(4)19)17(20)16-12(3)9-22-15(16)7-10/h6,9,11,14,18H,7-8H2,1-5H3/b10-6-/t11-,14-,18+/m1/s1 |
| Standard InCHIKey | DCFSJMWNJKXQCQ-CAOPSYQBSA-N |
| Ingredient External Links |
ZINC ID: ZINC000085677904 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC247452
Formula: C15H20O
Ingredient ID: NPC247452
| Common Name | n.a. |
| IUPAC Name | (5S,6S)-6-ethenyl-3,6-dimethyl-5-prop-1-en-2-yl-5,7-dihydro-4H-1-benzofuran |
| Canonical SMILES | C=C[C@]1(C)Cc2occ(c2C[C@H]1C(=C)C)C |
| Standard InCHI | InChI=1S/C15H20O/c1-6-15(5)8-14-12(11(4)9-16-14)7-13(15)10(2)3/h6,9,13H,1-2,7-8H2,3-5H3/t13-,15+/m0/s1 |
| Standard InCHIKey | HICAMHOOTMOHPA-DZGCQCFKSA-N |
| Ingredient External Links |
PubChem CID: 12305300 ZINC ID: ZINC000014559784 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Curcuma phaeocaulis | Curcuma | Zingiberaceae | |
| Curcuma kwangsiensis | Curcuma | Zingiberaceae |
|
| Curcuma longa | Curcuma | Zingiberaceae |
|
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Traversia baccharoides | Traversia | Asteraceae | |
| Curcuma zedoaria | Curcuma | Zingiberaceae |
|
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC245190
Formula: C15H16O2
Ingredient ID: NPC245190
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC1=C2C(=O)c3c(C[C@@]2(C=CC1)C)occ3C |
| Standard InCHI | InChI=1S/C15H16O2/c1-9-5-4-6-15(3)7-11-12(10(2)8-17-11)14(16)13(9)15/h4,6,8H,5,7H2,1-3H3/t15-/m0/s1 |
| Standard InCHIKey | ZAUXXSQCVPKKPE-HNNXBMFYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD168104] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC239133
Formula: C15H26O
Ingredient ID: NPC239133
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1CC[C@H]([C@H]2[C@H]1CC=C(C2)C)C(C)C |
| Standard InCHI | InChI=1S/C15H26O/c1-10(2)13-7-5-12(9-16)14-6-4-11(3)8-15(13)14/h4,10,12-16H,5-9H2,1-3H3/t12-,13+,14+,15+/m1/s1 |
| Standard InCHIKey | ISYMMRJPYSWIPM-QPSCCSFWSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD1967] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC235694
Formula: C18H24O5
Ingredient ID: NPC235694
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@@H]1C=C(C)Cc2occ(c2C(=O)[C@@H]([C@H](C1)C)OC(=O)C)C |
| Standard InCHI | InChI=1S/C18H24O5/c1-10-6-14(21-5)8-11(2)18(23-13(4)19)17(20)16-12(3)9-22-15(16)7-10/h6,9,11,14,18H,7-8H2,1-5H3/t11-,14+,18+/m0/s1 |
| Standard InCHIKey | DCFSJMWNJKXQCQ-UCMVZMLTSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD224183] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC235059
Formula: C9H8O
Ingredient ID: NPC235059
| Common Name | Cinnamaldehyde |
| IUPAC Name | (E)-3-phenylprop-2-enal |
| Canonical SMILES | O=C/C=C/c1ccccc1 |
| Standard InCHI | InChI=1S/C9H8O/c10-8-4-7-9-5-2-1-3-6-9/h1-8H/b7-4+ |
| Standard InCHIKey | KJPRLNWUNMBNBZ-QPJJXVBHSA-N |
| Ingredient External Links |
PubChem CID: 637511 ChEMBL ID: CHEMBL293492 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD152606] Database: NPASS [NPC235059] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Liquidambar orientalis | Liquidambar | Altingiaceae |
|
| Akebia trifoliata | Akebia | Lardizabalaceae |
|
| Styrax benzoin | Styrax | Styracaceae |
|
| Arnebia euchroma | Arnebia | Boraginaceae |
|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Lithospermum erythrorhizon | Lithospermum | Boraginaceae |
|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Actaea dahurica | Actaea | Ranunculaceae |
|
| Actaea cimicifuga | Actaea | Ranunculaceae |
|
| Daucus carota | Daucus | Apiaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Ephedra herba | Ephedra | Ephedraceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Pinellia ternata | Pinellia | Araceae |
|
| Podocarpus elongata | Podocarpus | Podocarpaceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Akebia quinata | Akebia | Lardizabalaceae |
|
| Styrax | Styrax | Styracaceae |
|
| Arnebia guttata | Arnebia | Boraginaceae |
|
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Polyalthia nemoralis | Polyalthia | Annonaceae |
|
| Saussurea costus | Saussurea | Asteraceae |
|
| Actaea simplex | Actaea | Ranunculaceae | |
| Eschweilera coriacea | Eschweilera | Lecythidaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Eugenia caryopyhllata | Eugenia | Myrtaceae | |
| Cinnamomum cassia | Cinnamomum | Lauraceae |
|
| Eucalyptus cladocalyx | Eucalyptus | Myrtaceae |
|
| Syzygium aromaticum | Syzygium | Myrtaceae |
|
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Tanacetum cinerariifolium | Tanacetum | Asteraceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Ulva pertusa | Ulva | Ulvaceae |
|
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Salvadora persica | Salvadora | Salvadoraceae |
|
| Elettaria cardamomum | Elettaria | Zingiberaceae |
|
| Commiphora myrrha | Commiphora | Burseraceae |
|
| Cinnamomum aromaticum | Cinnamomum | Lauraceae |
|
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
| Peltodon longipes | Peltodon | Lamiaceae |
Ingredient ID: NPC22678
Formula: C15H20O
Ingredient ID: NPC22678
| Common Name | n.a. |
| IUPAC Name | (5E,9E)-3,6,10-trimethyl-4,7,8,11-tetrahydrocyclodeca[b]furan |
| Canonical SMILES | C/C/1=CCc2c(C/C(=C/CC1)/C)occ2C |
| Standard InCHI | InChI=1S/C15H20O/c1-11-5-4-6-12(2)9-15-14(8-7-11)13(3)10-16-15/h6-7,10H,4-5,8-9H2,1-3H3/b11-7+,12-6+ |
| Standard InCHIKey | VMDXHYHOJPKFEK-IAVOFVOCSA-N |
| Ingredient External Links |
PubChem CID: 636458 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD90417] Database: NPASS [NPC22678] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lepidium apetalum | Lepidium | Brassicaceae |
|
| Torilis japonica | Torilis | Apiaceae |
|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Cnidium monnieri | Cnidium | Apiaceae |
|
| Curcuma phaeocaulis | Curcuma | Zingiberaceae | |
| Curcuma kwangsiensis | Curcuma | Zingiberaceae |
|
| Actinidia deliciosa | Actinidia | Actinidiaceae |
|
| Curcuma longa | Curcuma | Zingiberaceae |
|
| Curcuma wenyujin | Curcuma | Zingiberaceae | |
| Codonopsis radix | Codonopsis | Campanulaceae | |
| Traversia baccharoides | Traversia | Asteraceae | |
| Curcuma zedoaria | Curcuma | Zingiberaceae |
|
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
| Cnidium monieri | Cnidium | Apiaceae |
Ingredient ID: NPC225223
Formula: C17H24O5
Ingredient ID: NPC225223
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=C[C@H](c1c(CC(OC(=O)C)(C)C)c(O)c(c(c1O)O)C)C |
| Standard InCHI | InChI=1S/C17H24O5/c1-7-9(2)13-12(8-17(5,6)22-11(4)18)14(19)10(3)15(20)16(13)21/h7,9,19-21H,1,8H2,2-6H3/t9-/m1/s1 |
| Standard InCHIKey | JZUWSHQOQZGYIT-SECBINFHSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD38505] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC204357
Formula: C15H22O
Ingredient ID: NPC204357
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=C[C@H](c1ccc(cc1CC(O)(C)C)C)C |
| Standard InCHI | InChI=1S/C15H22O/c1-6-12(3)14-8-7-11(2)9-13(14)10-15(4,5)16/h6-9,12,16H,1,10H2,2-5H3/t12-/m1/s1 |
| Standard InCHIKey | GQUGDHVDNITJEZ-GFCCVEGCSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD195863] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC188824
Formula: C15H26O2
Ingredient ID: NPC188824
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=C[C@@H]([C@H]1[C@@H](CC(=C[C@H]1O)C)CC(O)(C)C)C |
| Standard InCHI | InChI=1S/C15H26O2/c1-6-11(3)14-12(9-15(4,5)17)7-10(2)8-13(14)16/h6,8,11-14,16-17H,1,7,9H2,2-5H3/t11-,12-,13+,14-/m0/s1 |
| Standard InCHIKey | ALYKQEBAOLQDEG-FQUUOJAGSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD182013] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC185373
Formula: C16H22O3
Ingredient ID: NPC185373
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@@H](C)CC(=O)c2c(C/C(=C/1)/C)occ2C |
| Standard InCHI | InChI=1S/C16H22O3/c1-10-5-13(18-4)6-11(2)8-15-16(14(17)7-10)12(3)9-19-15/h6,9-10,13H,5,7-8H2,1-4H3/b11-6+/t10-,13+/m1/s1 |
| Standard InCHIKey | JUFDIKOOORFASQ-JGLCCLGMSA-N |
| Ingredient External Links |
ZINC ID: ZINC000070451208 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC184692
Formula: C16H20O3
Ingredient ID: NPC184692
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@@H]1/C=C/C(=C)Cc2c(C(=O)C[C@@H]1C)c(C)co2 |
| Standard InCHI | InChI=1S/C16H20O3/c1-10-5-6-14(18-4)11(2)8-13(17)16-12(3)9-19-15(16)7-10/h5-6,9,11,14H,1,7-8H2,2-4H3/b6-5+/t11-,14+/m0/s1 |
| Standard InCHIKey | KYVMPRMAGALGDM-YNVXZPTESA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD150058] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC183885
Formula: C15H18O
Ingredient ID: NPC183885
| Common Name | n.a. |
| IUPAC Name | (4aS,8aS)-3,5,8a-trimethyl-4a,9-dihydro-4H-benzo[f][1]benzofuran |
| Canonical SMILES | CC1=CC=C[C@]2([C@H]1Cc1c(C2)occ1C)C |
| Standard InCHI | InChI=1S/C15H18O/c1-10-5-4-6-15(3)8-14-12(7-13(10)15)11(2)9-16-14/h4-6,9,13H,7-8H2,1-3H3/t13-,15+/m0/s1 |
| Standard InCHIKey | AUSAHAHDEVYCOC-DZGCQCFKSA-N |
| Ingredient External Links |
PubChem CID: 643237 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD3802] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC17920
Formula: C15H18O
Ingredient ID: NPC17920
| Common Name | n.a. |
| IUPAC Name | (4aS,8aS)-3,8a-dimethyl-5-methylidene-4,4a,6,9-tetrahydrobenzo[f][1]benzofuran |
| Canonical SMILES | C=C1CC=C[C@]2([C@H]1Cc1c(C2)occ1C)C |
| Standard InCHI | InChI=1S/C15H18O/c1-10-5-4-6-15(3)8-14-12(7-13(10)15)11(2)9-16-14/h4,6,9,13H,1,5,7-8H2,2-3H3/t13-,15+/m0/s1 |
| Standard InCHIKey | BZQURGSQMBBPRU-DZGCQCFKSA-N |
| Ingredient External Links |
PubChem CID: 12311270 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD181844] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC167059
Formula: C16H22O2
Ingredient ID: NPC167059
| Common Name | n.a. |
| IUPAC Name | (5E,8R,9E)-8-methoxy-3,6,10-trimethyl-4,7,8,11-tetrahydrocyclodeca[b]furan |
| Canonical SMILES | CO[C@@H]1C/C(=C/Cc2c(C/C(=C/1)/C)occ2C)/C |
| Standard InCHI | InChI=1S/C16H22O2/c1-11-5-6-15-13(3)10-18-16(15)9-12(2)8-14(7-11)17-4/h5,8,10,14H,6-7,9H2,1-4H3/b11-5+,12-8+/t14-/m1/s1 |
| Standard InCHIKey | NWLNPDFDTSFGEU-JBMXZMKISA-N |
| Ingredient External Links |
PubChem CID: 91711711 ZINC ID: ZINC000038321818 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC150837
Formula: C7H8O
Ingredient ID: NPC150837
| Common Name | Metacresol |
| IUPAC Name | 3-methylphenol |
| Canonical SMILES | Cc1cccc(c1)O |
| Standard InCHI | InChI=1S/C7H8O/c1-6-3-2-4-7(8)5-6/h2-5,8H,1H3 |
| Standard InCHIKey | RLSSMJSEOOYNOY-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 342 ChEMBL ID: CHEMBL298312 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD76349] Database: NPASS [NPC150837] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Atractylodes macrocephala | Atractylodes | Asteraceae |
|
| Morus alba | Morus | Moraceae |
|
| Artemisia capillaries | Artemisia | Asteraceae | |
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC147113
Formula: C15H20O3
Ingredient ID: NPC147113
| Common Name | n.a. |
| IUPAC Name | (5S,6S,7aS)-6-ethenyl-7a-hydroxy-3,6-dimethyl-5-prop-1-en-2-yl-5,7-dihydro-4H-1-benzofuran-2-one |
| Canonical SMILES | C=C[C@]1(C)C[C@]2(O)OC(=O)C(=C2C[C@H]1C(=C)C)C |
| Standard InCHI | InChI=1S/C15H20O3/c1-6-14(5)8-15(17)12(7-11(14)9(2)3)10(4)13(16)18-15/h6,11,17H,1-2,7-8H2,3-5H3/t11-,14+,15-/m0/s1 |
| Standard InCHIKey | SZSKOUUYIBMAJD-GLQYFDAESA-N |
| Ingredient External Links |
PubChem CID: 14038425 ZINC ID: ZINC000014449926 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC133069
Formula: C16H22O3
Ingredient ID: NPC133069
| Common Name | n.a. |
| IUPAC Name | (6R,8R,9E)-8-methoxy-3,6,10-trimethyl-6,7,8,11-tetrahydro-5H-cyclodeca[b]furan-4-one |
| Canonical SMILES | CO[C@@H]1C[C@@H](C)CC(=O)c2c(C/C(=C/1)/C)occ2C |
| Standard InCHI | InChI=1S/C16H22O3/c1-10-5-13(18-4)6-11(2)8-15-16(14(17)7-10)12(3)9-19-15/h6,9-10,13H,5,7-8H2,1-4H3/b11-6+/t10-,13-/m1/s1 |
| Standard InCHIKey | JUFDIKOOORFASQ-WCXSNEHCSA-N |
| Ingredient External Links |
PubChem CID: 11747425 ZINC ID: ZINC000036406631 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Angelica genuflexa | Angelica | Apiaceae |
|
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC114718
Formula: C15H18O3
Ingredient ID: NPC114718
| Common Name | n.a. |
| IUPAC Name | (4aS,8aS,9aS)-9a-hydroxy-3,8a-dimethyl-5-methylidene-4,4a,6,9-tetrahydrobenzo[f][1]benzofuran-2-one |
| Canonical SMILES | C=C1CC=C[C@]2([C@H]1CC1=C(C)C(=O)O[C@]1(C2)O)C |
| Standard InCHI | InChI=1S/C15H18O3/c1-9-5-4-6-14(3)8-15(17)12(7-11(9)14)10(2)13(16)18-15/h4,6,11,17H,1,5,7-8H2,2-3H3/t11-,14+,15-/m0/s1 |
| Standard InCHIKey | VMGUBSLDEXOUMH-GLQYFDAESA-N |
| Ingredient External Links |
PubChem CID: 101938021 ZINC ID: ZINC000070451215 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Ingredient ID: NPC106184
Formula: C30H50O2
Ingredient ID: NPC106184
| Common Name | n.a. |
| IUPAC Name | (1R,3S,5S,8R,9S,10R,13S,17S)-4,4,8,10,13-pentamethyl-17-[(2S)-6-methylhept-5-en-2-yl]-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
| Canonical SMILES | CC(=CCC[C@@H]([C@@H]1CC=C2[C@@]1(C)CC[C@H]1[C@@]2(C)CC[C@@H]2[C@]1(C)[C@H](O)C[C@@H](C2(C)C)O)C)C |
| Standard InCHI | InChI=1S/C30H50O2/c1-19(2)10-9-11-20(3)21-12-13-23-28(21,6)16-15-24-29(23,7)17-14-22-27(4,5)25(31)18-26(32)30(22,24)8/h10,13,20-22,24-26,31-32H,9,11-12,14-18H2,1-8H3/t20-,21-,22-,24-,25-,26+,28-,29-,30-/m0/s1 |
| Standard InCHIKey | YTDWFQYMAFQRGV-BIMLBXDVSA-N |
| Ingredient External Links |
PubChem CID: 42632429 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD81733] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC106184 | C30H50O2 | (1R,3S,5S,8R,9S,10R,13S,17S)-4,4,8,10,13-pentamethyl-17-[(2S)-6-methylhept-5-en-2-yl]-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol | 442.3810808 | 3.2967 | 4.54 | 9.098 | 2 | 2 | 40.46 | 4 | 4 | 32 | 1 |
| NPC114718 | C15H18O3 | (4aS,8aS,9aS)-9a-hydroxy-3,8a-dimethyl-5-methylidene-4,4a,6,9-tetrahydrobenzo[f][1]benzofuran-2-one | 246.1255944 | 2.013 | 2.78 | 1.945 | 3 | 1 | 46.53 | 0 | 3 | 18 | 0 |
| NPC133069 | C16H22O3 | (6R,8R,9E)-8-methoxy-3,6,10-trimethyl-6,7,8,11-tetrahydro-5H-cyclodeca[b]furan-4-one | 262.1568946 | 1.7811 | 2.89 | 2.283 | 2 | 0 | 39.44 | 1 | 2 | 19 | 0 |
| NPC147113 | C15H20O3 | (5S,6S,7aS)-6-ethenyl-7a-hydroxy-3,6-dimethyl-5-prop-1-en-2-yl-5,7-dihydro-4H-1-benzofuran-2-one | 248.1412445 | 2.5735 | 2.78 | 2.351 | 3 | 1 | 46.53 | 2 | 2 | 18 | 0 |
| NPC150837 | C7H8O | Metacresol | 108.06 | 0.1817 | 2.12 | 2.367 | 0 | 1 | 20.23 | 2 | 1 | 8 | 0 |
| NPC167059 | C16H22O2 | (5E,8R,9E)-8-methoxy-3,6,10-trimethyl-4,7,8,11-tetrahydrocyclodeca[b]furan | 246.1619799 | 2.9189 | 3 | 2.605 | 1 | 0 | 22.37 | 1 | 2 | 18 | 0 |
| NPC17920 | C15H18O | (4aS,8aS)-3,8a-dimethyl-5-methylidene-4,4a,6,9-tetrahydrobenzo[f][1]benzofuran | 214.1357652 | 2.5725 | 3 | 3.808 | 0 | 0 | 13.14 | 0 | 3 | 16 | 0 |
| NPC183885 | C15H18O | (4aS,8aS)-3,5,8a-trimethyl-4a,9-dihydro-4H-benzo[f][1]benzofuran | 214.1357652 | 2.6536 | 3 | 3.646 | 0 | 0 | 13.14 | 0 | 3 | 16 | 0 |
| NPC184692 | C16H20O3 | 260.1412445 | 1.591 | 2.89 | 2.003 | 2 | 0 | 39.44 | 1 | 2 | 19 | 0 | |
| NPC185373 | C16H22O3 | 262.1568946 | 1.7811 | 2.89 | 2.283 | 2 | 0 | 39.44 | 1 | 2 | 19 | 0 | |
| NPC188824 | C15H26O2 | 238.1932801 | 1.1496 | 2.89 | 3.114 | 2 | 2 | 40.46 | 4 | 1 | 17 | 0 | |
| NPC204357 | C15H22O | 218.1670653 | 1.9379 | 3 | 5.988 | 1 | 1 | 20.23 | 4 | 1 | 16 | 1 | |
| NPC225223 | C17H24O5 | 308.1623739 | 0.9361 | 2.78 | 2.791 | 2 | 3 | 86.99 | 6 | 1 | 22 | 0 | |
| NPC22678 | C15H20O | 216.1514153 | 3.2767 | 3 | 3.694 | 0 | 0 | 13.14 | 3 | 2 | 16 | 0 | |
| NPC235059 | C9H8O | Cinnamaldehyde | 132.06 | 0.1687 | 2.34 | 3.985 | 1 | 0 | 17.07 | 2 | 1 | 10 | 0 |
| NPC235694 | C18H24O5 | 320.1623739 | 1.508 | 2.89 | 2.048 | 4 | 0 | 65.74 | 3 | 2 | 23 | 0 | |
| NPC239133 | C15H26O | 222.1983655 | 0.7088 | 3 | 4.891 | 1 | 1 | 20.23 | 2 | 2 | 16 | 0 | |
| NPC245190 | C15H16O2 | 228.1150298 | 2.3251 | 2.89 | 3.072 | 1 | 0 | 30.21 | 0 | 3 | 17 | 0 | |
| NPC247452 | C15H20O | (5S,6S)-6-ethenyl-3,6-dimethyl-5-prop-1-en-2-yl-5,7-dihydro-4H-1-benzofuran | 216.1514153 | 3.133 | 3 | 4.214 | 0 | 0 | 13.14 | 2 | 2 | 16 | 0 |
| NPC247983 | C18H24O5 | 320.1623739 | 1.508 | 2.89 | 2.048 | 4 | 0 | 65.74 | 3 | 2 | 23 | 0 | |
| NPC252067 | C10H12O | Cuminaldehyde | 148.09 | 0.3805 | 2.45 | 4.48 | 1 | 0 | 17.07 | 4 | 1 | 11 | 0 |
| NPC257124 | C10H12O2 | Eugenol | 164.08 | 0.5166 | 2.34 | 2.484 | 0 | 1 | 29.46 | 5 | 1 | 12 | 0 |
| NPC262766 | C15H18O4 | (3aS,5S,8S)-3a-hydroxy-1,5,8-trimethyl-5,7,8,9-tetrahydro-4H-benzo[e][1]benzofuran-2,6-dione | 262.1205091 | 0.8784 | 2.67 | 0.852 | 4 | 1 | 63.6 | 0 | 3 | 19 | 0 |
| NPC289764 | C30H60 | triacont-1-ene | 420.4695019 | -6.4736 | 4.76 | 17.044 | 0 | 0 | 0 | 27 | 0 | 30 | 2 |
| NPC292967 | C15H26O2 | (1S,5R,6R)-5-[(2R)-2-hydroxybutan-2-yl]-2-methyl-6-(2-methylprop-1-enyl)cyclohex-2-en-1-ol | 238.1932801 | 0.8675 | 2.89 | 2.201 | 2 | 2 | 40.46 | 3 | 1 | 17 | 0 |
| NPC29652 | C15H18O2 | (5E,9E)-3,6,10-trimethyl-8,11-dihydro-7H-cyclodeca[b]furan-4-one | 230.1306798 | 2.585 | 2.89 | 2.601 | 1 | 0 | 30.21 | 0 | 2 | 17 | 0 |
| NPC303304 | C16H20O3 | (6S,7R,8E)-7-methoxy-3,6-dimethyl-10-methylidene-5,6,7,11-tetrahydrocyclodeca[b]furan-4-one | 260.1412445 | 1.591 | 2.89 | 2.003 | 2 | 0 | 39.44 | 1 | 2 | 19 | 0 |
| NPC31238 | C15H20O3 | 248.1412445 | 1.228 | 2.78 | 1.481 | 3 | 1 | 46.53 | 0 | 3 | 18 | 0 | |
| NPC45655 | C15H16O2 | (8S)-1,5,8-trimethyl-8,9-dihydro-7H-benzo[e][1]benzofuran-6-one | 228.1150298 | 1.3555 | 2.89 | 3.116 | 1 | 0 | 30.21 | 0 | 3 | 17 | 0 |
| NPC45947 | C15H18O3 | 246.13 | 1.2261 | 2.78 | 1.586 | 2 | 0 | 42.74 | 2 | 3 | 18 | 0 | |
| NPC70271 | C15H18O2 | (5S,6S)-6-ethenyl-3,6-dimethyl-5-prop-1-en-2-yl-5,7-dihydro-1-benzofuran-4-one | 230.1306798 | 2.5342 | 2.89 | 2.829 | 1 | 0 | 30.21 | 2 | 2 | 17 | 0 |
| NPC71258 | C17H22O3 | 274.1568946 | 2.8895 | 3 | 2.826 | 2 | 0 | 39.44 | 2 | 2 | 20 | 0 | |
| NPC76145 | C10H16 | Limonene | 136.13 | 2.1424 | 2.56 | 3.729 | 0 | 0 | 0 | 3 | 1 | 10 | 0 |
| NPC88805 | C17H24O4 | 292.1674592 | 1.3964 | 2.89 | 3.325 | 2 | 2 | 66.76 | 6 | 1 | 21 | 0 | |
| NPC90809 | C15H16O3 | (9aS)-9a-hydroxy-3,5,8-trimethyl-4,9-dihydrobenzo[f][1]benzofuran-2-one | 244.1099444 | 1.9898 | 2.78 | 3.201 | 3 | 1 | 46.53 | 0 | 3 | 18 | 0 |
| NPC92642 | C18H24O5 | [(5R,6S,8S,9Z)-8-methoxy-3,6,10-trimethyl-4-oxo-6,7,8,11-tetrahydro-5H-cyclodeca[b]furan-5-yl] acetate | 320.1623739 | 1.508 | 2.89 | 2.048 | 4 | 0 | 65.74 | 3 | 2 | 23 | 0 |
| NPC93317 | C16H28O2 | (1R,3aR,4R,8aS)-1-methoxy-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulen-4-ol | 252.2089301 | 1.131 | 3 | 3.132 | 2 | 1 | 29.46 | 2 | 2 | 18 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
