36 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
10 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC82123
Formula: C39H38O20
Ingredient ID: NPC82123
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cc(O)cc3c2C=C(O[C@@H]2O[C@H](C[O+]=C(C=Cc4ccc(cc4)O)O)[C@H]([C@@H]([C@H]2O)O)O)C(=C2C=CC(=O)C=C2)O3)[C@@H]([C@H]([C@@H]1OC(=O)CC(=O)O)O)O |
| Standard InCHI | InChI=1S/C39H38O20/c40-15-26-37(59-30(47)14-28(44)45)33(50)35(52)39(57-26)55-24-12-21(43)11-23-22(24)13-25(36(54-23)18-4-8-20(42)9-5-18)56-38-34(51)32(49)31(48)27(58-38)16-53-29(46)10-3-17-1-6-19(41)7-2-17/h1-13,26-27,31-35,37-40,48-52H,14-16H2,(H3-,41,42,43,44,45,46)/p+1/t26-,27-,31-,32+,33-,34-,35-,37-,38-,39-/m1/s1 |
| Standard InCHIKey | MDEOANVPTRUJEP-QUYWJHRBSA-O |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD110950] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
  |
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC8087
Formula: C6H13NO4
Ingredient ID: NPC8087
| Common Name | 2,5-Dideoxy-2,5-Imino-D-Mannitol |
| IUPAC Name | (2R,3R,4R,5R)-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol |
| Canonical SMILES | OC[C@H]1N[C@@H]([C@H]([C@@H]1O)O)CO |
| Standard InCHI | InChI=1S/C6H13NO4/c8-1-3-5(10)6(11)4(2-9)7-3/h3-11H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| Standard InCHIKey | PFYHYHZGDNWFIF-KVTDHHQDSA-N |
| Ingredient External Links |
PubChem CID: 124702 ZINC ID: ZINC000001492230 ChEMBL ID: CHEMBL312653 |
| Plant-Ingredient Association Reference |
PMID: 9599261 Database: NPASS [NPC8087] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Castanospermum australe | Castanospermum | Fabaceae |
|
| Morus bombycis | Morus | Moraceae |
|
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Xanthocercis zambesiaca | Xanthocercis | Fabaceae | |
| Angylocalyx pynaertii | Angylocalyx | Fabaceae | |
| Scorzoneroides autumnalis | Scorzoneroides | Asteraceae | |
| Glycyrrhiza glabra | Glycyrrhiza | Fabaceae |
 |
| aglaonema treubii | Aglaonema | Araceae | |
| Lactuca floridana | Lactuca | Asteraceae | |
| Glycyrrhiza uralensis | Glycyrrhiza | Fabaceae |
|
| Commelina communis | Commelina | Commelinaceae |
|
Ingredient ID: NPC69798
Formula: C7H15NO4
Ingredient ID: NPC69798
| Common Name | 2,5-Imino-2,5,6-Trideoxy-D-Gulo-Heptitol |
| IUPAC Name | (2R,3S,4S,5S)-2-(2-hydroxyethyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol |
| Canonical SMILES | OCC[C@H]1N[C@H]([C@@H]([C@H]1O)O)CO |
| Standard InCHI | InChI=1S/C7H15NO4/c9-2-1-4-6(11)7(12)5(3-10)8-4/h4-12H,1-3H2/t4-,5+,6+,7+/m1/s1 |
| Standard InCHIKey | AGFACLQFIYFFOI-BWBBJGPYSA-N |
| Ingredient External Links |
PubChem CID: 44593591 ChEMBL ID: CHEMBL464569 |
| Plant-Ingredient Association Reference |
PMID: 9599261 Database: NPASS [NPC69798] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
Ingredient ID: NPC61504
Formula: C30H26O13
Ingredient ID: NPC61504
| Common Name | n.a. |
| IUPAC Name | [(3S,6S)-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
| Canonical SMILES | Oc1ccc(cc1)C=CC(=[O+]CC1O[C@@H](Oc2cc3c(oc2c2ccc(c(c2)O)O)cc(cc3=O)O)C(C([C@@H]1O)O)O)O |
| Standard InCHI | InChI=1S/C30H26O13/c31-16-5-1-14(2-6-16)3-8-25(36)40-13-24-26(37)27(38)28(39)30(43-24)42-23-12-18-20(34)10-17(32)11-22(18)41-29(23)15-4-7-19(33)21(35)9-15/h1-12,24,26-28,30,37-39H,13H2,(H4-,31,32,33,34,35,36)/p+1/t24?,26-,27?,28?,30-/m1/s1 |
| Standard InCHIKey | QAOBEOXFSUJDJL-RYHKZSCWSA-O |
| Ingredient External Links |
PubChem CID: 91417365 |
| Plant-Ingredient Association Reference |
Database: TCMID [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Styrax benzoin | Styrax | Styracaceae |
|
| Gossypium herbaceum | Gossypium | Malvaceae |
|
| Prunus persica | Prunus | Rosaceae |
 |
| Vitis vinifera | Vitis | Vitaceae |
|
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Ficus carica | Ficus | Moraceae |
|
Ingredient ID: NPC5947
Formula: C40H40O21
Ingredient ID: NPC5947
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1cc(ccc1O)C=CC(=[O+]C[C@H]1O[C@@H](OC2=Cc3c(cc(cc3OC2=C2C=CC(=O)C=C2)O)O[C@@H]2O[C@H](COC(=O)CC(=O)O)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O)O |
| Standard InCHI | InChI=1S/C40H40O21/c1-54-25-10-17(2-8-22(25)43)3-9-30(46)55-15-27-32(48)35(51)37(53)40(61-27)59-26-13-21-23(57-38(26)18-4-6-19(41)7-5-18)11-20(42)12-24(21)58-39-36(52)34(50)33(49)28(60-39)16-56-31(47)14-29(44)45/h2-13,27-28,32-37,39-40,48-53H,14-16H2,1H3,(H3-,41,42,43,44,45,46)/p+1/t27-,28-,32-,33-,34+,35+,36-,37-,39-,40-/m1/s1 |
| Standard InCHIKey | ZWBURTPIYLFHIK-ZGFFMVSDSA-O |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD95935] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC58616
Formula: C9H10O2
Ingredient ID: NPC58616
| Common Name | E1501 |
| IUPAC Name | benzyl acetate |
| Canonical SMILES | CC(=O)OCc1ccccc1 |
| Standard InCHI | InChI=1S/C9H10O2/c1-8(10)11-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| Standard InCHIKey | QUKGYYKBILRGFE-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 8785 ChEMBL ID: CHEMBL1233714 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD118698] Database: NPASS [NPC58616] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper attenuatum | Piper | Piperaceae |
|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Artemisia jacutica | Artemisia | Asteraceae | |
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Bersama abyssinica | Bersama | Melianthaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Vitis vinifera | Vitis | Vitaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Aconitum sajanense | Aconitum | Ranunculaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Strychnos triplinervia | Strychnos | Loganiaceae |
|
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Styrax | Styrax | Styracaceae |
|
| Chimonanthus fragrans | Chimonanthus | Calycanthaceae | |
| Bombax ceiba | Bombax | Malvaceae |
|
| Erysimum odoratum | Erysimum | Brassicaceae | |
| Heterotheca inuloides | Heterotheca | Asteraceae |
|
| Delphinium andersoni | Delphinium | Ranunculaceae | |
| Vaccinium vitis-idaea | Vaccinium | Ericaceae |
|
| Vismia jefensis | Vismia | Hypericaceae | |
| Angelica tarokoensis | Angelica | Apiaceae | |
| Swertia delavayi | Swertia | Gentianaceae | |
| Epimedium davidii | Epimedium | Berberidaceae |
|
| Globba malaccensis | Globba | Zingiberaceae |
|
| Diphasia angolensis | Diphasia | Rutaceae | |
| Knightia excelsa | Knightia | Proteaceae |
|
| Isodon japonicus | Isodon | Lamiaceae |
|
| Solanum acaule | Solanum | Solanaceae | |
| Frullania tamarisci | Frullania | Frullaniaceae | |
| Alangium premnifolium | Alangium | Cornaceae | |
| Saussurea carthamoides | Saussurea | Asteraceae | |
| Galenia africana | Galenia | Aizoaceae |
|
| Micromeria pineolens | Micromeria | Lamiaceae | |
| Gnidia lamprantha | Gnidia | Thymelaeaceae |
|
| Artemisia annua | Artemisia | Asteraceae |
|
| Ilex amara | Ilex | Aquifoliaceae | |
| Leonurus glaucescens | Leonurus | Lamiaceae |
|
| Salacia madagascariensis | Salacia | Celastraceae |
|
| Maba buxifolia | Maba | Ebenaceae |
|
| Senna alexandrina | Senna | Fabaceae |
|
| Prunus mume | Prunus | Rosaceae |
|
| Quercus sessiliflora | Quercus | Fagaceae | |
| Eugenia caryopyhllata | Eugenia | Myrtaceae | |
| Syzygium aromaticum | Syzygium | Myrtaceae |
|
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Cassia jahnii | Cassia | Fabaceae | |
| Lepidium draba | Lepidium | Brassicaceae |
|
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Avrainvillea rawsonii | Avrainvillea | Udoteaceae | |
| Damnacanthus major | Damnacanthus | Rubiaceae | |
| Stauntonia hexaphylla | Stauntonia | Lardizabalaceae |
|
| Rubus sanctus | Rubus | Rosaceae |
|
Ingredient ID: NPC56506
Formula: C39H38O22
Ingredient ID: NPC56506
| Common Name | n.a. |
| IUPAC Name | 3-oxo-3-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-5-yl]oxyoxan-2-yl]methoxy]propanoic acid |
| Canonical SMILES | O=C(C=Cc1ccc(cc1)O)OC[C@H]1O[C@@H](Oc2cc3c(cc(cc3[o+]c2c2cc(O)c(c(c2)O)O)O)O[C@@H]2O[C@H](COC(=O)CC(=O)O)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C39H38O22/c40-17-4-1-15(2-5-17)3-6-28(46)55-13-25-31(49)34(52)36(54)39(61-25)59-24-11-19-22(57-37(24)16-7-20(42)30(48)21(43)8-16)9-18(41)10-23(19)58-38-35(53)33(51)32(50)26(60-38)14-56-29(47)12-27(44)45/h1-11,25-26,31-36,38-39,49-54H,12-14H2,(H5-,40,41,42,43,44,45,46,48)/p+1/t25-,26-,31-,32-,33+,34+,35-,36-,38-,39-/m1/s1 |
| Standard InCHIKey | LXITVYYZHYMDFB-AWJFVBHYSA-O |
| Ingredient External Links |
PubChem CID: 5281258 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD115115] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC56253
Formula: C21H23O10
Ingredient ID: NPC56253
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1O[C@@H](OC2=Cc3c(O)cc(cc3O[C+]2c2ccc(cc2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C21H23O10/c22-8-16-17(26)18(27)19(28)21(31-16)30-15-7-12-13(25)5-11(24)6-14(12)29-20(15)9-1-3-10(23)4-2-9/h1-7,16-19,21-28H,8,20H2/q+1/t16-,17-,18+,19-,21-/m1/s1 |
| Standard InCHIKey | JUNQVPKWBLFCKN-GQUPQBGVSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD26512] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC473952
Formula: C7H15NO5
Ingredient ID: NPC473952
| Common Name | 2,5-Dideoxy-2,5-Imino-D-Glycero-D-Manno-Heptitol |
| IUPAC Name | (2R,3R,4R,5R)-2-(1,2-dihydroxyethyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol |
| Canonical SMILES | OCC([C@H]1N[C@@H]([C@H]([C@@H]1O)O)CO)O |
| Standard InCHI | InChI=1S/C7H15NO5/c9-1-3-6(12)7(13)5(8-3)4(11)2-10/h3-13H,1-2H2/t3-,4?,5-,6-,7-/m1/s1 |
| Standard InCHIKey | ZJRUOSSQTZGFJV-UHEPRFFZSA-N |
| Ingredient External Links |
PubChem CID: 13005892 ChEMBL ID: CHEMBL456077 |
| Plant-Ingredient Association Reference |
PMID: 9599261 Database: NPASS [NPC473952] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
Ingredient ID: NPC38408
Formula: C27H30O17
Ingredient ID: NPC38408
| Common Name | n.a. |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[7-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-5-yl]oxyoxane-3,4,5-triol |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cc(O)cc3c2cc(O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)c([o+]3)c2cc(O)c(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C27H30O17/c28-6-16-19(34)21(36)23(38)26(43-16)41-14-4-9(30)3-13-10(14)5-15(25(40-13)8-1-11(31)18(33)12(32)2-8)42-27-24(39)22(37)20(35)17(7-29)44-27/h1-5,16-17,19-24,26-29,34-39H,6-7H2,(H3-,30,31,32,33)/p+1/t16-,17-,19-,20-,21+,22+,23-,24-,26-,27-/m1/s1 |
| Standard InCHIKey | XCTGXGVGJYACEI-LCENJUANSA-O |
| Ingredient External Links |
PubChem CID: 10100906 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD81078] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Conyza canadensis | Conyza | Asteraceae |
|
| Coreopsis fasciculata | Coreopsis | Asteraceae | |
| Balanophora harlandii | Balanophora | Balanophoraceae | |
| Selinum carvifolium | Selinum | Apiaceae | |
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Thuja plicata | Thuja | Cupressaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Polemonium caeruleum | Polemonium | Polemoniaceae |
|
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Crepis foetida | Crepis | Asteraceae |
|
| Cirsium japonicum | Cirsium | Asteraceae |
|
| Dorstenia lindeniana | Dorstenia | Moraceae | |
| Dioscoreophyllum cumminsii | Dioscoreophyllum | Menispermaceae |
|
| Phytolacca acinosa | Phytolacca | Phytolaccaceae |
|
| Garcinia hombroniana | Garcinia | Clusiaceae |
|
| Cardiospermum halicacabum | Cardiospermum | Sapindaceae |
|
| Aglaia elaeagnoidea | Aglaia | Meliaceae |
|
| Punica granatum | Punica | Lythraceae |
|
| Urtica triangularis | Urtica | Urticaceae |
|
| Strychnos ledermannii | Strychnos | Loganiaceae | |
| Pouzolzia occidentalis | Pouzolzia | Urticaceae | |
| Centaurea nigrescens | Centaurea | Asteraceae |
|
| Piper arboreum | Piper | Piperaceae |
|
| Parastrephia lepidophylla | Parastrephia | Asteraceae | |
| Phlogacanthus thyrsiflorus | Phlogacanthus | Acanthaceae |
|
| Euphorbia segetalis | Euphorbia | Euphorbiaceae | |
| Sidastrum acuminatum | Sidastrum | Malvaceae | |
| Syncolostemon parviflorus | Syncolostemon | Lamiaceae | |
| Aristolochia elegans | Aristolochia | Aristolochiaceae | |
| Penstemon secundiflorus | Penstemon | Plantaginaceae | |
| Cuphea carthagenensis | Cuphea | Lythraceae | |
| Ozoroa insignis | Ozoroa | Anacardiaceae |
|
| Ruta microcarpa | Ruta | Rutaceae |
|
| Crinum defixum | Crinum | Amaryllidaceae |
|
| Zanthoxylum monophyllum | Zanthoxylum | Rutaceae | |
| Euphorbia biglandulosa | Euphorbia | Euphorbiaceae | |
| Astragalus gummifer | Astragalus | Fabaceae |
|
| Triglochin maritima | Triglochin | Juncaginaceae |
|
| Lupinus cosentinii | Lupinus | Fabaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Viburnum davidii | Viburnum | Adoxaceae | |
| Agathosma scaberula | Agathosma | Rutaceae | |
| Phedimus kamtschaticus | Phedimus | Crassulaceae |
|
| Cichorium intybus | Cichorium | Asteraceae |
|
Ingredient ID: NPC32877
Formula: C39H38O20
Ingredient ID: NPC32877
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC(=[O+]C[C@H]1O[C@@H](OC2=Cc3c(cc(cc3OC2=C2C=CC(=O)C=C2)O)O[C@@H]2O[C@H](COC(=O)CC(=O)O)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O)C=Cc1ccc(cc1)O |
| Standard InCHI | InChI=1S/C39H38O20/c40-19-6-1-17(2-7-19)3-10-29(45)53-15-26-31(47)34(50)36(52)39(59-26)57-25-13-22-23(55-37(25)18-4-8-20(41)9-5-18)11-21(42)12-24(22)56-38-35(51)33(49)32(48)27(58-38)16-54-30(46)14-28(43)44/h1-13,26-27,31-36,38-39,47-52H,14-16H2,(H3-,40,41,42,43,44,45)/p+1/t26-,27-,31-,32-,33+,34+,35-,36-,38-,39-/m1/s1 |
| Standard InCHIKey | SVWGZAOFZPHNJL-KMKFZPLVSA-O |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD187442] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC308501
Formula: C36H36O17
Ingredient ID: NPC308501
| Common Name | n.a. |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-2-(4-hydroxyphenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cc(O)cc3c2C=C(O[C@@H]2O[C@H](C[O+]=C(C=Cc4ccc(cc4)O)O)[C@H]([C@@H]([C@H]2O)O)O)C(=C2C=CC(=O)C=C2)O3)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C36H36O17/c37-14-25-28(42)30(44)32(46)35(52-25)50-23-12-20(40)11-22-21(23)13-24(34(49-22)17-4-8-19(39)9-5-17)51-36-33(47)31(45)29(43)26(53-36)15-48-27(41)10-3-16-1-6-18(38)7-2-16/h1-13,25-26,28-33,35-37,42-47H,14-15H2,(H2-,38,39,40,41)/p+1/t25-,26-,28-,29-,30+,31+,32-,33-,35-,36-/m1/s1 |
| Standard InCHIKey | HFGYRTHYZMEEPZ-AQAMAIGXSA-O |
| Ingredient External Links |
PubChem CID: 20054973 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD100121] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC301898
Formula: C37H38O18
Ingredient ID: NPC301898
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cc(O)cc3c2C=C(O[C@@H]2O[C@H](C[O+]=C(C=Cc4ccc(c(c4)OC)O)O)[C@H]([C@@H]([C@H]2O)O)O)C(=C2C=CC(=O)C=C2)O3)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C37H38O18/c1-49-24-10-16(2-8-21(24)41)3-9-28(42)50-15-27-30(44)32(46)34(48)37(55-27)53-25-13-20-22(51-35(25)17-4-6-18(39)7-5-17)11-19(40)12-23(20)52-36-33(47)31(45)29(43)26(14-38)54-36/h2-13,26-27,29-34,36-38,43-48H,14-15H2,1H3,(H2-,39,40,41,42)/p+1/t26-,27-,29-,30-,31+,32+,33-,34-,36-,37-/m1/s1 |
| Standard InCHIKey | PXLHGVJUPQEPEJ-OTOOEMNYSA-O |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD175170] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC298120
Formula: C36H36O19
Ingredient ID: NPC298120
| Common Name | n.a. |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cc(O)cc3c2cc(O[C@@H]2O[C@H](COC(=O)C=Cc4ccc(cc4)O)[C@H]([C@@H]([C@H]2O)O)O)c([o+]3)c2cc(O)c(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C36H36O19/c37-12-24-28(44)30(46)32(48)35(54-24)52-22-10-17(39)9-21-18(22)11-23(34(51-21)15-7-19(40)27(43)20(41)8-15)53-36-33(49)31(47)29(45)25(55-36)13-50-26(42)6-3-14-1-4-16(38)5-2-14/h1-11,24-25,28-33,35-37,44-49H,12-13H2,(H4-,38,39,40,41,42,43)/p+1/t24-,25-,28-,29-,30+,31+,32-,33-,35-,36-/m1/s1 |
| Standard InCHIKey | HXWHJZIJSNBCJX-QHVGLBQHSA-O |
| Ingredient External Links |
PubChem CID: 101633884 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD194652] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC295990
Formula: C39H38O21
Ingredient ID: NPC295990
| Common Name | n.a. |
| IUPAC Name | 3-[[(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-7-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxychromenylium-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid |
| Canonical SMILES | O=C(C=Cc1ccc(cc1)O)OC[C@H]1O[C@@H](Oc2cc3c(cc(cc3[o+]c2c2ccc(c(c2)O)O)O)O[C@@H]2O[C@H](COC(=O)CC(=O)O)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C39H38O21/c40-18-5-1-16(2-6-18)3-8-29(46)54-14-26-31(48)34(51)36(53)39(60-26)58-25-12-20-23(56-37(25)17-4-7-21(42)22(43)9-17)10-19(41)11-24(20)57-38-35(52)33(50)32(49)27(59-38)15-55-30(47)13-28(44)45/h1-12,26-27,31-36,38-39,48-53H,13-15H2,(H4-,40,41,42,43,44,45,46)/p+1/t26-,27-,31-,32-,33+,34+,35-,36-,38-,39-/m1/s1 |
| Standard InCHIKey | HCZDGTUAMVKZNE-KMKFZPLVSA-O |
| Ingredient External Links |
PubChem CID: 101586992 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD76173] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rumex obtusifolius | Rumex | Polygonaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Perilla frutescens | Perilla | Lamiaceae |
|
Ingredient ID: NPC292792
Formula: C11H14O2
Ingredient ID: NPC292792
| Common Name | Methyleugenol |
| IUPAC Name | 1,2-dimethoxy-4-prop-2-enylbenzene |
| Canonical SMILES | C=CCc1ccc(c(c1)OC)OC |
| Standard InCHI | InChI=1S/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4,6-8H,1,5H2,2-3H3 |
| Standard InCHIKey | ZYEMGPIYFIJGTP-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 7127 ChEMBL ID: CHEMBL108861 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD30490] Database: NPASS [NPC292792] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Caesalpinia bonducella | Caesalpinia | Fabaceae |
|
| Artemisia capillaris | Artemisia | Asteraceae |
|
| Akebia trifoliata | Akebia | Lardizabalaceae |
|
| Arnebia euchroma | Arnebia | Boraginaceae |
|
| Angelica gigas | Angelica | Apiaceae |
|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Lithospermum erythrorhizon | Lithospermum | Boraginaceae |
|
| Illicium difengpi | Illicium | Schisandraceae |
|
| Asarum heterotropoides | Asarum | Aristolochiaceae | |
| Asarum heterotropoides f. schm. var. mandshuricum (maxim.) kitag. | Asarum | Aristolochiaceae | |
| Cornus officinalis | Cornus | Cornaceae |
|
| Sinapis semen | Sinapis | Brassicaceae | |
| Magnolia liliiflora | Magnolia | Magnoliaceae | |
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Garcinia oligantha | Garcinia | Clusiaceae | |
| Rosa rugosa | Rosa | Rosaceae |
|
| Actaea dahurica | Actaea | Ranunculaceae |
|
| Angelica sinensis | Angelica | Apiaceae |
|
| Actaea cimicifuga | Actaea | Ranunculaceae |
|
| Iris spuria | Iris | Iridaceae |
|
| Scutellaria barbata | Scutellaria | Lamiaceae |
|
| Eucalyptus hybrid | Eucalyptus | Myrtaceae | |
| Daucus carota | Daucus | Apiaceae |
|
| Aconitum episcopale | Aconitum | Ranunculaceae | |
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Mosla chinensis | Mosla | Lamiaceae |
|
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Pinellia ternata | Pinellia | Araceae |
|
| Sophora flavescens | Sophora | Fabaceae |
|
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Michelia alba | Michelia | Magnoliaceae |
|
| Akebia quinata | Akebia | Lardizabalaceae |
|
| Arnebia guttata | Arnebia | Boraginaceae |
|
| Ocimum basilicum | Ocimum | Lamiaceae |
|
| Zingiber officinale | Zingiber | Zingiberaceae |
|
| Elsholtzia ciliata | Elsholtzia | Lamiaceae |
|
| Polygala sibirica | Polygala | Polygalaceae |
|
| Cnidium officinale | Cnidium | Apiaceae |
|
| Coptis omeiensis | Coptis | Ranunculaceae |
|
| Elsholtzia splendens | Elsholtzia | Lamiaceae |
|
| Ocimum gratissimum | Ocimum | Lamiaceae |
|
| Acorus calamus | Acorus | Acoraceae |
|
| Chaenomeles sinensis | Chaenomeles | Rosaceae |
|
| Agastache rugosa | Agastache | Lamiaceae |
|
| Piper betle | Piper | Piperaceae |
|
| Polygala tenuifolia | Polygala | Polygalaceae |
|
| Actaea simplex | Actaea | Ranunculaceae | |
| Artemisia argyi | Artemisia | Asteraceae |
|
| Phyllanthus emblica | Phyllanthus | Phyllanthaceae |
|
| Artemisia coerulescens | Artemisia | Asteraceae | |
| Angelica acutiloba | Angelica | Apiaceae |
|
| Magnolia liliflora | Magnolia | Magnoliaceae |
|
| Ligusticum chuanxiong | Ligusticum | Apiaceae |
|
| Artemisia capillaries | Artemisia | Asteraceae | |
| Citrus limon | Citrus | Rutaceae |
|
| Ardisia arborescens | Ardisia | Primulaceae |
|
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Isatis tinctoria | Isatis | Brassicaceae |
|
| Alpinia galanga | Alpinia | Zingiberaceae |
|
| Myristica fragrans | Myristica | Myristicaceae |
|
| Zanthoxylum bungeanum | Zanthoxylum | Rutaceae |
|
| Campsis flos | Campsis | Bignoniaceae | |
| Acorus gramineus | Acorus | Acoraceae |
|
| Asarum sieboldii | Asarum | Aristolochiaceae |
|
| Clematis chinensis | Clematis | Ranunculaceae |
|
| Rubus trifidus | Rubus | Rosaceae |
|
| Elettaria cardamomum | Elettaria | Zingiberaceae |
|
| Cinnamomum aromaticum | Cinnamomum | Lauraceae |
|
| Magnolia officinalis rehd et wils | Magnolia | Magnoliaceae | |
| Acorus tatarinowii | Acorus | Acoraceae |
|
| Glehnia littoralis | Glehnia | Apiaceae |
|
| Rosa multiflora | Rosa | Rosaceae |
|
Ingredient ID: NPC268868
Formula: C39H38O21
Ingredient ID: NPC268868
| Common Name | n.a. |
| IUPAC Name | 3-[[(2R,3S,4S,5R,6S)-6-[3-[(2S,3R,4S,5S,6R)-6-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-7-hydroxy-2-(4-hydroxyphenyl)chromenylium-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid |
| Canonical SMILES | OC(=[O+]C[C@H]1O[C@@H](OC2=Cc3c(cc(cc3OC2=C2C=CC(=O)C=C2)O)O[C@@H]2O[C@H](COC(=O)CC(=O)O)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O)C=Cc1ccc(c(c1)O)O |
| Standard InCHI | InChI=1S/C39H38O21/c40-18-5-3-17(4-6-18)37-25(58-39-36(53)34(51)31(48)26(60-39)14-54-29(46)8-2-16-1-7-21(42)22(43)9-16)12-20-23(56-37)10-19(41)11-24(20)57-38-35(52)33(50)32(49)27(59-38)15-55-30(47)13-28(44)45/h1-12,26-27,31-36,38-39,48-53H,13-15H2,(H4-,40,41,42,43,44,45,46)/p+1/t26-,27-,31-,32-,33+,34+,35-,36-,38-,39-/m1/s1 |
| Standard InCHIKey | HWGACSBPJIKSNP-KMKFZPLVSA-O |
| Ingredient External Links |
PubChem CID: 5282162 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD166071] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC265184
Formula: C40H40O22
Ingredient ID: NPC265184
| Common Name | n.a. |
| IUPAC Name | 3-[[(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxy-5-methoxyphenyl)-7-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxychromenylium-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid |
| Canonical SMILES | COc1cc(cc(c1O)O)c1[o+]c2cc(O)cc(c2cc1O[C@@H]1O[C@H](COC(=O)C=Cc2ccc(cc2)O)[C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@H](COC(=O)CC(=O)O)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C40H40O22/c1-55-24-9-17(8-21(43)31(24)48)38-25(60-40-37(54)35(52)32(49)26(62-40)14-56-29(46)7-4-16-2-5-18(41)6-3-16)12-20-22(58-38)10-19(42)11-23(20)59-39-36(53)34(51)33(50)27(61-39)15-57-30(47)13-28(44)45/h2-12,26-27,32-37,39-40,49-54H,13-15H2,1H3,(H4-,41,42,43,44,45,46,48)/p+1/t26-,27-,32-,33-,34+,35+,36-,37-,39-,40-/m1/s1 |
| Standard InCHIKey | ZCJAIHSCFUFLJV-KZGNYCDPSA-O |
| Ingredient External Links |
PubChem CID: 100921412 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD31512] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC257124
Formula: C10H12O2
Ingredient ID: NPC257124
| Common Name | Eugenol |
| IUPAC Name | 2-methoxy-4-prop-2-enylphenol |
| Canonical SMILES | C=CCc1ccc(c(c1)OC)O |
| Standard InCHI | InChI=1S/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3,5-7,11H,1,4H2,2H3 |
| Standard InCHIKey | RRAFCDWBNXTKKO-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 3314 ChEMBL ID: CHEMBL42710 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD45145] Database: NPASS [NPC257124] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper attenuatum | Piper | Piperaceae |
|
| Artemisia montana | Artemisia | Asteraceae |
|
| Artemisia hanseniana | Artemisia | Asteraceae | |
| Caesalpinia bonducella | Caesalpinia | Fabaceae |
|
| Cistanche deserticola | Cistanche | Orobanchaceae |
|
| Asteriscus aquaticus | Asteriscus | Asteraceae | |
| Cinnamomum subavenium | Cinnamomum | Lauraceae |
|
| Artemisia capillaris | Artemisia | Asteraceae |
|
| Piper cubeba | Piper | Piperaceae |
|
| Akebia trifoliata | Akebia | Lardizabalaceae |
|
| Pseudowintera colorata | Pseudowintera | Winteraceae | |
| Arnebia euchroma | Arnebia | Boraginaceae |
|
| Kopsia grandifolia | Kopsia | Apocynaceae | |
| Strophanthus sarmentosus var. senegambiae | Strophanthus | Apocynaceae | |
| Phebalium dentatum | Phebalium | Rutaceae | |
| Ecballium elaterium | Ecballium | Cucurbitaceae |
|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Lithospermum erythrorhizon | Lithospermum | Boraginaceae |
|
| Capparis ovata | Capparis | Capparaceae |
|
| Croton montevidensis | Croton | Euphorbiaceae | |
| Illicium difengpi | Illicium | Schisandraceae |
|
| Ledebouria socialis | Ledebouria | Hyacinthaceae | |
| Murraya exotica | Murraya | Rutaceae |
|
| Datisca glomerata | Datisca | Datiscaceae | |
| Lycopus europaeus | Lycopus | Lamiaceae |
|
| Artemisia jacutica | Artemisia | Asteraceae | |
| Quercus imbricaria | Quercus | Fagaceae |
|
| Dipterocarpus dyeri | Dipterocarpus | Dipterocarpaceae | |
| Dioscorea olfersiana | Dioscorea | Dioscoreaceae |
|
| Cornus officinalis | Cornus | Cornaceae |
|
| Cassine papillosa | Cassine | Celastraceae |
|
| Siphonostegia chinensis | Siphonostegia | Orobanchaceae |
|
| Thymus quinquecostatus | Thymus | Lamiaceae |
|
| Ipomoea cairica | Ipomoea | Convolvulaceae |
|
| Rhodomyrtus tomentosa | Rhodomyrtus | Myrtaceae |
|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Magnolia liliiflora | Magnolia | Magnoliaceae | |
| Coptis japonica | Coptis | Ranunculaceae |
|
| Ceanothus velutinus | Ceanothus | Rhamnaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Mentha canadensis | Mentha | Lamiaceae |
|
| Humulus lupulus | Humulus | Cannabaceae |
|
| Garcinia scortechinii | Garcinia | Clusiaceae | |
| Uncaria macrophylla | Uncaria | Rubiaceae |
|
| Apollonias barbujana | Apollonias | Lauraceae | |
| Chlorophytum borivilianum | Chlorophytum | Asparagaceae |
|
| Bersama abyssinica | Bersama | Melianthaceae |
|
| Vitex negundo | Vitex | Lamiaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Prunus persica | Prunus | Rosaceae |
|
| Rumex obtusifolius | Rumex | Polygonaceae |
|
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Artemisia afra | Artemisia | Asteraceae |
|
| Actaea dahurica | Actaea | Ranunculaceae |
|
| Zea mays | Zea | Poaceae |
|
| Actaea cimicifuga | Actaea | Ranunculaceae |
|
| Scutellaria barbata | Scutellaria | Lamiaceae |
|
| Daucus carota | Daucus | Apiaceae |
|
| Isodon lophanthoides | Isodon | Lamiaceae |
|
| Elsholtzia bodinieri | Elsholtzia | Lamiaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Aconitum sajanense | Aconitum | Ranunculaceae | |
| Fragaria vesca | Fragaria | Rosaceae |
|
| Mosla chinensis | Mosla | Lamiaceae |
|
| Rosa chinensis | Rosa | Rosaceae |
|
| Solanum torvum | Solanum | Solanaceae |
|
| Diospyros kaki | Diospyros | Ebenaceae |
|
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Artemisia scoparia | Artemisia | Asteraceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Pinellia ternata | Pinellia | Araceae |
|
| Podocarpus elongata | Podocarpus | Podocarpaceae | |
| Strychnos triplinervia | Strychnos | Loganiaceae |
|
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Thymus vulgaris | Thymus | Lamiaceae |
|
| Akebia quinata | Akebia | Lardizabalaceae |
|
| Palicourea alpina | Palicourea | Rubiaceae | |
| Lupinus formosus | Lupinus | Fabaceae | |
| Wunderlichia mirabilis | Wunderlichia | Asteraceae | |
| Posoqueria latifolia | Posoqueria | Rubiaceae |
|
| Dicliptera riparia | Dicliptera | Acanthaceae |
|
| Oxandra xylopioides | Oxandra | Annonaceae | |
| Phyllanthus oligospermus | Phyllanthus | Phyllanthaceae | |
| Arnebia guttata | Arnebia | Boraginaceae |
|
| Ocimum basilicum | Ocimum | Lamiaceae |
|
| Lasianthus fordii | Lasianthus | Rubiaceae | |
| Ilex kaushue | Ilex | Aquifoliaceae |
|
| Zingiber officinale | Zingiber | Zingiberaceae |
|
| Dalbergia frutescens | Dalbergia | Fabaceae | |
| Colchicum macedonicum | Colchicum | Colchicaceae | |
| Euphorbia caducifolia | Euphorbia | Euphorbiaceae |
|
| Boronia muelleri | Boronia | Rutaceae | |
| Coprosma acerosa | Coprosma | Rubiaceae |
|
| Astilbe koreana | Astilbe | Saxifragaceae | |
| Scrophularia smithii | Scrophularia | Scrophulariaceae | |
| Artemisia dracunculus | Artemisia | Asteraceae |
|
| Eupatorium fortunei | Eupatorium | Asteraceae |
|
| Elsholtzia ciliata | Elsholtzia | Lamiaceae |
|
| Anethum graveolens | Anethum | Apiaceae |
|
| Hypericum papuanum | Hypericum | Hypericaceae |
|
| Zilla spinosa | Zilla | Brassicaceae |
|
| Cnidium officinale | Cnidium | Apiaceae |
|
| Kaunia arbuscularis | Kaunia | Asteraceae | |
| Trifolium pratense | Trifolium | Fabaceae |
|
| Sambucus ebulus | Sambucus | Adoxaceae |
|
| Ficus carica | Ficus | Moraceae |
|
| Inula thapsoides | Inula | Asteraceae | |
| Tylophora flava | Tylophora | Apocynaceae | |
| Limeum pterocarpum | Limeum | Limeaceae | |
| Coptis omeiensis | Coptis | Ranunculaceae |
|
| Trifolium alexandrium | Trifolium | Fabaceae |
|
| Coptis deltoidea | Coptis | Ranunculaceae |
|
| Cassia carnaval | Cassia | Fabaceae | |
| Salix sieboldiana | Salix | Salicaceae | |
| Bistorta officinalis | Bistorta | Polygonaceae |
|
| Mentha arvensis | Mentha | Lamiaceae |
|
| Camellia saluenensis | Camellia | Theaceae |
|
| Elsholtzia splendens | Elsholtzia | Lamiaceae |
|
| Alpinia officinarum | Alpinia | Zingiberaceae |
|
| Paeonia veitchii | Paeonia | Paeoniaceae |
|
| Dillenia papuana | Dillenia | Dilleniaceae | |
| Polyalthia nemoralis | Polyalthia | Annonaceae |
|
| Achillea millefolium | Achillea | Asteraceae |
|
| Nepeta cataria | Nepeta | Lamiaceae |
|
| Artemisia princeps | Artemisia | Asteraceae |
|
| Ocimum gratissimum | Ocimum | Lamiaceae |
|
| Acorus calamus | Acorus | Acoraceae |
|
| Solanum andigena | Solanum | Solanaceae | |
| Chaenomeles sinensis | Chaenomeles | Rosaceae |
|
| Agastache rugosa | Agastache | Lamiaceae |
|
| Bistorta manshuriensis | Bistorta | Polygonaceae | |
| Piper betle | Piper | Piperaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Actaea simplex | Actaea | Ranunculaceae | |
| Achillea moschata | Achillea | Asteraceae | |
| Jacaranda caucana | Jacaranda | Bignoniaceae | |
| Senna alexandrina | Senna | Fabaceae |
|
| Morus alba | Morus | Moraceae |
|
| Artemisia argyi | Artemisia | Asteraceae |
|
| Foeniculum vulgare | Foeniculum | Apiaceae |
|
| Bowdichia nitida | Bowdichia | Fabaceae | |
| Phyllanthus emblica | Phyllanthus | Phyllanthaceae |
|
| Eschweilera coriacea | Eschweilera | Lecythidaceae |
|
| Prunus mume | Prunus | Rosaceae |
|
| Piper nigrum | Piper | Piperaceae |
|
| Artemisia coerulescens | Artemisia | Asteraceae | |
| Coptis teeta | Coptis | Ranunculaceae |
|
| Litsea cubeba | Litsea | Lauraceae |
|
| Panax ginseng | Panax | Araliaceae |
|
| Cranfillia vulcanica | Cranfillia | Blechnaceae | |
| Bupleurum chinense | Bupleurum | Apiaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Laurus nobilis | Laurus | Lauraceae |
|
| Andrographis herba | Andrographis | Acanthaceae | |
| Magnolia liliflora | Magnolia | Magnoliaceae |
|
| Eugenia caryopyhllata | Eugenia | Myrtaceae | |
| Artemisia capillaries | Artemisia | Asteraceae | |
| Psidium guajava | Psidium | Myrtaceae |
|
| Alstonia undulifolia | Alstonia | Apocynaceae | |
| Aconitum leucostomum | Aconitum | Ranunculaceae |
|
| Amomum neoaurantiacum | Amomum | Zingiberaceae | |
| Scrophularia koelzii | Scrophularia | Scrophulariaceae |
|
| Eucalyptus cladocalyx | Eucalyptus | Myrtaceae |
|
| Syzygium aromaticum | Syzygium | Myrtaceae |
|
| Aquilegia ecalcarata | Aquilegia | Ranunculaceae |
|
| Betula platyphylla | Betula | Betulaceae |
|
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Polygonum flaccidum | Polygonum | Polygonaceae |
|
| Cassia jahnii | Cassia | Fabaceae | |
| Isatis tinctoria | Isatis | Brassicaceae |
|
| Persea mexicana | Persea | Lauraceae | |
| Tanacetum santolinoides | Tanacetum | Asteraceae |
|
| Persicaria thunbergii | Persicaria | Polygonaceae |
|
| Scrophularia ningpoensis | Scrophularia | Scrophulariaceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Hubertia tomentosa | Hubertia | Asteraceae | |
| Alpinia galanga | Alpinia | Zingiberaceae |
|
| Myristica fragrans | Myristica | Myristicaceae |
|
| Zanthoxylum bungeanum | Zanthoxylum | Rutaceae |
|
| Ligustrum obtusifolium | Ligustrum | Oleaceae |
|
| Campsis flos | Campsis | Bignoniaceae | |
| Coptis chinensis | Coptis | Ranunculaceae |
|
| Ulva pertusa | Ulva | Ulvaceae |
|
| Helichrysum auriceps | Helichrysum | Asteraceae | |
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Asarum sieboldii | Asarum | Aristolochiaceae |
|
| Scrophularia buergeriana | Scrophularia | Scrophulariaceae |
|
| Salvadora persica | Salvadora | Salvadoraceae |
|
| Artemisia klotzchiana | Artemisia | Asteraceae | |
| Cinnamomum camphora | Cinnamomum | Lauraceae |
|
| Avrainvillea rawsonii | Avrainvillea | Udoteaceae | |
| Salvia xalapensis | Salvia | Lamiaceae | |
| Gardenia tubifera | Gardenia | Rubiaceae |
|
| Toddalia asiatica | Toddalia | Rutaceae |
|
| Panax innovans | Panax | Araliaceae | |
| Cannabis sativa | Cannabis | Cannabaceae |
|
| Fagus fusca | Fagus | Fagaceae | |
| Damnacanthus major | Damnacanthus | Rubiaceae | |
| Elettaria cardamomum | Elettaria | Zingiberaceae |
|
| Spiracantha cornifolia | Spiracantha | Asteraceae | |
| Commiphora myrrha | Commiphora | Burseraceae |
|
| Tylophora tanakae | Tylophora | Apocynaceae | |
| Blumea mollis | Blumea | Asteraceae |
|
| Cinnamomum aromaticum | Cinnamomum | Lauraceae |
|
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
| Magnolia officinalis rehd et wils | Magnolia | Magnoliaceae | |
| Myristica cagayanensis | Myristica | Myristicaceae | |
| Ficus elastica | Ficus | Moraceae |
|
| Stauntonia hexaphylla | Stauntonia | Lardizabalaceae |
|
| Perilla frutescens | Perilla | Lamiaceae |
|
| Acorus tatarinowii | Acorus | Acoraceae |
|
| Epipactis palustris | Epipactis | Orchidaceae | |
| Rubus sanctus | Rubus | Rosaceae |
|
| Charpentiera obovata | Charpentiera | Amaranthaceae | |
| Lotus ucrainicus | Lotus | Fabaceae | |
| Peltodon longipes | Peltodon | Lamiaceae |
Ingredient ID: NPC248296
Formula: C36H36O18
Ingredient ID: NPC248296
| Common Name | n.a. |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-2-(4-hydroxyphenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cc(O)cc3c2C=C(O[C@@H]2O[C@H](C[O+]=C(C=Cc4ccc(c(c4)O)O)O)[C@H]([C@@H]([C@H]2O)O)O)C(=C2C=CC(=O)C=C2)O3)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C36H36O18/c37-13-25-28(43)30(45)32(47)35(53-25)51-23-11-18(39)10-22-19(23)12-24(34(50-22)16-3-5-17(38)6-4-16)52-36-33(48)31(46)29(44)26(54-36)14-49-27(42)8-2-15-1-7-20(40)21(41)9-15/h1-12,25-26,28-33,35-37,43-48H,13-14H2,(H3-,38,39,40,41,42)/p+1/t25-,26-,28-,29-,30+,31+,32-,33-,35-,36-/m1/s1 |
| Standard InCHIKey | MLLMLJXCGLXOIJ-AQAMAIGXSA-O |
| Ingredient External Links |
PubChem CID: 5282161 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD33367] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC239931
Formula: C9H10O
Ingredient ID: NPC239931
| Common Name | n.a. |
| IUPAC Name | (E)-3-phenylprop-2-en-1-ol |
| Canonical SMILES | OC/C=C/c1ccccc1 |
| Standard InCHI | InChI=1S/C9H10O/c10-8-4-7-9-5-2-1-3-6-9/h1-7,10H,8H2/b7-4+ |
| Standard InCHIKey | OOCCDEMITAIZTP-QPJJXVBHSA-N |
| Ingredient External Links |
PubChem CID: 5315892 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD28633] Database: NPASS [NPC239931] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Liquidambar orientalis | Liquidambar | Altingiaceae |
|
| Artemisia montana | Artemisia | Asteraceae |
|
| Styrax benzoin | Styrax | Styracaceae |
|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Styrax tonkinensis | Styrax | Styracaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Styrax | Styrax | Styracaceae |
|
| Artemisia princeps | Artemisia | Asteraceae |
|
| Artemisia argyi | Artemisia | Asteraceae |
|
| Cinnamomum cassia | Cinnamomum | Lauraceae |
|
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Stellera chamaejasme | Stellera | Thymelaeaceae |
|
| Cinnamomum aromaticum | Cinnamomum | Lauraceae |
|
Ingredient ID: NPC23837
Formula: C8H10O2
Ingredient ID: NPC23837
| Common Name | 1,4-Dimethoxybenzene |
| IUPAC Name | 1,4-dimethoxybenzene |
| Canonical SMILES | COc1ccc(cc1)OC |
| Standard InCHI | InChI=1S/C8H10O2/c1-9-7-3-5-8(10-2)6-4-7/h3-6H,1-2H3 |
| Standard InCHIKey | OHBQPCCCRFSCAX-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 9016 ChEMBL ID: CHEMBL1668604 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD170938] Database: NPASS [NPC23837] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Foeniculum vulgare | Foeniculum | Apiaceae |
|
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC235059
Formula: C9H8O
Ingredient ID: NPC235059
| Common Name | Cinnamaldehyde |
| IUPAC Name | (E)-3-phenylprop-2-enal |
| Canonical SMILES | O=C/C=C/c1ccccc1 |
| Standard InCHI | InChI=1S/C9H8O/c10-8-4-7-9-5-2-1-3-6-9/h1-8H/b7-4+ |
| Standard InCHIKey | KJPRLNWUNMBNBZ-QPJJXVBHSA-N |
| Ingredient External Links |
PubChem CID: 637511 ChEMBL ID: CHEMBL293492 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD152606] Database: NPASS [NPC235059] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Liquidambar orientalis | Liquidambar | Altingiaceae |
|
| Akebia trifoliata | Akebia | Lardizabalaceae |
|
| Styrax benzoin | Styrax | Styracaceae |
|
| Arnebia euchroma | Arnebia | Boraginaceae |
|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Lithospermum erythrorhizon | Lithospermum | Boraginaceae |
|
| Lophophora williamsii | Lophophora | Cactaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Ophiopogon intermedius | Ophiopogon | Asparagaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Actaea dahurica | Actaea | Ranunculaceae |
|
| Actaea cimicifuga | Actaea | Ranunculaceae |
|
| Daucus carota | Daucus | Apiaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Ephedra herba | Ephedra | Ephedraceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Pinellia ternata | Pinellia | Araceae |
|
| Podocarpus elongata | Podocarpus | Podocarpaceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Akebia quinata | Akebia | Lardizabalaceae |
|
| Styrax | Styrax | Styracaceae |
|
| Arnebia guttata | Arnebia | Boraginaceae |
|
| Kaempferia galanga | Kaempferia | Zingiberaceae |
|
| Polyalthia nemoralis | Polyalthia | Annonaceae |
|
| Saussurea costus | Saussurea | Asteraceae |
|
| Actaea simplex | Actaea | Ranunculaceae | |
| Eschweilera coriacea | Eschweilera | Lecythidaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Eugenia caryopyhllata | Eugenia | Myrtaceae | |
| Cinnamomum cassia | Cinnamomum | Lauraceae |
|
| Eucalyptus cladocalyx | Eucalyptus | Myrtaceae |
|
| Syzygium aromaticum | Syzygium | Myrtaceae |
|
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Tanacetum cinerariifolium | Tanacetum | Asteraceae |
|
| Traversia baccharoides | Traversia | Asteraceae | |
| Ulva pertusa | Ulva | Ulvaceae |
|
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Salvadora persica | Salvadora | Salvadoraceae |
|
| Elettaria cardamomum | Elettaria | Zingiberaceae |
|
| Commiphora myrrha | Commiphora | Burseraceae |
|
| Cinnamomum aromaticum | Cinnamomum | Lauraceae |
|
| Porophyllum ruderale | Porophyllum | Asteraceae |
|
| Peltodon longipes | Peltodon | Lamiaceae |
Ingredient ID: NPC229827
Formula: C29H34O17
Ingredient ID: NPC229827
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OCC(=O)[C@H]([C@@H]([C@@H](CO/C=C(/[C@H]([C@@H]([C@@H](COc1cc(O)c2c(c1)oc(cc2=O)c1cc(OC)c(c(c1)OC)O)O)O)O)O)O)O)O |
| Standard InCHI | InChI=1S/C29H34O17/c1-42-22-3-12(4-23(43-2)29(22)41)20-7-15(32)24-14(31)5-13(6-21(24)46-20)45-11-19(36)28(40)27(39)18(35)10-44-9-17(34)26(38)25(37)16(33)8-30/h3-7,10,17,19,25-28,30-31,34-41H,8-9,11H2,1-2H3/b18-10-/t17-,19-,25-,26-,27-,28-/m1/s1 |
| Standard InCHIKey | KLRXONYCJFOSBN-OUBZPLHOSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD185685] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC226490
Formula: C39H38O23
Ingredient ID: NPC226490
| Common Name | n.a. |
| IUPAC Name | 3-[[(2R,3S,4S,5R,6S)-6-[3-[(2S,3R,4S,5S,6R)-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-7-hydroxy-2-(3,4,5-trihydroxyphenyl)chromenylium-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid |
| Canonical SMILES | O=C(C=Cc1ccc(c(c1)O)O)OC[C@H]1O[C@@H](Oc2cc3c(cc(cc3[o+]c2c2cc(O)c(c(c2)O)O)O)O[C@@H]2O[C@H](COC(=O)CC(=O)O)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C39H38O23/c40-16-8-22-17(23(9-16)59-38-35(54)33(52)32(51)26(61-38)13-57-29(48)11-27(45)46)10-24(37(58-22)15-6-20(43)30(49)21(44)7-15)60-39-36(55)34(53)31(50)25(62-39)12-56-28(47)4-2-14-1-3-18(41)19(42)5-14/h1-10,25-26,31-36,38-39,50-55H,11-13H2,(H6-,40,41,42,43,44,45,46,47,49)/p+1/t25-,26-,31-,32-,33+,34+,35-,36-,38-,39-/m1/s1 |
| Standard InCHIKey | BRCDVDQOVIAQRF-AWJFVBHYSA-O |
| Ingredient External Links |
PubChem CID: 101633888 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD43947] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC217423
Formula: C10H12O3
Ingredient ID: NPC217423
| Common Name | n.a. |
| IUPAC Name | ethyl 2-methoxybenzoate |
| Canonical SMILES | CCOC(=O)c1ccccc1OC |
| Standard InCHI | InChI=1S/C10H12O3/c1-3-13-10(11)8-6-4-5-7-9(8)12-2/h4-7H,3H2,1-2H3 |
| Standard InCHIKey | FNODWEPAWIJGPM-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 81784 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD133719] Database: NPASS [NPC217423] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC200209
Formula: C36H36O18
Ingredient ID: NPC200209
| Common Name | n.a. |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cc(O)cc3c2cc(O[C@@H]2O[C@H](COC(=O)C=Cc4ccc(cc4)O)[C@H]([C@@H]([C@H]2O)O)O)c([o+]3)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C36H36O18/c37-13-25-28(43)30(45)32(47)35(53-25)51-23-11-18(39)10-22-19(23)12-24(34(50-22)16-4-7-20(40)21(41)9-16)52-36-33(48)31(46)29(44)26(54-36)14-49-27(42)8-3-15-1-5-17(38)6-2-15/h1-12,25-26,28-33,35-37,43-48H,13-14H2,(H3-,38,39,40,41,42)/p+1/t25-,26-,28-,29-,30+,31+,32-,33-,35-,36-/m1/s1 |
| Standard InCHIKey | YPXWWSJGANMFFQ-AQAMAIGXSA-O |
| Ingredient External Links |
PubChem CID: 5282068 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD52924] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Artemisia hanseniana | Artemisia | Asteraceae | |
| Kopsia grandifolia | Kopsia | Apocynaceae | |
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Ledebouria socialis | Ledebouria | Hyacinthaceae | |
| Lycopus europaeus | Lycopus | Lamiaceae |
|
| Dipterocarpus dyeri | Dipterocarpus | Dipterocarpaceae | |
| Ipomoea cairica | Ipomoea | Convolvulaceae |
|
| Ceanothus velutinus | Ceanothus | Rhamnaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Garcinia scortechinii | Garcinia | Clusiaceae | |
| Apollonias barbujana | Apollonias | Lauraceae | |
| Chlorophytum borivilianum | Chlorophytum | Asparagaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Isodon lophanthoides | Isodon | Lamiaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Fragaria vesca | Fragaria | Rosaceae |
|
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Lasianthus fordii | Lasianthus | Rubiaceae | |
| Aconitum leucostomum | Aconitum | Ranunculaceae |
|
| Aquilegia ecalcarata | Aquilegia | Ranunculaceae |
|
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Persea mexicana | Persea | Lauraceae | |
| Gardenia tubifera | Gardenia | Rubiaceae |
|
| Panax innovans | Panax | Araliaceae | |
| Blumea mollis | Blumea | Asteraceae |
|
| Perilla frutescens | Perilla | Lamiaceae |
|
Ingredient ID: NPC195807
Formula: C35H44O21
Ingredient ID: NPC195807
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@@H]1O[C@H](Oc2c(OC)cc(cc2OC)c2oc3cc(O[C@@H]4O[C@@H](CO[C@H]5O[C@@H](C)[C@@H]([C@H]([C@@H]5O)O)O)[C@@H]([C@@H]([C@@H]4O)O)O)cc(c3c(=O)c2)O)[C@@H]([C@@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C35H44O21/c1-11-23(39)26(42)29(45)33(51-11)50-10-21-25(41)28(44)30(46)34(55-21)52-13-6-14(37)22-15(38)8-16(53-17(22)7-13)12-4-18(48-2)32(19(5-12)49-3)56-35-31(47)27(43)24(40)20(9-36)54-35/h4-8,11,20-21,23-31,33-37,39-47H,9-10H2,1-3H3/t11-,20-,21-,23-,24+,25-,26+,27+,28-,29-,30-,31+,33-,34+,35+/m0/s1 |
| Standard InCHIKey | DTHALOCPATWECM-PVHPJOTLSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD88731] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC188907
Formula: C9H10O3
Ingredient ID: NPC188907
| Common Name | n.a. |
| IUPAC Name | methyl 2-methoxybenzoate |
| Canonical SMILES | COC(=O)c1ccccc1OC |
| Standard InCHI | InChI=1S/C9H10O3/c1-11-8-6-4-3-5-7(8)9(10)12-2/h3-6H,1-2H3 |
| Standard InCHIKey | PFYHAAAQPNMZHO-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 61151 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD68736] Database: NPASS [NPC188907] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC168623
Formula: C27H30O15
Ingredient ID: NPC168623
| Common Name | n.a. |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[7-hydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-5-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cc(O)cc3c2cc(O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)c([o+]3)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C27H30O15/c28-8-17-19(32)21(34)23(36)26(41-17)39-15-6-12(31)5-14-13(15)7-16(25(38-14)10-1-3-11(30)4-2-10)40-27-24(37)22(35)20(33)18(9-29)42-27/h1-7,17-24,26-29,32-37H,8-9H2,(H-,30,31)/p+1/t17-,18-,19-,20-,21+,22+,23-,24-,26-,27-/m1/s1 |
| Standard InCHIKey | SLCKJKWFULXZBD-ZOTFFYTFSA-O |
| Ingredient External Links |
PubChem CID: 441772 ZINC ID: ZINC000004097757 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Conyza canadensis | Conyza | Asteraceae |
|
| Coreopsis fasciculata | Coreopsis | Asteraceae | |
| Selinum carvifolium | Selinum | Apiaceae | |
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Thuja plicata | Thuja | Cupressaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Crepis foetida | Crepis | Asteraceae |
|
| Cirsium japonicum | Cirsium | Asteraceae |
|
| Dorstenia lindeniana | Dorstenia | Moraceae | |
| Dioscoreophyllum cumminsii | Dioscoreophyllum | Menispermaceae |
|
| Phytolacca acinosa | Phytolacca | Phytolaccaceae |
|
| Garcinia hombroniana | Garcinia | Clusiaceae |
|
| Cardiospermum halicacabum | Cardiospermum | Sapindaceae |
|
| Aglaia elaeagnoidea | Aglaia | Meliaceae |
|
| Punica granatum | Punica | Lythraceae |
|
| Urtica triangularis | Urtica | Urticaceae |
|
| Pouzolzia occidentalis | Pouzolzia | Urticaceae | |
| Centaurea nigrescens | Centaurea | Asteraceae |
|
| Piper arboreum | Piper | Piperaceae |
|
| Parastrephia lepidophylla | Parastrephia | Asteraceae | |
| Phlogacanthus thyrsiflorus | Phlogacanthus | Acanthaceae |
|
| Euphorbia segetalis | Euphorbia | Euphorbiaceae | |
| Sidastrum acuminatum | Sidastrum | Malvaceae | |
| Syncolostemon parviflorus | Syncolostemon | Lamiaceae | |
| Aristolochia elegans | Aristolochia | Aristolochiaceae | |
| Penstemon secundiflorus | Penstemon | Plantaginaceae | |
| Cuphea carthagenensis | Cuphea | Lythraceae | |
| Ozoroa insignis | Ozoroa | Anacardiaceae |
|
| Ruta microcarpa | Ruta | Rutaceae |
|
| Crinum defixum | Crinum | Amaryllidaceae |
|
| Zanthoxylum monophyllum | Zanthoxylum | Rutaceae | |
| Astragalus gummifer | Astragalus | Fabaceae |
|
| Triglochin maritima | Triglochin | Juncaginaceae |
|
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Phedimus kamtschaticus | Phedimus | Crassulaceae |
|
Ingredient ID: NPC14209
Formula: C29H34O17
Ingredient ID: NPC14209
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@@H]1O[C@](Oc2cc(O)c3c(c2)oc(cc3=O)c2cc(OC)c(c(c2)OC)O)([C@H]([C@@H]([C@H]1O)O)O)[C@@]1(CO)OC[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C29H34O17/c1-41-18-3-11(4-19(42-2)23(18)36)16-7-14(33)21-13(32)5-12(6-17(21)44-16)45-29(27(40)25(38)24(37)20(8-30)46-29)28(10-31)26(39)22(35)15(34)9-43-28/h3-7,15,20,22,24-27,30-32,34-40H,8-10H2,1-2H3/t15-,20-,22+,24-,25+,26-,27-,28-,29+/m0/s1 |
| Standard InCHIKey | GNNOKZUFEFTFIS-NDYQONEWSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD167671] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC139144
Formula: C38H38O18
Ingredient ID: NPC139144
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC(=[O+]C[C@H]1O[C@@H](OC2=Cc3c(cc(cc3OC2=C2C=CC(=O)C=C2)O)O[C@@H]2O[C@H](COC(=O)C)[C@H]([C@@H]([C@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O)C=Cc1ccc(cc1)O |
| Standard InCHI | InChI=1S/C38H38O18/c1-17(39)50-15-27-30(44)32(46)34(48)37(55-27)53-25-13-22(42)12-24-23(25)14-26(36(52-24)19-5-9-21(41)10-6-19)54-38-35(49)33(47)31(45)28(56-38)16-51-29(43)11-4-18-2-7-20(40)8-3-18/h2-14,27-28,30-35,37-38,44-49H,15-16H2,1H3,(H2-,40,41,42,43)/p+1/t27-,28-,30-,31-,32+,33+,34-,35-,37-,38-/m1/s1 |
| Standard InCHIKey | NRMCGRZJALTCIN-UGSGSFAZSA-O |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD192085] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC126106
Formula: C30H32O18
Ingredient ID: NPC126106
| Common Name | n.a. |
| IUPAC Name | 3-oxo-3-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-5-yl]oxyoxan-2-yl]methoxy]propanoic acid |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cc3c(O[C@@H]4O[C@H](COC(=O)CC(=O)O)[C@H]([C@@H]([C@H]4O)O)O)cc(cc3[o+]c2c2ccc(cc2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C30H32O18/c31-9-18-22(37)24(39)26(41)30(47-18)46-17-7-14-15(44-28(17)11-1-3-12(32)4-2-11)5-13(33)6-16(14)45-29-27(42)25(40)23(38)19(48-29)10-43-21(36)8-20(34)35/h1-7,18-19,22-27,29-31,37-42H,8-10H2,(H2-,32,33,34,35)/p+1/t18-,19-,22-,23-,24+,25+,26-,27-,29-,30-/m1/s1 |
| Standard InCHIKey | XAUWJGQEHRUDEM-IEKHAQANSA-O |
| Ingredient External Links |
PubChem CID: 101930173 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD44707] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
Ingredient ID: NPC118343
Formula: C14H12O2
Ingredient ID: NPC118343
| Common Name | Benzyl Benzoate |
| IUPAC Name | benzyl benzoate |
| Canonical SMILES | O=C(c1ccccc1)OCc1ccccc1 |
| Standard InCHI | InChI=1S/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
| Standard InCHIKey | SESFRYSPDFLNCH-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 2345 ZINC ID: ZINC000000001021 ChEMBL ID: CHEMBL1239 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC118343] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Liquidambar orientalis | Liquidambar | Altingiaceae |
|
| Piper attenuatum | Piper | Piperaceae |
|
| Styrax benzoin | Styrax | Styracaceae |
|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Murraya exotica | Murraya | Rutaceae |
|
| Artemisia jacutica | Artemisia | Asteraceae | |
| Styrax tonkinensis | Styrax | Styracaceae |
|
| Sinapis semen | Sinapis | Brassicaceae | |
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Bersama abyssinica | Bersama | Melianthaceae |
|
| Uvaria acuminata | Uvaria | Annonaceae |
|
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Chamaemelum nobile | Chamaemelum | Asteraceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Aconitum sajanense | Aconitum | Ranunculaceae | |
| Schkuhria multiflora | Schkuhria | Asteraceae | |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Strychnos triplinervia | Strychnos | Loganiaceae |
|
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Leonurus japonicus | Leonurus | Lamiaceae |
|
| Solidago decurrens | Solidago | Asteraceae | |
| Anthocleista grandiflora | Anthocleista | Gentianaceae |
|
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Helleborus caucasicus | Helleborus | Ranunculaceae | |
| Lespedeza homoloba | Lespedeza | Fabaceae |
|
| Lolium perenne | Lolium | Poaceae |
|
| Hypoestes serpens | Hypoestes | Acanthaceae |
|
| Primula farinosa | Primula | Primulaceae | |
| Cynomorium songaricum | Cynomorium | Cynomoriaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Rheedia acuminata | Rheedia | Clusiaceae |
|
| Acacia aulacocarpa | Acacia | Fabaceae | |
| Aspidosperma subincanum | Aspidosperma | Apocynaceae |
|
| Syzygium aromaticum | Syzygium | Myrtaceae |
|
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Hypericum perforatum | Hypericum | Hypericaceae |
|
| Cassia jahnii | Cassia | Fabaceae | |
| Ardisia neriifolia | Ardisia | Primulaceae | |
| Psiadia dentata | Psiadia | Asteraceae | |
| Peritassa compta | Peritassa | Celastraceae | |
| Eupatorium argentinum | Eupatorium | Asteraceae | |
| Cryptocarya aschersoniana | Cryptocarya | Lauraceae | |
| Myroxylon pereirae | Myroxylon | Fabaceae | |
| Juniperus brevifolia | Juniperus | Cupressaceae | |
| Avrainvillea rawsonii | Avrainvillea | Udoteaceae | |
| Guatteria boliviana | Guatteria | Annonaceae | |
| Damnacanthus major | Damnacanthus | Rubiaceae | |
| Cinnamomum aromaticum | Cinnamomum | Lauraceae |
|
| Anemone flaccida | Anemone | Ranunculaceae |
|
| Stauntonia hexaphylla | Stauntonia | Lardizabalaceae |
|
| Rubus sanctus | Rubus | Rosaceae |
|
| Rosa multiflora | Rosa | Rosaceae |
|
Ingredient ID: NPC116377
Formula: C7H15NO4
Ingredient ID: NPC116377
| Common Name | 2,5-Imino-2,5,6-Trideoxy-D-Manno-Heptitol |
| IUPAC Name | (2R,3R,4R,5R)-2-(2-hydroxyethyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol |
| Canonical SMILES | OCC[C@H]1N[C@@H]([C@H]([C@@H]1O)O)CO |
| Standard InCHI | InChI=1S/C7H15NO4/c9-2-1-4-6(11)7(12)5(3-10)8-4/h4-12H,1-3H2/t4-,5-,6-,7-/m1/s1 |
| Standard InCHIKey | AGFACLQFIYFFOI-DBRKOABJSA-N |
| Ingredient External Links |
PubChem CID: 10374978 ChEMBL ID: CHEMBL407337 |
| Plant-Ingredient Association Reference |
PMID: 9599261 Database: NPASS [NPC116377] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
Ingredient ID: NPC108218
Formula: C8H10O
Ingredient ID: NPC108218
| Common Name | n.a. |
| IUPAC Name | 2-phenylethanol |
| Canonical SMILES | OCCc1ccccc1 |
| Standard InCHI | InChI=1S/C8H10O/c9-7-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| Standard InCHIKey | WRMNZCZEMHIOCP-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 6054 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD186060] Database: NPASS [NPC108218] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Artemisia montana | Artemisia | Asteraceae |
|
| Artemisia capillaris | Artemisia | Asteraceae |
|
| Akebia trifoliata | Akebia | Lardizabalaceae |
|
| Arnebia euchroma | Arnebia | Boraginaceae |
|
| Aloe vera | Aloe | Xanthorrhoeaceae |
|
| Tetracera alnifolia | Tetracera | Dilleniaceae |
|
| Lithospermum erythrorhizon | Lithospermum | Boraginaceae |
|
| Vepris nobilis | Vepris | Rutaceae |
|
| Camptotheca acuminata | Camptotheca | Nyssaceae |
|
| Cornus officinalis | Cornus | Cornaceae |
|
| Aconitum fischeri | Aconitum | Ranunculaceae |
|
| Aloe ferox | Aloe | Asphodelaceae |
|
| Chromolaena odorata | Chromolaena | Asteraceae |
|
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Actaea dahurica | Actaea | Ranunculaceae |
|
| Convallaria majalis | Convallaria | Asparagaceae |
|
| Actaea cimicifuga | Actaea | Ranunculaceae |
|
| Atractylodes lancea | Atractylodes | Asteraceae |
|
| Saposhnikovia divaricata | Saposhnikovia | Apiaceae |
|
| Vitis vinifera | Vitis | Vitaceae |
|
| Pulmonaria mollis | Pulmonaria | Boraginaceae | |
| Rabdosia angustifolia | Isodon | Lamiaceae | |
| Rosa chinensis | Rosa | Rosaceae |
|
| Cicuta virosa | Cicuta | Apiaceae |
|
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae |
|
| Lagascea mollis | Lagascea | Asteraceae |
|
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Espeletia grandiflora | Espeletia | Asteraceae | |
| Phlegmariurus yunnanensis | Phlegmariurus | Lycopodiaceae | |
| Michelia alba | Michelia | Magnoliaceae |
|
| Akebia quinata | Akebia | Lardizabalaceae |
|
| Actinidia polygama | Actinidia | Actinidiaceae |
|
| Arnebia guttata | Arnebia | Boraginaceae |
|
| Bidens pilosa | Bidens | Asteraceae |
|
| Atractylodes macrocephala | Atractylodes | Asteraceae |
|
| Smilax bracteata | Smilax | Smilacaceae |
|
| Lepidium graminifolium | Lepidium | Brassicaceae |
|
| Panax notoginseng | Panax | Araliaceae |
|
| Drosera indica | Drosera | Droseraceae |
|
| Cnidium officinale | Cnidium | Apiaceae |
|
| Rhodiola crenulata | Rhodiola | Crassulaceae |
|
| Bombax ceiba | Bombax | Malvaceae |
|
| Astragalus bisulcatus | Astragalus | Fabaceae |
|
| Pinus flexilis | Pinus | Pinaceae |
|
| Brachyglottis bidwillii | Brachyglottis | Asteraceae | |
| Bistorta officinalis | Bistorta | Polygonaceae |
|
| Galium mollugo | Galium | Rubiaceae |
|
| Drummondita hassellii | Drummondita | Rutaceae | |
| Aconitum napellus | Aconitum | Ranunculaceae |
|
| Tynanthus panurensis | Tynanthus | Bignoniaceae | |
| Ephedra distachya | Ephedra | Ephedraceae |
|
| Typha latifolia | Typha | Typhaceae |
|
| Achillea nana | Achillea | Asteraceae |
|
| Camellia saluenensis | Camellia | Theaceae |
|
| Senegalia mellifera | Senegalia | Fabaceae |
|
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Psilotum nudum | Psilotum | Psilotaceae |
|
| Uncaria sterrophylla | Uncaria | Rubiaceae |
|
| Vicia amoena | Vicia | Fabaceae |
|
| Flindersia xanthoxyla | Flindersia | Rutaceae | |
| Calea lantanoides | Calea | Asteraceae | |
| Bothriocline ripensis | Bothriocline | Asteraceae | |
| Ballota limbata | Ballota | Lamiaceae |
|
| Angelica dahurica | Angelica | Apiaceae |
|
| Boenninghausenia albiflora | Boenninghausenia | Rutaceae |
|
| Cibotium barometz | Cibotium | Cibotiaceae |
|
| Dysosma pleianthum | Dysosma | Berberidaceae | |
| Coronilla cretica | Coronilla | Fabaceae | |
| Gardenia imperialis | Gardenia | Rubiaceae | |
| Artemisia princeps | Artemisia | Asteraceae |
|
| Grindelia scorzonerifolia | Grindelia | Asteraceae | |
| Scutellaria sieberi | Scutellaria | Lamiaceae | |
| Lonchocarpus atropurpureus | Lonchocarpus | Fabaceae | |
| Baccharoides lasiopus | Baccharoides | Asteraceae |
|
| Christisonia bicolor | Christisonia | Orobanchaceae | |
| Spatholobus suberectus | Spatholobus | Fabaceae |
|
| Erysimum odoratum | Erysimum | Brassicaceae | |
| Heterotheca inuloides | Heterotheca | Asteraceae |
|
| Delphinium andersoni | Delphinium | Ranunculaceae | |
| Vaccinium vitis-idaea | Vaccinium | Ericaceae |
|
| Vismia jefensis | Vismia | Hypericaceae | |
| Angelica tarokoensis | Angelica | Apiaceae | |
| Swertia delavayi | Swertia | Gentianaceae | |
| Atroxima liberica | Atroxima | Polygalaceae | |
| Epimedium davidii | Epimedium | Berberidaceae |
|
| Globba malaccensis | Globba | Zingiberaceae |
|
| Diphasia angolensis | Diphasia | Rutaceae | |
| Knightia excelsa | Knightia | Proteaceae |
|
| Piper longum | Piper | Piperaceae |
|
| Isodon japonicus | Isodon | Lamiaceae |
|
| Solanum acaule | Solanum | Solanaceae | |
| Chaenomeles sinensis | Chaenomeles | Rosaceae |
|
| Frullania tamarisci | Frullania | Frullaniaceae | |
| Alangium premnifolium | Alangium | Cornaceae | |
| Bistorta manshuriensis | Bistorta | Polygonaceae | |
| Linum crispum | Linum | Linaceae | |
| Saussurea carthamoides | Saussurea | Asteraceae | |
| Capsella bursa-pastoris | Capsella | Brassicaceae |
|
| Palafoxia texana | Palafoxia | Asteraceae | |
| Galenia africana | Galenia | Aizoaceae |
|
| Micromeria pineolens | Micromeria | Lamiaceae | |
| Gnidia lamprantha | Gnidia | Thymelaeaceae |
|
| Ilex amara | Ilex | Aquifoliaceae | |
| Leonurus glaucescens | Leonurus | Lamiaceae |
|
| Sanguisorba officinalis | Sanguisorba | Rosaceae |
|
| Salacia madagascariensis | Salacia | Celastraceae |
|
| Maba buxifolia | Maba | Ebenaceae |
|
| Actaea simplex | Actaea | Ranunculaceae | |
| Platycladus orientalis | Platycladus | Cupressaceae |
|
| Artemisia argyi | Artemisia | Asteraceae |
|
| Aloe spicata | Aloe | Asphodelaceae |
|
| Quercus sessiliflora | Quercus | Fagaceae | |
| Hippophae fructus | Hippophae | Elaeagnaceae | |
| Litchi chinensis | Litchi | Sapindaceae |
|
| Aloe africana | Aloe | Xanthorrhoeaceae |
|
| Rheedia acuminata | Rheedia | Clusiaceae |
|
| Acacia aulacocarpa | Acacia | Fabaceae | |
| Aspidosperma subincanum | Aspidosperma | Apocynaceae |
|
| Apocynum androsaemifolium | Apocynum | Apocynaceae |
|
| Ardisia neriifolia | Ardisia | Primulaceae | |
| Psiadia dentata | Psiadia | Asteraceae | |
| Peritassa compta | Peritassa | Celastraceae | |
| Eupatorium argentinum | Eupatorium | Asteraceae | |
| Lawsonia inermis | Lawsonia | Lythraceae |
|
| Campsis flos | Campsis | Bignoniaceae | |
| Lepidium draba | Lepidium | Brassicaceae |
|
| Petroselinum crispum | Petroselinum | Apiaceae |
|
| Cryptocarya aschersoniana | Cryptocarya | Lauraceae | |
| Humulus scandens | Humulus | Cannabaceae |
|
| Juniperus brevifolia | Juniperus | Cupressaceae | |
| Bergenia crassifolia | Bergenia | Saxifragaceae |
|
| Gomesa radicans | Gomesa | Orchidaceae | |
| Guatteria boliviana | Guatteria | Annonaceae | |
| Schisandra chinensis | Schisandra | Schisandraceae |
|
| Pseudocinchona pachyceras | Pseudocinchona | Rubiaceae | |
| Anemone flaccida | Anemone | Ranunculaceae |
|
| Licaria brasiliensis | Licaria | Lauraceae | |
| Crotalaria orixensis | Crotalaria | Fabaceae |
|
| Elaeodendron alluaudianum | Elaeodendron | Celastraceae | |
| Crocus sativus | Crocus | Iridaceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC108218 | C8H10O | 122.0731649 | -0.1931 | 2.23 | 3.189 | 1 | 1 | 20.23 | 3 | 1 | 9 | 0 | |
| NPC116377 | C7H15NO4 | 2,5-Imino-2,5,6-Trideoxy-D-Manno-Heptitol | 177.1 | -2.728 | 1.68 | -0.571 | 5 | 5 | 92.95 | 7 | 1 | 12 | 0 |
| NPC118343 | C14H12O2 | Benzyl Benzoate | 212.08 | -0.0795 | 2.78 | 5.895 | 2 | 0 | 26.3 | 4 | 2 | 16 | 1 |
| NPC126106 | C30H32O18 | 3-oxo-3-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-5-yl]oxyoxan-2-yl]methoxy]propanoic acid | 682.1745142 | -5.1708 | 2.78 | -1.277 | 14 | 11 | 282.59 | 11 | 5 | 48 | 3 |
| NPC139144 | C38H38O18 | 783.2136394 | -4.2003 | 3.66 | 1.196 | 13 | 9 | 271.59 | 11 | 6 | 56 | 3 | |
| NPC14209 | C29H34O17 | 654.1795996 | -6.2554 | 2.78 | -2.242 | 11 | 10 | 274.75 | 8 | 5 | 46 | 2 | |
| NPC168623 | C27H30O15 | (2S,3R,4S,5S,6R)-2-[7-hydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-5-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | 596.1741203 | -5.335 | 2.78 | -1.369 | 11 | 11 | 239.22 | 7 | 5 | 42 | 2 |
| NPC188907 | C9H10O3 | 166.0629942 | -0.0406 | 2.12 | 2.675 | 2 | 0 | 35.53 | 5 | 1 | 12 | 0 | |
| NPC195807 | C35H44O21 | 800.2375084 | -6.7288 | 3 | -2.371 | 15 | 11 | 322.67 | 11 | 6 | 56 | 3 | |
| NPC200209 | C36H36O18 | [(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate | 758.2058144 | -5.5253 | 3.44 | 0.374 | 12 | 12 | 285.75 | 11 | 6 | 54 | 3 |
| NPC217423 | C10H12O3 | 180.0786442 | 0.2098 | 2.23 | 3.098 | 2 | 0 | 35.53 | 6 | 1 | 13 | 0 | |
| NPC226490 | C39H38O23 | 3-[[(2R,3S,4S,5R,6S)-6-[3-[(2S,3R,4S,5S,6R)-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-7-hydroxy-2-(3,4,5-trihydroxyphenyl)chromenylium-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid | 876.1960375 | -6.2817 | 3.22 | -0.813 | 15 | 14 | 369.58 | 15 | 6 | 62 | 3 |
| NPC229827 | C29H34O17 | 654.1795996 | -6.5259 | 2.78 | -3.907 | 11 | 10 | 282.59 | 16 | 3 | 46 | 3 | |
| NPC235059 | C9H8O | Cinnamaldehyde | 132.06 | 0.1687 | 2.34 | 3.985 | 1 | 0 | 17.07 | 2 | 1 | 10 | 0 |
| NPC23837 | C8H10O2 | 1,4-Dimethoxybenzene | 138.07 | -0.1036 | 2.12 | 1.908 | 0 | 0 | 18.46 | 4 | 1 | 10 | 0 |
| NPC239931 | C9H10O | 134.0731649 | 0.0191 | 2.34 | 3.808 | 1 | 1 | 20.23 | 3 | 1 | 10 | 0 | |
| NPC248296 | C36H36O18 | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-2-(4-hydroxyphenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate | 757.1979893 | -5.0397 | 3.44 | 0.14 | 12 | 11 | 285.75 | 9 | 6 | 54 | 2 |
| NPC257124 | C10H12O2 | Eugenol | 164.08 | 0.5166 | 2.34 | 2.484 | 0 | 1 | 29.46 | 5 | 1 | 12 | 0 |
| NPC265184 | C40H40O22 | 3-[[(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxy-5-methoxyphenyl)-7-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxychromenylium-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid | 874.216773 | -5.4129 | 3.44 | 0.022 | 15 | 12 | 338.35 | 16 | 6 | 62 | 3 |
| NPC268868 | C39H38O21 | 3-[[(2R,3S,4S,5R,6S)-6-[3-[(2S,3R,4S,5S,6R)-6-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-7-hydroxy-2-(4-hydroxyphenyl)chromenylium-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid | 843.1983833 | -4.8755 | 3.44 | 0.232 | 15 | 11 | 329.12 | 13 | 6 | 60 | 3 |
| NPC292792 | C11H14O2 | Methyleugenol | 178.1 | 0.9251 | 2.45 | 3.003 | 0 | 0 | 18.46 | 6 | 1 | 13 | 0 |
| NPC295990 | C39H38O21 | 3-[[(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-7-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxychromenylium-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid | 844.2062083 | -5.3611 | 3.44 | 0.466 | 15 | 12 | 329.12 | 15 | 6 | 60 | 3 |
| NPC298120 | C36H36O19 | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate | 774.200729 | -5.9856 | 3.33 | -0.16 | 12 | 13 | 305.98 | 11 | 6 | 55 | 3 |
| NPC301898 | C37H38O18 | 771.2136394 | -4.6312 | 3.55 | 0.23 | 12 | 10 | 274.75 | 10 | 6 | 55 | 2 | |
| NPC308501 | C36H36O17 | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-2-(4-hydroxyphenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate | 741.2030747 | -4.5794 | 3.55 | 0.885 | 12 | 10 | 265.52 | 9 | 6 | 53 | 2 |
| NPC32877 | C39H38O20 | 827.2034686 | -4.4152 | 3.55 | 0.977 | 15 | 10 | 308.89 | 13 | 6 | 59 | 3 | |
| NPC38408 | C27H30O17 | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[7-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-5-yl]oxyoxane-3,4,5-triol | 628.1639496 | -6.2556 | 2.56 | -2.437 | 11 | 13 | 279.68 | 7 | 5 | 44 | 2 |
| NPC473952 | C7H15NO5 | 2,5-Dideoxy-2,5-Imino-D-Glycero-D-Manno-Heptitol | 193.1 | -2.9507 | 1.57 | -1.172 | 6 | 6 | 113.18 | 8 | 1 | 13 | 1 |
| NPC56253 | C21H23O10 | 433.1134719 | -3.7212 | 2.67 | 0.644 | 6 | 7 | 169.3 | 4 | 4 | 31 | 1 | |
| NPC56506 | C39H38O22 | 3-oxo-3-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[7-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-5-yl]oxyoxan-2-yl]methoxy]propanoic acid | 860.2011229 | -5.8214 | 3.33 | -0.068 | 15 | 13 | 349.35 | 15 | 6 | 61 | 3 |
| NPC58616 | C9H10O2 | E1501 | 150.07 | -0.0696 | 2.23 | 3.149 | 2 | 0 | 26.3 | 4 | 1 | 11 | 0 |
| NPC5947 | C40H40O21 | 857.2140333 | -4.467 | 3.55 | 0.322 | 15 | 10 | 318.12 | 14 | 6 | 61 | 3 | |
| NPC61504 | C30H26O13 | [(3S,6S)-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate | 595.1451659 | -3.7357 | 3.33 | 2.341 | 9 | 8 | 206.6 | 7 | 5 | 43 | 1 |
| NPC69798 | C7H15NO4 | 2,5-Imino-2,5,6-Trideoxy-D-Gulo-Heptitol | 177.1 | -2.728 | 1.68 | -0.571 | 5 | 5 | 92.95 | 7 | 1 | 12 | 0 |
| NPC8087 | C6H13NO4 | 2,5-Dideoxy-2,5-Imino-D-Mannitol | 163.08 | -2.44 | 1.57 | -0.929 | 5 | 5 | 92.95 | 6 | 1 | 11 | 0 |
| NPC82123 | C39H38O20 | 827.2034686 | -4.4152 | 3.55 | 0.548 | 15 | 10 | 308.89 | 13 | 6 | 59 | 3 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
