NPASS Compound

Natural Product: NPC482748

Natural Product ID	NPC482748
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	SLWCVFLNZDOMEZ-VVNIYGKJSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	127043009
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 122128 0 0 0 0 0 0 0 0999 V2000 -7.0625 -2.1236 0.8414 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6064 -0.7937 1.4595 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8567 -0.1233 1.9576 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7649 0.1460 0.7922 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1447 0.9185 -0.3200 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7530 2.2908 0.2350 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8481 0.2632 -0.8152 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0086 0.1062 0.3953 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.6317 -0.3997 0.1737 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3288 -1.1390 -0.8407 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9729 -1.6632 -1.0963 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9895 -0.9634 -0.2420 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5482 -1.4290 -0.4594 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3493 -2.8906 -0.2852 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2552 -1.1245 -1.9394 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1731 -1.3058 -2.2916 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1112 -0.4434 -1.4607 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7684 -0.4178 -0.0210 C 0 0 2 0 0 0 0 0 0 0 0 0 2.3069 0.9337 0.5081 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5885 -1.4640 0.6996 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3598 -1.5306 2.0596 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3216 -0.5360 0.3296 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0366 -0.6804 1.7953 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3713 -0.1121 2.0254 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3936 -0.8102 1.1798 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5988 -2.1676 1.8485 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6603 0.0140 1.2265 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3708 1.4785 0.9883 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4148 -0.1018 2.5246 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5731 -1.0558 2.4940 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4390 -0.8152 -1.6912 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1594 0.1390 -2.4211 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5578 0.2743 -1.9349 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5989 0.2169 -3.0341 C 0 0 2 0 0 0 0 0 0 0 0 0 6.1274 0.8113 -4.3428 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7008 0.3963 -4.6453 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5558 -0.2192 -5.9802 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1115 -1.3666 -6.1478 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9359 0.5269 -7.0904 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2607 -0.5367 -3.7044 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2144 2.1979 -4.3897 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9764 -1.1008 -3.2940 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7789 1.3232 -1.0672 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1778 0.9889 0.2110 C 0 0 1 0 0 0 0 0 0 0 0 0 7.5997 1.4835 0.3779 C 0 0 1 0 0 0 0 0 0 0 0 0 7.9148 1.5726 1.8483 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9650 0.7510 2.6495 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5208 1.1577 2.4059 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0004 2.0845 3.4295 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5419 3.2015 3.0859 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9866 1.7884 4.7776 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3905 1.6972 1.1212 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1066 -0.6073 2.5148 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9917 2.8947 2.2918 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5146 0.6299 -0.2530 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1014 1.1568 -1.3971 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2676 0.7161 -1.2836 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8215 1.8532 -2.5780 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6969 -2.0039 -0.0315 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6815 -2.6029 1.6420 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1917 -2.7914 0.6843 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6860 0.7283 2.6226 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3822 -0.8974 2.5896 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2498 -0.7972 0.4827 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6035 0.7883 1.1917 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7932 2.6385 -0.2156 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5172 3.0614 -0.0311 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6302 2.2925 1.3225 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0495 -0.6444 -1.3947 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3837 1.0200 -1.4671 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9957 1.1266 0.8925 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1128 -1.4021 -1.5632 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0279 -2.7524 -0.9913 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7743 -1.4400 -2.1846 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9472 0.0895 -0.6720 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3073 -3.4871 -0.2164 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2573 -3.1773 0.5767 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1541 -3.3959 -1.1658 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6161 -0.1121 -2.2087 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8333 -1.8367 -2.5964 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2913 -1.0708 -3.3695 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5461 -2.3417 -2.1756 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0190 0.5653 -1.9053 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6251 0.8576 1.5582 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0262 1.3418 -0.1959 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4048 1.6162 0.4515 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6512 -1.1526 0.5859 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5260 -2.4558 0.2030 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8670 -0.9176 2.6156 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0847 0.5112 0.0975 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1330 -1.6790 2.2102 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6741 0.0022 2.4313 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5998 -0.2694 3.0990 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2851 0.9599 1.8735 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2967 -2.7998 1.2680 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6000 -2.6240 1.9741 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9636 -2.0470 2.8983 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4742 1.6959 0.4152 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4046 2.0500 1.9658 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2086 1.9574 0.3943 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7981 -0.2673 3.4052 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9026 0.9031 2.7258 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3004 -2.1206 2.4763 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0905 -0.9226 3.4921 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5967 1.0736 -2.6032 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7597 -0.6543 -1.3150 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5336 0.7574 -2.7896 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7543 0.4318 -5.1737 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0123 1.2608 -4.5926 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0835 0.1172 -8.0031 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4159 2.6353 -4.7598 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6239 -1.4412 -2.6335 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2383 -0.0920 0.4016 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6552 2.5243 -0.0425 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9460 1.1499 2.0546 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1613 0.9912 3.7318 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9141 0.2390 2.4217 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1174 2.4942 5.4606 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8454 -0.9860 3.0722 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0119 3.4660 1.5033 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0461 1.2081 -0.8786 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5016 2.5364 -2.9449 H 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 6 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 1 5 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 6 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 1 18 20 1 0 20 21 1 0 18 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 25 27 1 0 27 28 1 6 27 29 1 0 29 30 1 0 17 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 2 0 37 39 1 0 36 40 1 0 35 41 1 0 34 42 1 0 33 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 2 0 49 51 1 0 48 52 1 0 47 53 1 0 46 54 1 0 45 55 1 0 5 56 1 0 56 57 2 0 56 58 1 0 30 2 1 0 40 32 1 0 52 44 1 0 8 2 1 0 27 9 1 0 25 12 1 0 22 13 1 0 1 59 1 0 1 60 1 0 1 61 1 0 3 62 1 0 3 63 1 0 4 64 1 0 4 65 1 0 6 66 1 0 6 67 1 0 6 68 1 0 7 69 1 0 7 70 1 0 8 71 1 1 10 72 1 0 11 73 1 0 11 74 1 0 12 75 1 6 14 76 1 0 14 77 1 0 14 78 1 0 15 79 1 0 15 80 1 0 16 81 1 0 16 82 1 0 17 83 1 6 19 84 1 0 19 85 1 0 19 86 1 0 20 87 1 0 20 88 1 0 21 89 1 0 22 90 1 6 23 91 1 0 23 92 1 0 24 93 1 0 24 94 1 0 26 95 1 0 26 96 1 0 26 97 1 0 28 98 1 0 28 99 1 0 28100 1 0 29101 1 0 29102 1 0 30103 1 0 30104 1 0 32105 1 6 33106 1 1 34107 1 1 35108 1 6 36109 1 6 39110 1 0 41111 1 0 42112 1 0 44113 1 1 45114 1 6 46115 1 6 47116 1 1 48117 1 6 51118 1 0 53119 1 0 54120 1 0 55121 1 0 58122 1 0 M END

Standard InCHIKey	SLWCVFLNZDOMEZ-VVNIYGKJSA-N
Standard InCHI	InChI=1S/C42H64O16/c1-37-13-14-38(2,36(53)54)17-20(37)19-7-8-22-39(3)11-10-23(40(4,18-43)21(39)9-12-42(22,6)41(19,5)16-15-37)55-35-31(27(47)26(46)30(57-35)33(51)52)58-34-28(48)24(44)25(45)29(56-34)32(49)50/h7,20-31,34-35,43-48H,8-18H2,1-6H3,(H,49,50)(H,51,52)(H,53,54)/t20-,21-,22-,23+,24+,25+,26+,27+,28-,29+,30+,31-,34+,35-,37-,38+,39+,40-,41-,42-/m1/s1
SMILES	C[C@@]12CC[C@@](C)(C[C@@H]2C2=CC[C@@H]3[C@@]4(C)CC[C@@H]([C@](C)(CO)[C@@H]4CC[C@@]3(C)[C@]2(C)CC1)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	824.42	Volume:	805.19 ? Van der Waals volume.
Dense:	1.024	LogP:	1.969 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.404 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.543 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	41.0
TPSA:	270.2 ? Topological Polar Surface Area.	H-Bond Acceptor:	16.0
H-Bond Donor:	9.0	Rings:	7.0
Heavy Atoms:	16.0

MedChem Properties

QED Drug-Likeness Score:	0.125	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.98	Fsp³:	0.881
MCE-18:	157.291 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.777	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.025 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.232	Promiscuous compounds:	0.121

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.175	MDCK Permeability:	-5.181
Pgp-inhibitor:	0.0	Pgp-substrate:	0.073
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.132	30% Bioavailability (F30%):	0.001
50% Bioavailability (F50%):	0.653

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	1.0
Plasma Protein Binding (PPB):	72.91%	Volume Distribution (VD):	-0.604
Fu:	21.866% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.155
OATP1B3 inhibitor:	0.001	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.091	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.083

Half-life (T1/2):

3.855

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.632	Drug-induced Liver Injury (DILI):	0.981
AMES Toxicity:	0.168	Rat Oral Acute Toxicity:	0.034
Maximum Recommended Daily Dose:	0.021	Skin Sensitization:	0.998
Carcinogencity:	0.096	Eye Corrosion:	0.0
Eye Irritation:	0.009	Respiratory Toxicity:	0.13
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.993
Hematotoxicity:	0.504	Drug-induced Nephrotoxicity:	0.997
Genotoxicity:	0.849	RPMI-8226 Immunitoxicity:	0.023
A549 Cytotoxicity:	0.013	Hek293 Cytotoxicity:	0.016
BCF:	0.398 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.373 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.982 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.038 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1007/s11164-015-2099-x]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1134/S1021443711030101]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	root	n.a.	PMID[16441081]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[16675659]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	root	n.a.	PMID[22074222]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22074222]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	rhizome	n.a.	PMID[23867078]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	root	n.a.	PMID[23867078]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24479468]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	roots	n.a.	n.a.	PMID[24957203]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25445757]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25744461]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26841168]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32196343]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO7154	Glycyrrhiza uralensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1
IC50	1

Activity Type	# Activity
Organism	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT742	Organism	Influenza A virus	Influenza A virus	Activity	=	47.0	%	PMID[26841168]
NPT742	Organism	Influenza A virus	Influenza A virus	IC50	=	39600.0	nM	PMID[26841168]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC482748 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23011
0.1-0.2	23081
0.2-0.3	2667
0.3-0.4	742
0.4-0.5	251
0.5-0.6	72
0.6-0.7	17
0.7-0.8	1
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8966	High Similarity	NPC309780
0.8152	Intermediate Similarity	NPC482751
0.7979	Intermediate Similarity	NPC482741
0.7979	Intermediate Similarity	NPC482745
0.7979	Intermediate Similarity	NPC482743
0.7979	Intermediate Similarity	NPC146753
0.7143	Intermediate Similarity	NPC482747
0.7143	Intermediate Similarity	NPC202666
0.7143	Intermediate Similarity	NPC471961
0.7143	Intermediate Similarity	NPC242015
0.6633	Remote Similarity	NPC482726
0.6596	Remote Similarity	NPC224121
0.6415	Remote Similarity	NPC482755
0.6381	Remote Similarity	NPC118440
0.6346	Remote Similarity	NPC471965
0.6346	Remote Similarity	NPC482749
0.6321	Remote Similarity	NPC131469
0.6262	Remote Similarity	NPC95437
0.6214	Remote Similarity	NPC472949
0.6204	Remote Similarity	NPC114692
0.6204	Remote Similarity	NPC236657
0.6162	Remote Similarity	NPC482752
0.6147	Remote Similarity	NPC218954
0.6111	Remote Similarity	NPC262199
0.6091	Remote Similarity	NPC187618
0.6091	Remote Similarity	NPC120116
0.6058	Remote Similarity	NPC473884
0.5981	Remote Similarity	NPC14617
0.5918	Remote Similarity	NPC286347
0.5877	Remote Similarity	NPC313110
0.5833	Remote Similarity	NPC251768
0.5833	Remote Similarity	NPC11551
0.581	Remote Similarity	NPC275343
0.5795	Remote Similarity	NPC171203
0.5795	Remote Similarity	NPC307426
0.5795	Remote Similarity	NPC98442
0.5795	Remote Similarity	NPC242468
0.5778	Remote Similarity	NPC263393
0.5743	Remote Similarity	NPC294112
0.5727	Remote Similarity	NPC482734
0.5727	Remote Similarity	NPC182342
0.5727	Remote Similarity	NPC482727
0.5727	Remote Similarity	NPC471964
0.5714	Remote Similarity	NPC482750
0.5701	Remote Similarity	NPC482746
0.5701	Remote Similarity	NPC475171
0.5588	Remote Similarity	NPC480937
0.5575	Remote Similarity	NPC301449
0.5575	Remote Similarity	NPC601290
0.5556	Remote Similarity	NPC482717
0.5487	Remote Similarity	NPC247315
0.5487	Remote Similarity	NPC482728
0.5472	Remote Similarity	NPC12288
0.5463	Remote Similarity	NPC157868
0.5421	Remote Similarity	NPC174679
0.5421	Remote Similarity	NPC279554
0.5421	Remote Similarity	NPC59804
0.5398	Remote Similarity	NPC64715
0.5364	Remote Similarity	NPC242840
0.5333	Remote Similarity	NPC480938
0.5328	Remote Similarity	NPC82380
0.5328	Remote Similarity	NPC244296
0.531	Remote Similarity	NPC611191
0.53	Remote Similarity	NPC204407
0.5288	Remote Similarity	NPC476887
0.5248	Remote Similarity	NPC57362
0.5248	Remote Similarity	NPC28198
0.5248	Remote Similarity	NPC476123
0.5196	Remote Similarity	NPC177246
0.5185	Remote Similarity	NPC476882
0.5179	Remote Similarity	NPC285091
0.5175	Remote Similarity	NPC31193
0.5172	Remote Similarity	NPC482737
0.5161	Remote Similarity	NPC155120
0.5161	Remote Similarity	NPC288833
0.514	Remote Similarity	NPC164194
0.5126	Remote Similarity	NPC471962
0.5106	Remote Similarity	NPC474525
0.5089	Remote Similarity	NPC192791
0.5089	Remote Similarity	NPC75417
0.5088	Remote Similarity	NPC482722
0.5088	Remote Similarity	NPC139044
0.5088	Remote Similarity	NPC471963
0.5088	Remote Similarity	NPC471383
0.5088	Remote Similarity	NPC482729
0.5088	Remote Similarity	NPC482742
0.5088	Remote Similarity	NPC482744
0.5078	Remote Similarity	NPC11577
0.5078	Remote Similarity	NPC141600
0.5053	Remote Similarity	NPC46441
0.5048	Remote Similarity	NPC471967
0.5046	Remote Similarity	NPC136877
0.5045	Remote Similarity	NPC488561
0.5043	Remote Similarity	NPC482735
0.5043	Remote Similarity	NPC477075
0.5043	Remote Similarity	NPC477076
0.5043	Remote Similarity	NPC477079
0.5041	Remote Similarity	NPC151543
0.5041	Remote Similarity	NPC475140

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC482748 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6887
0.1-0.2	2220
0.2-0.3	35
0.3-0.4	5
0.4-0.5	2
0.5-0.6	0
0.6-0.7	0
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7143	Intermediate Similarity	NPD8328	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data