Drug Information| Drug ID:   | NPD7901 |
| Drug Name:   | |
| Molecular Formula:   | C34H50O7 |
| Canonical SMILES:   | O=C(O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2C(=O)C=C2[C@@]1(C)CC[C@@]1([C@H]2C[C@](C)(CC1)C(=O)[O-])C)C)C)CCC(=O)[O-] |
| Standard InCHI:   | "InChI=1S/C34H50O7/c1-29(2)23-10-13-34(7)27(32(23,5)12-11-24(29)41-26(38)9-8-25(36)37)22(35)18-20-21-19-31(4,28(39)40)15-14-30(21,3)16-17-33(20,34)6/h18,21,23-24,27H,8-17,19H2,1-7H3,(H,36,37)(H,39,40)/p-2/t21-,23-,24-,27+,30+,31-,32-,33+,34+/m0/s1" |
| Standard InCHIKey:   | OBZHEBDUNPOCJG-WBXJDKIVSA-L |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7901Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7013 | NPC297687 |
| Remote Similarity | 0.68 | NPC74751 |
| Remote Similarity | 0.68 | NPC323943 |
| Remote Similarity | 0.68 | NPC503895 |
| Remote Similarity | 0.6154 | NPC482712 |
| Remote Similarity | 0.6027 | NPC480944 |
| Remote Similarity | 0.5789 | NPC278983 |
| Remote Similarity | 0.5789 | NPC91298 |
| Remote Similarity | 0.5526 | NPC526917 |
| Remote Similarity | 0.5244 | NPC608622 |
| Remote Similarity | 0.5244 | NPC583184 |
| Remote Similarity | 0.5217 | NPC471967 |
| Remote Similarity | 0.5185 | NPC147367 |
| Remote Similarity | 0.5125 | NPC96095 |
| Remote Similarity | 0.5125 | NPC600308 |
| Remote Similarity | 0.5122 | NPC4036 |
| Remote Similarity | 0.5122 | NPC65120 |
| Remote Similarity | 0.5122 | NPC145067 |
| Remote Similarity | 0.5122 | NPC329425 |
| Remote Similarity | 0.5122 | NPC142122 |
| Remote Similarity | 0.5122 | NPC233455 |
| Remote Similarity | 0.5122 | NPC158030 |
| Remote Similarity | 0.5122 | NPC93503 |
| Remote Similarity | 0.5122 | NPC238009 |
| Remote Similarity | 0.5122 | NPC599824 |
| Remote Similarity | 0.5122 | NPC610357 |
| Remote Similarity | 0.5106 | NPC482752 |
| Molecular Weight   | 568.34 |
| ALogP   | 0.5265 |
| MLogP   | 4.43 |
| XLogP   | 5.893 |
| HDA   | 7 |
| HBD   | 0 |
| Rotatable Bonds   | 15 |
| TPSA   | 123.63 |
| RO5 Violation   | 1 |