NPASS Compound

Natural Product: NPC82380

Natural Product ID	NPC82380
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Bunkankasaponin B
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4S,4aR,6aR,6bS,8R,8aR,9R,10R,12aS,14aR,14bR)-9-acetyloxy-8-hydroxy-4,8a-bis(hydroxymethyl)-10-[(2S,3R,4R,5S,6R)-3-hydroxy-6-methyl-4,5-bis[[(Z)-2-methylbut-2-enoyl]oxy]oxan-2-yl]oxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4-dihydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms	Bunkankasaponin B
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2058435
PubChem CID	70692696
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 176183 0 0 0 0 0 0 0 0999 V2000 9.5243 2.8985 -2.1429 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9597 3.2947 -2.1907 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8417 2.7556 -1.3700 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2510 3.2368 -1.5156 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4875 1.7486 -0.3823 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3739 1.2839 0.3709 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2212 1.2930 -0.2498 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7487 0.3384 0.6476 C 0 0 1 0 0 0 0 0 0 0 0 0 8.7449 0.8773 1.6469 C 0 0 1 0 0 0 0 0 0 0 0 0 9.1233 2.2805 2.0855 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4803 0.9192 1.1774 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9406 -0.2466 0.7332 C 0 0 2 0 0 0 0 0 0 0 0 0 7.7374 -0.7455 -0.4468 C 0 0 1 0 0 0 0 0 0 0 0 0 9.1835 -0.8898 0.0024 C 0 0 1 0 0 0 0 0 0 0 0 0 9.9521 -1.4209 -1.0344 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5049 -2.6957 -1.0015 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2438 -3.3461 0.0687 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3093 -3.2784 -2.0586 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5777 -2.6134 -3.1452 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0916 -1.2157 -3.3988 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8231 -4.6582 -1.8993 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3019 -2.0902 -0.6526 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6314 -0.1283 0.3548 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6851 -0.9986 0.8427 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0204 -0.4276 2.0947 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8906 0.4709 1.7986 C 0 0 1 0 0 0 0 0 0 0 0 0 3.6307 1.8484 1.5725 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6971 2.8126 1.2779 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1297 0.1687 0.5354 C 0 0 1 0 0 0 0 0 0 0 0 0 2.4200 -1.0927 -0.1535 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8684 -1.5220 -0.2231 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4047 -1.3399 -1.6333 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8144 -3.0630 -0.0618 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7008 0.4432 0.8104 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1464 1.4383 0.1831 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2752 1.8187 0.3801 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9893 0.5339 0.5650 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4765 0.6467 0.2924 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1095 1.6443 1.1765 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5614 1.1918 -1.1437 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4449 0.3846 -2.0383 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7616 -0.0176 -1.3588 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4072 -0.9444 -0.2413 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3393 -2.3518 -0.9238 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4890 -1.1434 0.7782 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9109 0.0080 1.4206 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0391 -0.7238 0.2522 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7317 -1.4482 1.5380 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2394 -1.5576 1.6195 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5452 -0.1843 1.7710 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9877 0.3322 3.0996 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0455 -0.3177 1.8021 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2202 -1.7849 1.9605 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6257 0.2446 3.0887 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9556 0.8414 2.8948 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6741 0.6092 4.1081 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4743 1.1042 -1.0302 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6432 1.3016 -1.7870 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8292 1.7215 -0.9980 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.4786 2.9626 -1.6265 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.6269 2.7543 -3.1414 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3034 2.2887 -3.7244 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8592 3.1247 -4.8557 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7956 3.8250 -4.8169 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5960 3.1833 -6.0300 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3790 2.4140 -2.6716 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6079 1.8351 -3.4527 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6166 4.0344 -1.4284 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8383 0.7712 -0.8878 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1648 0.4492 0.4221 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.5362 0.9317 0.7344 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.5408 0.0174 0.0677 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.2835 -1.3720 0.5813 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.8510 -1.7856 0.4815 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.5685 -2.5275 -0.8309 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3453 -3.1933 -0.7571 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9190 -0.8427 0.7898 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.6613 -1.3847 1.9438 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.5363 0.1080 -1.3000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.7971 0.9564 2.1099 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6162 -1.3819 3.0207 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1725 -1.6940 4.2111 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1727 -1.0855 4.5638 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5877 -2.7445 5.0664 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0890 3.0926 -1.1318 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9318 3.5675 -2.8314 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3655 1.8483 -2.4401 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2724 4.0501 -2.9291 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8269 3.1606 -0.5696 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7586 2.5426 -2.2410 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2988 4.2444 -1.9697 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6294 0.0143 1.2527 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7786 0.2377 2.5534 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4252 3.0360 1.6154 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0056 2.4412 3.1773 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1604 2.5458 1.8245 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1050 -1.0635 1.4917 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5993 -0.2084 -1.3749 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1263 -1.6845 0.8081 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1951 -3.1134 -3.9093 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9837 -1.1781 -3.4420 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4665 -0.5203 -2.6202 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4532 -0.9038 -4.4068 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3539 -5.3655 -2.6174 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9182 -4.7229 -2.0976 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5410 -5.0287 -0.8945 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6733 -2.4293 -1.5078 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2735 -1.8216 1.3027 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9067 0.0774 2.6049 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1538 2.0834 2.5213 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3346 1.7714 0.7495 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8723 3.6332 1.8335 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5158 0.9373 -0.2197 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1591 -0.9882 -1.2867 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7728 -1.9660 0.0603 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5017 -1.2928 -2.2816 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9386 -0.3949 -1.7735 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9332 -2.2489 -1.9667 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7971 -3.5139 -0.2763 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0068 -3.4777 -0.7094 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4845 -3.2323 0.9769 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6901 2.0725 -0.5432 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6653 2.4811 -0.4114 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3311 2.4846 1.3012 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6454 -0.1318 -0.3000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7346 2.3862 0.5901 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2948 2.3295 1.5673 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6201 1.2950 2.0676 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8846 2.2341 -1.1553 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5564 1.1586 -1.6547 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7475 1.0407 -2.8847 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9522 -0.4943 -2.5002 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3225 -0.5278 -2.1857 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1310 -2.4135 -1.7051 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4904 -3.1345 -0.1519 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3664 -2.4622 -1.4214 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1703 -1.9343 1.5246 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3917 -1.5982 0.3198 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6123 -0.0148 2.3566 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3513 -1.2565 -0.4923 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2793 -1.1483 2.4065 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0676 -2.5193 1.3331 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9605 -1.8751 0.5665 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0247 -2.2713 2.3883 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0487 0.0697 3.3711 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9361 1.4069 3.2555 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4361 -0.2779 3.8793 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2155 -2.4710 1.2692 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2691 -1.9888 2.9847 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2350 -2.0946 2.2062 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6291 -0.5115 3.8986 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0182 1.0650 3.5199 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8494 1.9894 2.9698 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0741 0.4022 4.8476 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8692 0.4793 -2.4662 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4873 2.0532 0.0240 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4599 3.1746 -1.2198 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8844 3.7206 -3.5993 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3515 1.2118 -3.9756 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3011 3.7349 -6.8386 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2967 1.2460 -4.1794 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0293 4.7166 -0.8134 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4643 1.0846 1.0547 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6916 1.9318 0.3019 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5475 0.3331 0.4314 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9277 -2.0937 0.0765 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7257 -2.6004 1.2609 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3436 -3.3149 -0.9336 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5157 -1.8498 -1.6827 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4434 -4.1370 -0.4812 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4537 -0.7738 1.9978 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5146 1.0194 -1.6474 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3941 1.8267 2.4222 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2675 -3.6281 5.1592 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4113 -2.3832 6.0876 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5783 -3.0610 4.6836 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 9 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 2 0 19 20 1 0 18 21 1 0 13 22 1 0 12 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 6 27 28 1 0 26 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 29 34 1 0 34 35 2 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 1 38 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 6 43 45 1 0 45 46 1 0 43 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 1 50 52 1 0 52 53 1 6 52 54 1 0 54 55 1 0 55 56 1 0 42 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 2 0 63 65 1 0 62 66 1 0 61 67 1 0 60 68 1 0 59 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 74 77 1 0 73 78 1 0 72 79 1 0 71 80 1 0 25 81 1 0 81 82 1 0 82 83 2 0 82 84 1 0 14 8 1 0 31 24 1 0 52 34 1 0 66 58 1 0 77 70 1 0 55 26 1 0 50 37 1 0 47 38 1 0 1 85 1 0 1 86 1 0 1 87 1 0 2 88 1 0 4 89 1 0 4 90 1 0 4 91 1 0 8 92 1 1 9 93 1 1 10 94 1 0 10 95 1 0 10 96 1 0 12 97 1 1 13 98 1 6 14 99 1 1 19100 1 0 20101 1 0 20102 1 0 20103 1 0 21104 1 0 21105 1 0 21106 1 0 22107 1 0 24108 1 1 25109 1 1 27110 1 0 27111 1 0 28112 1 0 29113 1 6 30114 1 0 30115 1 0 32116 1 0 32117 1 0 32118 1 0 33119 1 0 33120 1 0 33121 1 0 35122 1 0 36123 1 0 36124 1 0 37125 1 6 39126 1 0 39127 1 0 39128 1 0 40129 1 0 40130 1 0 41131 1 0 41132 1 0 42133 1 6 44134 1 0 44135 1 0 44136 1 0 45137 1 0 45138 1 0 46139 1 0 47140 1 6 48141 1 0 48142 1 0 49143 1 0 49144 1 0 51145 1 0 51146 1 0 51147 1 0 53148 1 0 53149 1 0 53150 1 0 54151 1 0 54152 1 0 55153 1 6 56154 1 0 58155 1 6 59156 1 1 60157 1 1 61158 1 6 62159 1 6 65160 1 0 67161 1 0 68162 1 0 70163 1 1 71164 1 6 72165 1 1 73166 1 6 74167 1 1 75168 1 0 75169 1 0 76170 1 0 78171 1 0 79172 1 0 80173 1 0 84174 1 0 84175 1 0 84176 1 0 M END

Standard InCHIKey	YWRZZQBSAZIBEQ-LVBDLZJESA-N
Standard InCHI	InChI=1S/C60H92O24/c1-13-26(3)50(74)80-43-28(5)76-53(42(71)44(43)81-51(75)27(4)14-2)84-47-48(77-29(6)64)60(25-63)31(21-55(47,7)8)30-15-16-34-56(9)19-18-36(57(10,24-62)33(56)17-20-58(34,11)59(30,12)22-35(60)65)79-54-46(40(69)39(68)45(82-54)49(72)73)83-52-41(70)38(67)37(66)32(23-61)78-52/h13-15,28,31-48,52-54,61-63,65-71H,16-25H2,1-12H3,(H,72,73)/b26-13-,27-14-/t28-,31+,32-,33-,34-,35-,36+,37-,38+,39+,40+,41-,42-,43+,44-,45+,46-,47+,48+,52+,53+,54-,56+,57-,58-,59-,60+/m1/s1
SMILES	C/C=C(/C)C(=O)O[C@H]1[C@@H](C)O[C@H]([C@@H]([C@H]1OC(=O)/C(=CC)/C)O)O[C@H]1[C@@H]([C@@]2(CO)[C@@H](CC1(C)C)C1=CC[C@@H]3[C@@]4(C)CC[C@@H]([C@](C)(CO)[C@@H]4CC[C@@]3(C)[C@]1(C)C[C@H]2O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)OC(=O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1196.6	Volume:	1170.374 ? Van der Waals volume.
Dense:	1.022	LogP:	1.818 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.222 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.112 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	18.0	Rigid Bonds:	50.0
TPSA:	373.88 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	11.0	Rings:	8.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.036	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.217	Fsp³:	0.833
MCE-18:	187.182 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.883	Fluc inhibitor:	0.002 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.254	Promiscuous compounds:	0.26

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.048	MDCK Permeability:	-5.14
Pgp-inhibitor:	0.0	Pgp-substrate:	0.594
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.033
20% Bioavailability (F20%):	0.978	30% Bioavailability (F30%):	0.997
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.663	MRP1:	0.998
Plasma Protein Binding (PPB):	69.629%	Volume Distribution (VD):	-0.56
Fu:	21.899% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.162	BCRP inhibitor:	0.001
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.006
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.234

Half-life (T1/2):

3.122

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.554	Drug-induced Liver Injury (DILI):	0.988
AMES Toxicity:	0.976	Rat Oral Acute Toxicity:	0.048
Maximum Recommended Daily Dose:	0.017	Skin Sensitization:	1.0
Carcinogencity:	0.295	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.01
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.998
Hematotoxicity:	0.932	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.99	RPMI-8226 Immunitoxicity:	0.243
A549 Cytotoxicity:	0.978	Hek293 Cytotoxicity:	0.689
BCF:	0.309 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.437 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.442 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.171 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	wood	n.a.	n.a.	PMID[10691716]
NPO25430	Xanthoceras sorbifolium	Species	Sapindaceae	Eukaryota	n.a.	xylem	n.a.	PMID[10691716]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	husks	Inner Mongolia, China	2004-SEP	PMID[18549275]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22801644]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	leaves	n.a.	n.a.	PMID[23313635]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO25430	Xanthoceras sorbifolium	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO25430	Xanthoceras sorbifolium	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	10

Activity Type	# Activity
Cell line	8
Non-molecular	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT165	Cell line	HeLa	Homo sapiens	IC50	=	4030.0	nM	PMID[22801644]
NPT547	Cell line	BGC-823	Homo sapiens	IC50	=	2500.0	nM	PMID[22801644]
NPT83	Cell line	MCF7	Homo sapiens	IC50	=	2460.0	nM	PMID[22801644]
NPT306	Cell line	PC-3	Homo sapiens	IC50	=	2580.0	nM	PMID[22801644]
NPT65	Cell line	HepG2	Homo sapiens	IC50	=	4030.0	nM	PMID[22801644]
NPT81	Cell line	A549	Homo sapiens	IC50	=	3030.0	nM	PMID[22801644]
NPT453	Cell line	HT-1080	Homo sapiens	IC50	=	1140.0	nM	PMID[22801644]
NPT1171	Cell line	HEp-2	Homo sapiens	IC50	=	4720.0	nM	PMID[22801644]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	2220.0	nM	PMID[22801644]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	4140.0	nM	PMID[22801644]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC82380 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22477
0.1-0.2	22973
0.2-0.3	3328
0.3-0.4	675
0.4-0.5	294
0.5-0.6	71
0.6-0.7	26
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	1
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.981	High Similarity	NPC244296
0.9352	High Similarity	NPC470518
0.8136	Intermediate Similarity	NPC11577
0.7983	Intermediate Similarity	NPC141600
0.7632	Intermediate Similarity	NPC107536
0.7632	Intermediate Similarity	NPC280029
0.7632	Intermediate Similarity	NPC9470
0.75	Intermediate Similarity	NPC476780
0.7016	Intermediate Similarity	NPC271610
0.6905	Remote Similarity	NPC476777
0.6891	Remote Similarity	NPC25998
0.6885	Remote Similarity	NPC602995
0.6508	Remote Similarity	NPC329828
0.6484	Remote Similarity	NPC312650
0.6475	Remote Similarity	NPC472267
0.6475	Remote Similarity	NPC115656
0.6417	Remote Similarity	NPC477191
0.6406	Remote Similarity	NPC488308
0.6406	Remote Similarity	NPC476774
0.6385	Remote Similarity	NPC110700
0.6371	Remote Similarity	NPC478155
0.6364	Remote Similarity	NPC477077
0.6299	Remote Similarity	NPC252289
0.6299	Remote Similarity	NPC305793
0.6288	Remote Similarity	NPC476775
0.624	Remote Similarity	NPC478154
0.6154	Remote Similarity	NPC265841
0.6124	Remote Similarity	NPC478597
0.6119	Remote Similarity	NPC488309
0.6116	Remote Similarity	NPC64715
0.6094	Remote Similarity	NPC269484
0.6094	Remote Similarity	NPC97918
0.6083	Remote Similarity	NPC118440
0.6061	Remote Similarity	NPC476779
0.6031	Remote Similarity	NPC478596
0.5968	Remote Similarity	NPC477193
0.5954	Remote Similarity	NPC178264
0.594	Remote Similarity	NPC484059
0.594	Remote Similarity	NPC484060
0.5906	Remote Similarity	NPC252657
0.5906	Remote Similarity	NPC88311
0.5906	Remote Similarity	NPC609119
0.5878	Remote Similarity	NPC192765
0.5873	Remote Similarity	NPC477195
0.584	Remote Similarity	NPC477078
0.5827	Remote Similarity	NPC477196
0.5806	Remote Similarity	NPC236657
0.5802	Remote Similarity	NPC46823
0.5794	Remote Similarity	NPC329976
0.5772	Remote Similarity	NPC611191
0.5758	Remote Similarity	NPC329923
0.5758	Remote Similarity	NPC475281
0.5726	Remote Similarity	NPC603832
0.5725	Remote Similarity	NPC476778
0.5714	Remote Similarity	NPC187618
0.5683	Remote Similarity	NPC476776
0.568	Remote Similarity	NPC114692
0.5645	Remote Similarity	NPC131469
0.5635	Remote Similarity	NPC477076
0.5615	Remote Similarity	NPC1314
0.5615	Remote Similarity	NPC273878
0.561	Remote Similarity	NPC251768
0.56	Remote Similarity	NPC95437
0.5591	Remote Similarity	NPC120116
0.5547	Remote Similarity	NPC329657
0.5512	Remote Similarity	NPC218954
0.5512	Remote Similarity	NPC477079
0.5448	Remote Similarity	NPC470912
0.542	Remote Similarity	NPC313110
0.541	Remote Similarity	NPC472949
0.5407	Remote Similarity	NPC71391
0.5368	Remote Similarity	NPC484061
0.5368	Remote Similarity	NPC484062
0.5354	Remote Similarity	NPC302887
0.5349	Remote Similarity	NPC477192
0.5344	Remote Similarity	NPC478152
0.5338	Remote Similarity	NPC284449
0.5333	Remote Similarity	NPC277212
0.5333	Remote Similarity	NPC30279
0.5328	Remote Similarity	NPC482748
0.5312	Remote Similarity	NPC470914
0.5276	Remote Similarity	NPC470913
0.5273	Remote Similarity	NPC473160
0.5271	Remote Similarity	NPC301449
0.5271	Remote Similarity	NPC601290
0.5263	Remote Similarity	NPC478600
0.5263	Remote Similarity	NPC478599
0.5259	Remote Similarity	NPC283417
0.5259	Remote Similarity	NPC200049
0.5231	Remote Similarity	NPC160452
0.5227	Remote Similarity	NPC478151
0.5211	Remote Similarity	NPC484063
0.5211	Remote Similarity	NPC484064
0.5185	Remote Similarity	NPC478150
0.5175	Remote Similarity	NPC279915
0.5161	Remote Similarity	NPC473884
0.5159	Remote Similarity	NPC605226
0.5154	Remote Similarity	NPC477075
0.5152	Remote Similarity	NPC605294
0.5143	Remote Similarity	NPC484833
0.5128	Remote Similarity	NPC485563
0.512	Remote Similarity	NPC475171
0.5118	Remote Similarity	NPC44716
0.5108	Remote Similarity	NPC473452
0.5036	Remote Similarity	NPC470517
0.5036	Remote Similarity	NPC478598

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC82380 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7100
0.1-0.2	1991
0.2-0.3	54
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data