NPASS Compound

Natural Product: NPC478155

Natural Product ID	NPC478155
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	xanifolia-Y10
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4S,4aS,6aR,6bS,8R,8aR,9R,10R,12aS,14aR,14bS)-8-hydroxy-8a-(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-9,10-bis[[(Z)-2-methylbut-2-enoyl]oxy]-2,3,4,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydro-1H-picen-3-yl]oxy]-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxy-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms	xanifolia-Y10
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44560536
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 164171 0 0 0 0 0 0 0 0999 V2000 8.8452 3.4422 2.0084 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6940 4.0500 0.9828 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7234 3.5812 -0.2323 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6219 4.2562 -1.2366 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9198 2.4383 -0.6773 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0074 2.0304 -1.8625 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0421 1.7582 0.1488 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2513 0.6469 -0.2539 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6715 -0.5893 0.4528 C 0 0 1 0 0 0 0 0 0 0 0 0 6.6846 -1.6862 0.5929 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4071 -1.5551 -0.1513 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0719 -0.2557 -0.7654 C 0 0 2 0 0 0 0 0 0 0 0 0 5.8014 0.9688 -0.2952 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2174 1.7528 0.8028 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7365 1.8853 0.8954 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9467 0.7328 0.3266 C 0 0 2 0 0 0 0 0 0 0 0 0 3.6356 0.1190 -0.8381 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0289 -0.1093 -1.9964 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6083 0.2010 -2.2543 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9433 0.0191 -0.9085 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4983 1.0908 -0.0115 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6271 1.1116 1.2255 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8104 1.4192 0.7677 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3263 0.1632 0.1708 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4989 -0.1073 -1.0641 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7801 -1.5688 -1.3997 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2024 -1.9007 -1.5476 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1281 -1.3156 -0.4930 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7850 0.0535 -0.0782 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4821 0.3253 1.2464 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3983 -1.3572 -1.0607 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2438 -2.3051 -0.4913 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5205 -1.7945 0.0127 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7215 -2.1390 -0.8425 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.6008 -3.4724 -1.5405 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2616 -3.5135 -2.2461 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2962 -3.4406 -1.3068 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2058 -2.5630 -3.3586 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1094 -2.5864 -4.2287 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1929 -1.6486 -3.4763 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5662 -4.4627 -0.5536 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0378 -1.0917 -1.7092 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3296 -0.6142 -1.4851 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.4174 0.8344 -1.1483 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.0423 1.4674 -2.3769 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.9475 0.3550 -3.4025 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.0292 -0.8247 -2.6634 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0370 0.4745 -4.4275 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9026 1.6779 -5.1211 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4258 2.6301 -2.7641 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3360 1.0694 -0.0981 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7875 -2.2063 1.3391 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0483 -1.1496 2.1947 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3538 -1.4047 2.9031 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3769 -0.5947 4.1881 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5445 0.6587 3.9992 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0994 0.2415 3.6872 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0690 -1.0593 3.2035 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3216 0.4137 4.9702 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9933 0.0900 4.8449 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5882 1.3902 5.1778 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9741 -1.3166 5.2888 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3988 -1.0243 2.0631 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0996 0.7006 -2.2032 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4073 2.4724 -0.6251 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8616 -0.2568 1.4741 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7652 1.3403 2.0178 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7008 1.9426 -1.5161 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1294 1.2938 -2.6462 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4437 -2.0519 2.0780 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4101 -2.9723 0.1144 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9704 -0.9873 0.0431 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1015 -0.9569 0.8036 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9409 -0.5357 1.9835 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3812 -1.3729 0.2988 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5259 -1.7913 -0.9346 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4368 -1.8808 -1.9125 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5702 -1.3314 1.1874 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7903 3.5970 1.7270 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1176 2.3739 2.1173 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9993 3.9855 2.9781 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3270 4.9181 1.2213 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6513 3.8492 -1.1943 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2604 4.0464 -2.2782 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6759 5.3373 -1.0784 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5405 0.4859 -1.3390 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8774 -0.2503 1.5207 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5957 -1.9952 0.5063 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4230 -2.3979 -0.9299 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4810 -0.3895 -1.8289 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6027 2.8219 0.7560 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5010 2.0580 1.9851 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3614 2.8026 0.4030 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5821 -0.5515 -2.8325 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1816 -0.4785 -3.0041 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5747 1.2745 -2.5956 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3473 -0.9454 -0.4710 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8798 1.8820 1.9559 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5046 0.0816 1.6822 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3624 1.5812 1.7441 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8779 2.3125 0.1557 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0576 -0.6693 0.8905 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2732 -2.1647 -0.6138 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2642 -1.7715 -2.3650 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6220 -1.7121 -2.5567 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3028 -3.0158 -1.4316 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1330 -2.0243 0.3738 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1848 0.7901 -0.7957 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9756 -0.2398 2.0716 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5667 1.3870 1.4790 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5039 -0.1084 1.1884 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6370 -2.6958 0.3973 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5158 -0.6790 0.0461 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5939 -2.2504 -0.1698 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4356 -3.5764 -2.2343 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1725 -4.5393 -2.7337 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3011 -0.8028 -4.0399 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7622 -4.2428 0.0149 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8407 -1.1981 -0.6827 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4439 1.3233 -0.9403 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1330 1.6646 -2.2461 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9806 0.4029 -3.9384 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0561 0.4671 -3.9839 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9417 -0.3308 -5.2143 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5111 2.3805 -4.7338 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8273 3.4191 -2.3390 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8538 0.2143 0.0404 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0388 -0.2197 1.6372 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4110 -2.4757 3.1994 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4388 -0.2607 4.3308 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9879 1.2503 3.1816 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7178 0.9400 2.9395 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4154 1.4746 5.2622 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8267 -0.1793 5.7674 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4319 0.8903 4.8938 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8359 0.8247 5.9592 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3121 -2.0038 5.0324 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0651 -1.7693 2.0654 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3767 0.9100 -3.0179 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5829 1.6456 -1.8176 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9413 0.1791 -2.7056 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3154 3.2640 0.1641 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5316 2.5984 -1.2749 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2776 2.6546 -1.2904 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3449 0.2301 2.3603 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4545 -1.2227 1.2266 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9079 -0.2763 1.9125 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7947 2.0686 2.6982 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6211 2.2145 -1.5463 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2597 2.8632 -1.2833 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7381 1.7066 -3.4427 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4848 -2.2332 2.4613 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9063 -1.3033 2.6306 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9136 -3.0190 2.1358 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2698 -3.1134 -0.9759 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4445 -2.9657 0.4536 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9210 -3.8759 0.5818 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5303 -2.1029 -1.2839 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8090 -2.3564 -2.8698 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9771 -0.9037 -2.1543 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6665 -2.5595 -1.5272 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3451 -1.6339 2.2299 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0139 -0.3166 1.2631 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3728 -2.0092 0.8298 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 36 38 1 0 38 39 2 0 38 40 1 0 35 41 1 0 34 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 45 50 1 0 44 51 1 0 33 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 56 61 1 0 55 62 1 0 54 63 1 0 25 64 1 6 21 65 1 6 16 66 1 1 14 67 1 0 13 68 1 6 68 69 1 0 10 70 1 0 10 71 1 0 9 72 1 0 72 73 1 0 73 74 2 0 73 75 1 0 75 76 2 0 76 77 1 0 75 78 1 0 13 8 1 0 17 12 1 0 21 16 1 0 25 20 1 0 29 24 1 0 37 32 1 0 47 43 1 0 58 53 1 0 1 79 1 0 1 80 1 0 1 81 1 0 2 82 1 0 4 83 1 0 4 84 1 0 4 85 1 0 8 86 1 6 9 87 1 1 11 88 1 0 11 89 1 0 12 90 1 6 14 91 1 6 15 92 1 0 15 93 1 0 18 94 1 0 19 95 1 0 19 96 1 0 20 97 1 1 22 98 1 0 22 99 1 0 23100 1 0 23101 1 0 24102 1 1 26103 1 0 26104 1 0 27105 1 0 27106 1 0 28107 1 1 29108 1 6 30109 1 0 30110 1 0 30111 1 0 32112 1 1 33113 1 1 34114 1 1 35115 1 6 36116 1 6 40117 1 0 41118 1 0 43119 1 1 44120 1 1 45121 1 1 46122 1 6 48123 1 0 48124 1 0 49125 1 0 50126 1 0 51127 1 0 53128 1 6 54129 1 1 55130 1 1 56131 1 6 57132 1 6 59133 1 0 59134 1 0 60135 1 0 61136 1 0 62137 1 0 63138 1 0 64139 1 0 64140 1 0 64141 1 0 65142 1 0 65143 1 0 65144 1 0 66145 1 0 66146 1 0 66147 1 0 67148 1 0 68149 1 0 68150 1 0 69151 1 0 70152 1 0 70153 1 0 70154 1 0 71155 1 0 71156 1 0 71157 1 0 76158 1 0 77159 1 0 77160 1 0 77161 1 0 78162 1 0 78163 1 0 78164 1 0 M END

Standard InCHIKey	LHJJKJNQRCMYPR-IHZMPRSVSA-N
Standard InCHI	InChI=1S/C56H86O22/c1-11-24(3)47(69)77-44-45(78-48(70)25(4)12-2)56(23-59)29(19-52(44,6)7)28-13-14-33-53(8)17-16-30(26(5)27(53)15-18-54(33,9)55(28,10)20-34(56)60)71-51-43(76-50-39(65)37(63)35(61)31(21-57)72-50)41(40(66)42(75-51)46(67)68)74-49-38(64)36(62)32(22-58)73-49/h11-13,26-27,29-45,49-51,57-66H,14-23H2,1-10H3,(H,67,68)/b24-11-,25-12-/t26-,27-,29-,30-,31+,32-,33+,34+,35-,36-,37-,38+,39+,40-,41-,42-,43+,44-,45-,49-,50-,51+,53-,54+,55+,56-/m0/s1
SMILES	C/C=C(/C)\C(=O)O[C@H]1[C@@H](C(C[C@@H]2[C@]1([C@@H](C[C@@]3(C2=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H]([C@H]5C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O[C@H]7[C@@H]([C@H]([C@@H](O7)CO)O)O)O[C@H]8[C@@H]([C@H]([C@H]([C@H](O8)CO)O)O)O)C)C)C)O)CO)(C)C)OC(=O)/C(=C\C)/C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1110.56	Volume:	1086.246 ? Van der Waals volume.
Dense:	1.022	LogP:	1.792 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.39 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.493 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	48.0
TPSA:	347.58 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	11.0	Rings:	8.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.05	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.996	Fsp³:	0.839
MCE-18:	178.233 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.797	Fluc inhibitor:	0.004 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.26	Promiscuous compounds:	0.213

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.306	MDCK Permeability:	-5.167
Pgp-inhibitor:	0.0	Pgp-substrate:	0.026
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.196
20% Bioavailability (F20%):	0.963	30% Bioavailability (F30%):	0.988
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.03	MRP1:	0.91
Plasma Protein Binding (PPB):	78.972%	Volume Distribution (VD):	-0.507
Fu:	13.324% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.049	BCRP inhibitor:	0.001
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.008
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.029	CYP3A4-substrate:	0.269
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.048
HLM stability:	0.006 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.033

Half-life (T1/2):

2.364

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.65	Drug-induced Liver Injury (DILI):	0.985
AMES Toxicity:	0.974	Rat Oral Acute Toxicity:	0.033
Maximum Recommended Daily Dose:	0.006	Skin Sensitization:	1.0
Carcinogencity:	0.489	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.018
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.995
Hematotoxicity:	0.938	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.962	RPMI-8226 Immunitoxicity:	0.226
A549 Cytotoxicity:	0.988	Hek293 Cytotoxicity:	0.652
BCF:	0.282 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.469 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.565 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.347 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	wood	n.a.	n.a.	PMID[10691716]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	husks	Inner Mongolia, China	2004-SEP	PMID[18549275]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22801644]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	leaves	n.a.	n.a.	PMID[23313635]
NPO30992	Xanthoceras sorbifolia	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT377	Cell line	OVCAR-3	Homo sapiens	IC50	=	4800	nM	PMID[18549275]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC478155 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22079
0.1-0.2	23360
0.2-0.3	3507
0.3-0.4	687
0.4-0.5	143
0.5-0.6	46
0.6-0.7	25
0.7-0.8	0
0.8-0.85	4
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8491	Intermediate Similarity	NPC478152
0.8318	Intermediate Similarity	NPC25998
0.8182	Intermediate Similarity	NPC478150
0.8165	Intermediate Similarity	NPC478154
0.7807	Intermediate Similarity	NPC329828
0.7632	Intermediate Similarity	NPC602995
0.7373	Intermediate Similarity	NPC476780
0.7167	Intermediate Similarity	NPC271610
0.7049	Intermediate Similarity	NPC476777
0.7018	Intermediate Similarity	NPC329976
0.6983	Remote Similarity	NPC609119
0.6897	Remote Similarity	NPC478151
0.6829	Remote Similarity	NPC478153
0.661	Remote Similarity	NPC107536
0.661	Remote Similarity	NPC280029
0.661	Remote Similarity	NPC9470
0.6532	Remote Similarity	NPC488308
0.648	Remote Similarity	NPC312650
0.6378	Remote Similarity	NPC110700
0.6371	Remote Similarity	NPC82380
0.6371	Remote Similarity	NPC244296
0.627	Remote Similarity	NPC265841
0.627	Remote Similarity	NPC476774
0.6231	Remote Similarity	NPC488309
0.619	Remote Similarity	NPC470518
0.6174	Remote Similarity	NPC605226
0.6172	Remote Similarity	NPC484059
0.6172	Remote Similarity	NPC484060
0.6172	Remote Similarity	NPC476779
0.616	Remote Similarity	NPC46823
0.6134	Remote Similarity	NPC477191
0.6116	Remote Similarity	NPC605294
0.6111	Remote Similarity	NPC192765
0.6063	Remote Similarity	NPC178264
0.6031	Remote Similarity	NPC476775
0.595	Remote Similarity	NPC477193
0.5859	Remote Similarity	NPC478597
0.5854	Remote Similarity	NPC477195
0.5847	Remote Similarity	NPC44716
0.5806	Remote Similarity	NPC477196
0.5781	Remote Similarity	NPC47995
0.5769	Remote Similarity	NPC478596
0.5704	Remote Similarity	NPC476778
0.5662	Remote Similarity	NPC476776
0.5659	Remote Similarity	NPC473918
0.5574	Remote Similarity	NPC302887
0.5574	Remote Similarity	NPC603832
0.5564	Remote Similarity	NPC484833
0.5556	Remote Similarity	NPC472267
0.5556	Remote Similarity	NPC115656
0.5455	Remote Similarity	NPC484061
0.5455	Remote Similarity	NPC484062
0.544	Remote Similarity	NPC160452
0.5426	Remote Similarity	NPC284449
0.542	Remote Similarity	NPC277212
0.542	Remote Similarity	NPC30279
0.541	Remote Similarity	NPC475591
0.541	Remote Similarity	NPC236870
0.5401	Remote Similarity	NPC484063
0.5401	Remote Similarity	NPC484064
0.5379	Remote Similarity	NPC71391
0.5378	Remote Similarity	NPC603026
0.5344	Remote Similarity	NPC283417
0.5344	Remote Similarity	NPC200049
0.5303	Remote Similarity	NPC252289
0.5303	Remote Similarity	NPC305793
0.5255	Remote Similarity	NPC11577
0.5255	Remote Similarity	NPC141600
0.5234	Remote Similarity	NPC473160
0.5207	Remote Similarity	NPC22956
0.5197	Remote Similarity	NPC477077
0.5156	Remote Similarity	NPC187290
0.5154	Remote Similarity	NPC252657
0.5154	Remote Similarity	NPC88311
0.5145	Remote Similarity	NPC302543
0.5143	Remote Similarity	NPC279915
0.5115	Remote Similarity	NPC478600
0.5115	Remote Similarity	NPC478599
0.5113	Remote Similarity	NPC269484
0.5113	Remote Similarity	NPC97918
0.5039	Remote Similarity	NPC470914

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC478155 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7036
0.1-0.2	2045
0.2-0.3	67
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data