NPASS Compound

Natural Product: NPC482728

Natural Product ID	NPC482728
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	HJFOOTRGDAPZMV-KVVUUCQYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 141148 0 0 0 0 0 0 0 0999 V2000 -4.2778 0.6538 -0.9066 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4524 -0.5716 -0.7485 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8677 -1.5147 -1.9011 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9829 -0.3767 -0.9305 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5490 -0.0026 -2.3106 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3443 0.8309 -2.4515 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6931 0.7626 -1.3990 C 0 0 1 0 0 0 0 0 0 0 0 0 1.1933 2.2061 -1.2096 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1821 0.1678 -0.1417 C 0 0 1 0 0 0 0 0 0 0 0 0 1.1340 0.4979 0.9170 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9423 1.1684 1.9413 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4826 -0.0778 0.6652 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7803 -0.3075 -0.5913 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1242 -0.8939 -0.8888 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9308 -1.1957 0.3397 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0698 -2.0858 -0.0499 C 0 0 1 0 0 0 0 0 0 0 0 0 5.7213 -3.5065 0.3369 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3164 -2.0905 -1.5446 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2268 -0.6894 -2.1124 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9124 -0.0378 -1.8161 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1786 1.3365 -1.2627 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0735 0.1230 -3.0786 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8120 0.8162 -2.7082 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9392 -0.0227 -1.7764 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6022 -1.3175 -2.4378 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3352 -1.7403 0.6496 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9717 -2.5017 1.3888 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8443 -0.4535 0.4555 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0409 0.0192 1.0558 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7967 1.1131 2.0401 C 0 0 2 0 0 0 0 0 0 0 0 0 10.1333 1.4433 2.6770 C 0 0 1 0 0 0 0 0 0 0 0 0 11.1669 1.7142 1.6376 C 0 0 2 0 0 0 0 0 0 0 0 0 10.8254 1.3045 0.2509 C 0 0 2 0 0 0 0 0 0 0 0 0 10.3847 2.4722 -0.6275 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3960 2.0492 -1.9605 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9760 0.2552 0.0961 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4299 1.2302 2.0182 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9998 2.4592 3.6042 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9785 0.5962 3.0491 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2738 0.3761 0.1648 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6743 1.7783 0.3740 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5692 -0.3711 1.4587 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4345 -1.5556 1.2976 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7136 -1.3396 0.5074 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.7198 -0.8054 1.3211 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7179 -1.6813 1.6082 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.1210 -1.2612 1.2925 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8983 -2.5946 1.1870 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3193 -3.5923 2.1684 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.5701 -2.9882 3.3008 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5212 -2.6418 4.3822 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3611 -3.4920 4.7676 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5323 -1.4025 5.0037 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7145 -1.9556 2.9900 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6121 -4.6200 1.5285 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2504 -2.4054 1.3697 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3118 -0.5795 0.1273 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0459 0.6120 0.3163 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.2920 0.4951 -0.5264 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.5797 1.7771 -1.2808 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2705 2.9221 -0.3398 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8225 2.9071 0.0935 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0606 3.9580 -0.6284 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0089 3.7225 -1.2879 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5118 5.2689 -0.5868 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2427 1.6586 -0.0444 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1317 2.9346 0.7523 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8086 1.8025 -2.4137 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3736 0.2642 0.3328 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5766 1.1290 0.0393 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2505 0.3742 -1.4113 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8443 1.4155 -1.5686 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9842 -1.4301 -1.9290 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6513 -2.5614 -1.6273 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4456 -1.2247 -2.8562 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5667 -1.4347 -0.7998 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4334 -0.9102 -2.9789 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4214 0.5298 -2.7881 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1406 0.6059 -3.4493 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6921 1.8993 -2.6248 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0538 2.2873 -0.5600 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3564 2.5742 -2.2655 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3574 2.8835 -0.8787 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2460 -0.9606 -0.2876 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1451 -0.2565 1.5185 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9454 -1.8758 -1.3863 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2635 -0.2657 0.8652 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3164 -1.7423 1.1103 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3290 -4.1735 -0.3079 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0617 -3.7366 1.3885 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6416 -3.7296 0.2091 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6668 -2.7799 -2.0902 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3657 -2.4326 -1.6956 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3533 -0.7871 -3.2130 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1082 -0.1301 -1.7386 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4729 1.6283 -0.4606 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2191 1.3667 -0.8288 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1731 2.0952 -2.0712 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6609 0.8639 -3.7015 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9992 -0.7684 -3.6888 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2425 1.0678 -3.6003 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1580 1.7409 -2.1488 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5094 -1.8142 -2.8223 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1982 -2.0587 -1.6867 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9144 -1.2593 -3.2876 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4188 -0.8561 1.6660 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3911 2.0439 1.6263 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4465 0.4964 3.2079 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2988 2.8379 1.6134 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8049 0.9768 -0.2265 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1463 3.3017 -0.5771 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4272 2.9053 -0.3421 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3448 1.0804 -2.0315 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2681 0.5216 2.6851 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8870 2.8959 3.7318 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2640 0.9879 3.9092 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9362 2.3684 -0.4966 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8841 2.2568 1.0302 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5703 1.8593 1.0675 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0360 0.2932 2.2354 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6249 -0.7288 1.9501 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9118 -2.4610 0.9241 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7845 -1.8480 2.3317 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0531 -2.4024 0.3060 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4998 -2.6286 1.0656 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5932 -0.6711 2.1415 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7377 -3.0056 0.1715 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2147 -4.1189 2.6163 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9196 -3.8083 3.7283 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1191 -1.2051 5.8066 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9217 -4.9329 2.1845 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7599 -2.9666 0.7154 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3044 0.7114 1.4102 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2019 -0.3685 -1.1826 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6569 1.8196 -1.5337 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4376 3.8613 -0.9036 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8040 3.1704 1.1718 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3387 5.8917 -1.3825 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9957 2.5378 0.4400 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1100 2.4766 -3.0746 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9710 -0.4463 0.0090 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 1 7 9 1 0 9 10 1 0 10 11 2 0 10 12 1 0 12 13 2 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 1 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 6 16 26 1 0 26 27 2 0 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 33 36 1 0 32 37 1 0 31 38 1 0 30 39 1 0 9 40 1 0 40 41 1 1 40 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 2 0 51 53 1 0 50 54 1 0 49 55 1 0 48 56 1 0 47 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 2 0 63 65 1 0 62 66 1 0 61 67 1 0 60 68 1 0 59 69 1 0 44 2 1 0 54 46 1 0 66 58 1 0 40 4 1 0 24 7 1 0 36 29 1 0 24 13 1 0 20 14 1 0 1 70 1 0 1 71 1 0 1 72 1 0 3 73 1 0 3 74 1 0 3 75 1 0 4 76 1 1 5 77 1 0 5 78 1 0 6 79 1 0 6 80 1 0 8 81 1 0 8 82 1 0 8 83 1 0 9 84 1 6 12 85 1 0 14 86 1 6 15 87 1 0 15 88 1 0 17 89 1 0 17 90 1 0 17 91 1 0 18 92 1 0 18 93 1 0 19 94 1 0 19 95 1 0 21 96 1 0 21 97 1 0 21 98 1 0 22 99 1 0 22100 1 0 23101 1 0 23102 1 0 25103 1 0 25104 1 0 25105 1 0 29106 1 1 30107 1 6 31108 1 1 32109 1 6 33110 1 6 34111 1 0 34112 1 0 35113 1 0 37114 1 0 38115 1 0 39116 1 0 41117 1 0 41118 1 0 41119 1 0 42120 1 0 42121 1 0 43122 1 0 43123 1 0 44124 1 6 46125 1 6 47126 1 1 48127 1 6 49128 1 1 50129 1 1 53130 1 0 55131 1 0 56132 1 0 58133 1 1 59134 1 6 60135 1 6 61136 1 6 62137 1 1 65138 1 0 67139 1 0 68140 1 0 69141 1 0 M END

Standard InCHIKey	HJFOOTRGDAPZMV-KVVUUCQYSA-N
Standard InCHI	InChI=1S/C48H72O21/c1-43(2)23-8-11-48(7)36(21(50)16-19-20-17-45(4,13-12-44(20,3)14-15-47(19,48)6)42(63)69-39-31(57)26(52)25(51)22(18-49)64-39)46(23,5)10-9-24(43)65-41-35(30(56)29(55)34(67-41)38(61)62)68-40-32(58)27(53)28(54)33(66-40)37(59)60/h16,20,22-36,39-41,49,51-58H,8-15,17-18H2,1-7H3,(H,59,60)(H,61,62)/t20-,22-,23+,24+,25-,26+,27+,28+,29+,30+,31-,32-,33+,34+,35-,36-,39+,40+,41-,44-,45+,46+,47-,48-/m0/s1
SMILES	CC1(C)[C@H]2CC[C@@]3(C)[C@@H](C(=O)C=C4[C@@H]5C[C@@](C)(CC[C@@]5(C)CC[C@]34C)C(=O)O[C@@H]3[C@H]([C@@H]([C@H]([C@H](CO)O3)O)O)O)[C@]2(C)CC[C@H]1O[C@@H]1[C@H]([C@@H]([C@H]([C@H](C(=O)O)O1)O)O)O[C@@H]1[C@H]([C@@H]([C@H]([C@H](C(=O)O)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	984.46	Volume:	941.725 ? Van der Waals volume.
Dense:	1.045	LogP:	0.298 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.378 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.074 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	48.0
TPSA:	346.19 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	11.0	Rings:	8.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.102	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.465	Fsp³:	0.875
MCE-18:	181.867 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.861	Fluc inhibitor:	0.006 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.096 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.182	Promiscuous compounds:	0.268

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.553	MDCK Permeability:	-4.884
Pgp-inhibitor:	0.0	Pgp-substrate:	0.0
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.319
20% Bioavailability (F20%):	0.233	30% Bioavailability (F30%):	0.956
50% Bioavailability (F50%):	0.997

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.268
Plasma Protein Binding (PPB):	59.781%	Volume Distribution (VD):	-0.336
Fu:	25.488% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.976	BCRP inhibitor:	0.0
BSEP inhibitor:	0.001

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.211	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.963	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.362
HLM stability:	0.003 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.322

Half-life (T1/2):

3.405

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.51	Drug-induced Liver Injury (DILI):	0.956
AMES Toxicity:	0.225	Rat Oral Acute Toxicity:	0.007
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.002	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.995
Hematotoxicity:	0.288	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.503	RPMI-8226 Immunitoxicity:	0.313
A549 Cytotoxicity:	0.051	Hek293 Cytotoxicity:	0.027
BCF:	0.401 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.676 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.707 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.617 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1007/s11164-015-2099-x]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1134/S1021443711030101]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	root	n.a.	PMID[16441081]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[16675659]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	root	n.a.	PMID[22074222]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22074222]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	rhizome	n.a.	PMID[23867078]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	root	n.a.	PMID[23867078]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24479468]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	roots	n.a.	n.a.	PMID[24957203]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25445757]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25744461]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26841168]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32196343]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1
IC50	1

Activity Type	# Activity
Organism	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT742	Organism	Influenza A virus	Influenza A virus	Activity	=	47.0	%	PMID[26841168]
NPT742	Organism	Influenza A virus	Influenza A virus	IC50	=	39600.0	nM	PMID[26841168]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC482728 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20800
0.1-0.2	24700
0.2-0.3	3347
0.3-0.4	699
0.4-0.5	241
0.5-0.6	30
0.6-0.7	29
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC247315
0.7938	Intermediate Similarity	NPC482750
0.7549	Intermediate Similarity	NPC285091
0.7404	Intermediate Similarity	NPC482729
0.7404	Intermediate Similarity	NPC482742
0.7353	Intermediate Similarity	NPC482747
0.7353	Intermediate Similarity	NPC202666
0.7353	Intermediate Similarity	NPC471961
0.7353	Intermediate Similarity	NPC242015
0.7184	Intermediate Similarity	NPC482717
0.6972	Remote Similarity	NPC482737
0.6916	Remote Similarity	NPC482722
0.6916	Remote Similarity	NPC471963
0.6916	Remote Similarity	NPC482744
0.6852	Remote Similarity	NPC482734
0.6852	Remote Similarity	NPC182342
0.6852	Remote Similarity	NPC482727
0.6852	Remote Similarity	NPC471964
0.6792	Remote Similarity	NPC482741
0.6792	Remote Similarity	NPC482745
0.6792	Remote Similarity	NPC482743
0.6792	Remote Similarity	NPC146753
0.6789	Remote Similarity	NPC262199
0.6729	Remote Similarity	NPC471965
0.6729	Remote Similarity	NPC482749
0.6727	Remote Similarity	NPC482740
0.6726	Remote Similarity	NPC471962
0.6514	Remote Similarity	NPC251768
0.6408	Remote Similarity	NPC482752
0.6372	Remote Similarity	NPC301449
0.6372	Remote Similarity	NPC601290
0.6356	Remote Similarity	NPC482736
0.6356	Remote Similarity	NPC482738
0.6339	Remote Similarity	NPC482755
0.6228	Remote Similarity	NPC482735
0.6216	Remote Similarity	NPC14617
0.6195	Remote Similarity	NPC64715
0.6147	Remote Similarity	NPC157868
0.6058	Remote Similarity	NPC471967
0.5963	Remote Similarity	NPC309780
0.5946	Remote Similarity	NPC482746
0.5893	Remote Similarity	NPC192791
0.5868	Remote Similarity	NPC482739
0.5752	Remote Similarity	NPC75417
0.5669	Remote Similarity	NPC258617
0.5575	Remote Similarity	NPC473884
0.5487	Remote Similarity	NPC482748
0.5478	Remote Similarity	NPC242840
0.5439	Remote Similarity	NPC472949
0.5385	Remote Similarity	NPC11551
0.5339	Remote Similarity	NPC475591
0.5339	Remote Similarity	NPC236870
0.5328	Remote Similarity	NPC187290
0.5294	Remote Similarity	NPC31193
0.5276	Remote Similarity	NPC470218
0.5259	Remote Similarity	NPC475171
0.5254	Remote Similarity	NPC473401
0.5254	Remote Similarity	NPC159309
0.5254	Remote Similarity	NPC86222
0.5156	Remote Similarity	NPC283417
0.5156	Remote Similarity	NPC200049
0.5128	Remote Similarity	NPC469946
0.5126	Remote Similarity	NPC40775
0.5088	Remote Similarity	NPC482726
0.5086	Remote Similarity	NPC275343
0.5083	Remote Similarity	NPC118440
0.5082	Remote Similarity	NPC114484
0.5077	Remote Similarity	NPC4749
0.5041	Remote Similarity	NPC297263

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC482728 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6533
0.1-0.2	2554
0.2-0.3	53
0.3-0.4	6
0.4-0.5	3
0.5-0.6	0
0.6-0.7	0
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7353	Intermediate Similarity	NPD8328	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data