NPASS Compound

Natural Product: NPC26626

Natural Product ID	NPC26626
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Asterlingulatoside C
IUPAC Name	[(2S,3R,4S,5S)-3-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl] (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-5-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms	asterlingulatoside C
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL450513
PubChem CID	44566668
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 157165 0 0 0 0 0 0 0 0999 V2000 8.1222 1.6107 2.1271 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1013 0.5802 1.0168 C 0 0 1 0 0 0 0 0 0 0 0 0 9.4881 0.0283 0.8060 C 0 0 1 0 0 0 0 0 0 0 0 0 9.4467 -0.9101 -0.3751 C 0 0 2 0 0 0 0 0 0 0 0 0 8.4444 -2.0181 -0.0143 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1072 -1.3885 0.3521 C 0 0 1 0 0 0 0 0 0 0 0 0 7.2670 -0.4656 1.3808 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6326 -0.7988 -0.7847 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4496 -1.3192 -1.2943 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7666 -1.9135 -2.6402 C 0 0 2 0 0 0 0 0 0 0 0 0 5.6516 -0.8940 -3.7502 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3122 -0.1763 -3.5883 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4009 0.5457 -2.4137 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3691 -0.2861 -1.3357 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0655 -0.8156 -1.1908 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2620 -0.5131 -0.1135 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7158 0.2581 0.7587 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8548 -1.0676 0.0668 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0962 -2.5684 0.1167 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4650 -3.1768 -1.1882 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5456 -2.7582 -2.3106 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6860 -3.5847 -2.2129 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2544 -3.1741 -3.6093 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3725 -1.2883 -2.3520 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1007 -0.5659 -1.0894 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3228 -0.2017 -0.8852 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0550 0.3033 -1.8391 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4784 0.7106 -1.7683 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0777 0.2833 -0.4708 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4943 0.7273 -0.2646 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8063 2.1344 -0.6230 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3408 -0.1555 -1.1925 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7956 -0.0011 -0.9874 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2793 -0.0120 0.4210 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3377 0.4743 1.4559 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5606 -0.3920 2.7087 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7034 1.8958 1.8902 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8825 0.3531 1.1316 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0246 1.0880 2.1005 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6347 0.4749 2.0012 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1255 0.5944 0.6166 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5905 2.0080 0.4436 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9388 -0.3877 0.4462 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4385 -1.7778 0.5749 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9497 0.0245 1.4987 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3953 -0.5993 1.4168 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4519 -1.5968 2.3903 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4209 0.8119 0.4567 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5860 0.1409 0.7333 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.1704 0.6498 2.0085 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.6854 0.6426 1.9601 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.0800 1.5609 0.8230 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.2244 1.3183 -0.4032 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.3695 2.5439 -0.6918 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6949 2.4176 -1.9011 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.4876 0.1689 -0.3272 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.4295 1.3954 0.5830 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.1502 1.1047 3.1879 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7814 -0.1923 3.0450 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6305 -1.4981 -5.0034 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9137 -2.9663 -2.9553 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8812 -2.7238 1.1045 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6819 -1.5253 -0.4742 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4368 1.0239 0.6633 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4677 1.0180 1.5586 C 0 0 1 0 0 0 0 0 0 0 0 0 12.8239 1.0340 0.8366 C 0 0 1 0 0 0 0 0 0 0 0 0 13.3654 2.4516 0.7344 C 0 0 2 0 0 0 0 0 0 0 0 0 13.5983 2.9904 2.1159 C 0 0 1 0 0 0 0 0 0 0 0 0 12.5878 2.3121 3.0421 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4114 2.2077 2.2893 O 0 0 0 0 0 0 0 0 0 0 0 0 14.9093 2.6582 2.4805 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4466 3.2102 0.0107 O 0 0 0 0 0 0 0 0 0 0 0 0 13.7591 0.2333 1.4510 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4578 2.5697 1.6910 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8881 1.2742 2.8540 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1243 1.6876 2.6243 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6887 1.0092 0.0811 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7760 -0.5925 1.6764 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0776 -0.4600 -1.3020 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2794 -2.7250 -0.8277 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4389 -2.1946 0.6818 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1315 -2.1321 -0.6272 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7978 -2.3128 -2.6618 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4769 -0.1528 -3.7521 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1408 0.4840 -4.4640 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5561 -0.9621 -3.6097 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5422 0.3686 -0.4285 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2478 -3.1312 0.5192 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0180 -2.6958 0.7659 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3254 -4.2927 -1.0757 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5060 -3.0503 -1.5118 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8795 -3.8976 -1.1458 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5668 -3.1424 -2.6780 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5094 -4.5546 -2.7374 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6430 -2.2851 -4.1441 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0976 -3.8391 -3.4216 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5195 -3.6460 -4.3052 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3517 -0.8896 -2.7621 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3379 -1.0424 -3.1748 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5586 0.4880 -1.2847 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6151 0.4728 -2.8395 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4656 1.8124 -1.9403 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0197 0.2979 -2.6488 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1363 -0.8485 -0.5502 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2525 2.5619 -1.4658 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8885 2.2429 -0.9476 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7271 2.8728 0.2032 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0985 0.2148 -2.2270 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0131 -1.2163 -1.1430 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2761 -0.8851 -1.5116 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2375 0.8657 -1.5644 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6753 -1.0425 0.6653 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0926 0.1473 3.5013 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2096 -1.2839 2.4609 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6282 -0.8192 3.0982 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2069 2.4413 1.0675 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8369 2.4347 2.2989 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4421 1.8453 2.7182 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6305 -0.7446 1.2365 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8715 2.1651 1.8879 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4034 1.0547 3.1448 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5770 -0.5030 2.4826 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9946 1.1462 2.6516 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7082 2.0814 -0.1871 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3839 2.4669 1.4527 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3552 2.6809 -0.0041 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8367 -2.4168 1.2562 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4767 -1.8678 1.0079 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5109 -2.3192 -0.3880 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3939 -0.1696 2.4972 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8306 1.1370 1.3790 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1165 0.1720 1.8372 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3530 -1.8047 2.6958 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3335 -0.9351 0.8711 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7901 1.6743 2.2976 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0120 -0.3869 1.7895 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8982 2.6005 1.1643 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9227 1.2234 -1.2590 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6756 2.7495 0.1493 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9937 3.4570 -0.7839 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2869 1.9861 -2.5645 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.5326 0.5722 0.0158 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.6586 1.9481 3.0122 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0294 -1.1222 2.9197 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5523 -0.7423 -5.6615 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5526 -2.8788 -3.8514 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0761 -3.1078 1.5335 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9696 -1.7424 0.4493 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4167 0.1988 2.3049 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7050 0.6766 -0.2102 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3152 2.3560 0.1467 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4772 4.0772 2.0984 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9648 1.3298 3.3535 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4563 2.9282 3.9553 H 0 0 0 0 0 0 0 0 0 0 0 0 15.5069 3.2165 1.9266 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3058 2.7343 -0.8558 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3606 -0.1647 0.7661 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 18 16 1 6 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 6 30 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 35 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 6 41 43 1 0 43 44 1 1 43 45 1 0 45 46 1 0 46 47 1 0 34 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 53 56 1 0 52 57 1 0 51 58 1 0 50 59 1 0 11 60 1 0 10 61 1 0 5 62 1 0 4 63 1 0 3 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 68 71 1 0 67 72 1 0 66 73 1 0 7 2 1 0 14 9 1 0 25 18 1 0 43 26 1 0 56 49 1 0 70 65 1 0 46 18 1 0 41 29 1 0 38 30 1 0 1 74 1 0 1 75 1 0 1 76 1 0 2 77 1 6 3 78 1 1 4 79 1 6 5 80 1 6 6 81 1 1 9 82 1 1 10 83 1 1 11 84 1 6 12 85 1 0 12 86 1 0 14 87 1 1 19 88 1 0 19 89 1 0 20 90 1 0 20 91 1 0 22 92 1 0 22 93 1 0 22 94 1 0 23 95 1 0 23 96 1 0 23 97 1 0 24 98 1 0 24 99 1 0 25100 1 6 27101 1 0 28102 1 0 28103 1 0 29104 1 6 31105 1 0 31106 1 0 31107 1 0 32108 1 0 32109 1 0 33110 1 0 33111 1 0 34112 1 1 36113 1 0 36114 1 0 36115 1 0 37116 1 0 37117 1 0 37118 1 0 38119 1 6 39120 1 0 39121 1 0 40122 1 0 40123 1 0 42124 1 0 42125 1 0 42126 1 0 44127 1 0 44128 1 0 44129 1 0 45130 1 0 45131 1 0 46132 1 1 47133 1 0 49134 1 1 50135 1 1 51136 1 6 52137 1 1 53138 1 6 54139 1 0 54140 1 0 55141 1 0 57142 1 0 58143 1 0 59144 1 0 60145 1 0 61146 1 0 62147 1 0 63148 1 0 65149 1 1 66150 1 6 67151 1 6 68152 1 6 69153 1 0 69154 1 0 71155 1 0 72156 1 0 73157 1 0 M END

Standard InCHIKey	CBKUPIHIUWBHCR-WJOMFMDUSA-N
Standard InCHI	InChI=1S/C52H84O21/c1-22-40(71-42-37(62)32(57)25(54)20-66-42)36(61)39(64)43(68-22)72-41-33(58)26(55)21-67-45(41)73-46(65)52-16-15-47(2,3)17-24(52)23-9-10-29-49(6)13-12-31(70-44-38(63)35(60)34(59)27(19-53)69-44)48(4,5)28(49)11-14-50(29,7)51(23,8)18-30(52)56/h9,22,24-45,53-64H,10-21H2,1-8H3/t22-,24-,25+,26-,27+,28-,29+,30+,31-,32-,33-,34+,35-,36-,37+,38+,39+,40-,41+,42-,43-,44-,45-,49-,50+,51+,52+/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@H]([C@H](CO[C@H]1OC(=O)[C@]12CCC(C)(C)C[C@H]1C1=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)C[C@H]2O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1044.55	Volume:	1010.261 ? Van der Waals volume.
Dense:	1.034	LogP:	1.6 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.368 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.198 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	51.0
TPSA:	333.67 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	12.0	Rings:	9.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.077	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.74	Fsp³:	0.942
MCE-18:	195.446 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.756	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.199	Promiscuous compounds:	0.101

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.307	MDCK Permeability:	-5.07
Pgp-inhibitor:	0.0	Pgp-substrate:	0.819
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.576
20% Bioavailability (F20%):	0.537	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.034
Plasma Protein Binding (PPB):	68.093%	Volume Distribution (VD):	-0.392
Fu:	20.352% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.003
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.001	CYP2C19-substrate:	0.001
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.941
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.134
HLM stability:	0.139 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.184

Half-life (T1/2):

3.458

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.007
Human Hepatotoxicity (H-HT):	0.798	Drug-induced Liver Injury (DILI):	0.942
AMES Toxicity:	0.951	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.047	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.515	Drug-induced Nephrotoxicity:	0.997
Genotoxicity:	0.128	RPMI-8226 Immunitoxicity:	0.316
A549 Cytotoxicity:	0.874	Hek293 Cytotoxicity:	0.306
BCF:	1.427 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.656 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.183 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.285 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO26359	Aster lingulatus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[9249983]
NPO26359	Aster lingulatus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO26359	Aster lingulatus	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	8800.0	nM	PMID[19128055]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC26626 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22262
0.1-0.2	22984
0.2-0.3	3156
0.3-0.4	824
0.4-0.5	320
0.5-0.6	113
0.6-0.7	59
0.7-0.8	0
0.8-0.85	5
0.85-0.9	1
0.9-0.95	1
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC104137
0.9135	High Similarity	NPC85154
0.8962	High Similarity	NPC286457
0.8485	Intermediate Similarity	NPC164389
0.8365	Intermediate Similarity	NPC815
0.8273	Intermediate Similarity	NPC473452
0.8108	Intermediate Similarity	NPC13998
0.8036	Intermediate Similarity	NPC470876
0.7938	Intermediate Similarity	NPC1046
0.7647	Intermediate Similarity	NPC489209
0.7636	Intermediate Similarity	NPC123522
0.7589	Intermediate Similarity	NPC283417
0.7589	Intermediate Similarity	NPC200049
0.7429	Intermediate Similarity	NPC488526
0.7417	Intermediate Similarity	NPC102505
0.7417	Intermediate Similarity	NPC488514
0.7391	Intermediate Similarity	NPC57484
0.7377	Intermediate Similarity	NPC33012
0.7304	Intermediate Similarity	NPC4749
0.7295	Intermediate Similarity	NPC8524
0.728	Intermediate Similarity	NPC489208
0.7227	Intermediate Similarity	NPC309223
0.713	Intermediate Similarity	NPC480423
0.7107	Intermediate Similarity	NPC220160
0.7083	Intermediate Similarity	NPC144644
0.7083	Intermediate Similarity	NPC37860
0.7083	Intermediate Similarity	NPC170407
0.6949	Remote Similarity	NPC21691
0.6909	Remote Similarity	NPC64715
0.6885	Remote Similarity	NPC70809
0.6855	Remote Similarity	NPC68767
0.6855	Remote Similarity	NPC293031
0.6852	Remote Similarity	NPC117714
0.6754	Remote Similarity	NPC11242
0.6697	Remote Similarity	NPC30289
0.6667	Remote Similarity	NPC237191
0.6667	Remote Similarity	NPC302543
0.6636	Remote Similarity	NPC232237
0.6514	Remote Similarity	NPC263756
0.6514	Remote Similarity	NPC469946
0.6491	Remote Similarity	NPC481079
0.6475	Remote Similarity	NPC23020
0.6455	Remote Similarity	NPC112352
0.6449	Remote Similarity	NPC485563
0.6429	Remote Similarity	NPC63159
0.6429	Remote Similarity	NPC482010
0.6379	Remote Similarity	NPC207738
0.6379	Remote Similarity	NPC481078
0.6364	Remote Similarity	NPC213674
0.6338	Remote Similarity	NPC472270
0.6338	Remote Similarity	NPC112492
0.6333	Remote Similarity	NPC135904
0.6299	Remote Similarity	NPC224381
0.6299	Remote Similarity	NPC142151
0.6299	Remote Similarity	NPC267694
0.629	Remote Similarity	NPC475514
0.6279	Remote Similarity	NPC110385
0.6279	Remote Similarity	NPC153673
0.626	Remote Similarity	NPC473386
0.6228	Remote Similarity	NPC297263
0.6218	Remote Similarity	NPC475287
0.6216	Remote Similarity	NPC76497
0.621	Remote Similarity	NPC265841
0.6183	Remote Similarity	NPC485562
0.6182	Remote Similarity	NPC480420
0.6176	Remote Similarity	NPC329893
0.6154	Remote Similarity	NPC51099
0.614	Remote Similarity	NPC105800
0.6136	Remote Similarity	NPC275225
0.6102	Remote Similarity	NPC31838
0.6102	Remote Similarity	NPC187290
0.6098	Remote Similarity	NPC471577
0.6083	Remote Similarity	NPC60557
0.6083	Remote Similarity	NPC67857
0.6068	Remote Similarity	NPC301449
0.6068	Remote Similarity	NPC601290
0.6066	Remote Similarity	NPC480419
0.6066	Remote Similarity	NPC123199
0.6053	Remote Similarity	NPC305267
0.6032	Remote Similarity	NPC41061
0.6032	Remote Similarity	NPC227551
0.6017	Remote Similarity	NPC295823
0.6017	Remote Similarity	NPC174720
0.6017	Remote Similarity	NPC475467
0.6015	Remote Similarity	NPC480421
0.6	Remote Similarity	NPC185466
0.5985	Remote Similarity	NPC484831
0.5985	Remote Similarity	NPC484830
0.5952	Remote Similarity	NPC488308
0.595	Remote Similarity	NPC610204
0.5946	Remote Similarity	NPC235405
0.5942	Remote Similarity	NPC472268
0.5938	Remote Similarity	NPC236638
0.5938	Remote Similarity	NPC294453
0.5938	Remote Similarity	NPC305981
0.592	Remote Similarity	NPC481080
0.5909	Remote Similarity	NPC475208
0.5909	Remote Similarity	NPC48499
0.5906	Remote Similarity	NPC471580
0.5906	Remote Similarity	NPC271610
0.5906	Remote Similarity	NPC312650
0.5902	Remote Similarity	NPC79643
0.5893	Remote Similarity	NPC249848
0.5893	Remote Similarity	NPC107966
0.5891	Remote Similarity	NPC261506
0.5891	Remote Similarity	NPC4328
0.5882	Remote Similarity	NPC475177
0.5874	Remote Similarity	NPC311178
0.5872	Remote Similarity	NPC90856
0.587	Remote Similarity	NPC297950
0.5862	Remote Similarity	NPC235438
0.5857	Remote Similarity	NPC475394
0.582	Remote Similarity	NPC300419
0.5816	Remote Similarity	NPC233223
0.5816	Remote Similarity	NPC183816
0.5816	Remote Similarity	NPC43589
0.5814	Remote Similarity	NPC481081
0.5811	Remote Similarity	NPC322904
0.5806	Remote Similarity	NPC475209
0.5806	Remote Similarity	NPC603137
0.5793	Remote Similarity	NPC488619
0.5789	Remote Similarity	NPC80843
0.5785	Remote Similarity	NPC210729
0.5785	Remote Similarity	NPC82931
0.5776	Remote Similarity	NPC44716
0.5776	Remote Similarity	NPC46665
0.5776	Remote Similarity	NPC2370
0.5776	Remote Similarity	NPC480475
0.5775	Remote Similarity	NPC475584
0.5775	Remote Similarity	NPC475152
0.5763	Remote Similarity	NPC302887
0.5762	Remote Similarity	NPC488204
0.5758	Remote Similarity	NPC250247
0.575	Remote Similarity	NPC160452
0.575	Remote Similarity	NPC69811
0.5746	Remote Similarity	NPC480422
0.5745	Remote Similarity	NPC484829
0.5741	Remote Similarity	NPC128925
0.5738	Remote Similarity	NPC288205
0.5738	Remote Similarity	NPC51465
0.5727	Remote Similarity	NPC214484
0.5726	Remote Similarity	NPC284449
0.5724	Remote Similarity	NPC222951
0.5703	Remote Similarity	NPC480418
0.5702	Remote Similarity	NPC295371
0.5702	Remote Similarity	NPC39211
0.569	Remote Similarity	NPC30735
0.5682	Remote Similarity	NPC488309
0.5678	Remote Similarity	NPC222580
0.5678	Remote Similarity	NPC488517
0.5664	Remote Similarity	NPC300655
0.5664	Remote Similarity	NPC13989
0.5664	Remote Similarity	NPC196874
0.5664	Remote Similarity	NPC475516
0.5655	Remote Similarity	NPC478559
0.5655	Remote Similarity	NPC478560
0.5646	Remote Similarity	NPC472269
0.5641	Remote Similarity	NPC251768
0.5635	Remote Similarity	NPC602995
0.563	Remote Similarity	NPC488515
0.5621	Remote Similarity	NPC488201
0.5616	Remote Similarity	NPC488618
0.5615	Remote Similarity	NPC476779
0.5614	Remote Similarity	NPC127056
0.561	Remote Similarity	NPC475119
0.5593	Remote Similarity	NPC475591
0.5593	Remote Similarity	NPC236870
0.5591	Remote Similarity	NPC488560
0.5586	Remote Similarity	NPC204458
0.5586	Remote Similarity	NPC238935
0.5578	Remote Similarity	NPC475444
0.5578	Remote Similarity	NPC473679
0.5565	Remote Similarity	NPC76972
0.5565	Remote Similarity	NPC469782
0.5565	Remote Similarity	NPC204414
0.5565	Remote Similarity	NPC607904
0.5565	Remote Similarity	NPC610461
0.5563	Remote Similarity	NPC324933
0.5556	Remote Similarity	NPC160415
0.5546	Remote Similarity	NPC475504
0.5537	Remote Similarity	NPC606145
0.5524	Remote Similarity	NPC329878
0.5512	Remote Similarity	NPC475160
0.5512	Remote Similarity	NPC473714
0.5508	Remote Similarity	NPC10607
0.55	Remote Similarity	NPC471435
0.55	Remote Similarity	NPC471434
0.5492	Remote Similarity	NPC488564
0.5492	Remote Similarity	NPC241909
0.5492	Remote Similarity	NPC80986
0.547	Remote Similarity	NPC192791
0.547	Remote Similarity	NPC223301
0.547	Remote Similarity	NPC171544
0.5462	Remote Similarity	NPC476774
0.5462	Remote Similarity	NPC476780
0.5455	Remote Similarity	NPC202828
0.5455	Remote Similarity	NPC119592
0.5455	Remote Similarity	NPC104372
0.5448	Remote Similarity	NPC482011

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC26626 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7460
0.1-0.2	1632
0.2-0.3	52
0.3-0.4	6
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data