NPASS Compound

Natural Product: NPC476776

Natural Product ID	NPC476776
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	theasaponins F3
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4S,6aR,6bS,8R,8aR,9R,10R,14bR)-8a-(acetyloxymethyl)-8,9-dihydroxy-4-methoxycarbonyl-4,6a,6b,11,11,14b-hexamethyl-10-[(Z)-2-methylbut-2-enoyl]oxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-5-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms	theasaponins F3
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44566252
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 180188 0 0 0 0 0 0 0 0999 V2000 12.7056 -0.5784 2.1441 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5285 0.4604 1.4941 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0673 1.3507 0.6534 C 0 0 0 0 0 0 0 0 0 0 0 0 13.9698 2.3547 0.0508 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6648 1.3635 0.2974 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2058 2.2291 -0.5332 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6956 0.5261 0.7523 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3317 0.5174 0.4092 C 0 0 1 0 0 0 0 0 0 0 0 0 9.0290 -0.7309 -0.3711 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6208 -0.9021 -0.8071 C 0 0 2 0 0 0 0 0 0 0 0 0 7.3140 -0.2419 -2.0959 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8614 -0.0392 -2.4347 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1060 0.6135 -1.2925 C 0 0 2 0 0 0 0 0 0 0 0 0 5.2885 -0.4531 -0.2438 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2717 -1.1990 0.0292 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9176 -1.1525 -0.5625 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8553 -0.3159 -1.8302 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6750 0.9080 -1.5997 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9999 1.5587 -0.3997 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5496 1.6626 -0.4401 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7288 0.9849 -1.4939 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4107 -0.1117 -2.1996 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6440 -1.4414 -1.9996 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7757 -1.1557 -2.4395 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3522 -0.4745 -1.1524 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6698 0.7737 -0.9791 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6230 1.8474 -1.5923 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7156 1.1510 0.4849 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8287 0.3169 1.3907 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6282 2.4830 0.8107 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6431 3.0458 2.0865 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7216 -0.3417 -1.3333 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4444 -1.3800 -0.7717 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6797 -0.9426 -0.1254 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7658 -2.0234 -0.0801 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0983 -3.3677 -0.2613 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2884 -3.4122 -1.5105 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8817 -2.1637 -1.9229 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0069 -4.1076 -2.5833 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4882 -5.2543 -2.4272 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1663 -3.4958 -3.8106 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3890 -3.7572 0.8750 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6494 -1.7758 -1.0981 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9637 -1.7710 -0.7201 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4445 -0.2962 -0.5752 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3998 0.4325 -1.8443 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7606 -0.4171 -3.0504 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4253 -1.8607 -2.8985 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7368 -2.4098 -1.6485 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9980 0.0869 -4.1277 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1824 1.1145 -2.0764 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6842 -0.2998 0.0427 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7444 -0.0455 1.3626 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.6594 1.1097 1.6649 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.0599 0.8261 1.1848 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.1365 -0.5622 0.6255 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.4460 -1.5947 1.4477 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2940 -1.1372 2.0862 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.5159 -0.9057 0.6559 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.3821 1.7457 0.1766 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7462 1.2065 3.0782 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4552 -0.4893 1.1757 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0223 0.7842 1.3447 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0470 1.8260 1.7716 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.7316 3.1454 2.0345 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9023 2.9904 2.9604 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9665 1.5084 3.3551 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0947 0.7128 2.2500 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2742 1.3907 4.1631 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4315 0.0576 4.5129 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1045 3.3693 2.3524 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2067 3.6250 0.8093 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2736 1.4171 2.8643 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3255 0.0791 -3.6975 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6783 1.9123 -2.7319 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6521 -0.6805 0.3382 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0439 0.1973 1.4464 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3923 0.7762 1.5435 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2908 2.2910 1.8056 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1077 0.2582 2.8084 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7895 1.8989 -1.0178 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1027 0.8797 -2.3619 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5595 -2.4296 -1.1516 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9022 -3.1281 0.0456 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9309 -4.5019 0.0057 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6677 -5.1798 -1.0217 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2970 -5.2438 1.2527 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8485 -0.7333 -1.5026 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1353 -0.2098 3.0228 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0921 -1.1675 1.4252 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3940 -1.3583 2.5893 H 0 0 0 0 0 0 0 0 0 0 0 0 14.6092 0.4851 1.7296 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6537 2.5601 -1.0035 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9453 3.3300 0.5655 H 0 0 0 0 0 0 0 0 0 0 0 0 15.0306 2.0196 0.0596 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2313 1.3601 -0.3077 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3265 -1.6528 0.2023 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6628 -0.9272 -2.9404 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8134 0.4619 -3.3901 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4357 -1.0550 -2.5651 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4151 -1.9722 0.8051 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2483 -0.8098 0.2393 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6285 -2.2017 -0.7846 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3909 -0.9021 -2.6019 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3134 0.9678 0.5126 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4279 2.5681 -0.1886 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1749 1.2657 0.5608 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2075 2.7699 -0.3744 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5429 1.7822 -2.2915 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6106 -1.7675 -0.9700 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0195 -2.2067 -2.7135 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2765 -2.1344 -2.5624 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8802 -0.4712 -3.2709 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1627 -1.2522 -0.3974 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4048 1.9782 -2.6693 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5536 2.7971 -1.0115 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6780 1.5301 -1.5189 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5158 3.7340 2.1466 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3187 3.6269 2.2281 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6709 2.2145 2.8144 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7633 -2.0325 -0.2059 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1417 -0.0862 -0.7046 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3035 -2.0188 0.8981 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9370 -4.1045 -0.3772 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3565 -4.0224 -1.3067 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4869 -3.9705 -4.6506 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3403 -4.7640 0.8513 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0100 -2.1356 0.3263 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7179 0.0941 0.1557 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1827 1.2418 -1.8165 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8171 -0.2665 -3.3612 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3610 -1.9919 -3.1697 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0431 -2.4304 -3.6319 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4908 0.7802 -4.6340 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3491 2.0115 -2.4565 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7581 0.1771 1.8639 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2997 2.0881 1.2867 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8077 0.9369 2.0228 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8790 -0.6235 -0.4613 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1491 -2.0868 2.1603 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1226 -2.4132 0.7622 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.9251 -0.8698 -0.2340 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9581 1.5208 -0.6719 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9353 0.2731 3.4065 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4848 1.0984 0.3851 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3307 2.0491 0.9264 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0184 3.8953 2.4551 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7343 3.5998 3.8737 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1767 1.2581 4.0611 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1323 1.7471 3.6061 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1637 1.9929 5.1076 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8381 -0.1262 5.2916 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7052 3.7454 3.0665 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4846 3.6407 0.1260 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0565 2.2107 3.4455 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8745 -0.8213 -4.2279 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8288 1.0019 -4.0149 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3569 0.0976 -4.1638 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6671 2.1415 -3.1341 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1748 2.8802 -2.3982 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2676 1.6332 -3.6170 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6388 -1.7158 0.8289 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8243 -0.2625 2.4773 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2800 1.0369 1.4977 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3775 2.8312 0.8345 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0692 2.5882 2.5194 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3072 2.4444 2.2967 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4364 0.3635 3.7001 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2744 -0.8320 2.6939 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0068 0.8499 3.0316 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0367 2.4821 -1.9606 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3677 2.5966 -0.3239 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8580 1.7445 -0.6398 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9970 1.1411 -3.3006 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4953 -2.6360 -1.3381 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2365 -2.6530 -1.9839 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4283 -5.7491 1.6685 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7136 -4.5578 2.0219 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0861 -5.9940 1.0351 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0471 -1.6769 -1.7681 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 6 26 28 1 0 28 29 2 0 28 30 1 0 30 31 1 0 25 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 37 39 1 0 39 40 2 0 39 41 1 0 36 42 1 0 35 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 47 50 1 0 46 51 1 0 45 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 56 59 1 0 55 60 1 0 54 61 1 0 34 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 67 69 1 0 69 70 1 0 66 71 1 0 65 72 1 0 64 73 1 0 22 74 1 6 18 75 1 6 14 76 1 0 76 77 1 0 77 78 1 0 78 79 1 0 78 80 1 0 13 81 1 1 11 82 1 0 10 83 1 6 83 84 1 0 84 85 1 0 85 86 2 0 85 87 1 0 9 88 1 0 78 8 1 0 76 10 1 0 18 13 1 0 22 17 1 0 26 21 1 0 38 33 1 0 49 44 1 0 58 53 1 0 68 63 1 0 1 89 1 0 1 90 1 0 1 91 1 0 2 92 1 0 4 93 1 0 4 94 1 0 4 95 1 0 8 96 1 6 9 97 1 1 11 98 1 6 12 99 1 0 12100 1 0 15101 1 0 16102 1 0 16103 1 0 17104 1 0 19105 1 0 19106 1 0 20107 1 0 20108 1 0 21109 1 0 23110 1 0 23111 1 0 24112 1 0 24113 1 0 25114 1 1 27115 1 0 27116 1 0 27117 1 0 31118 1 0 31119 1 0 31120 1 0 33121 1 1 34122 1 6 35123 1 1 36124 1 6 37125 1 1 41126 1 0 42127 1 0 44128 1 1 45129 1 1 46130 1 1 47131 1 6 48132 1 0 48133 1 0 50134 1 0 51135 1 0 53136 1 1 54137 1 6 55138 1 1 56139 1 6 57140 1 0 57141 1 0 59142 1 0 60143 1 0 61144 1 0 63145 1 6 64146 1 6 65147 1 1 66148 1 1 67149 1 1 69150 1 0 69151 1 0 70152 1 0 71153 1 0 72154 1 0 73155 1 0 74156 1 0 74157 1 0 74158 1 0 75159 1 0 75160 1 0 75161 1 0 76162 1 0 77163 1 0 77164 1 0 79165 1 0 79166 1 0 79167 1 0 80168 1 0 80169 1 0 80170 1 0 81171 1 0 81172 1 0 81173 1 0 82174 1 0 83175 1 0 83176 1 0 87177 1 0 87178 1 0 87179 1 0 88180 1 0 M END

Standard InCHIKey	ATBIRQWSFWRRKH-PBXHKCJESA-N
Standard InCHI	InChI=1S/C60H92O28/c1-11-24(2)49(76)88-47-46(73)60(23-81-25(3)62)27(18-55(47,4)5)26-12-13-31-56(6)16-15-34(59(9,54(77)78-10)32(56)14-17-57(31,7)58(26,8)19-33(60)65)83-53-45(87-51-40(71)38(69)37(68)30(20-61)82-51)42(41(72)43(85-53)48(74)75)84-52-44(36(67)29(64)22-80-52)86-50-39(70)35(66)28(63)21-79-50/h11-12,27-47,50-53,61,63-73H,13-23H2,1-10H3,(H,74,75)/b24-11-/t27?,28-,29+,30-,31?,32?,33-,34+,35+,36+,37+,38+,39-,40-,41+,42+,43+,44-,45-,46+,47+,50+,51-,52+,53-,56-,57-,58-,59+,60+/m1/s1
SMILES	C/C=C(/C)\C(=O)O[C@H]1[C@@H]([C@@]2([C@@H](C[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(CC[C@@H]([C@@]5(C)C(=O)OC)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O[C@H]7[C@@H]([C@H]([C@H](CO7)O)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O[C@@H]9[C@@H]([C@H]([C@H]([C@H](O9)CO)O)O)O)C)C)C2CC1(C)C)C)O)COC(=O)C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1260.58	Volume:	1199.615 ? Van der Waals volume.
Dense:	1.051	LogP:	0.669 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.609 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.906 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	18.0	Rigid Bonds:	55.0
TPSA:	432.8 ? Topological Polar Surface Area.	H-Bond Acceptor:	28.0
H-Bond Donor:	13.0	Rings:	9.0
Heavy Atoms:	28.0

MedChem Properties

QED Drug-Likeness Score:	0.028	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.446	Fsp³:	0.867
MCE-18:	206.286 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.632	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.028 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.186	Promiscuous compounds:	0.117

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.152	MDCK Permeability:	-5.259
Pgp-inhibitor:	0.0	Pgp-substrate:	0.725
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.408
20% Bioavailability (F20%):	0.949	30% Bioavailability (F30%):	0.975
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.997
Plasma Protein Binding (PPB):	60.401%	Volume Distribution (VD):	-0.524
Fu:	27.919% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.993	BCRP inhibitor:	0.0
BSEP inhibitor:	0.001

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.62	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.012
HLM stability:	0.016 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.41

Half-life (T1/2):

3.506

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.752	Drug-induced Liver Injury (DILI):	0.536
AMES Toxicity:	0.619	Rat Oral Acute Toxicity:	0.004
Maximum Recommended Daily Dose:	0.058	Skin Sensitization:	1.0
Carcinogencity:	0.02	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.239	Drug-induced Nephrotoxicity:	0.997
Genotoxicity:	0.822	RPMI-8226 Immunitoxicity:	0.163
A549 Cytotoxicity:	0.689	Hek293 Cytotoxicity:	0.399
BCF:	0.154 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.682 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.954 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.62 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[ 16712885]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.foodchem.2013.08.121]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Flowers	n.a.	n.a.	PMID[16180814]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	seeds	Shizuoka prefecture, Japan	n.a.	PMID[16499314]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[18068204]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[21434603]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	flower	n.a.	PMID[21922925]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[21925888]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	leaves	n.a.	n.a.	PMID[22377672]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	leaf	n.a.	PMID[23265489]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Leaves	Bandung, West Java, Indonesia		PMID[23621359]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[37255739]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.		Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Stem	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Shoot	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Seed Oil	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Seed	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Plant	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Leaf Essent. Oil	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Leaf	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	Cotyledon	n.a.	n.a.	Database[FooDB]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO8258	Camellia sinensis	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	1

Activity Type	# Activity
Organism	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT29	Organism	Rattus norvegicus	Rattus norvegicus	Inhibition	=	42.1	%	PMID[16499314]

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC476776 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22844
0.1-0.2	22897
0.2-0.3	3139
0.3-0.4	545
0.4-0.5	326
0.5-0.6	70
0.6-0.7	24
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9068	High Similarity	NPC476775
0.8917	High Similarity	NPC476778
0.8033	Intermediate Similarity	NPC476774
0.8016	Intermediate Similarity	NPC279915
0.746	Intermediate Similarity	NPC476780
0.7402	Intermediate Similarity	NPC271610
0.7287	Intermediate Similarity	NPC476777
0.7188	Intermediate Similarity	NPC265841
0.7077	Intermediate Similarity	NPC476779
0.6953	Remote Similarity	NPC252289
0.6953	Remote Similarity	NPC305793
0.6875	Remote Similarity	NPC602995
0.687	Remote Similarity	NPC312650
0.6842	Remote Similarity	NPC11577
0.6842	Remote Similarity	NPC141600
0.6825	Remote Similarity	NPC609119
0.6794	Remote Similarity	NPC488308
0.6767	Remote Similarity	NPC110700
0.6744	Remote Similarity	NPC283417
0.6744	Remote Similarity	NPC200049
0.6719	Remote Similarity	NPC284449
0.6641	Remote Similarity	NPC1314
0.6641	Remote Similarity	NPC273878
0.6591	Remote Similarity	NPC178264
0.6515	Remote Similarity	NPC71391
0.6515	Remote Similarity	NPC192765
0.6496	Remote Similarity	NPC488309
0.6412	Remote Similarity	NPC603137
0.632	Remote Similarity	NPC611191
0.6231	Remote Similarity	NPC25998
0.6087	Remote Similarity	NPC484059
0.6087	Remote Similarity	NPC484060
0.6031	Remote Similarity	NPC605294
0.5985	Remote Similarity	NPC472267
0.5985	Remote Similarity	NPC115656
0.5985	Remote Similarity	NPC477196
0.5912	Remote Similarity	NPC329828
0.587	Remote Similarity	NPC484061
0.587	Remote Similarity	NPC484062
0.5857	Remote Similarity	NPC478153
0.5797	Remote Similarity	NPC4749
0.5778	Remote Similarity	NPC478154
0.5775	Remote Similarity	NPC302543
0.5766	Remote Similarity	NPC269484
0.5766	Remote Similarity	NPC97918
0.5714	Remote Similarity	NPC187290
0.5704	Remote Similarity	NPC252657
0.5704	Remote Similarity	NPC88311
0.5683	Remote Similarity	NPC82380
0.5683	Remote Similarity	NPC244296
0.5662	Remote Similarity	NPC478155
0.5649	Remote Similarity	NPC302887
0.5643	Remote Similarity	NPC470518
0.5639	Remote Similarity	NPC160452
0.5581	Remote Similarity	NPC605226
0.558	Remote Similarity	NPC609305
0.5538	Remote Similarity	NPC44716
0.5532	Remote Similarity	NPC21691
0.5515	Remote Similarity	NPC107536
0.5515	Remote Similarity	NPC280029
0.5515	Remote Similarity	NPC9470
0.55	Remote Similarity	NPC277212
0.55	Remote Similarity	NPC30279
0.55	Remote Similarity	NPC46823
0.5481	Remote Similarity	NPC329976
0.5414	Remote Similarity	NPC64715
0.5414	Remote Similarity	NPC603832
0.539	Remote Similarity	NPC47995
0.5375	Remote Similarity	NPC485563
0.5374	Remote Similarity	NPC484063
0.5374	Remote Similarity	NPC484064
0.5368	Remote Similarity	NPC104137
0.5368	Remote Similarity	NPC207738
0.5368	Remote Similarity	NPC26626
0.5333	Remote Similarity	NPC477191
0.5328	Remote Similarity	NPC477197
0.5294	Remote Similarity	NPC187618
0.5294	Remote Similarity	NPC477193
0.529	Remote Similarity	NPC470475
0.5263	Remote Similarity	NPC475591
0.5263	Remote Similarity	NPC236870
0.5221	Remote Similarity	NPC301449
0.5221	Remote Similarity	NPC601290
0.5217	Remote Similarity	NPC11242
0.5217	Remote Similarity	NPC477195
0.5197	Remote Similarity	NPC485562
0.5188	Remote Similarity	NPC232237
0.5175	Remote Similarity	NPC473918
0.5113	Remote Similarity	NPC117714
0.5111	Remote Similarity	NPC488517
0.5109	Remote Similarity	NPC23275
0.5108	Remote Similarity	NPC815
0.5102	Remote Similarity	NPC484833
0.5075	Remote Similarity	NPC164389
0.5072	Remote Similarity	NPC477192
0.5071	Remote Similarity	NPC478151
0.5068	Remote Similarity	NPC473452
0.5068	Remote Similarity	NPC286457
0.5066	Remote Similarity	NPC489209
0.5036	Remote Similarity	NPC477194
0.5035	Remote Similarity	NPC313110
0.5035	Remote Similarity	NPC607904
0.5034	Remote Similarity	NPC85154

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC476776 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7101
0.1-0.2	2010
0.2-0.3	35
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data