NPASS Compound

Natural Product: NPC470514

Natural Product ID	NPC470514
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Sorbifoliaside C
IUPAC Name	(3R,4R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-3,4-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-4a-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxymethyl]-3,4,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-1H-picen-5-one
Synonyms	sorbifoliaside C
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2058159
PubChem CID	66552718
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 188197 0 0 0 0 0 0 0 0999 V2000 6.1707 -5.1355 0.2288 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1578 -4.1165 0.8118 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4239 -3.4546 -0.2905 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0422 -2.0523 -0.1633 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5649 -1.8267 -0.1189 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6684 -2.7043 0.2748 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1854 -2.4049 0.2966 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0730 -0.9056 0.4922 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2605 -0.4179 0.9253 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3068 -1.5229 0.9585 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6492 -0.9816 1.3669 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1145 0.1575 0.5166 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0987 1.2163 0.2302 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7413 0.6625 0.0404 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6716 1.7410 0.0192 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4441 1.2149 -0.8339 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6909 -0.2622 -0.7058 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1972 -0.4173 -0.5607 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7772 0.4489 0.5470 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5707 -0.3839 1.5274 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3219 -0.3386 2.6979 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6741 -1.2571 0.9420 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2220 -2.0427 2.0717 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9670 -3.2626 1.7100 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1699 -3.9929 2.9073 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2226 -2.3235 2.9959 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7035 -0.2559 0.4938 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7836 -0.8008 -0.1968 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6683 0.2289 -0.5579 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8085 0.4065 -2.0306 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1918 0.0516 -2.5374 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7012 -1.2098 -1.8693 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4771 -1.1202 -0.3999 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8678 0.0185 0.0379 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8197 -1.2690 0.3296 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5356 -0.1183 0.0370 O 0 0 0 0 0 0 0 0 0 0 0 0 12.7905 -0.0877 0.5889 C 0 0 0 0 0 0 0 0 0 0 0 0 12.9711 1.0564 1.5692 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8425 2.3808 0.8853 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6007 2.4558 -0.4081 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5567 1.1628 -1.1870 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7469 0.0540 -0.3991 O 0 0 0 0 0 0 0 0 0 0 0 0 14.5901 1.1741 -2.2870 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5177 0.0686 -3.0981 O 0 0 0 0 0 0 0 0 0 0 0 0 13.1713 3.5362 -1.1850 O 0 0 0 0 0 0 0 0 0 0 0 0 13.1866 3.4469 1.7067 O 0 0 0 0 0 0 0 0 0 0 0 0 14.2781 0.9624 2.0640 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0035 -1.4916 -2.2092 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2135 0.0033 -3.9102 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5935 1.7387 -2.3601 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7870 -0.0975 -1.9166 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3671 -0.9762 -2.0212 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5062 1.8097 -1.1362 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1757 2.3704 1.1999 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1975 0.7675 1.1127 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3988 0.6172 0.4397 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0103 1.9726 0.0949 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6047 2.5716 1.2908 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1763 2.0362 2.6339 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0203 0.5371 2.6243 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3173 0.0397 1.3501 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9031 -0.0972 3.6390 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2198 0.1014 3.6150 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0341 -0.2295 2.5885 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0011 -1.3518 2.9657 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.0852 -1.4462 1.9510 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7949 -0.7775 0.6346 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1954 0.6015 0.8311 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7894 0.8222 2.1162 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.2073 1.6670 0.3814 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6000 2.8923 0.4858 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0414 -1.5804 -0.2211 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.3353 -2.8031 1.6780 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5522 -1.2052 4.2150 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0640 2.4981 3.5905 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3601 3.9675 1.2459 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9862 1.7933 -0.8930 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6625 2.4283 -2.0677 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7912 3.3125 -2.5031 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0377 2.5668 -2.8925 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8069 1.2506 -3.5532 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6444 0.5750 -2.8938 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5370 1.3862 -3.0309 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4198 -0.8297 -3.4378 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3648 -1.4556 -2.7573 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9363 0.4348 -3.3091 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7158 3.3883 -3.8203 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1532 4.1485 -1.4251 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1488 0.0360 2.3891 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2681 -5.0058 1.6938 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5915 -5.7988 -0.4291 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4943 -5.7438 1.0987 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9996 -4.6178 -0.2499 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5401 -4.0864 -0.5366 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0690 -3.6136 -1.2192 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3739 -1.5308 -1.1131 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9761 -3.6878 0.6054 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2355 -2.9602 1.1649 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2748 -2.8042 -0.5927 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8147 -0.7209 1.3362 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0221 -2.2375 1.7672 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3974 -2.0789 0.0339 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3830 -1.8073 1.2575 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7067 -0.6504 2.4229 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4807 -0.2966 -0.4353 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7388 0.2355 -1.0043 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0639 2.6572 -0.4543 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3283 2.0240 1.0372 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1739 1.4275 -1.9108 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3366 1.8385 -0.6407 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4070 1.2217 0.0665 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9947 1.0025 1.1022 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9369 -1.3622 2.6322 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9899 -3.0873 1.3196 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7438 -3.4156 3.4701 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5776 -2.8145 3.7913 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3062 0.5671 -0.1304 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1688 0.2652 1.3719 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2701 1.2100 -0.1553 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0894 -0.1934 -2.6288 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8773 0.8702 -2.2102 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0773 -2.0426 -2.2997 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8147 -1.9766 -0.0918 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3325 -2.1237 -0.1506 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6448 -1.4243 1.3974 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9715 -1.0321 1.1305 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3110 0.9554 2.4476 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7657 2.5295 0.6285 H 0 0 0 0 0 0 0 0 0 0 0 0 14.6645 2.6564 -0.1665 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5326 1.0789 -1.6201 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4472 2.1263 -2.8475 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6043 1.1953 -1.8224 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2216 -0.5865 -2.8374 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9301 4.2889 -0.6020 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6168 4.2579 1.5333 H 0 0 0 0 0 0 0 0 0 0 0 0 14.6413 1.8636 2.2665 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1116 -2.2066 -2.8829 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0986 -0.9098 -4.2161 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2239 2.0909 -3.0095 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7371 0.4671 -1.8740 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0936 0.5990 -2.4756 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0073 -0.9992 -2.5260 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2974 -0.2181 -2.8602 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1422 -1.7389 -2.2728 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5802 -1.4976 -2.0427 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8780 2.8435 -1.0426 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2642 1.1639 -1.6191 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6353 1.8363 -1.8269 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7664 2.1214 2.1067 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7405 3.1985 0.7261 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1711 2.7468 1.3967 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2754 -0.0087 -0.4374 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1953 2.6466 -0.3022 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7319 2.5145 1.2018 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1914 2.4775 2.8652 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9755 0.2294 2.8319 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7590 -1.2433 3.6217 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5323 0.1205 4.6913 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4481 -0.6522 1.7543 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3765 -2.2752 3.0038 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0661 -1.0443 2.3215 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7784 -0.6327 0.1268 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3332 0.6886 0.1496 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4401 1.4447 -0.6780 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1492 1.5873 0.9632 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0902 3.5263 -0.0784 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6801 -2.2300 -0.6556 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3000 -2.9670 1.5264 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6874 -0.2398 4.3978 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5203 3.3379 3.3383 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5180 4.1389 1.7462 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7184 3.0064 -2.0312 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4454 3.9242 -3.3682 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7301 2.4222 -2.0429 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6930 1.2828 -4.6517 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9394 0.4146 -1.8193 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0594 -0.7288 -4.4911 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3434 -1.4282 -3.3491 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6510 -1.6365 -1.8127 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7710 0.8378 -3.6326 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6411 3.0349 -4.7311 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0413 5.0997 -1.6387 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2240 -0.8851 3.0346 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1363 0.4459 2.5997 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9589 0.6887 2.6996 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6539 -5.6776 1.0297 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8987 -5.6548 2.3224 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5481 -4.4062 2.2547 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 23 26 1 0 22 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 41 43 1 0 43 44 1 0 40 45 1 0 39 46 1 0 38 47 1 0 32 48 1 0 31 49 1 0 30 50 1 0 18 51 1 0 17 52 1 0 13 53 1 0 13 54 1 0 12 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 60 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 68 70 1 0 70 71 1 0 67 72 1 0 66 73 1 0 65 74 1 0 59 75 1 0 58 76 1 0 57 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 81 82 1 0 82 83 1 0 82 84 1 0 84 85 1 0 81 86 1 0 80 87 1 0 79 88 1 0 9 89 1 0 2 90 1 0 24 2 1 0 83 78 1 0 22 4 1 0 18 5 1 0 17 8 1 0 14 9 1 0 34 29 1 0 42 37 1 0 61 56 1 0 69 64 1 0 1 91 1 0 1 92 1 0 1 93 1 0 3 94 1 0 3 95 1 0 4 96 1 0 6 97 1 0 7 98 1 0 7 99 1 0 8100 1 0 10101 1 0 10102 1 0 11103 1 0 11104 1 0 12105 1 0 14106 1 0 15107 1 0 15108 1 0 16109 1 0 16110 1 0 19111 1 0 19112 1 0 23113 1 0 24114 1 0 25115 1 0 26116 1 0 27117 1 0 27118 1 0 29119 1 0 30120 1 0 31121 1 0 32122 1 0 33123 1 0 35124 1 0 35125 1 0 37126 1 0 38127 1 0 39128 1 0 40129 1 0 41130 1 0 43131 1 0 43132 1 0 44133 1 0 45134 1 0 46135 1 0 47136 1 0 48137 1 0 49138 1 0 50139 1 0 51140 1 0 51141 1 0 51142 1 0 52143 1 0 52144 1 0 52145 1 0 53146 1 0 53147 1 0 53148 1 0 54149 1 0 54150 1 0 54151 1 0 56152 1 0 57153 1 0 58154 1 0 59155 1 0 60156 1 0 62157 1 0 62158 1 0 64159 1 0 65160 1 0 66161 1 0 67162 1 0 68163 1 0 70164 1 0 70165 1 0 71166 1 0 72167 1 0 73168 1 0 74169 1 0 75170 1 0 76171 1 0 78172 1 0 79173 1 0 80174 1 0 81175 1 0 82176 1 0 84177 1 0 84178 1 0 85179 1 0 86180 1 0 87181 1 0 88182 1 0 89183 1 0 89184 1 0 89185 1 0 90186 1 0 90187 1 0 90188 1 0 M END

Standard InCHIKey	YURMATDASSYCTB-TUANEQDRSA-N
Standard InCHI	InChI=1S/C60H98O30/c1-55(2)14-23-22-8-9-30-57(5)12-11-32(89-54-47(90-53-46(78)40(72)35(67)26(18-63)86-53)42(74)37(69)28(88-54)20-82-51-44(76)39(71)34(66)25(17-62)85-51)56(3,4)29(57)10-13-58(30,6)59(22,7)15-31(64)60(23,49(80)48(55)79)21-83-52-45(77)41(73)36(68)27(87-52)19-81-50-43(75)38(70)33(65)24(16-61)84-50/h8,23-30,32-54,61-63,65-80H,9-21H2,1-7H3/t23-,24+,25+,26+,27+,28+,29-,30+,32-,33+,34+,35+,36+,37+,38-,39-,40-,41-,42-,43+,44+,45+,46+,47+,48-,49-,50+,51+,52+,53-,54-,57-,58+,59+,60-/m0/s1
SMILES	CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C3(CC(=O)C2(C(C1O)O)COC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)O)O)O)O)O)O)C)C)(C)C)OC8C(C(C(C(O8)COC9C(C(C(C(O9)CO)O)O)O)O)O)OC1C(C(C(C(O1)CO)O)O)O)C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1298.61	Volume:	1219.185 ? Van der Waals volume.
Dense:	1.065	LogP:	-2.571 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	-1.241 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.119 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	57.0
TPSA:	493.74 ? Topological Polar Surface Area.	H-Bond Acceptor:	30.0
H-Bond Donor:	19.0	Rings:	10.0
Heavy Atoms:	30.0

MedChem Properties

QED Drug-Likeness Score:	0.05	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.488	Fsp³:	0.95
MCE-18:	222.923 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.0	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.009 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.396 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.423	Promiscuous compounds:	0.001

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.555	MDCK Permeability:	-4.965
Pgp-inhibitor:	0.0	Pgp-substrate:	0.999
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	0.857	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	16.811%	Volume Distribution (VD):	-0.345
Fu:	37.66% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.018	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.84	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.026	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.102	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.775

Half-life (T1/2):

3.869

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.202
Human Hepatotoxicity (H-HT):	0.247	Drug-induced Liver Injury (DILI):	0.258
AMES Toxicity:	0.742	Rat Oral Acute Toxicity:	0.085
Maximum Recommended Daily Dose:	0.089	Skin Sensitization:	0.002
Carcinogencity:	0.002	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.531	Ototoxicity:	1.0
Hematotoxicity:	0.001	Drug-induced Nephrotoxicity:	0.003
Genotoxicity:	0.007	RPMI-8226 Immunitoxicity:	0.149
A549 Cytotoxicity:	0.019	Hek293 Cytotoxicity:	0.965
BCF:	0.505 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.914 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.267 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.2 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	wood	n.a.	n.a.	PMID[10691716]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	husks	Inner Mongolia, China	2004-SEP	PMID[18549275]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22801644]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	leaves	n.a.	n.a.	PMID[23313635]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	10

Activity Type	# Activity
Cell line	8
Non-molecular	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT165	Cell line	HeLa	Homo sapiens	IC50	>	100000.0	nM	PMID[15104487]
NPT547	Cell line	BGC-823	Homo sapiens	IC50	>	100000.0	nM	PMID[1965654]
NPT83	Cell line	MCF7	Homo sapiens	IC50	>	100000.0	nM	DrugMatrix in vivo data: Pathology
NPT306	Cell line	PC-3	Homo sapiens	IC50	>	100000.0	nM	PubChem BioAssay data set
NPT65	Cell line	HepG2	Homo sapiens	IC50	>	100000.0	nM	PMID[16872131]
NPT81	Cell line	A549	Homo sapiens	IC50	>	100000.0	nM	PMID[24904961]
NPT453	Cell line	HT-1080	Homo sapiens	IC50	>	100000.0	nM	PMID[22119124]
NPT1171	Cell line	HEp-2	Homo sapiens	IC50	>	100000.0	nM	PMID[16180827]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	>	100000.0	nM	PMID[22801644]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC470514 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21057
0.1-0.2	23714
0.2-0.3	3708
0.3-0.4	779
0.4-0.5	480
0.5-0.6	88
0.6-0.7	10
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9355	High Similarity	NPC470513
0.7864	Intermediate Similarity	NPC470516
0.7576	Intermediate Similarity	NPC470512
0.7282	Intermediate Similarity	NPC173859
0.6952	Remote Similarity	NPC148603
0.6909	Remote Similarity	NPC470915
0.6522	Remote Similarity	NPC470911
0.6422	Remote Similarity	NPC470515
0.6404	Remote Similarity	NPC185466
0.6271	Remote Similarity	NPC470517
0.6126	Remote Similarity	NPC63159
0.6087	Remote Similarity	NPC207738
0.6053	Remote Similarity	NPC481079
0.6038	Remote Similarity	NPC48499
0.5965	Remote Similarity	NPC470914
0.5776	Remote Similarity	NPC291903
0.5656	Remote Similarity	NPC603137
0.5652	Remote Similarity	NPC222580
0.5652	Remote Similarity	NPC123796
0.5625	Remote Similarity	NPC469946
0.562	Remote Similarity	NPC79643
0.561	Remote Similarity	NPC475140
0.5583	Remote Similarity	NPC475119
0.5575	Remote Similarity	NPC478066
0.5537	Remote Similarity	NPC473824
0.5537	Remote Similarity	NPC607904
0.5537	Remote Similarity	NPC610204
0.5528	Remote Similarity	NPC135904
0.5526	Remote Similarity	NPC480947
0.5517	Remote Similarity	NPC297263
0.5484	Remote Similarity	NPC470218
0.5478	Remote Similarity	NPC480475
0.547	Remote Similarity	NPC471435
0.547	Remote Similarity	NPC471434
0.5455	Remote Similarity	NPC288205
0.5455	Remote Similarity	NPC51465
0.5431	Remote Similarity	NPC105800
0.5417	Remote Similarity	NPC31838
0.5417	Remote Similarity	NPC609281
0.5403	Remote Similarity	NPC123199
0.5378	Remote Similarity	NPC606145
0.5372	Remote Similarity	NPC606553
0.5345	Remote Similarity	NPC232237
0.5339	Remote Similarity	NPC119794
0.531	Remote Similarity	NPC473373
0.5304	Remote Similarity	NPC112352
0.5299	Remote Similarity	NPC148417
0.5299	Remote Similarity	NPC162574
0.5285	Remote Similarity	NPC60557
0.5285	Remote Similarity	NPC67857
0.528	Remote Similarity	NPC609305
0.5271	Remote Similarity	NPC41061
0.5271	Remote Similarity	NPC227551
0.5271	Remote Similarity	NPC258617
0.5259	Remote Similarity	NPC309714
0.5242	Remote Similarity	NPC151543
0.5231	Remote Similarity	NPC43550
0.5225	Remote Similarity	NPC164194
0.5221	Remote Similarity	NPC208650
0.5214	Remote Similarity	NPC251768
0.5214	Remote Similarity	NPC164389
0.5214	Remote Similarity	NPC488526
0.5191	Remote Similarity	NPC305981
0.5167	Remote Similarity	NPC78034
0.5164	Remote Similarity	NPC469947
0.5164	Remote Similarity	NPC104137
0.5164	Remote Similarity	NPC26626
0.5164	Remote Similarity	NPC480948
0.5161	Remote Similarity	NPC610461
0.5152	Remote Similarity	NPC261506
0.5152	Remote Similarity	NPC4328
0.5141	Remote Similarity	NPC329893
0.513	Remote Similarity	NPC295371
0.513	Remote Similarity	NPC220427
0.5128	Remote Similarity	NPC605226
0.5126	Remote Similarity	NPC470913
0.5126	Remote Similarity	NPC257468
0.5122	Remote Similarity	NPC480939
0.5113	Remote Similarity	NPC70809
0.5086	Remote Similarity	NPC263756
0.5086	Remote Similarity	NPC213674
0.5083	Remote Similarity	NPC64715
0.5083	Remote Similarity	NPC302887
0.5083	Remote Similarity	NPC484832
0.5082	Remote Similarity	NPC488564
0.5082	Remote Similarity	NPC160452
0.5081	Remote Similarity	NPC172365
0.5079	Remote Similarity	NPC165204
0.5076	Remote Similarity	NPC481081
0.5075	Remote Similarity	NPC220160
0.5071	Remote Similarity	NPC475177
0.5043	Remote Similarity	NPC192791
0.5043	Remote Similarity	NPC127056
0.5043	Remote Similarity	NPC485579
0.5041	Remote Similarity	NPC36831
0.504	Remote Similarity	NPC252657
0.504	Remote Similarity	NPC88311
0.504	Remote Similarity	NPC268184
0.5039	Remote Similarity	NPC219180
0.5038	Remote Similarity	NPC309223
0.5038	Remote Similarity	NPC470876
0.5037	Remote Similarity	NPC250247

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC470514 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7006
0.1-0.2	2081
0.2-0.3	55
0.3-0.4	8
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data