NPASS Compound

Natural Product: NPC110385

Natural Product ID	NPC110385
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3'o-Acetylplatycodin D
IUPAC Name	[(2S,3R,4S,5S)-3-[(2S,3R,4R,5R,6S)-3-acetyloxy-5-[(2S,3R,4S,5R)-4-[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-3,5-dihydroxyoxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl] (4aR,5R,6aR,6aS,6bR,8aR,10R,11S,12aR,14bS)-5,11-dihydroxy-9,9-bis(hydroxymethyl)-2,2,6a,6b,12a-pentamethyl-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms	3'-O-Acetylplatycodin D
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1641861
PubChem CID	46173910
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 182191 0 0 0 0 0 0 0 0999 V2000 -13.8235 3.0207 -1.0361 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.4216 2.0072 -1.8823 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.9677 0.8036 -1.0995 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.8988 1.0644 -0.2551 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.4481 -0.2127 0.1997 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.1468 -0.1213 0.6279 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2370 -0.7315 -0.2116 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4527 0.3378 -0.9655 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.4232 1.2597 -1.4054 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5629 1.0570 -0.0179 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5211 0.1235 0.6126 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9109 -1.2944 0.2486 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.3351 -1.6608 0.5006 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5466 -3.0337 -0.1867 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9064 -3.3131 -0.0189 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6887 -1.8985 1.9219 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7629 -2.7902 2.5062 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8867 -2.2530 0.7673 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6224 -2.0172 -0.0919 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1520 -0.6132 0.0911 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2423 0.3963 -0.1259 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7019 1.7817 -0.0108 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2397 1.8574 -0.0163 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4042 0.8920 -0.4702 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0926 -0.2980 -0.9870 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7455 0.0408 -2.2963 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2180 -1.4831 -1.2174 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8696 -1.1504 -1.7240 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.1632 -0.0630 -0.9662 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9661 1.0254 -0.3893 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3946 2.3775 -0.7378 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1359 2.6173 -2.1845 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6984 3.8937 -2.3905 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4298 2.8776 -2.9280 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5760 1.4681 -2.8463 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9816 0.4424 -1.8462 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5151 -0.7662 0.1686 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4406 -2.0105 0.2008 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2147 -0.1363 1.1872 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8082 -0.8813 2.2264 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0120 -0.6678 3.3625 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1393 -1.6999 4.2838 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5924 -2.1038 4.4165 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4488 -0.9482 3.9711 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2495 -0.6653 2.4844 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0102 -1.4063 1.6583 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0020 -0.8271 0.9215 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8274 -0.9758 -0.4766 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6747 -0.0480 -1.0749 C 0 0 1 0 0 0 0 0 0 0 0 0 4.9457 1.2612 -1.3449 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9812 0.1451 -0.3989 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3818 -1.0389 0.4165 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2707 -1.5855 1.2330 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5493 -1.5968 2.6174 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5291 -2.8044 3.2900 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2709 -3.8986 2.7117 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8098 -2.9121 4.7500 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3601 -0.5939 1.3446 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9285 0.5299 -1.3327 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5103 1.7687 -1.1065 C 0 0 2 0 0 0 0 0 0 0 0 0 8.2090 2.7512 -1.9921 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2210 3.2389 -2.7591 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2481 2.1537 -3.0968 C 0 0 2 0 0 0 0 0 0 0 0 0 10.9112 1.7915 -1.8250 C 0 0 1 0 0 0 0 0 0 0 0 0 9.9374 1.5767 -0.7282 C 0 0 1 0 0 0 0 0 0 0 0 0 10.3077 2.3663 0.3708 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8082 0.7273 -1.9529 O 0 0 0 0 0 0 0 0 0 0 0 0 13.1263 1.0696 -1.6518 C 0 0 2 0 0 0 0 0 0 0 0 0 14.0543 0.5656 -2.5124 O 0 0 0 0 0 0 0 0 0 0 0 0 15.2393 0.3640 -1.8169 C 0 0 0 0 0 0 0 0 0 0 0 0 14.8624 0.0202 -0.4148 C 0 0 2 0 0 0 0 0 0 0 0 0 13.4167 0.3376 -0.3404 C 0 0 1 0 0 0 0 0 0 0 0 0 13.1323 1.1533 0.7584 O 0 0 0 0 0 0 0 0 0 0 0 0 15.5352 0.7946 0.5476 O 0 0 0 0 0 0 0 0 0 0 0 0 15.0927 -1.4449 -0.0924 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5730 -1.6651 1.1794 O 0 0 0 0 0 0 0 0 0 0 0 0 11.1153 2.7300 -4.0288 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9123 0.1791 4.6240 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8159 -2.4520 5.7421 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8411 -0.8915 -3.0775 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4844 -0.5296 1.4343 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5128 0.4093 2.0650 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4647 -0.6792 1.1623 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.7516 -0.9680 0.3634 C 0 0 2 0 0 0 0 0 0 0 0 0 -14.1755 0.2931 -0.3149 C 0 0 2 0 0 0 0 0 0 0 0 0 -15.1785 0.0453 -1.2494 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.7084 -1.4748 1.2355 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1945 -1.8436 1.8432 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.7893 2.9045 -0.8409 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6547 2.3228 -2.6225 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.3019 1.7024 -2.4904 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6740 0.0207 -1.8501 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4683 -0.8285 -0.7327 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8641 -1.2040 -1.0292 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0014 -0.0638 -1.8684 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0136 1.8736 -2.0942 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2210 1.5104 0.7695 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0873 1.9017 -0.5390 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7905 -1.3343 -0.8799 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9816 -3.8305 0.3335 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2167 -3.0049 -1.2308 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0202 -4.0631 0.6154 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6322 -2.5266 1.8969 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9241 -1.0361 2.5353 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5929 -2.4372 3.4290 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1370 -3.2984 0.6265 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6375 -2.1236 1.8394 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8881 -2.2690 -1.1254 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8907 -2.7383 0.3401 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5498 0.2895 -1.2096 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0361 2.2944 0.9357 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0829 2.4506 -0.8081 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7744 2.7374 0.3693 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5264 -0.6958 -2.5904 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9650 -0.0929 -3.1071 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0523 1.0912 -2.4124 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1016 -2.1137 -0.2841 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7265 -2.1461 -1.9428 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2709 -2.1237 -1.6374 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7219 0.9825 0.7610 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6341 2.4073 -0.2479 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9398 3.1863 -0.2353 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4731 3.7551 -3.1543 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0651 4.7578 -2.6551 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1475 4.1188 -1.4034 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1737 3.3686 -2.2466 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2727 3.6131 -3.7620 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8772 1.9984 -3.3847 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0422 1.0925 -3.7376 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5427 1.8782 -3.2701 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4053 -0.4226 -2.3986 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7784 0.8434 -1.1909 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6214 -1.9776 1.9952 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8251 -1.2925 5.2668 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4774 -2.5572 4.0681 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7585 -3.0258 3.8168 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4975 -0.9872 4.2863 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5066 0.4033 2.3797 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1656 0.2280 1.0741 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8913 -0.4779 -2.0980 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8080 1.8708 -0.4535 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5713 1.8893 -2.0448 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0234 1.0635 -1.9274 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8830 0.9888 0.3244 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8774 -1.8468 -0.1449 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0680 -2.6542 0.9035 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3793 -3.8300 4.9568 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3047 -1.9883 5.1431 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8582 -2.9895 5.3133 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7737 -1.3844 1.8089 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0112 2.1121 -0.1263 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9263 3.7110 -3.6941 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7767 3.9908 -2.1627 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6675 1.3169 -3.5376 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5676 2.6656 -1.5315 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1120 0.5158 -0.3525 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9616 1.9914 1.2009 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2491 2.1419 -1.3963 H 0 0 0 0 0 0 0 0 0 0 0 0 15.8012 1.3193 -1.8096 H 0 0 0 0 0 0 0 0 0 0 0 0 15.8530 -0.4623 -2.2629 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7635 -0.5568 -0.2347 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4069 2.0921 0.5408 H 0 0 0 0 0 0 0 0 0 0 0 0 16.4957 0.5051 0.4759 H 0 0 0 0 0 0 0 0 0 0 0 0 16.1619 -1.6372 -0.0541 H 0 0 0 0 0 0 0 0 0 0 0 0 14.5284 -2.0879 -0.7937 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7006 -2.5988 1.4895 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5638 3.3264 -4.6022 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1259 1.0078 4.1333 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0337 -1.6528 6.2440 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7187 -1.6772 -3.6437 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3834 -0.7243 1.2730 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5419 0.4233 1.9467 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7930 -1.3248 2.1339 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4983 0.8679 2.3870 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3793 -0.4565 2.7371 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7662 1.1533 2.4116 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6951 0.1331 1.9038 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4489 -1.7027 -0.4132 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.4536 1.0476 0.4403 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.8425 -0.5569 -0.8099 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.7399 -2.4591 1.1024 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5831 -1.7704 2.7511 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 13 16 1 0 16 17 1 0 12 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 2 0 24 25 1 0 25 26 1 6 25 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 32 34 1 0 32 35 1 0 35 36 1 0 29 37 1 1 37 38 2 0 37 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 49 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 2 0 55 57 1 0 52 58 1 0 51 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 64 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 71 74 1 1 71 75 1 0 75 76 1 0 63 77 1 0 44 78 1 0 43 79 1 0 28 80 1 0 20 81 1 1 11 82 1 1 5 83 1 0 83 84 1 0 84 85 1 0 85 86 1 0 84 87 1 0 83 88 1 0 85 3 1 0 13 7 1 0 25 20 1 0 36 29 1 0 45 40 1 0 53 47 1 0 65 60 1 0 72 68 1 0 21 11 1 0 30 24 1 0 1 89 1 0 2 90 1 0 2 91 1 0 3 92 1 6 5 93 1 6 7 94 1 6 8 95 1 6 9 96 1 0 10 97 1 0 10 98 1 0 12 99 1 6 14100 1 0 14101 1 0 15102 1 0 16103 1 0 16104 1 0 17105 1 0 18106 1 0 18107 1 0 19108 1 0 19109 1 0 21110 1 6 22111 1 0 22112 1 0 23113 1 0 26114 1 0 26115 1 0 26116 1 0 27117 1 0 27118 1 0 28119 1 6 30120 1 1 31121 1 0 31122 1 0 33123 1 0 33124 1 0 33125 1 0 34126 1 0 34127 1 0 34128 1 0 35129 1 0 35130 1 0 36131 1 0 36132 1 0 40133 1 6 42134 1 0 42135 1 0 43136 1 6 44137 1 6 45138 1 1 47139 1 6 49140 1 6 50141 1 0 50142 1 0 50143 1 0 51144 1 1 52145 1 6 53146 1 6 57147 1 0 57148 1 0 57149 1 0 58150 1 0 60151 1 1 62152 1 0 62153 1 0 63154 1 6 64155 1 1 65156 1 1 66157 1 0 68158 1 1 70159 1 0 70160 1 0 72161 1 1 73162 1 0 74163 1 0 75164 1 0 75165 1 0 76166 1 0 77167 1 0 78168 1 0 79169 1 0 80170 1 0 81171 1 0 81172 1 0 81173 1 0 82174 1 0 82175 1 0 82176 1 0 83177 1 1 84178 1 6 85179 1 1 86180 1 0 87181 1 0 88182 1 0 M END

Standard InCHIKey	CNHZRRBWLMSLDX-WNHLAMKZSA-N
Standard InCHI	InChI=1S/C59H94O29/c1-24-41(84-47-40(74)42(30(67)19-78-47)85-51-45(75)58(77,22-63)23-80-51)39(73)44(82-25(2)64)50(81-24)86-43-35(69)29(66)18-79-49(43)88-52(76)59-13-12-53(3,4)14-27(59)26-8-9-32-54(5)15-28(65)46(87-48-38(72)37(71)36(70)31(17-60)83-48)57(20-61,21-62)33(54)10-11-55(32,6)56(26,7)16-34(59)68/h8,24,27-51,60-63,65-75,77H,9-23H2,1-7H3/t24-,27-,28-,29-,30+,31+,32+,33+,34+,35-,36+,37-,38+,39+,40+,41-,42-,43+,44+,45-,46-,47-,48-,49-,50-,51-,54+,55+,56+,58+,59+/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@@H](O)C[C@]3([C@H](C2(CO)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)C[C@H]([C@@]2([C@H]3CC(C)(C)CC2)C(=O)O[C@@H]2OC[C@@H]([C@@H]([C@H]2O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2OC(=O)C)O)O[C@@H]2OC[C@H]([C@@H]([C@H]2O)O[C@@H]2OC[C@]([C@H]2O)(O)CO)O)O)O)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1266.59	Volume:	1190.462 ? Van der Waals volume.
Dense:	1.064	LogP:	-0.765 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.196 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.81 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	17.0	Rigid Bonds:	57.0
TPSA:	459.35 ? Topological Polar Surface Area.	H-Bond Acceptor:	29.0
H-Bond Donor:	16.0	Rings:	10.0
Heavy Atoms:	29.0

MedChem Properties

QED Drug-Likeness Score:	0.042	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.573	Fsp³:	0.932
MCE-18:	221.754 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.674	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.231	Promiscuous compounds:	0.59

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.056	MDCK Permeability:	-5.01
Pgp-inhibitor:	0.0	Pgp-substrate:	0.998
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.837
20% Bioavailability (F20%):	0.364	30% Bioavailability (F30%):	0.997
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.004	MRP1:	0.144
Plasma Protein Binding (PPB):	50.397%	Volume Distribution (VD):	-0.471
Fu:	30.907% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.007
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.001
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.674

Half-life (T1/2):

3.517

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.847	Drug-induced Liver Injury (DILI):	0.777
AMES Toxicity:	0.984	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.122	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.816	Drug-induced Nephrotoxicity:	0.996
Genotoxicity:	0.202	RPMI-8226 Immunitoxicity:	0.269
A549 Cytotoxicity:	0.931	Hek293 Cytotoxicity:	0.494
BCF:	0.412 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.316 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.134 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.896 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	root	n.a.	PMID[17851435]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	Roots	n.a.	n.a.	PMID[20939516]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	root	n.a.	PMID[20939516]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO214	Platycodon grandiflorus	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO21551	Radix platycodi	Species	Lymnaeidae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO214	Platycodon grandiflorus	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO214	Platycodon grandiflorus	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4

Activity Type	# Activity
Cell line	1
Non-molecular	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT148	Cell line	HCT-15	Homo sapiens	IC50	=	3400.0	nM	PMID[20939516]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	2300.0	nM	PMID[20939516]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	4100.0	nM	PMID[20939516]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	2200.0	nM	PMID[20939516]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC110385 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25745
0.1-0.2	20902
0.2-0.3	2397
0.3-0.4	500
0.4-0.5	231
0.5-0.6	58
0.6-0.7	9
0.7-0.8	0
0.8-0.85	4
0.85-0.9	3
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9328	High Similarity	NPC153673
0.9098	High Similarity	NPC275225
0.8908	High Similarity	NPC37860
0.877	High Similarity	NPC293031
0.8607	High Similarity	NPC267694
0.8293	Intermediate Similarity	NPC144644
0.8293	Intermediate Similarity	NPC170407
0.8175	Intermediate Similarity	NPC68767
0.8016	Intermediate Similarity	NPC142151
0.7969	Intermediate Similarity	NPC51099
0.7438	Intermediate Similarity	NPC815
0.7007	Intermediate Similarity	NPC480421
0.6977	Remote Similarity	NPC85154
0.6934	Remote Similarity	NPC33012
0.6923	Remote Similarity	NPC237191
0.6861	Remote Similarity	NPC8524
0.6279	Remote Similarity	NPC104137
0.6279	Remote Similarity	NPC26626
0.6275	Remote Similarity	NPC23020
0.625	Remote Similarity	NPC13998
0.6014	Remote Similarity	NPC473452
0.5984	Remote Similarity	NPC164389
0.5948	Remote Similarity	NPC475584
0.5948	Remote Similarity	NPC475152
0.5921	Remote Similarity	NPC475394
0.5899	Remote Similarity	NPC286457
0.5833	Remote Similarity	NPC485563
0.5793	Remote Similarity	NPC102505
0.5793	Remote Similarity	NPC488514
0.5786	Remote Similarity	NPC480418
0.5725	Remote Similarity	NPC480423
0.5714	Remote Similarity	NPC480422
0.5683	Remote Similarity	NPC471577
0.5646	Remote Similarity	NPC489209
0.5634	Remote Similarity	NPC470876
0.5625	Remote Similarity	NPC309223
0.5603	Remote Similarity	NPC473386
0.56	Remote Similarity	NPC475208
0.558	Remote Similarity	NPC475899
0.5578	Remote Similarity	NPC478825
0.5562	Remote Similarity	NPC476113
0.5548	Remote Similarity	NPC220160
0.5479	Remote Similarity	NPC70809
0.5442	Remote Similarity	NPC482010
0.5425	Remote Similarity	NPC489208
0.5423	Remote Similarity	NPC4749
0.5417	Remote Similarity	NPC471580
0.5417	Remote Similarity	NPC475514
0.5397	Remote Similarity	NPC1046
0.5396	Remote Similarity	NPC123522
0.539	Remote Similarity	NPC283417
0.539	Remote Similarity	NPC200049
0.5385	Remote Similarity	NPC475527
0.5385	Remote Similarity	NPC21691
0.538	Remote Similarity	NPC475892
0.5379	Remote Similarity	NPC293330
0.5369	Remote Similarity	NPC480417
0.5368	Remote Similarity	NPC69811
0.5366	Remote Similarity	NPC472270
0.5366	Remote Similarity	NPC112492
0.5349	Remote Similarity	NPC480420
0.5306	Remote Similarity	NPC302543
0.5278	Remote Similarity	NPC57484
0.5231	Remote Similarity	NPC150400
0.5203	Remote Similarity	NPC33068
0.5185	Remote Similarity	NPC475504
0.5163	Remote Similarity	NPC477464
0.5135	Remote Similarity	NPC477463
0.5108	Remote Similarity	NPC481078
0.5074	Remote Similarity	NPC488517
0.5071	Remote Similarity	NPC11242
0.5069	Remote Similarity	NPC471550
0.5065	Remote Similarity	NPC485562
0.5057	Remote Similarity	NPC488513
0.5038	Remote Similarity	NPC475516
0.5037	Remote Similarity	NPC488526
0.5037	Remote Similarity	NPC305267
0.5034	Remote Similarity	NPC484546
0.5033	Remote Similarity	NPC224381

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC110385 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7913
0.1-0.2	1199
0.2-0.3	38
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data