NPASS Compound

Natural Product: NPC23275

Natural Product ID	NPC23275
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Rel-Camellioside E
IUPAC Name	(2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8R,8aR,12aS,14aR,14bR)-8,8a-dihydroxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Synonyms	Rel-Camellioside E
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2087223
PubChem CID	66553431
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 163171 0 0 0 0 0 0 0 0999 V2000 -10.0351 0.8935 -2.9554 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3027 -0.4243 -3.0068 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2001 -0.8463 -4.4579 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9828 -1.5103 -2.1955 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6325 -1.4161 -0.7464 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1590 -1.6512 -0.4852 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3943 -1.4086 -1.7535 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8867 -0.1994 -2.5035 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9228 -1.2238 -1.5124 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0776 -1.7385 -2.3980 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5955 -1.6387 -2.2995 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2214 -0.7180 -1.1689 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7415 -0.6265 -0.9155 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0203 -1.9143 -1.1399 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1719 0.3483 -1.9554 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2981 0.6257 -1.7225 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6498 1.0420 -0.3538 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1470 0.4262 0.7571 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6080 -0.6947 1.4476 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2963 1.5209 1.8348 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5278 0.0324 0.3955 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.1660 -0.7912 1.4756 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6697 -0.5358 1.3237 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0700 -1.0822 -0.0034 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3181 -2.5616 0.1703 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4547 -0.4710 -0.2903 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3713 0.9779 -0.6357 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2966 -0.7841 0.9056 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7649 -0.7632 0.6519 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2705 0.5324 0.5157 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9992 0.7502 -0.1225 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7561 1.8633 0.1350 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3938 1.8547 1.4991 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8098 1.3686 1.3586 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5773 2.4408 0.6070 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6861 2.9496 -0.5232 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5544 3.1402 -1.7074 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3144 2.5371 -2.7895 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6649 3.9737 -1.7095 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6918 2.0401 -0.8760 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9244 3.4945 1.4294 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8911 0.2358 0.5881 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3659 -0.8650 1.2095 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7766 -2.1899 0.9200 C 0 0 1 0 0 0 0 0 0 0 0 0 4.9726 -3.0166 2.1951 C 0 0 2 0 0 0 0 0 0 0 0 0 6.4861 -3.0926 2.3808 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1795 -1.7899 2.1639 C 0 0 1 0 0 0 0 0 0 0 0 0 8.6603 -1.9927 2.2076 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1329 -2.6835 1.0935 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7794 -1.0627 1.0434 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0289 -4.0928 1.5569 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4454 -4.2715 2.1301 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5504 -2.2463 0.3500 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5660 -2.8853 -0.8759 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5665 -3.9734 -1.0435 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2732 -4.1843 -2.5100 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4246 -3.8111 -3.4174 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0324 -2.4857 -3.0137 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1277 -1.5083 -4.1451 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7945 -0.3586 -3.7117 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3316 -1.9447 -1.9210 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3551 -4.8343 -3.4851 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1055 -3.5201 -2.9232 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9659 -5.1649 -0.4293 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3472 3.1759 1.9481 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6838 3.4118 3.1048 C 0 0 1 0 0 0 0 0 0 0 0 0 3.6456 3.9143 4.1440 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8792 5.3889 4.1240 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5227 6.0651 4.1286 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7553 5.5380 2.9315 C 0 0 1 0 0 0 0 0 0 0 0 0 2.3236 6.0306 1.6169 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4801 7.4025 1.7143 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5483 4.1913 2.9754 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6180 7.4498 4.0299 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6603 5.7928 3.0558 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1324 3.5819 5.4165 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0359 -2.9758 -0.0747 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3348 1.7465 -2.7737 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7911 0.9101 -2.1407 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5445 1.1337 -3.9293 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0008 0.0793 -5.0360 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1241 -1.3556 -4.7984 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3064 -1.4947 -4.5474 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7960 -2.5191 -2.6224 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0767 -1.3320 -2.2821 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2717 -2.1418 -0.1853 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9488 -0.4035 -0.3912 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5622 -2.2948 -2.4083 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1842 -0.0137 -3.3445 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8482 0.7051 -1.8662 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4605 -2.2812 -3.2763 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2175 -2.6627 -2.2054 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2056 -1.2560 -3.2796 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5393 0.3115 -1.5129 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1960 -2.6969 -0.4107 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0714 -1.7062 -1.1499 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2392 -2.2299 -2.1908 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7098 1.3169 -1.7804 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2949 -0.0180 -2.9741 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9195 -0.1836 -2.1620 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5167 1.4953 -2.4170 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5861 2.1727 -0.2815 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2594 -1.6993 1.2046 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4836 -0.6239 2.5742 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6909 -0.6206 1.2973 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3426 1.6147 2.1800 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0116 2.5151 1.4393 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3288 1.3216 2.7163 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1241 1.0007 0.3483 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0579 -1.8844 1.2424 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8222 -0.5426 2.4922 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1507 -1.1215 2.1244 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8308 0.5332 1.4503 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5608 -3.2144 -0.2887 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3103 -2.8595 1.2625 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3021 -2.9017 -0.2096 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2716 1.4899 -0.1933 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5114 1.5139 -0.1997 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4806 1.1747 -1.7443 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0375 -1.7783 1.3208 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0384 -0.0452 1.6956 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2548 -1.1873 1.5747 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2699 0.9871 1.4169 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0912 2.7770 0.0914 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8403 1.2180 2.1843 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2719 1.1513 2.3285 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5108 2.0170 0.1885 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2843 3.9626 -0.2693 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4796 3.6851 -2.2452 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2168 4.2885 0.9520 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3447 -0.6458 2.3196 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4944 -2.7171 0.1756 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5665 -2.4102 3.0121 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6881 -3.4114 3.4237 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9222 -1.1168 3.0363 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9064 -2.5920 3.1039 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1960 -1.0306 2.2952 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6808 -3.4517 1.3378 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0122 -4.9650 2.0287 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4461 -4.1535 2.0594 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6021 -3.3000 -1.0358 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6256 -3.6217 -0.5190 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0823 -5.2674 -2.6513 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0091 -3.6611 -4.4334 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0588 -2.6976 -2.6485 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7910 -1.9871 -4.9183 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1639 -1.2999 -4.6345 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6919 -0.6735 -3.4013 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2671 -4.4502 -3.3777 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3280 -2.9767 -3.7475 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8065 -5.9664 -0.9831 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2971 2.4239 3.4965 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5974 3.3574 4.0428 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4731 5.6367 5.0389 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9953 5.7341 5.0298 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7369 6.0200 2.9963 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2093 5.4942 1.2871 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5273 5.8752 0.8304 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5572 7.8144 1.7146 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5076 7.7058 4.3843 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1443 6.6297 3.3076 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8497 3.7817 6.0761 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7046 -3.1712 0.6280 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 1 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 18 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 1 24 26 1 0 26 27 1 6 26 28 1 0 28 29 1 0 29 30 1 0 17 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 2 0 37 39 1 0 36 40 1 0 35 41 1 0 34 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 47 50 1 0 46 51 1 0 45 52 1 0 44 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 58 61 1 0 57 62 1 0 56 63 1 0 55 64 1 0 33 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 70 73 1 0 69 74 1 0 68 75 1 0 67 76 1 0 6 77 1 1 8 2 1 0 26 9 1 0 40 32 1 0 50 43 1 0 61 54 1 0 73 66 1 0 29 6 1 0 24 12 1 0 21 13 1 0 1 78 1 0 1 79 1 0 1 80 1 0 3 81 1 0 3 82 1 0 3 83 1 0 4 84 1 0 4 85 1 0 5 86 1 0 5 87 1 0 7 88 1 6 8 89 1 0 8 90 1 0 10 91 1 0 11 92 1 0 11 93 1 0 12 94 1 6 14 95 1 0 14 96 1 0 14 97 1 0 15 98 1 0 15 99 1 0 16100 1 0 16101 1 0 17102 1 6 19103 1 0 19104 1 0 19105 1 0 20106 1 0 20107 1 0 20108 1 0 21109 1 6 22110 1 0 22111 1 0 23112 1 0 23113 1 0 25114 1 0 25115 1 0 25116 1 0 27117 1 0 27118 1 0 27119 1 0 28120 1 0 28121 1 0 29122 1 1 30123 1 0 32124 1 1 33125 1 1 34126 1 1 35127 1 6 36128 1 1 39129 1 0 41130 1 0 43131 1 1 44132 1 6 45133 1 1 46134 1 1 47135 1 1 48136 1 0 48137 1 0 49138 1 0 51139 1 0 52140 1 0 54141 1 6 55142 1 1 56143 1 1 57144 1 6 58145 1 1 59146 1 0 59147 1 0 60148 1 0 62149 1 0 63150 1 0 64151 1 0 66152 1 1 67153 1 6 68154 1 1 69155 1 1 70156 1 1 71157 1 0 71158 1 0 72159 1 0 74160 1 0 75161 1 0 76162 1 0 77163 1 0 M END

Standard InCHIKey	HBDLKPJBPGZZHU-QRQUFXRISA-N
Standard InCHI	InChI=1S/C53H86O24/c1-48(2)14-15-53(69)22(16-48)21-8-9-27-50(5)12-11-29(49(3,4)26(50)10-13-51(27,6)52(21,7)17-28(53)57)73-47-42(77-45-37(65)34(62)31(59)24(19-55)71-45)39(38(66)40(75-47)43(67)68)74-46-41(35(63)32(60)25(20-56)72-46)76-44-36(64)33(61)30(58)23(18-54)70-44/h8,22-42,44-47,54-66,69H,9-20H2,1-7H3,(H,67,68)/t22-,23+,24+,25+,26-,27+,28+,29-,30+,31-,32-,33-,34-,35-,36+,37+,38-,39-,40-,41+,42+,44-,45-,46-,47+,50-,51+,52+,53+/m0/s1
SMILES	CC1(C)CC[C@]2([C@@H](C1)C1=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)C[C@H]2O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1106.55	Volume:	1053.928 ? Van der Waals volume.
Dense:	1.05	LogP:	-0.005 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.383 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.231 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	51.0
TPSA:	394.36 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	15.0	Rings:	9.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.07	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.89	Fsp³:	0.943
MCE-18:	199.922 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.682	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.366	Promiscuous compounds:	0.155

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.646	MDCK Permeability:	-5.076
Pgp-inhibitor:	0.0	Pgp-substrate:	0.556
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	0.999	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.947
Plasma Protein Binding (PPB):	57.827%	Volume Distribution (VD):	-0.41
Fu:	28.154% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.94	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.045
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.324

Half-life (T1/2):

3.151

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.869	Drug-induced Liver Injury (DILI):	0.987
AMES Toxicity:	0.992	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.311	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.956	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.917	RPMI-8226 Immunitoxicity:	0.263
A549 Cytotoxicity:	0.997	Hek293 Cytotoxicity:	0.696
BCF:	0.689 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.24 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.598 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.57 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	leaf	n.a.	PMID[16926516]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[22834923]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	Roots	n.a.	n.a.	PMID[30395460]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32569471]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[39065796]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO23380	Camellia japonica	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	12

Activity Type	# Activity
Others	3
Non-molecular	9

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	1.9	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	4.3	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	13.3	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	108.3	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	110.0	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	116.2	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	113.9	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	110.6	%	PMID[22834923]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	114.9	%	PMID[22834923]
NPT2	Others	Unspecified	n.a.	Activity	=	21.9	%	DOI[10.6019/CHEMBL1201861]
NPT2	Others	Unspecified	n.a.	Activity	=	16.7	%	DOI[10.6019/CHEMBL1201861]
NPT2	Others	Unspecified	n.a.	Activity	=	23.3	%	DOI[10.6019/CHEMBL1201861]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC23275 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24282
0.1-0.2	21731
0.2-0.3	2651
0.3-0.4	685
0.4-0.5	373
0.5-0.6	98
0.6-0.7	25
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8077	Intermediate Similarity	NPC469947
0.8077	Intermediate Similarity	NPC480948
0.7692	Intermediate Similarity	NPC302887
0.7477	Intermediate Similarity	NPC160452
0.7434	Intermediate Similarity	NPC181066
0.7027	Intermediate Similarity	NPC480939
0.6759	Remote Similarity	NPC44716
0.6726	Remote Similarity	NPC480936
0.6667	Remote Similarity	NPC480947
0.6636	Remote Similarity	NPC22956
0.6545	Remote Similarity	NPC475591
0.6545	Remote Similarity	NPC236870
0.6525	Remote Similarity	NPC283417
0.6525	Remote Similarity	NPC200049
0.6514	Remote Similarity	NPC605226
0.6475	Remote Similarity	NPC484059
0.6475	Remote Similarity	NPC484060
0.6364	Remote Similarity	NPC484061
0.6364	Remote Similarity	NPC484062
0.627	Remote Similarity	NPC484063
0.627	Remote Similarity	NPC484064
0.6226	Remote Similarity	NPC164194
0.6207	Remote Similarity	NPC187290
0.6198	Remote Similarity	NPC277212
0.6198	Remote Similarity	NPC30279
0.6091	Remote Similarity	NPC603026
0.6066	Remote Similarity	NPC46823
0.6048	Remote Similarity	NPC265841
0.6036	Remote Similarity	NPC80843
0.6	Remote Similarity	NPC225791
0.6	Remote Similarity	NPC64715
0.5966	Remote Similarity	NPC25998
0.5946	Remote Similarity	NPC472949
0.592	Remote Similarity	NPC488308
0.5917	Remote Similarity	NPC609119
0.5909	Remote Similarity	NPC25605
0.5877	Remote Similarity	NPC251768
0.5873	Remote Similarity	NPC271610
0.5873	Remote Similarity	NPC312650
0.5859	Remote Similarity	NPC302543
0.5856	Remote Similarity	NPC109079
0.5841	Remote Similarity	NPC192791
0.5833	Remote Similarity	NPC288205
0.5833	Remote Similarity	NPC51465
0.5789	Remote Similarity	NPC114304
0.5726	Remote Similarity	NPC602995
0.5714	Remote Similarity	NPC127056
0.5691	Remote Similarity	NPC284449
0.569	Remote Similarity	NPC118440
0.568	Remote Similarity	NPC47995
0.5664	Remote Similarity	NPC488561
0.566	Remote Similarity	NPC31839
0.5649	Remote Similarity	NPC488309
0.5635	Remote Similarity	NPC71391
0.5635	Remote Similarity	NPC329828
0.563	Remote Similarity	NPC301449
0.563	Remote Similarity	NPC601290
0.5593	Remote Similarity	NPC79718
0.5591	Remote Similarity	NPC21691
0.5574	Remote Similarity	NPC475119
0.5546	Remote Similarity	NPC114692
0.5537	Remote Similarity	NPC329976
0.5537	Remote Similarity	NPC475486
0.5517	Remote Similarity	NPC30289
0.5512	Remote Similarity	NPC4749
0.5512	Remote Similarity	NPC192765
0.5508	Remote Similarity	NPC131469
0.55	Remote Similarity	NPC291903
0.5492	Remote Similarity	NPC605294
0.5478	Remote Similarity	NPC469946
0.5469	Remote Similarity	NPC178264
0.5462	Remote Similarity	NPC95437
0.5462	Remote Similarity	NPC476779
0.544	Remote Similarity	NPC477465
0.5433	Remote Similarity	NPC473918
0.5426	Remote Similarity	NPC476774
0.5426	Remote Similarity	NPC476780
0.5417	Remote Similarity	NPC236657
0.5403	Remote Similarity	NPC313110
0.5398	Remote Similarity	NPC12288
0.5345	Remote Similarity	NPC213674
0.5339	Remote Similarity	NPC159309
0.5339	Remote Similarity	NPC480475
0.5339	Remote Similarity	NPC86222
0.5327	Remote Similarity	NPC606107
0.5315	Remote Similarity	NPC480943
0.5303	Remote Similarity	NPC110700
0.5303	Remote Similarity	NPC476777
0.528	Remote Similarity	NPC473824
0.5267	Remote Similarity	NPC258617
0.5259	Remote Similarity	NPC157868
0.5254	Remote Similarity	NPC117714
0.5246	Remote Similarity	NPC324875
0.5246	Remote Similarity	NPC292677
0.5242	Remote Similarity	NPC11242
0.5238	Remote Similarity	NPC151543
0.5224	Remote Similarity	NPC476775
0.5217	Remote Similarity	NPC59804
0.5207	Remote Similarity	NPC488515
0.5203	Remote Similarity	NPC187618
0.5203	Remote Similarity	NPC120116
0.5169	Remote Similarity	NPC112352
0.5164	Remote Similarity	NPC114484
0.5156	Remote Similarity	NPC251263
0.5147	Remote Similarity	NPC279915
0.5147	Remote Similarity	NPC476778
0.5124	Remote Similarity	NPC222580
0.5124	Remote Similarity	NPC257468
0.5124	Remote Similarity	NPC123796
0.512	Remote Similarity	NPC62725
0.5118	Remote Similarity	NPC123522
0.5116	Remote Similarity	NPC470218
0.5115	Remote Similarity	NPC470518
0.5109	Remote Similarity	NPC476776
0.5086	Remote Similarity	NPC56713
0.5085	Remote Similarity	NPC263756
0.5083	Remote Similarity	NPC40775
0.5083	Remote Similarity	NPC164389
0.5083	Remote Similarity	NPC2370
0.5081	Remote Similarity	NPC488564
0.5081	Remote Similarity	NPC480473
0.5081	Remote Similarity	NPC480474
0.5079	Remote Similarity	NPC470475
0.5042	Remote Similarity	NPC75417
0.5041	Remote Similarity	NPC281148
0.5041	Remote Similarity	NPC63159
0.504	Remote Similarity	NPC36831
0.5039	Remote Similarity	NPC268184
0.5038	Remote Similarity	NPC470876

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC23275 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7183
0.1-0.2	1901
0.2-0.3	59
0.3-0.4	6
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data