NPASS Compound

Natural Product: NPC31838

Natural Product ID	NPC31838
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Oleanolic Acid 3-O-[Beta-D-Xylopyranosyl-(1->2)-Beta-D-Glucuronopyranoside-6-O-Butylester]-28-O-Beta-D-Glucopyranoside
IUPAC Name	butyl (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-4,4,6a,6b,11,11,14b-heptamethyl-8a-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxane-2-carboxylate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1773980
PubChem CID	52951890
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 151158 0 0 0 0 0 0 0 0999 V2000 -10.8999 -4.1639 -3.2652 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5977 -2.6717 -3.4160 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4947 -2.5837 -4.4633 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1020 -1.1401 -4.7125 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6265 -0.5285 -3.5463 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5314 -0.9226 -2.8253 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8691 -1.9135 -3.2093 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1162 -0.1976 -1.6020 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8738 1.2504 -1.9644 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7979 2.0530 -0.6875 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2444 1.2348 0.4424 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4124 0.1123 -0.0903 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1582 0.5284 -0.5275 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1035 0.0596 0.2351 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.1635 -0.8601 -0.4611 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1116 -0.2152 -1.3118 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3051 0.8481 -0.6312 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4140 2.0874 -1.4701 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8551 1.0026 0.7603 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1082 1.9475 1.6231 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2542 2.3145 1.2141 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9647 1.4644 0.2185 C 0 0 2 0 0 0 0 0 0 0 0 0 2.6006 2.3589 -0.8250 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1133 0.3851 -0.4096 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8074 -0.1932 -1.5807 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2740 -0.3137 -1.3426 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8965 0.0847 -0.2395 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3758 -0.1324 -0.2093 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7889 -1.5388 -0.4920 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0396 -2.4113 0.6791 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0176 -3.5594 0.6302 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3942 -3.1332 0.5957 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9195 -1.7780 2.0158 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3476 -0.3629 2.1207 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0785 0.5086 0.9285 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4040 1.7913 1.2848 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9680 1.7989 1.5488 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1480 0.7234 0.8838 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6127 -0.2588 1.8702 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4556 0.9151 0.4394 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7657 2.1292 0.4964 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3722 0.0415 -0.0566 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6411 0.5098 -0.4944 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7587 0.0171 0.3571 C 0 0 1 0 0 0 0 0 0 0 0 0 12.0622 0.1780 -0.3915 C 0 0 2 0 0 0 0 0 0 0 0 0 11.9567 -0.8439 -1.5417 C 0 0 1 0 0 0 0 0 0 0 0 0 10.6426 -0.6698 -2.2360 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8750 -1.9888 -2.1322 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7681 -1.8361 -2.9730 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8550 0.3401 -1.8158 O 0 0 0 0 0 0 0 0 0 0 0 0 13.0139 -0.6031 -2.3820 O 0 0 0 0 0 0 0 0 0 0 0 0 13.0808 -0.3353 0.4340 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8966 0.7627 1.5389 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3245 1.2237 0.8663 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8217 2.5591 0.4260 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6188 1.1561 2.3812 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9838 -0.6937 -1.0225 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3090 0.7866 1.2227 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2787 1.3347 2.5035 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6152 1.9997 2.7489 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6830 0.9969 2.3574 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.4801 -0.2892 3.0996 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.0525 -0.7198 3.1993 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1678 0.3009 3.4504 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1157 -0.2219 4.3355 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6477 0.8194 0.9755 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7062 2.1676 4.1516 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0470 3.2136 -0.8505 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8593 1.7472 -2.8073 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8052 -4.4300 -3.8758 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1416 -4.4359 -2.2231 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0808 -4.7855 -3.6357 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2013 -2.3344 -2.4471 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4910 -2.0990 -3.7149 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6420 -3.1853 -4.0681 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9111 -3.0542 -5.3774 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0151 -0.6091 -5.0401 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3621 -1.1317 -5.5413 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9720 -0.3011 -0.8876 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8902 1.3115 -2.4685 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8457 2.3849 -0.4072 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6542 1.9314 1.0812 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1946 -0.5367 0.8120 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5729 -0.5735 1.0495 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7189 -1.5804 0.2808 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7666 -1.5118 -1.1514 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6596 0.1792 -2.2194 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4961 -1.0424 -1.7184 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0194 2.9985 -1.0370 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0787 1.8426 -2.4559 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4955 2.1619 -1.7893 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6917 -0.0280 1.2165 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1569 1.5749 2.6950 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7298 2.8922 1.6913 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3115 3.4048 0.9128 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8828 2.3072 2.1587 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3019 3.4371 -0.6614 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3551 2.1214 -1.8550 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7076 2.3804 -0.7678 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0224 -0.4589 0.3423 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6646 0.3406 -2.5390 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4912 -1.2573 -1.8157 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8136 -0.7731 -2.1944 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7248 0.4494 -1.1296 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0395 -1.9940 -1.1874 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7446 -1.5449 -1.1044 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0063 -3.1843 0.8871 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0665 -3.9754 -0.3969 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3835 -4.3482 1.3152 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5733 -3.3932 -0.4673 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2159 -2.5125 0.9512 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3376 -4.1012 1.1381 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5424 -2.3806 2.7286 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8704 -1.9369 2.3920 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4305 -0.3541 2.4458 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8315 0.0875 3.0263 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7018 2.5497 0.5054 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9516 2.1732 2.2051 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7765 1.7102 2.6458 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6118 2.8429 1.2842 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6245 -1.2786 1.4389 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2735 -0.1961 2.7843 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5977 -0.0180 2.2436 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6418 1.6481 -0.3295 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6970 -1.0824 0.6104 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2665 1.1862 -0.7441 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0575 -1.8425 -1.0769 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9039 -0.5377 -3.3339 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4683 -2.8430 -2.4735 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4794 -2.0876 -1.1070 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5414 -2.7566 -3.2835 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8924 -0.7356 -1.9915 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9181 -0.0195 1.3577 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3280 1.6313 1.3646 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4566 2.4630 -0.4804 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5159 3.0421 1.1809 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0622 3.3214 0.2198 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1250 0.2939 2.8293 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7155 1.1030 2.5131 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2625 2.0764 2.8866 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4187 2.0219 2.6492 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7316 2.9542 2.2333 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6720 1.4253 2.6221 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0265 -1.0891 2.5215 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9808 -1.4380 4.0561 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7301 -1.3024 2.2966 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6108 -1.0706 4.5345 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0502 1.5778 0.5118 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3911 1.3474 4.6155 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2372 3.7839 -0.0645 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2800 2.5210 -2.3580 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 6 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 6 22 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 30 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 1 35 40 1 6 40 41 2 0 40 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 47 50 1 0 46 51 1 0 45 52 1 0 44 53 1 0 19 54 1 0 54 55 1 0 54 56 1 0 12 57 1 0 11 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 62 65 1 0 61 66 1 0 60 67 1 0 10 68 1 0 9 69 1 0 57 8 1 0 64 59 1 0 54 14 1 0 24 17 1 0 38 27 1 0 50 43 1 0 38 22 1 0 35 28 1 0 1 70 1 0 1 71 1 0 1 72 1 0 2 73 1 0 2 74 1 0 3 75 1 0 3 76 1 0 4 77 1 0 4 78 1 0 8 79 1 1 9 80 1 6 10 81 1 1 11 82 1 1 12 83 1 1 14 84 1 1 15 85 1 0 15 86 1 0 16 87 1 0 16 88 1 0 18 89 1 0 18 90 1 0 18 91 1 0 19 92 1 1 20 93 1 0 20 94 1 0 21 95 1 0 21 96 1 0 23 97 1 0 23 98 1 0 23 99 1 0 24100 1 1 25101 1 0 25102 1 0 26103 1 0 28104 1 6 29105 1 0 29106 1 0 31107 1 0 31108 1 0 31109 1 0 32110 1 0 32111 1 0 32112 1 0 33113 1 0 33114 1 0 34115 1 0 34116 1 0 36117 1 0 36118 1 0 37119 1 0 37120 1 0 39121 1 0 39122 1 0 39123 1 0 43124 1 6 44125 1 1 45126 1 6 46127 1 1 47128 1 6 48129 1 0 48130 1 0 49131 1 0 51132 1 0 52133 1 0 53134 1 0 55135 1 0 55136 1 0 55137 1 0 56138 1 0 56139 1 0 56140 1 0 59141 1 6 60142 1 6 61143 1 6 62144 1 6 63145 1 0 63146 1 0 65147 1 0 66148 1 0 67149 1 0 68150 1 0 69151 1 0 M END

Standard InCHIKey	PWLRHGZJMJUWAB-ZEIJXSQXSA-N
Standard InCHI	InChI=1S/C51H82O18/c1-9-10-21-63-41(61)39-35(57)36(58)40(68-42-37(59)32(54)27(53)24-64-42)44(67-39)66-31-14-15-48(6)29(47(31,4)5)13-16-50(8)30(48)12-11-25-26-22-46(2,3)17-19-51(26,20-18-49(25,50)7)45(62)69-43-38(60)34(56)33(55)28(23-52)65-43/h11,26-40,42-44,52-60H,9-10,12-24H2,1-8H3/t26-,27+,28+,29-,30+,31-,32-,33+,34-,35-,36-,37+,38+,39-,40+,42-,43-,44+,48-,49+,50+,51-/m0/s1
SMILES	CCCCOC(=O)[C@@H]1[C@H]([C@@H]([C@H]([C@H](O[C@H]2CC[C@@]3(C)[C@@H](CC[C@]4(C)[C@@H]3CC=C3[C@@H]5CC(C)(C)CC[C@@]5(CC[C@@]43C)C(=O)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)C2(C)C)O1)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO28005.2	Panax japonicus var. major (burk.) wu et feng	Varieties	Araliaceae	Eukaryota	Roots	n.a.	n.a.	PMID[21417387]
NPO28005.2	Panax japonicus var. major (burk.) wu et feng	Varieties	Araliaceae	Eukaryota	n.a.	root	n.a.	PMID[21417387]
NPO28005.2	Panax japonicus var. major (burk.) wu et feng	Varieties	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO28005.2	Panax japonicus var. major (burk.) wu et feng	Varieties	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1
Inhibition	1

Activity Type	# Activity
Others	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	IC50	=	21200.0	nM	PMID[21417387]
NPT2	Others	Unspecified	n.a.	Inhibition	=	20.0	%	PMID[21417387]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC31838 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22603
0.1-0.2	23026
0.2-0.3	2998
0.3-0.4	614
0.4-0.5	380
0.5-0.6	115
0.6-0.7	67
0.7-0.8	0
0.8-0.85	1
0.85-0.9	2
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9271	High Similarity	NPC222580
0.8878	High Similarity	NPC297263
0.8557	High Similarity	NPC469946
0.8081	Intermediate Similarity	NPC39211
0.783	Intermediate Similarity	NPC80986
0.7642	Intermediate Similarity	NPC104372
0.757	Intermediate Similarity	NPC301449
0.757	Intermediate Similarity	NPC601290
0.7524	Intermediate Similarity	NPC63159
0.7431	Intermediate Similarity	NPC481078
0.7407	Intermediate Similarity	NPC481079
0.7404	Intermediate Similarity	NPC112352
0.7358	Intermediate Similarity	NPC235438
0.7193	Intermediate Similarity	NPC123199
0.7157	Intermediate Similarity	NPC48499
0.7129	Intermediate Similarity	NPC90856
0.7048	Intermediate Similarity	NPC295371
0.6964	Remote Similarity	NPC187290
0.6961	Remote Similarity	NPC214484
0.6944	Remote Similarity	NPC251768
0.6944	Remote Similarity	NPC480475
0.687	Remote Similarity	NPC79643
0.6789	Remote Similarity	NPC10607
0.6759	Remote Similarity	NPC192791
0.6752	Remote Similarity	NPC135904
0.6698	Remote Similarity	NPC475516
0.6667	Remote Similarity	NPC57484
0.6606	Remote Similarity	NPC223301
0.6606	Remote Similarity	NPC171544
0.6579	Remote Similarity	NPC295823
0.6579	Remote Similarity	NPC174720
0.6579	Remote Similarity	NPC475467
0.6571	Remote Similarity	NPC78046
0.6542	Remote Similarity	NPC235405
0.6508	Remote Similarity	NPC250247
0.6505	Remote Similarity	NPC128925
0.6496	Remote Similarity	NPC60557
0.6496	Remote Similarity	NPC67857
0.6486	Remote Similarity	NPC46665
0.6481	Remote Similarity	NPC249848
0.6481	Remote Similarity	NPC107966
0.6476	Remote Similarity	NPC204458
0.6452	Remote Similarity	NPC481081
0.6446	Remote Similarity	NPC481080
0.6429	Remote Similarity	NPC475591
0.6429	Remote Similarity	NPC236870
0.6423	Remote Similarity	NPC41061
0.6423	Remote Similarity	NPC227551
0.6417	Remote Similarity	NPC470218
0.6415	Remote Similarity	NPC1046
0.6396	Remote Similarity	NPC30735
0.632	Remote Similarity	NPC236638
0.632	Remote Similarity	NPC294453
0.632	Remote Similarity	NPC305981
0.6273	Remote Similarity	NPC157868
0.627	Remote Similarity	NPC261506
0.627	Remote Similarity	NPC4328
0.6239	Remote Similarity	NPC139894
0.6216	Remote Similarity	NPC263756
0.6216	Remote Similarity	NPC213674
0.616	Remote Similarity	NPC258617
0.6154	Remote Similarity	NPC480473
0.6154	Remote Similarity	NPC480474
0.6148	Remote Similarity	NPC283417
0.6148	Remote Similarity	NPC200049
0.6139	Remote Similarity	NPC167383
0.6111	Remote Similarity	NPC43550
0.6111	Remote Similarity	NPC29069
0.6106	Remote Similarity	NPC160415
0.6102	Remote Similarity	NPC104137
0.6102	Remote Similarity	NPC26626
0.6098	Remote Similarity	NPC488560
0.6094	Remote Similarity	NPC70809
0.6083	Remote Similarity	NPC475287
0.6053	Remote Similarity	NPC40775
0.6053	Remote Similarity	NPC159309
0.6053	Remote Similarity	NPC164389
0.6053	Remote Similarity	NPC86222
0.6034	Remote Similarity	NPC64715
0.6019	Remote Similarity	NPC237503
0.6017	Remote Similarity	NPC241909
0.6016	Remote Similarity	NPC475160
0.6016	Remote Similarity	NPC473714
0.6	Remote Similarity	NPC185466
0.5965	Remote Similarity	NPC309714
0.595	Remote Similarity	NPC76972
0.595	Remote Similarity	NPC469782
0.595	Remote Similarity	NPC204414
0.5948	Remote Similarity	NPC475504
0.592	Remote Similarity	NPC4749
0.5906	Remote Similarity	NPC470876
0.5902	Remote Similarity	NPC123522
0.5893	Remote Similarity	NPC473373
0.5888	Remote Similarity	NPC256798
0.5887	Remote Similarity	NPC191827
0.5877	Remote Similarity	NPC469945
0.5872	Remote Similarity	NPC189884
0.5872	Remote Similarity	NPC138334
0.5847	Remote Similarity	NPC281148
0.5847	Remote Similarity	NPC114484
0.5841	Remote Similarity	NPC488561
0.5833	Remote Similarity	NPC207738
0.5826	Remote Similarity	NPC117714
0.5826	Remote Similarity	NPC30289
0.582	Remote Similarity	NPC610204
0.5814	Remote Similarity	NPC202828
0.5814	Remote Similarity	NPC119592
0.5785	Remote Similarity	NPC11242
0.5769	Remote Similarity	NPC298034
0.5769	Remote Similarity	NPC71065
0.576	Remote Similarity	NPC471550
0.5752	Remote Similarity	NPC150400
0.5748	Remote Similarity	NPC476068
0.5702	Remote Similarity	NPC473884
0.5688	Remote Similarity	NPC209894
0.5682	Remote Similarity	NPC224381
0.5669	Remote Similarity	NPC85154
0.5656	Remote Similarity	NPC62725
0.5652	Remote Similarity	NPC473343
0.5641	Remote Similarity	NPC488526
0.5635	Remote Similarity	NPC100639
0.5615	Remote Similarity	NPC293330
0.5615	Remote Similarity	NPC65105
0.5603	Remote Similarity	NPC242840
0.56	Remote Similarity	NPC475899
0.56	Remote Similarity	NPC165204
0.5581	Remote Similarity	NPC286457
0.5573	Remote Similarity	NPC136768
0.5565	Remote Similarity	NPC300419
0.5564	Remote Similarity	NPC220160
0.5537	Remote Similarity	NPC606145
0.553	Remote Similarity	NPC302543
0.5514	Remote Similarity	NPC199457
0.5508	Remote Similarity	NPC473459
0.5504	Remote Similarity	NPC21691
0.5495	Remote Similarity	NPC161434
0.5492	Remote Similarity	NPC470477
0.5487	Remote Similarity	NPC179434
0.5484	Remote Similarity	NPC288205
0.5484	Remote Similarity	NPC51465
0.5478	Remote Similarity	NPC58448
0.5463	Remote Similarity	NPC68419
0.5462	Remote Similarity	NPC110633
0.5462	Remote Similarity	NPC480418
0.5448	Remote Similarity	NPC482010
0.5447	Remote Similarity	NPC609281
0.544	Remote Similarity	NPC268184
0.544	Remote Similarity	NPC607904
0.544	Remote Similarity	NPC610461
0.5433	Remote Similarity	NPC480419
0.5433	Remote Similarity	NPC603137
0.5431	Remote Similarity	NPC470512
0.5417	Remote Similarity	NPC470514
0.541	Remote Similarity	NPC291903
0.5401	Remote Similarity	NPC480422
0.5391	Remote Similarity	NPC475140
0.5385	Remote Similarity	NPC161674
0.5378	Remote Similarity	NPC2370
0.5372	Remote Similarity	NPC471435
0.5372	Remote Similarity	NPC471434
0.5372	Remote Similarity	NPC302887
0.537	Remote Similarity	NPC306746
0.5366	Remote Similarity	NPC481030
0.5366	Remote Similarity	NPC160452
0.5362	Remote Similarity	NPC33012
0.5345	Remote Similarity	NPC127056
0.5333	Remote Similarity	NPC148417
0.5333	Remote Similarity	NPC68175
0.5333	Remote Similarity	NPC162574
0.5328	Remote Similarity	NPC489209
0.5323	Remote Similarity	NPC36831
0.5317	Remote Similarity	NPC473824
0.5312	Remote Similarity	NPC155410
0.5294	Remote Similarity	NPC104071
0.5294	Remote Similarity	NPC469778
0.529	Remote Similarity	NPC8524
0.528	Remote Similarity	NPC470915
0.528	Remote Similarity	NPC815
0.5278	Remote Similarity	NPC472268
0.5276	Remote Similarity	NPC192600
0.5263	Remote Similarity	NPC164194
0.5254	Remote Similarity	NPC76497
0.5254	Remote Similarity	NPC80843
0.525	Remote Similarity	NPC102439
0.525	Remote Similarity	NPC173859
0.525	Remote Similarity	NPC305267
0.525	Remote Similarity	NPC148603
0.5246	Remote Similarity	NPC486563
0.5238	Remote Similarity	NPC475119
0.5227	Remote Similarity	NPC473645
0.5227	Remote Similarity	NPC265841
0.5214	Remote Similarity	NPC480420
0.521	Remote Similarity	NPC75417
0.5208	Remote Similarity	NPC297950
0.5207	Remote Similarity	NPC105800
0.5191	Remote Similarity	NPC301639
0.5191	Remote Similarity	NPC478065
0.5182	Remote Similarity	NPC604133
0.5175	Remote Similarity	NPC269095

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC31838 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7424
0.1-0.2	1680
0.2-0.3	41
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data