Drug Information| Drug ID:   | NPD5285 |
| Drug Name:   | Methylprednisolone Acetate |
| Molecular Formula:   | C22H30O5.C2H4O2 |
| Canonical SMILES:   | CC(=O)O.OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)C |
| Standard InCHI:   | "InChI=1S/C22H30O5.C2H4O2/c1-12-8-14-15-5-7-22(27,18(26)11-23)21(15,3)10-17(25)19(14)20(2)6-4-13(24)9-16(12)20;1-2(3)4/h4,6,9,12,14-15,17,19,23,25,27H,5,7-8,10-11H2,1-3H3;1H3,(H,3,4)/t12-,14-,15-,17-,19+,20-,21-,22-;/m0./s1" |
| Standard InCHIKey:   | MGVGMXLGOKTYKP-ZFOBEOMCSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD5285Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.8947 | NPC144956 |
| High Similarity | 0.8947 | NPC608439 |
| Remote Similarity | 0.6462 | NPC334061 |
| Remote Similarity | 0.6462 | NPC611819 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 374.21 |
| ALogP   | -0.9799 |
| MLogP   | 3.33 |
| XLogP   | 1.525 |
| HDA   | 5 |
| HBD   | 3 |
| Rotatable Bonds   | 8 |
| TPSA   | 94.83 |
| RO5 Violation   | 0 |