NPASS Compound

Natural Product: NPC36831

Natural Product ID	NPC36831
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Latifoloside G
IUPAC Name	[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl] (1R,2R,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-1-hydroxy-10-[(2S,3R,4S,5S)-5-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms	Latifoloside G
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL499381
PubChem CID	44566333
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 181190 0 0 0 0 0 0 0 0999 V2000 6.9556 -5.0643 1.5842 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5600 -3.7610 0.9638 C 0 0 2 0 0 0 0 0 0 0 0 0 7.3630 -2.6542 1.5683 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5820 -1.6938 2.4015 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3600 -1.1254 1.6664 C 0 0 2 0 0 0 0 0 0 0 0 0 4.4326 -0.7025 2.7896 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0989 -0.2194 2.3500 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3961 -1.2432 1.5014 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9410 -2.3240 2.4712 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2846 -1.9121 0.5068 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8165 -2.3928 -0.6516 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4007 -2.3336 -1.0905 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5799 -1.7801 0.0111 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8734 -1.5605 -0.3388 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0134 -0.5917 -1.4506 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5041 -2.8674 -0.7482 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9248 -2.5996 -1.1320 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7389 -1.8905 -0.0601 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9625 -1.4774 1.1150 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0993 -2.6357 2.1600 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6115 -0.3329 1.8680 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5346 -1.1765 0.9557 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.0695 0.2404 1.1863 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3972 0.2208 1.5523 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2541 -0.6466 0.6993 C 0 0 1 0 0 0 0 0 0 0 0 0 1.9420 0.2742 -0.3269 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5870 -0.9383 -0.6491 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8985 -1.3102 -0.6425 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9571 -0.3552 -0.2949 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2778 -1.1530 -0.3313 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.0105 -2.6394 -0.5412 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.1332 -2.8676 -1.7462 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2568 -1.7977 -1.9527 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2616 -3.2213 -0.8652 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1660 -0.6947 -1.2807 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3593 -0.2206 -0.8190 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.7482 1.0754 -1.4256 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.1065 1.5444 -0.9082 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.0896 0.4245 -1.2635 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.5721 -0.8392 -0.6240 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.5275 -1.9661 -1.0016 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.8178 -1.7511 -0.5816 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3270 -1.2253 -1.1276 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.3564 0.6837 -0.8019 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.4495 2.6705 -1.6748 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7819 2.0312 -1.1770 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7726 0.2700 0.9111 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9395 1.6273 0.8888 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7492 2.1541 2.0520 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3137 3.5982 2.3469 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0308 4.2246 0.9979 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7865 3.5381 0.4508 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9115 3.5035 -1.0512 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6485 2.2562 0.9902 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8926 5.5940 1.0381 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3708 4.2499 2.9451 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1117 2.2067 1.7953 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7619 -2.1186 0.7413 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0592 -3.5206 1.1996 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3634 -4.6011 0.4392 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8986 -3.7015 2.5779 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8681 0.0507 0.9304 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3910 1.1990 1.0229 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9460 -0.1106 0.0815 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4952 0.9721 -0.6510 C 0 0 1 0 0 0 0 0 0 0 0 0 8.9012 1.2776 -0.2932 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8331 0.1464 -0.5995 C 0 0 2 0 0 0 0 0 0 0 0 0 9.3186 -0.6356 -1.7665 C 0 0 1 0 0 0 0 0 0 0 0 0 8.4084 0.1884 -2.6486 C 0 0 1 0 0 0 0 0 0 0 0 0 8.0308 -0.6650 -3.8396 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2123 -1.1670 -4.4345 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3498 0.7293 -1.9839 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4210 -1.0077 -2.5533 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1487 -0.6439 0.5051 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3149 2.3802 -1.0822 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6500 3.4549 -0.2610 C 0 0 1 0 0 0 0 0 0 0 0 0 11.1161 3.7664 -0.5289 C 0 0 1 0 0 0 0 0 0 0 0 0 11.2883 5.1457 -1.1274 C 0 0 1 0 0 0 0 0 0 0 0 0 10.3563 5.2455 -2.2974 C 0 0 2 0 0 0 0 0 0 0 0 0 8.9310 4.8941 -1.9434 C 0 0 2 0 0 0 0 0 0 0 0 0 8.1208 6.1711 -2.0938 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8708 4.5395 -0.6182 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7965 4.3504 -3.2827 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0061 6.0749 -0.1376 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8428 3.6374 0.6630 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9713 -4.9285 2.0508 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0959 -5.8813 0.8469 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2817 -5.3983 2.3790 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7194 -3.8627 -0.1432 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1684 -3.0559 2.2211 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8924 -2.1367 0.7398 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3340 -2.0971 3.3902 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2816 -0.8317 2.6241 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9513 0.1867 3.2595 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4340 -1.4720 3.5560 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1179 0.7970 1.9497 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4937 -0.1291 3.3053 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8948 -3.3240 2.0397 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6476 -2.3771 3.3487 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9634 -2.1036 2.9416 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5269 -2.8686 -1.3545 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2443 -1.8949 -2.0857 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1062 -3.4229 -1.2254 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5052 -2.6076 0.7847 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3653 0.2768 -1.4537 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0419 -0.2227 -1.6090 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7608 -1.1589 -2.3962 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3852 -3.6812 -0.0394 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9811 -3.1835 -1.6864 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9539 -1.9827 -2.0807 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3606 -3.5714 -1.4447 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4660 -2.7085 0.2642 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2187 -2.6811 2.8047 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0723 -2.5535 2.6855 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1464 -3.5734 1.5725 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0657 -0.3198 2.8685 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5467 0.6136 1.3488 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6342 -0.6522 2.1843 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0009 -1.7315 1.7915 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5884 0.7246 2.0341 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2738 0.8932 0.3056 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7484 1.2724 1.5226 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4554 -0.1010 2.6091 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9915 0.4917 -0.0481 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4558 1.2908 -0.3362 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9862 -0.1806 -1.3230 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0103 -2.2431 -0.0363 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1476 0.4604 -1.0488 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7188 -1.0473 0.6725 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7027 -3.1378 0.3806 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7367 -3.0373 -2.6573 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5317 -3.7807 -1.5655 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0329 -4.1270 -1.1851 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3979 -0.1757 0.2815 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8740 1.0303 -2.5306 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0945 1.7550 0.1688 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0120 0.3120 -2.3623 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5845 -0.7908 0.4820 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1091 -2.9469 -0.6856 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5319 -1.9758 -2.1155 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.9786 -2.2200 0.2921 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.9406 0.8804 -1.5814 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4213 2.6501 -1.9163 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2013 2.1356 -1.9690 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2757 1.9474 -0.1013 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5198 1.6011 2.9872 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4112 3.5994 2.9938 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9338 3.9888 0.3557 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8951 4.1181 0.7554 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9676 3.7436 -1.3668 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6234 2.5289 -1.4936 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2989 4.3172 -1.4872 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5248 5.9647 1.8540 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7176 4.9317 2.3425 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4170 3.1107 1.5360 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3053 -2.0107 -0.2455 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7477 -4.7411 -0.5931 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2780 -4.5404 0.3922 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6157 -5.5928 0.9384 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4563 -4.5648 2.7078 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8681 1.8831 -0.4142 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9526 1.5744 0.7878 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8274 0.6108 -0.8931 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8349 -1.6061 -1.4661 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0475 1.0194 -3.0499 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4052 -1.5218 -3.5617 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5406 -0.0668 -4.6415 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2421 -2.1429 -4.3577 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1217 -1.2693 -1.8696 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7254 -0.2303 1.2986 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5069 3.2312 0.8151 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5713 3.0526 -1.2446 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3268 5.2161 -1.5176 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4628 6.2591 -2.7383 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5144 4.1373 -2.6420 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1099 5.9531 -2.4986 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0755 6.7650 -1.1556 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6146 6.8220 -2.8527 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6940 4.0195 -3.1010 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5344 5.8519 0.6646 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3057 3.9710 1.4322 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 1 8 10 1 0 10 11 2 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 6 14 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 19 21 1 0 19 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 18 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 31 34 1 0 30 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 39 44 1 0 38 45 1 0 37 46 1 0 29 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 52 54 1 0 51 55 1 0 50 56 1 0 49 57 1 0 10 58 1 0 58 59 1 0 59 60 1 0 59 61 1 1 5 62 1 6 62 63 2 0 62 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 69 72 1 0 68 73 1 0 67 74 1 0 66 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 80 82 1 0 79 83 1 0 78 84 1 0 77 85 1 0 59 2 1 0 72 65 1 0 82 76 1 0 58 5 1 0 25 8 1 0 33 28 1 0 43 36 1 0 54 48 1 0 25 13 1 0 22 14 1 0 1 86 1 0 1 87 1 0 1 88 1 0 2 89 1 6 3 90 1 0 3 91 1 0 4 92 1 0 4 93 1 0 6 94 1 0 6 95 1 0 7 96 1 0 7 97 1 0 9 98 1 0 9 99 1 0 9100 1 0 11101 1 0 12102 1 0 12103 1 0 13104 1 1 15105 1 0 15106 1 0 15107 1 0 16108 1 0 16109 1 0 17110 1 0 17111 1 0 18112 1 1 20113 1 0 20114 1 0 20115 1 0 21116 1 0 21117 1 0 21118 1 0 22119 1 1 23120 1 0 23121 1 0 24122 1 0 24123 1 0 26124 1 0 26125 1 0 26126 1 0 28127 1 1 29128 1 6 30129 1 1 31130 1 1 32131 1 0 32132 1 0 34133 1 0 36134 1 1 37135 1 6 38136 1 1 39137 1 6 40138 1 1 41139 1 0 41140 1 0 42141 1 0 44142 1 0 45143 1 0 46144 1 0 48145 1 6 49146 1 1 50147 1 1 51148 1 6 52149 1 6 53150 1 0 53151 1 0 53152 1 0 55153 1 0 56154 1 0 57155 1 0 58156 1 6 60157 1 0 60158 1 0 60159 1 0 61160 1 0 65161 1 1 66162 1 1 67163 1 6 68164 1 1 69165 1 6 70166 1 0 70167 1 0 71168 1 0 73169 1 0 74170 1 0 76171 1 1 77172 1 6 78173 1 6 79174 1 6 80175 1 6 81176 1 0 81177 1 0 81178 1 0 83179 1 0 84180 1 0 85181 1 0 M END

Standard InCHIKey	XOBMETAHXPDITA-SAAJXQLZSA-N
Standard InCHI	InChI=1S/C59H96O26/c1-23-12-17-59(53(74)85-52-45(40(70)36(66)29(21-61)80-52)83-48-41(71)37(67)33(63)24(2)77-48)19-18-56(7)26(47(59)58(23,9)75)10-11-31-55(6)15-14-32(54(4,5)30(55)13-16-57(31,56)8)81-51-46(84-49-42(72)38(68)34(64)25(3)78-49)44(27(62)22-76-51)82-50-43(73)39(69)35(65)28(20-60)79-50/h10,23-25,27-52,60-73,75H,11-22H2,1-9H3/t23-,24+,25+,27+,28-,29-,30+,31-,32+,33+,34+,35-,36-,37-,38-,39+,40+,41-,42-,43-,44+,45-,46-,47-,48+,49+,50+,51+,52+,55+,56-,57-,58-,59+/m1/s1
SMILES	C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@@]34C)O[C@H]3[C@@H]([C@H]([C@H](CO3)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)O)O)O)[C@@H]2[C@]1(C)O)C(=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](C)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1220.62	Volume:	1166.728 ? Van der Waals volume.
Dense:	1.046	LogP:	0.8 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.778 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.726 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	57.0
TPSA:	412.82 ? Topological Polar Surface Area.	H-Bond Acceptor:	26.0
H-Bond Donor:	15.0	Rings:	10.0
Heavy Atoms:	26.0

MedChem Properties

QED Drug-Likeness Score:	0.054	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.289	Fsp³:	0.949
MCE-18:	219.826 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.709	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.013 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.347	Promiscuous compounds:	0.176

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.948	MDCK Permeability:	-4.823
Pgp-inhibitor:	0.0	Pgp-substrate:	0.712
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.991
20% Bioavailability (F20%):	0.845	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.005
Plasma Protein Binding (PPB):	63.95%	Volume Distribution (VD):	-0.309
Fu:	21.191% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.012	CYP3A4-substrate:	0.224
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.017
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.896

Half-life (T1/2):

4.294

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.606	Drug-induced Liver Injury (DILI):	0.933
AMES Toxicity:	0.978	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.009	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.637	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.2	RPMI-8226 Immunitoxicity:	0.422
A549 Cytotoxicity:	0.861	Hek293 Cytotoxicity:	0.242
BCF:	1.038 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.502 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.99 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.017 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33035	ilex kudincha	Species	Aquifoliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10425145]
NPO33035	ilex kudincha	Species	Aquifoliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10479318]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	1

Activity Type	# Activity
Individual protein	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1214	Individual protein	Acyl coenzyme A:cholesterol acyltransferase 1	Homo sapiens	Inhibition	=	10.6	%	PMID[15646539]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC36831 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23734
0.1-0.2	22085
0.2-0.3	2754
0.3-0.4	715
0.4-0.5	421
0.5-0.6	125
0.6-0.7	15
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8969	High Similarity	NPC68175
0.8381	Intermediate Similarity	NPC268184
0.802	Intermediate Similarity	NPC160415
0.7476	Intermediate Similarity	NPC161674
0.7429	Intermediate Similarity	NPC46665
0.6792	Remote Similarity	NPC58448
0.6635	Remote Similarity	NPC204458
0.6606	Remote Similarity	NPC112352
0.6216	Remote Similarity	NPC263756
0.6207	Remote Similarity	NPC481079
0.6195	Remote Similarity	NPC480475
0.6148	Remote Similarity	NPC100639
0.6075	Remote Similarity	NPC47063
0.6071	Remote Similarity	NPC469946
0.6066	Remote Similarity	NPC135904
0.6063	Remote Similarity	NPC481081
0.6019	Remote Similarity	NPC189884
0.6019	Remote Similarity	NPC138334
0.6018	Remote Similarity	NPC75417
0.6	Remote Similarity	NPC57484
0.5922	Remote Similarity	NPC46388
0.5862	Remote Similarity	NPC63159
0.5849	Remote Similarity	NPC271138
0.582	Remote Similarity	NPC60557
0.582	Remote Similarity	NPC67857
0.581	Remote Similarity	NPC37739
0.5776	Remote Similarity	NPC10607
0.5776	Remote Similarity	NPC164389
0.5776	Remote Similarity	NPC148603
0.5755	Remote Similarity	NPC310014
0.5755	Remote Similarity	NPC269315
0.5726	Remote Similarity	NPC148417
0.5726	Remote Similarity	NPC475591
0.5726	Remote Similarity	NPC236870
0.5725	Remote Similarity	NPC70809
0.5702	Remote Similarity	NPC481078
0.5692	Remote Similarity	NPC305981
0.5691	Remote Similarity	NPC475287
0.569	Remote Similarity	NPC117714
0.5678	Remote Similarity	NPC222580
0.5649	Remote Similarity	NPC261506
0.5649	Remote Similarity	NPC4328
0.5645	Remote Similarity	NPC123522
0.5645	Remote Similarity	NPC79643
0.5635	Remote Similarity	NPC471550
0.562	Remote Similarity	NPC80986
0.56	Remote Similarity	NPC165204
0.5574	Remote Similarity	NPC187290
0.5546	Remote Similarity	NPC297263
0.5538	Remote Similarity	NPC41061
0.5538	Remote Similarity	NPC470876
0.5538	Remote Similarity	NPC227551
0.5538	Remote Similarity	NPC258617
0.5526	Remote Similarity	NPC475516
0.5517	Remote Similarity	NPC213674
0.5512	Remote Similarity	NPC475160
0.5512	Remote Similarity	NPC473714
0.5508	Remote Similarity	NPC251768
0.5508	Remote Similarity	NPC173859
0.5504	Remote Similarity	NPC484061
0.5504	Remote Similarity	NPC484062
0.5496	Remote Similarity	NPC43550
0.5492	Remote Similarity	NPC480473
0.5492	Remote Similarity	NPC480474
0.5487	Remote Similarity	NPC48499
0.547	Remote Similarity	NPC192791
0.5462	Remote Similarity	NPC110633
0.5455	Remote Similarity	NPC128925
0.5455	Remote Similarity	NPC477463
0.5448	Remote Similarity	NPC224381
0.5433	Remote Similarity	NPC155410
0.5433	Remote Similarity	NPC123199
0.5424	Remote Similarity	NPC480947
0.5403	Remote Similarity	NPC470915
0.5391	Remote Similarity	NPC235405
0.5391	Remote Similarity	NPC25605
0.5385	Remote Similarity	NPC476068
0.5345	Remote Similarity	NPC249848
0.5345	Remote Similarity	NPC107966
0.5338	Remote Similarity	NPC136768
0.5338	Remote Similarity	NPC236638
0.5338	Remote Similarity	NPC294453
0.5323	Remote Similarity	NPC31838
0.5317	Remote Similarity	NPC76972
0.5317	Remote Similarity	NPC469782
0.5317	Remote Similarity	NPC204414
0.531	Remote Similarity	NPC214484
0.5294	Remote Similarity	NPC30735
0.5294	Remote Similarity	NPC250247
0.529	Remote Similarity	NPC480422
0.5289	Remote Similarity	NPC475504
0.5289	Remote Similarity	NPC123796
0.5285	Remote Similarity	NPC301449
0.5285	Remote Similarity	NPC601290
0.5263	Remote Similarity	NPC293330
0.5263	Remote Similarity	NPC484059
0.5263	Remote Similarity	NPC484060
0.5263	Remote Similarity	NPC78046
0.5242	Remote Similarity	NPC295823
0.5242	Remote Similarity	NPC174720
0.5242	Remote Similarity	NPC475467
0.5234	Remote Similarity	NPC607265
0.5227	Remote Similarity	NPC286457
0.5207	Remote Similarity	NPC235438
0.5203	Remote Similarity	NPC114484
0.52	Remote Similarity	NPC104137
0.52	Remote Similarity	NPC26626
0.5185	Remote Similarity	NPC298034
0.5185	Remote Similarity	NPC71065
0.5175	Remote Similarity	NPC90856
0.517	Remote Similarity	NPC220838
0.5169	Remote Similarity	NPC470512
0.5169	Remote Similarity	NPC39211
0.5145	Remote Similarity	NPC480417
0.513	Remote Similarity	NPC164194
0.5122	Remote Similarity	NPC302887
0.512	Remote Similarity	NPC96641
0.512	Remote Similarity	NPC160452
0.512	Remote Similarity	NPC470477
0.512	Remote Similarity	NPC163183
0.5116	Remote Similarity	NPC470911
0.5115	Remote Similarity	NPC277212
0.5115	Remote Similarity	NPC30279
0.5115	Remote Similarity	NPC488560
0.5109	Remote Similarity	NPC484063
0.5109	Remote Similarity	NPC484064
0.5102	Remote Similarity	NPC45606
0.5085	Remote Similarity	NPC127056
0.5083	Remote Similarity	NPC223301
0.5083	Remote Similarity	NPC171544
0.5082	Remote Similarity	NPC162574
0.5079	Remote Similarity	NPC469947
0.5079	Remote Similarity	NPC480948
0.5076	Remote Similarity	NPC85154
0.5041	Remote Similarity	NPC470514
0.5041	Remote Similarity	NPC257468
0.5041	Remote Similarity	NPC309714
0.5041	Remote Similarity	NPC30289
0.504	Remote Similarity	NPC23275
0.5039	Remote Similarity	NPC151543
0.5038	Remote Similarity	NPC283417
0.5038	Remote Similarity	NPC470218
0.5038	Remote Similarity	NPC200049
0.5037	Remote Similarity	NPC65105
0.5035	Remote Similarity	NPC33012

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC36831 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7670
0.1-0.2	1425
0.2-0.3	50
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data