NPASS Compound

Natural Product: NPC603832

Natural Product ID	NPC603832
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	SMBRHXBVGDCQRG-HOSUYAQASA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1095016
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 135141 0 0 0 0 0 0 0 0999 V2000 -10.3956 -0.3355 0.4608 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3424 -0.6125 1.8955 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1820 -0.6214 2.5381 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1932 -0.9094 3.9968 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9050 -0.3714 1.8872 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8675 -0.3985 2.5636 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7820 -0.1037 0.5419 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5742 0.1410 -0.1487 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3596 -0.8313 -1.2611 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.4564 -2.1592 -0.8066 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1415 -0.6218 -2.0899 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.6391 -0.6442 -3.5691 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2080 -1.9150 -3.7050 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2200 -1.8267 -2.0929 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0114 -2.9750 -2.1095 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2614 -1.9275 -0.9759 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5952 -0.6519 -0.5372 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8806 -0.5001 0.9442 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1088 0.5410 -1.2099 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3719 1.6330 -1.2368 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0217 1.7752 -0.6284 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5157 0.5135 -0.0384 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9727 0.4474 0.2118 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8133 0.5942 -1.0011 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3161 1.6122 1.1285 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7178 1.1688 2.4973 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9446 0.2113 2.3895 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9929 0.8707 1.7966 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9897 1.2980 2.6546 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0678 2.6961 2.6923 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6569 3.2376 1.5803 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7463 4.2133 0.9471 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6087 4.4610 1.4169 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1870 4.8602 -0.1989 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0975 2.2254 0.5425 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9083 2.9239 -0.3715 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9909 1.1675 1.1526 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1214 0.1311 0.2443 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4338 -0.0338 -0.2008 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5921 0.1021 -1.5474 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8425 -1.1491 -2.0867 C 0 0 1 0 0 0 0 0 0 0 0 0 9.7995 -1.0998 -3.2554 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0325 -0.5693 -2.8893 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4219 -2.0028 -1.0154 C 0 0 2 0 0 0 0 0 0 0 0 0 8.8426 -3.2862 -1.1359 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0280 -1.3347 0.2555 C 0 0 1 0 0 0 0 0 0 0 0 0 10.2094 -1.1540 1.0069 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3384 0.7008 2.4418 C 0 0 1 0 0 0 0 0 0 0 0 0 7.1707 1.1596 3.4935 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4419 -1.0067 1.7172 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0867 -1.9912 2.8607 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4898 -1.7448 0.9249 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5537 -2.1819 1.7085 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1579 -0.8279 0.9692 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8993 -1.9957 0.0909 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5191 -1.9909 -0.3773 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0731 -0.6646 -0.7801 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7825 -0.4637 -2.2569 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4340 0.6559 -1.9137 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2352 1.8122 -1.4166 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4957 1.5413 -0.6920 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6734 1.9212 -1.5629 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6173 2.4751 0.5413 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.4252 -0.4867 0.0939 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9890 0.6591 0.1963 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7891 -1.1180 -0.0786 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2564 -0.8110 2.4365 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2936 -2.0059 4.1808 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3210 -0.5060 4.5245 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1179 -0.4439 4.4460 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7952 0.0698 0.6400 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2613 -0.6919 -1.9345 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9293 -2.2435 0.0382 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7683 -0.5892 -4.2355 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4112 0.1027 -3.7347 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9809 -2.3377 -4.5564 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6595 -1.8747 -3.0681 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7187 -3.6458 -2.7598 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8334 -2.4199 -0.1284 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5251 -2.7122 -1.2545 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8185 -1.0617 1.1573 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0674 0.5375 1.2368 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1208 -1.0322 1.5634 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7364 2.5434 -1.7364 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3868 2.2631 -1.3801 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1704 2.5632 0.1725 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9488 0.4747 1.0007 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0115 -0.2904 -1.5935 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8333 0.9451 -0.6534 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4633 1.4540 -1.6017 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5072 2.3490 1.2307 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1919 2.2085 0.7366 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0753 2.0301 3.0618 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9362 0.6617 3.0592 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2128 0.0982 3.4776 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6701 0.9882 3.6902 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5572 3.8032 1.9363 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5381 5.1842 -0.9073 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2559 1.7475 0.0400 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7155 2.6803 -1.3027 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9605 1.6488 1.3462 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0342 0.7722 0.3136 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8657 -1.5494 -2.4725 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9689 -2.1391 -3.6004 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3938 -0.5242 -4.1200 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5194 -0.1544 -3.6556 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5409 -2.1118 -1.1242 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0081 -3.8445 -0.3576 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3534 -1.9239 0.9109 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9141 -0.7001 0.4847 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3918 -0.3829 2.4940 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2430 0.4841 4.2052 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8413 -1.8780 3.6739 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0969 -1.7319 3.2857 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1121 -3.0305 2.5261 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9372 -1.0214 0.1821 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0974 -2.6492 0.4322 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3237 -2.3000 1.0822 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3374 -0.8310 1.7502 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0386 -2.9526 0.6756 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5815 -2.0877 -0.7696 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5195 -2.6497 -1.2997 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1372 -2.4797 0.4284 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0386 -1.1612 -2.6061 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5406 0.5894 -2.5157 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6292 -0.7301 -2.9116 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0850 0.9985 -2.9601 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5745 2.5059 -0.8177 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4981 2.4581 -2.3122 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2089 1.0702 -1.9996 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3606 2.6547 -1.0827 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2580 2.4831 -2.4437 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7641 2.2671 1.1964 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7266 3.5068 0.2093 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5497 2.1134 1.0479 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 9 11 1 0 11 12 1 6 12 13 1 0 11 14 1 0 14 15 1 0 14 16 1 0 16 17 1 0 17 18 1 1 17 19 1 0 19 20 2 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 6 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 2 0 32 34 1 0 31 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 37 48 1 0 48 49 1 0 27 50 1 0 50 51 1 1 50 52 1 0 52 53 1 0 50 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 6 19 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 61 63 1 0 61 8 1 0 59 11 1 0 57 17 1 0 57 22 1 0 54 23 1 0 48 29 1 0 46 39 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 0 4 68 1 0 4 69 1 0 4 70 1 0 8 71 1 1 9 72 1 6 10 73 1 0 12 74 1 0 12 75 1 0 13 76 1 0 14 77 1 6 15 78 1 0 16 79 1 0 16 80 1 0 18 81 1 0 18 82 1 0 18 83 1 0 20 84 1 0 21 85 1 0 21 86 1 0 22 87 1 1 24 88 1 0 24 89 1 0 24 90 1 0 25 91 1 0 25 92 1 0 26 93 1 0 26 94 1 0 27 95 1 1 29 96 1 1 31 97 1 1 34 98 1 0 35 99 1 6 36100 1 0 37101 1 1 39102 1 1 41103 1 6 42104 1 0 42105 1 0 43106 1 0 44107 1 6 45108 1 0 46109 1 1 47110 1 0 48111 1 6 49112 1 0 51113 1 0 51114 1 0 51115 1 0 52116 1 0 52117 1 0 53118 1 0 54119 1 1 55120 1 0 55121 1 0 56122 1 0 56123 1 0 58124 1 0 58125 1 0 58126 1 0 59127 1 6 60128 1 0 60129 1 0 62130 1 0 62131 1 0 62132 1 0 63133 1 0 63134 1 0 63135 1 0 M END

Standard InCHIKey	SMBRHXBVGDCQRG-HOSUYAQASA-N
Standard InCHI	InChI=1S/C46H72O17/c1-9-21(2)38(58)63-36-35(55)46(20-49)23(16-41(36,3)4)22-10-11-26-42(5)14-13-28(43(6,19-48)25(42)12-15-44(26,7)45(22,8)17-27(46)50)60-40-32(54)33(31(53)34(62-40)37(56)57)61-39-30(52)29(51)24(18-47)59-39/h9-10,23-36,39-40,47-55H,11-20H2,1-8H3,(H,56,57)/b21-9-/t23-,24-,25+,26+,27+,28-,29-,30+,31-,32+,33-,34-,35-,36-,39-,40+,42-,43+,44+,45+,46-/m0/s1
SMILES	C/C=C(/C)C(=O)O[C@H]1[C@H](O)[C@]2(CO)[C@H](O)C[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O[C@@H]6O[C@H](C(=O)O)[C@@H](O)[C@H](O[C@@H]7O[C@@H](CO)[C@H](O)[C@H]7O)[C@H]6O)[C@](C)(CO)[C@@H]5CC[C@]43C)[C@@H]2CC1(C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	896.48	Volume:	883.165 ? Van der Waals volume.
Dense:	1.015	LogP:	1.52 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.172 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.816 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	40.0
TPSA:	282.59 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	10.0	Rings:	7.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.063	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.345	Fsp³:	0.87
MCE-18:	157.791 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.784	Fluc inhibitor:	0.003 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.21	Promiscuous compounds:	0.228

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.406	MDCK Permeability:	-5.167
Pgp-inhibitor:	0.0	Pgp-substrate:	0.354
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.004
20% Bioavailability (F20%):	0.967	30% Bioavailability (F30%):	0.752
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.801	MRP1:	0.969
Plasma Protein Binding (PPB):	75.625%	Volume Distribution (VD):	-0.54
Fu:	17.593% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.765
OATP1B3 inhibitor:	0.001	BCRP inhibitor:	0.005
BSEP inhibitor:	0.025

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.002	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.001
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.266

Half-life (T1/2):

2.321

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.004
Human Hepatotoxicity (H-HT):	0.507	Drug-induced Liver Injury (DILI):	0.92
AMES Toxicity:	0.886	Rat Oral Acute Toxicity:	0.253
Maximum Recommended Daily Dose:	0.039	Skin Sensitization:	1.0
Carcinogencity:	0.537	Eye Corrosion:	0.0
Eye Irritation:	0.003	Respiratory Toxicity:	0.123
Drug-induced Neurotoxicity:	0.004	Ototoxicity:	0.985
Hematotoxicity:	0.851	Drug-induced Nephrotoxicity:	0.997
Genotoxicity:	0.966	RPMI-8226 Immunitoxicity:	0.151
A549 Cytotoxicity:	0.949	Hek293 Cytotoxicity:	0.575
BCF:	0.364 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.367 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.202 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.005 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8706	Aesculus pavia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[17914881]
NPO8706	Aesculus pavia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8706	Aesculus pavia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3
Inhibition	5
Activity	1
GI50	5

Activity Type	# Activity
Individual protein	9
Cell line	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1044	Individual protein	DNA topoisomerase II alpha	Homo sapiens	IC50	>	250000.0	nM	PMID[20371180]
NPT143	Individual protein	DNA topoisomerase I	Homo sapiens	Inhibition	n.a.	n.a.	%	PMID[20371180]
NPT143	Individual protein	DNA topoisomerase I	Homo sapiens	IC50	=	23800.0	nM	PMID[20371180]
NPT143	Individual protein	DNA topoisomerase I	Homo sapiens	Activity	n.a.	n.a.	n.a.	PMID[20371180]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT306	Cell line	PC-3	Homo sapiens	GI50	=	5510.0	nM	PMID[20371180]
NPT116	Cell line	HL-60	Homo sapiens	GI50	=	7500.0	nM	PMID[20371180]
NPT81	Cell line	A549	Homo sapiens	GI50	=	12920.0	nM	PMID[20371180]
NPT461	Cell line	PANC-1	Homo sapiens	GI50	=	10350.0	nM	PMID[20371180]
NPT171	Cell line	MRC5	Homo sapiens	GI50	=	15380.0	nM	PMID[20371180]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC603832 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20267
0.1-0.2	25241
0.2-0.3	3423
0.3-0.4	728
0.4-0.5	136
0.5-0.6	43
0.6-0.7	14
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7551	Intermediate Similarity	NPC603870
0.7182	Intermediate Similarity	NPC609119
0.7091	Intermediate Similarity	NPC472267
0.7091	Intermediate Similarity	NPC115656
0.7037	Intermediate Similarity	NPC477191
0.6838	Remote Similarity	NPC476774
0.6759	Remote Similarity	NPC611191
0.6667	Remote Similarity	NPC478597
0.6555	Remote Similarity	NPC478596
0.6518	Remote Similarity	NPC477193
0.6518	Remote Similarity	NPC477192
0.6404	Remote Similarity	NPC477195
0.6348	Remote Similarity	NPC477196
0.6167	Remote Similarity	NPC252289
0.6167	Remote Similarity	NPC305793
0.6146	Remote Similarity	NPC258547
0.6042	Remote Similarity	NPC283343
0.6034	Remote Similarity	NPC477194
0.6032	Remote Similarity	NPC476775
0.5983	Remote Similarity	NPC605294
0.5966	Remote Similarity	NPC478600
0.5966	Remote Similarity	NPC478599
0.5932	Remote Similarity	NPC25998
0.5827	Remote Similarity	NPC11577
0.5827	Remote Similarity	NPC141600
0.5798	Remote Similarity	NPC107536
0.5798	Remote Similarity	NPC280029
0.5798	Remote Similarity	NPC9470
0.5726	Remote Similarity	NPC82380
0.5726	Remote Similarity	NPC244296
0.5714	Remote Similarity	NPC11242
0.5691	Remote Similarity	NPC269484
0.5691	Remote Similarity	NPC97918
0.568	Remote Similarity	NPC478598
0.5635	Remote Similarity	NPC476780
0.56	Remote Similarity	NPC329828
0.5574	Remote Similarity	NPC478155
0.5565	Remote Similarity	NPC159309
0.5565	Remote Similarity	NPC86222
0.5455	Remote Similarity	NPC477197
0.5455	Remote Similarity	NPC476778
0.5447	Remote Similarity	NPC1314
0.5447	Remote Similarity	NPC273878
0.5447	Remote Similarity	NPC478154
0.544	Remote Similarity	NPC602995
0.5414	Remote Similarity	NPC476776
0.5378	Remote Similarity	NPC114484
0.5345	Remote Similarity	NPC605226
0.5312	Remote Similarity	NPC470518
0.5312	Remote Similarity	NPC21691
0.5242	Remote Similarity	NPC252657
0.5242	Remote Similarity	NPC88311
0.5234	Remote Similarity	NPC4749
0.5231	Remote Similarity	NPC271610
0.5185	Remote Similarity	NPC224121
0.5154	Remote Similarity	NPC265841
0.5152	Remote Similarity	NPC476777
0.5122	Remote Similarity	NPC329976
0.5086	Remote Similarity	NPC473884
0.5076	Remote Similarity	NPC484059
0.5076	Remote Similarity	NPC484060
0.5076	Remote Similarity	NPC476779

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC603832 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6568
0.1-0.2	2528
0.2-0.3	51
0.3-0.4	2
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data