NPASS Compound

Natural Product: NPC482752

Natural Product ID	NPC482752
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	HLDYLAJAWSKPFZ-QHTHLUDZSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	102510758
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 100105 0 0 0 0 0 0 0 0999 V2000 3.1530 -1.4567 1.8648 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8013 -1.0456 0.4134 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2242 -2.2331 -0.4270 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3271 -0.8307 0.4436 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6006 -2.1199 0.6504 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7513 -1.7063 1.2549 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4631 -0.9199 0.2160 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9875 -1.9325 -0.7913 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6904 0.1814 -0.4455 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5084 0.5193 -1.6382 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1433 0.5605 -2.8219 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9035 0.8344 -1.3397 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4562 0.4528 -0.1692 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8670 0.7769 0.1318 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5227 1.5204 -1.0011 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9509 1.8568 -0.6039 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0022 3.3838 -0.4514 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3108 1.3111 0.7611 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0357 -0.1522 0.9227 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5947 -0.4710 0.5395 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6505 -1.4795 -0.5574 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9170 -0.9921 1.7848 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4965 -1.3696 1.5391 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6832 -0.2933 0.8602 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2720 0.7615 1.8814 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9370 1.4762 -1.6176 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6815 2.3435 -2.1464 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1212 0.1680 -2.0604 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7538 0.0216 -0.6592 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2071 -0.3521 -2.0290 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4529 1.3856 -0.4132 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9324 1.2512 -0.6459 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6014 0.1863 0.1457 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7964 -0.1391 -0.5373 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9288 0.2068 0.1559 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8015 -0.9903 0.4308 C 0 0 1 0 0 0 0 0 0 0 0 0 8.0142 -0.9318 -0.4516 C 0 0 2 0 0 0 0 0 0 0 0 0 8.8251 0.2826 -0.0201 C 0 0 1 0 0 0 0 0 0 0 0 0 7.8450 1.3951 0.2698 C 0 0 1 0 0 0 0 0 0 0 0 0 8.4359 2.7102 -0.0844 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4872 3.0917 0.5041 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8594 3.5333 -1.0494 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7012 1.1774 -0.4935 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5356 -0.0922 1.1189 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5702 -0.7754 -1.7642 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1282 -1.0828 1.7825 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1875 -1.1472 2.0866 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4842 -0.9777 2.5792 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1160 -2.5610 1.9692 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3610 -2.7213 -0.9439 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0473 -1.9634 -1.1517 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6781 -3.0621 0.1723 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1406 -0.2181 1.3833 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1489 -2.7160 1.3850 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3669 -2.6540 -0.2837 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5300 -1.2102 2.1957 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3585 -2.6020 1.4792 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2588 -2.1104 -1.6092 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1624 -2.9338 -0.3500 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9157 -1.6223 -1.2929 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8155 1.0750 0.2446 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4849 1.3783 -2.0870 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8796 1.4589 1.0270 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9260 2.4383 -1.1697 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5771 0.9006 -1.9143 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0010 3.7541 -0.7461 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2620 3.8711 -1.1189 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8124 3.6835 0.5979 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8445 1.9239 1.5783 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4043 1.4590 0.8782 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7576 -0.7192 0.3021 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2382 -0.4084 1.9757 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6904 -1.7939 -0.7924 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2392 -1.0564 -1.4889 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0117 -2.3696 -0.3088 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4328 -1.8756 2.2054 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9078 -0.1384 2.5202 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4783 -2.3168 1.0088 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0106 -1.5367 2.5272 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4251 1.7927 1.5037 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2345 0.6897 2.2020 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9859 0.6605 2.7417 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4235 -0.0505 -3.0131 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7346 -1.1987 -2.5049 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1704 0.5853 -2.6629 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2941 -0.5759 -1.9921 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2738 1.7432 0.5996 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0399 2.0525 -1.1883 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3621 2.2537 -0.3381 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1920 1.2247 -1.7470 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9524 0.6571 1.1063 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6307 0.6828 1.1339 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2194 -1.8945 0.1772 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6080 -1.8633 -0.3578 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5478 0.6005 -0.7914 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6010 1.4552 1.3641 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5074 4.1608 -1.5445 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9339 -0.9933 0.9460 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7655 -1.3445 -1.8639 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6692 -1.8891 1.9123 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 6 7 9 1 0 9 10 1 0 10 11 2 0 10 12 1 0 12 13 2 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 1 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 1 16 26 1 0 26 27 2 0 26 28 1 0 9 29 1 0 29 30 1 6 29 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 2 0 40 42 1 0 39 43 1 0 38 44 1 0 37 45 1 0 36 46 1 0 33 2 1 0 43 35 1 0 29 4 1 0 24 7 1 0 24 13 1 0 20 14 1 0 1 47 1 0 1 48 1 0 1 49 1 0 3 50 1 0 3 51 1 0 3 52 1 0 4 53 1 1 5 54 1 0 5 55 1 0 6 56 1 0 6 57 1 0 8 58 1 0 8 59 1 0 8 60 1 0 9 61 1 1 12 62 1 0 14 63 1 1 15 64 1 0 15 65 1 0 17 66 1 0 17 67 1 0 17 68 1 0 18 69 1 0 18 70 1 0 19 71 1 0 19 72 1 0 21 73 1 0 21 74 1 0 21 75 1 0 22 76 1 0 22 77 1 0 23 78 1 0 23 79 1 0 25 80 1 0 25 81 1 0 25 82 1 0 28 83 1 0 30 84 1 0 30 85 1 0 30 86 1 0 31 87 1 0 31 88 1 0 32 89 1 0 32 90 1 0 33 91 1 1 35 92 1 1 36 93 1 6 37 94 1 6 38 95 1 6 39 96 1 1 42 97 1 0 44 98 1 0 45 99 1 0 46100 1 0 M END

Standard InCHIKey	HLDYLAJAWSKPFZ-QHTHLUDZSA-N
Standard InCHI	InChI=1S/C36H54O10/c1-31(2)21-8-11-36(7)27(34(21,5)10-9-22(31)45-29-25(40)23(38)24(39)26(46-29)28(41)42)20(37)16-18-19-17-33(4,30(43)44)13-12-32(19,3)14-15-35(18,36)6/h16,19,21-27,29,38-40H,8-15,17H2,1-7H3,(H,41,42)(H,43,44)/t19-,21+,22+,23+,24+,25-,26+,27-,29-,32-,33+,34+,35-,36-/m1/s1
SMILES	CC1(C)[C@@H]2CC[C@]3(C)[C@H](C(=O)C=C4[C@H]5C[C@](C)(CC[C@]5(C)CC[C@@]34C)C(=O)O)[C@@]2(C)CC[C@@H]1O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1007/s11164-015-2099-x]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1134/S1021443711030101]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	root	n.a.	PMID[16441081]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[16675659]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	root	n.a.	PMID[22074222]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22074222]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	rhizome	n.a.	PMID[23867078]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	root	n.a.	PMID[23867078]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24479468]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	roots	n.a.	n.a.	PMID[24957203]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25445757]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25744461]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26841168]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32196343]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1
IC50	1

Activity Type	# Activity
Organism	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT742	Organism	Influenza A virus	Influenza A virus	Activity	=	47.0	%	PMID[26841168]
NPT742	Organism	Influenza A virus	Influenza A virus	IC50	=	39600.0	nM	PMID[26841168]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC482752 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	18194
0.1-0.2	27399
0.2-0.3	3664
0.3-0.4	476
0.4-0.5	69
0.5-0.6	13
0.6-0.7	23
0.7-0.8	0
0.8-0.85	0
0.85-0.9	4
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9059	High Similarity	NPC482746
0.8837	High Similarity	NPC482747
0.8837	High Similarity	NPC202666
0.8837	High Similarity	NPC471961
0.8837	High Similarity	NPC242015
0.7912	Intermediate Similarity	NPC482741
0.7912	Intermediate Similarity	NPC482745
0.7912	Intermediate Similarity	NPC482743
0.7912	Intermediate Similarity	NPC146753
0.7882	Intermediate Similarity	NPC471967
0.7826	Intermediate Similarity	NPC471965
0.7826	Intermediate Similarity	NPC482749
0.7553	Intermediate Similarity	NPC14617
0.75	Intermediate Similarity	NPC262199
0.7097	Intermediate Similarity	NPC482750
0.7041	Intermediate Similarity	NPC482734
0.7041	Intermediate Similarity	NPC182342
0.7041	Intermediate Similarity	NPC482727
0.7041	Intermediate Similarity	NPC471964
0.6915	Remote Similarity	NPC309780
0.6829	Remote Similarity	NPC482712
0.6829	Remote Similarity	NPC74751
0.6585	Remote Similarity	NPC4036
0.6585	Remote Similarity	NPC65120
0.6585	Remote Similarity	NPC145067
0.6585	Remote Similarity	NPC233455
0.6585	Remote Similarity	NPC158030
0.6531	Remote Similarity	NPC482717
0.6436	Remote Similarity	NPC482722
0.6436	Remote Similarity	NPC471963
0.6408	Remote Similarity	NPC247315
0.6408	Remote Similarity	NPC482728
0.64	Remote Similarity	NPC285091
0.6311	Remote Similarity	NPC482755
0.6275	Remote Similarity	NPC482729
0.6275	Remote Similarity	NPC482742
0.6275	Remote Similarity	NPC482744
0.619	Remote Similarity	NPC482737
0.619	Remote Similarity	NPC482735
0.6162	Remote Similarity	NPC482748
0.6111	Remote Similarity	NPC471962
0.602	Remote Similarity	NPC482726
0.5833	Remote Similarity	NPC96095
0.5804	Remote Similarity	NPC482739
0.5789	Remote Similarity	NPC286347
0.5784	Remote Similarity	NPC482751
0.5752	Remote Similarity	NPC482736
0.5752	Remote Similarity	NPC482738
0.5657	Remote Similarity	NPC480938
0.5556	Remote Similarity	NPC480943
0.5505	Remote Similarity	NPC482740
0.5455	Remote Similarity	NPC480937
0.5238	Remote Similarity	NPC275343
0.5189	Remote Similarity	NPC157868
0.5149	Remote Similarity	NPC294112

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC482752 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5979
0.1-0.2	3108
0.2-0.3	53
0.3-0.4	3
0.4-0.5	1
0.5-0.6	2
0.6-0.7	3
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.8837	High Similarity	NPD8328	Phase 2
0.6829	Remote Similarity	NPD7748	Pre-clinical
0.6585	Remote Similarity	NPD7515	Phase 2
0.6437	Remote Similarity	NPD7902	Phase 4
0.5106	Remote Similarity	NPD7900	Approved
0.5106	Remote Similarity	NPD7901	Clinical (unspecified phase)

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data