NPASS Compound

Natural Product: NPC41061

Natural Product ID	NPC41061
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3-O-Beta-D-Glucopyranosyl-(1->4)-Beta-D-Glucopyranosyl-(1->3)-Alpha-L-Rhamnopyranosyl-(1->2)-Beta-D-Xylopyranosyloleanolic Acid 28-O-Beta-D-Glucopyranosyl-(1->6)-Beta-D-Glucopyranoside
IUPAC Name	[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2S,3R,4S,5R)-3-[(2S,3R,4R,5S,6S)-4-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,5-dihydroxy-6-methyloxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL445174
PubChem CID	21577279
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 202212 0 0 0 0 0 0 0 0999 V2000 11.4728 0.9541 4.1145 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0051 1.3204 2.8590 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0103 0.1725 1.9038 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7450 -0.3412 1.6317 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9443 0.4648 0.8761 C 0 0 1 0 0 0 0 0 0 0 0 0 9.0715 1.2776 1.5869 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7420 1.0822 1.1980 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9123 0.4903 2.3048 C 0 0 1 0 0 0 0 0 0 0 0 0 7.1880 1.1310 3.4824 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4337 0.6214 1.8841 C 0 0 2 0 0 0 0 0 0 0 0 0 5.3826 0.3315 0.5527 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5943 -0.7672 0.1893 C 0 0 1 0 0 0 0 0 0 0 0 0 3.5055 -0.1728 -0.7034 C 0 0 1 0 0 0 0 0 0 0 0 0 4.2228 0.7477 -1.5173 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9079 0.0682 -2.5175 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3188 -1.3194 -2.1698 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4588 -1.6124 -0.7103 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0942 -2.9443 -0.4871 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5930 -1.5146 -2.7573 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9181 -1.0326 -1.5765 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5500 -1.0253 -1.5920 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9968 -0.2566 -2.7865 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4135 0.1316 -2.3540 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2540 -1.0944 -2.0958 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5905 -2.1285 -1.2128 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8582 -2.3282 -1.3630 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3876 -2.8046 0.0157 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2784 -3.4102 -2.3164 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4642 -3.3379 -1.2523 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9010 -3.1101 -1.0145 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4536 -1.7287 -1.0668 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4314 -0.6631 -1.2630 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.0579 0.6285 -1.6082 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2062 0.8746 -0.6784 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7106 -0.0388 0.1391 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1981 -1.4082 0.2297 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2660 -1.4930 1.4207 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3039 -2.4212 0.4622 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6839 -1.8792 0.4381 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9087 -0.6164 1.2143 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8802 0.4434 0.9768 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4073 1.2252 2.1232 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7642 0.8420 3.4968 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7116 0.0752 4.2623 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9516 2.1441 4.3177 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0970 0.1504 3.5701 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0761 -1.0067 2.6424 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2258 -0.0607 0.7295 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1370 0.0936 1.5661 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4386 0.2764 -0.5735 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6393 0.8155 -1.0204 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.3318 0.0448 -1.9525 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6592 0.5665 -1.9771 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.6263 -0.3539 -2.6410 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.9160 0.1246 -2.6074 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.4553 0.2742 -1.3544 C 0 0 2 0 0 0 0 0 0 0 0 0 -15.4968 -0.6919 -1.2723 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.8268 -0.7864 0.0772 C 0 0 2 0 0 0 0 0 0 0 0 0 -16.6712 -2.0192 0.3501 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.9620 -3.1664 -0.0138 O 0 0 0 0 0 0 0 0 0 0 0 0 -16.5462 0.4736 0.4819 C 0 0 2 0 0 0 0 0 0 0 0 0 -16.5464 1.4409 -0.6566 C 0 0 1 0 0 0 0 0 0 0 0 0 -15.1211 1.5981 -1.2038 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.4663 2.4723 -0.3388 O 0 0 0 0 0 0 0 0 0 0 0 0 -17.3589 1.0796 -1.7017 O 0 0 0 0 0 0 0 0 0 0 0 0 -16.0281 1.0308 1.6526 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5494 1.8965 -2.7473 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.8274 2.8225 -1.7595 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.4518 2.2039 -1.6088 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6827 3.0415 -0.8378 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7496 4.0681 -2.3780 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.7430 2.3463 -3.1818 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5190 -1.5710 -2.1566 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6471 -1.6231 -3.4511 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1286 1.9771 2.0433 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9801 2.8404 1.4357 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1264 2.3232 0.6561 C 0 0 2 0 0 0 0 0 0 0 0 0 6.8073 2.1499 -0.7114 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3757 4.0345 2.3116 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7303 1.2651 -0.1590 C 0 0 1 0 0 0 0 0 0 0 0 0 11.9469 0.4471 -0.5231 C 0 0 2 0 0 0 0 0 0 0 0 0 12.8452 0.4234 0.7035 C 0 0 2 0 0 0 0 0 0 0 0 0 13.8856 -0.4840 0.5437 O 0 0 0 0 0 0 0 0 0 0 0 0 15.1362 0.0962 0.4452 C 0 0 2 0 0 0 0 0 0 0 0 0 15.7653 -0.4389 -0.6431 O 0 0 0 0 0 0 0 0 0 0 0 0 17.0877 -0.1534 -0.8138 C 0 0 2 0 0 0 0 0 0 0 0 0 17.9197 -1.3815 -1.1316 C 0 0 0 0 0 0 0 0 0 0 0 0 17.8763 -2.3470 -0.1468 O 0 0 0 0 0 0 0 0 0 0 0 0 17.7592 0.6277 0.2553 C 0 0 2 0 0 0 0 0 0 0 0 0 17.2021 0.4849 1.6328 C 0 0 1 0 0 0 0 0 0 0 0 0 15.9294 -0.3271 1.6808 C 0 0 1 0 0 0 0 0 0 0 0 0 15.1725 -0.0133 2.8187 O 0 0 0 0 0 0 0 0 0 0 0 0 18.1306 0.0386 2.5691 O 0 0 0 0 0 0 0 0 0 0 0 0 17.9053 1.9937 -0.1022 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5455 1.0448 -1.6182 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9833 1.4212 -1.3311 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7840 1.5954 4.8161 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0334 1.6745 3.0160 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4104 2.1965 2.5498 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5271 -0.6738 2.4663 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3002 -0.2059 0.2290 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7823 0.3273 0.3461 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1771 -0.5901 2.4451 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4458 1.5691 3.9317 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8359 -0.0488 2.5099 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1480 -1.2814 1.0359 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8748 0.4393 -0.0738 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2290 -0.0226 -3.4198 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7518 0.6939 -2.8665 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6728 -2.1067 -2.6587 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5125 -1.5370 -0.3920 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9637 -3.0863 0.4931 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2254 -1.9435 -2.1360 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2623 -0.3439 -0.7336 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5619 0.6993 -2.8264 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9308 -0.8109 -3.7048 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3499 0.7035 -1.4292 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9081 0.6853 -3.1872 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7135 -1.7345 -0.1475 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7299 -3.6071 0.4020 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4711 -1.9396 0.7120 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3880 -3.2588 -0.1791 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4039 -4.3941 -1.7675 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2635 -3.2424 -2.7804 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5587 -3.6490 -3.1096 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0711 -4.0146 -0.4290 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2965 -3.9602 -2.1656 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4675 -3.6881 -1.8244 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1822 -3.5562 -0.0213 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9757 -0.5017 -0.2244 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3546 0.7677 -2.6661 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3359 1.4650 -1.4056 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6091 1.8993 -0.7313 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4976 -2.2900 1.3302 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8330 -0.5273 1.7252 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8803 -1.8356 2.3028 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2665 -3.2280 -0.3310 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1618 -2.9679 1.4174 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1555 -1.8314 -0.5890 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3347 -2.6682 0.9321 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3914 1.1899 0.2835 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2742 1.2913 2.0858 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6827 2.3294 2.0058 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9881 -0.9929 4.2476 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7296 0.3467 5.3608 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7038 0.1796 3.8546 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5806 1.9062 5.2003 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3566 2.9201 3.6692 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9412 2.4306 4.7258 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3411 -0.1636 4.6100 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8583 0.9179 3.3168 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1034 -1.4895 2.7192 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3306 -1.7497 2.9832 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3263 0.9220 -0.1570 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8916 0.8346 -0.9341 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3378 -0.3994 -3.7307 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5302 -1.3923 -2.2816 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7631 -0.0035 -0.5328 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.8867 -0.9368 0.6880 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.8072 -2.0677 1.4620 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.6116 -1.9268 -0.1988 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.9860 -3.0210 0.1677 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.6280 0.1775 0.6379 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.8290 2.4793 -0.3268 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.2611 2.1375 -2.1724 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.9153 1.8915 0.2555 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.6228 1.9289 -2.1793 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.8527 0.2820 2.2767 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8160 1.7620 -3.5869 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3746 2.9036 -0.8172 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0601 2.1234 -2.6667 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9586 2.9433 0.1039 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4382 4.7758 -1.7494 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8004 2.4227 -4.1661 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3603 -0.9228 -1.8401 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9941 -2.5554 -2.3929 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1370 -1.0753 -3.0681 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7096 -1.8938 -3.9871 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0253 -0.7457 -4.0323 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2617 -2.5089 -3.4619 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3133 3.3657 0.6383 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9372 3.1282 0.6076 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7157 2.9935 -1.1952 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4721 4.5462 2.6335 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8850 4.7364 1.5885 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1144 3.8028 3.0695 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0189 2.2431 0.2201 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5532 -0.5821 -0.7618 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2899 1.4366 0.7531 H 0 0 0 0 0 0 0 0 0 0 0 0 15.1051 1.2014 0.4942 H 0 0 0 0 0 0 0 0 0 0 0 0 17.1539 0.4808 -1.7525 H 0 0 0 0 0 0 0 0 0 0 0 0 17.6619 -1.8270 -2.1308 H 0 0 0 0 0 0 0 0 0 0 0 0 18.9698 -1.0348 -1.2194 H 0 0 0 0 0 0 0 0 0 0 0 0 17.1924 -3.0249 -0.2928 H 0 0 0 0 0 0 0 0 0 0 0 0 18.8335 0.2747 0.3215 H 0 0 0 0 0 0 0 0 0 0 0 0 16.9190 1.5245 1.9797 H 0 0 0 0 0 0 0 0 0 0 0 0 16.0774 -1.4047 1.6917 H 0 0 0 0 0 0 0 0 0 0 0 0 15.3883 0.9034 3.0821 H 0 0 0 0 0 0 0 0 0 0 0 0 18.9026 0.6466 2.5258 H 0 0 0 0 0 0 0 0 0 0 0 0 18.1611 1.9785 -1.0585 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5285 0.4650 -2.4083 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9464 0.5841 -1.8607 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 16 19 1 0 13 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 26 28 1 0 25 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 1 1 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 43 45 1 0 43 46 1 0 46 47 1 0 40 48 1 6 48 49 2 0 48 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 58 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 62 65 1 0 61 66 1 0 53 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 68 71 1 0 67 72 1 0 31 73 1 6 24 74 1 6 10 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 76 79 1 0 5 80 1 0 80 81 1 0 81 82 1 0 82 83 1 0 83 84 1 0 84 85 1 0 85 86 1 0 86 87 1 0 87 88 1 0 86 89 1 0 89 90 1 0 90 91 1 0 91 92 1 0 90 93 1 0 89 94 1 0 81 95 1 0 80 96 1 0 82 3 1 0 91 84 1 0 77 7 1 0 17 12 1 0 26 21 1 0 36 31 1 0 47 40 1 0 69 51 1 0 32 24 1 0 41 35 1 0 63 56 1 0 1 97 1 0 2 98 1 0 2 99 1 0 3100 1 1 5101 1 6 7102 1 6 8103 1 1 9104 1 0 10105 1 1 12106 1 1 13107 1 1 15108 1 0 15109 1 0 16110 1 6 17111 1 1 18112 1 0 19113 1 0 21114 1 1 22115 1 0 22116 1 0 23117 1 0 23118 1 0 25119 1 1 27120 1 0 27121 1 0 27122 1 0 28123 1 0 28124 1 0 28125 1 0 29126 1 0 29127 1 0 30128 1 0 30129 1 0 32130 1 1 33131 1 0 33132 1 0 34133 1 0 37134 1 0 37135 1 0 37136 1 0 38137 1 0 38138 1 0 39139 1 0 39140 1 0 41141 1 6 42142 1 0 42143 1 0 44144 1 0 44145 1 0 44146 1 0 45147 1 0 45148 1 0 45149 1 0 46150 1 0 46151 1 0 47152 1 0 47153 1 0 51154 1 1 53155 1 1 54156 1 0 54157 1 0 56158 1 1 58159 1 1 59160 1 0 59161 1 0 60162 1 0 61163 1 1 62164 1 1 63165 1 6 64166 1 0 65167 1 0 66168 1 0 67169 1 6 68170 1 1 69171 1 6 70172 1 0 71173 1 0 72174 1 0 73175 1 0 73176 1 0 73177 1 0 74178 1 0 74179 1 0 74180 1 0 76181 1 6 77182 1 6 78183 1 0 79184 1 0 79185 1 0 79186 1 0 80187 1 1 81188 1 6 82189 1 1 84190 1 6 86191 1 6 87192 1 0 87193 1 0 88194 1 0 89195 1 1 90196 1 1 91197 1 6 92198 1 0 93199 1 0 94200 1 0 95201 1 0 96202 1 0 M END

Standard InCHIKey	JZBAYEDJGKCDRG-HEQXVAOLSA-N
Standard InCHI	InChI=1S/C65H106O31/c1-25-36(70)51(94-55-48(82)44(78)50(31(22-68)90-55)93-54-46(80)42(76)39(73)30(21-67)89-54)49(83)57(87-25)95-52-37(71)28(69)23-85-58(52)92-35-12-13-62(6)33(61(35,4)5)11-14-64(8)34(62)10-9-26-27-19-60(2,3)15-17-65(27,18-16-63(26,64)7)59(84)96-56-47(81)43(77)40(74)32(91-56)24-86-53-45(79)41(75)38(72)29(20-66)88-53/h9,25,27-58,66-83H,10-24H2,1-8H3/t25-,27-,28+,29+,30+,31+,32+,33-,34+,35-,36-,37-,38+,39+,40+,41-,42-,43-,44+,45+,46+,47+,48+,49+,50+,51+,52+,53+,54-,55-,56-,57-,58-,62-,63+,64+,65-/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@@H](O)[C@H](O[C@H]3[C@@H](OC[C@H]([C@@H]3O)O)O[C@H]3CC[C@]4([C@H](C3(C)C)CC[C@@]3([C@@H]4CC=C4[C@@]3(C)CC[C@@]3([C@H]4CC(C)(C)CC3)C(=O)O[C@@H]3O[C@H](CO[C@@H]4O[C@H](CO)[C@H]([C@@H]([C@H]4O)O)O)[C@H]([C@@H]([C@H]3O)O)O)C)C)O[C@H]([C@@H]2O)C)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1382.67	Volume:	1305.899 ? Van der Waals volume.
Dense:	1.059	LogP:	-0.018 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.964 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.66 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	17.0	Rigid Bonds:	63.0
TPSA:	491.97 ? Topological Polar Surface Area.	H-Bond Acceptor:	31.0
H-Bond Donor:	18.0	Rings:	11.0
Heavy Atoms:	31.0

MedChem Properties

QED Drug-Likeness Score:	0.039	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.693	Fsp³:	0.954
MCE-18:	239.717 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.774	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.394	Promiscuous compounds:	0.074

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.175	MDCK Permeability:	-5.064
Pgp-inhibitor:	0.0	Pgp-substrate:	0.107
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.999
20% Bioavailability (F20%):	0.184	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.085	MRP1:	0.0
Plasma Protein Binding (PPB):	53.014%	Volume Distribution (VD):	-0.267
Fu:	26.609% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.938	CYP3A4-substrate:	0.083
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.999
HLM stability:	0.002 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.554

Half-life (T1/2):

6.213

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.732	Drug-induced Liver Injury (DILI):	0.985
AMES Toxicity:	0.993	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.003	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.483	Drug-induced Nephrotoxicity:	0.998
Genotoxicity:	0.077	RPMI-8226 Immunitoxicity:	0.427
A549 Cytotoxicity:	0.967	Hek293 Cytotoxicity:	0.616
BCF:	1.434 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.667 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.2 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.198 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27055	Scabiosa tschiliensis	Species	Caprifoliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[15104490]
NPO27055	Scabiosa tschiliensis	Species	Caprifoliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO27055	Scabiosa tschiliensis	Species	Caprifoliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO27055	Scabiosa tschiliensis	Species	Caprifoliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3

Activity Type	# Activity
Cell line	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1083	Cell line	A-375	Homo sapiens	IC50	>	20000.0	nM	PMID[23639650]
NPT81	Cell line	A549	Homo sapiens	IC50	>	20000.0	nM	PMID[23639650]
NPT116	Cell line	HL-60	Homo sapiens	IC50	>	20000.0	nM	PMID[23639650]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC41061 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25360
0.1-0.2	20673
0.2-0.3	2526
0.3-0.4	668
0.4-0.5	369
0.5-0.6	71
0.6-0.7	70
0.7-0.8	0
0.8-0.85	11
0.85-0.9	8
0.9-0.95	7
0.95-1	4

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC227551
0.9817	High Similarity	NPC305981
0.9727	High Similarity	NPC261506
0.9727	High Similarity	NPC4328
0.9286	High Similarity	NPC236638
0.9286	High Similarity	NPC294453
0.9252	High Similarity	NPC79643
0.9083	High Similarity	NPC135904
0.9035	High Similarity	NPC298034
0.9035	High Similarity	NPC71065
0.9027	High Similarity	NPC43550
0.8966	High Similarity	NPC250247
0.8909	High Similarity	NPC123199
0.8839	High Similarity	NPC481080
0.8807	High Similarity	NPC60557
0.8807	High Similarity	NPC475287
0.8807	High Similarity	NPC67857
0.8621	High Similarity	NPC202828
0.8621	High Similarity	NPC119592
0.8403	Intermediate Similarity	NPC220160
0.8376	Intermediate Similarity	NPC65105
0.8364	Intermediate Similarity	NPC481078
0.8318	Intermediate Similarity	NPC63159
0.8305	Intermediate Similarity	NPC481081
0.8205	Intermediate Similarity	NPC110633
0.8142	Intermediate Similarity	NPC76972
0.8142	Intermediate Similarity	NPC469782
0.8142	Intermediate Similarity	NPC204414
0.8017	Intermediate Similarity	NPC475160
0.8017	Intermediate Similarity	NPC473714
0.7966	Intermediate Similarity	NPC476068
0.7917	Intermediate Similarity	NPC293330
0.7851	Intermediate Similarity	NPC136768
0.7797	Intermediate Similarity	NPC488560
0.7788	Intermediate Similarity	NPC295823
0.7788	Intermediate Similarity	NPC174720
0.7788	Intermediate Similarity	NPC475467
0.7706	Intermediate Similarity	NPC112352
0.7692	Intermediate Similarity	NPC165204
0.7686	Intermediate Similarity	NPC258617
0.7571	Intermediate Similarity	NPC469778
0.7536	Intermediate Similarity	NPC469776
0.75	Intermediate Similarity	NPC32723
0.7447	Intermediate Similarity	NPC481323
0.7434	Intermediate Similarity	NPC475504
0.7417	Intermediate Similarity	NPC100639
0.7343	Intermediate Similarity	NPC135334
0.7329	Intermediate Similarity	NPC295941
0.7315	Intermediate Similarity	NPC48499
0.7292	Intermediate Similarity	NPC481324
0.7236	Intermediate Similarity	NPC57484
0.719	Intermediate Similarity	NPC155410
0.7179	Intermediate Similarity	NPC241909
0.7165	Intermediate Similarity	NPC70809
0.7063	Intermediate Similarity	NPC161717
0.7042	Intermediate Similarity	NPC469775
0.7014	Intermediate Similarity	NPC469774
0.7007	Intermediate Similarity	NPC469777
0.6977	Remote Similarity	NPC224381
0.6949	Remote Similarity	NPC481079
0.6911	Remote Similarity	NPC251263
0.6897	Remote Similarity	NPC148417
0.6885	Remote Similarity	NPC192600
0.6871	Remote Similarity	NPC100925
0.687	Remote Similarity	NPC104071
0.6867	Remote Similarity	NPC469772
0.6855	Remote Similarity	NPC470218
0.685	Remote Similarity	NPC475514
0.6842	Remote Similarity	NPC469946
0.681	Remote Similarity	NPC102439
0.681	Remote Similarity	NPC46665
0.6776	Remote Similarity	NPC469773
0.6774	Remote Similarity	NPC219180
0.6667	Remote Similarity	NPC480475
0.6638	Remote Similarity	NPC223301
0.6638	Remote Similarity	NPC171544
0.6609	Remote Similarity	NPC295371
0.6583	Remote Similarity	NPC104372
0.6579	Remote Similarity	NPC475516
0.6555	Remote Similarity	NPC297263
0.6535	Remote Similarity	NPC54636
0.6525	Remote Similarity	NPC473459
0.6519	Remote Similarity	NPC480422
0.6441	Remote Similarity	NPC160415
0.6435	Remote Similarity	NPC235405
0.6429	Remote Similarity	NPC133818
0.6423	Remote Similarity	NPC31838
0.6423	Remote Similarity	NPC187290
0.6417	Remote Similarity	NPC222580
0.6393	Remote Similarity	NPC301449
0.6393	Remote Similarity	NPC601290
0.6387	Remote Similarity	NPC10607
0.6387	Remote Similarity	NPC251768
0.6379	Remote Similarity	NPC249848
0.6379	Remote Similarity	NPC107966
0.6341	Remote Similarity	NPC80986
0.6333	Remote Similarity	NPC475591
0.6333	Remote Similarity	NPC236870
0.6333	Remote Similarity	NPC235438
0.6316	Remote Similarity	NPC29069
0.6303	Remote Similarity	NPC30735
0.626	Remote Similarity	NPC324875
0.626	Remote Similarity	NPC292677
0.625	Remote Similarity	NPC475209
0.6224	Remote Similarity	NPC472268
0.6218	Remote Similarity	NPC192791
0.6202	Remote Similarity	NPC191827
0.6179	Remote Similarity	NPC114484
0.6165	Remote Similarity	NPC471385
0.6154	Remote Similarity	NPC297950
0.6136	Remote Similarity	NPC13998
0.6136	Remote Similarity	NPC286457
0.6116	Remote Similarity	NPC159309
0.6116	Remote Similarity	NPC86222
0.6107	Remote Similarity	NPC85154
0.6102	Remote Similarity	NPC150400
0.6087	Remote Similarity	NPC214484
0.608	Remote Similarity	NPC480473
0.608	Remote Similarity	NPC480474
0.605	Remote Similarity	NPC39211
0.6033	Remote Similarity	NPC309714
0.6032	Remote Similarity	NPC104137
0.6032	Remote Similarity	NPC475486
0.6032	Remote Similarity	NPC26626
0.6014	Remote Similarity	NPC102505
0.6014	Remote Similarity	NPC488514
0.6	Remote Similarity	NPC166422
0.6	Remote Similarity	NPC33012
0.5984	Remote Similarity	NPC164389
0.5966	Remote Similarity	NPC473373
0.5956	Remote Similarity	NPC302543
0.5954	Remote Similarity	NPC471550
0.5948	Remote Similarity	NPC90856
0.5944	Remote Similarity	NPC489208
0.594	Remote Similarity	NPC21691
0.5929	Remote Similarity	NPC8524
0.5921	Remote Similarity	NPC472269
0.592	Remote Similarity	NPC281148
0.5896	Remote Similarity	NPC480418
0.5887	Remote Similarity	NPC609763
0.5878	Remote Similarity	NPC480419
0.5868	Remote Similarity	NPC263756
0.5868	Remote Similarity	NPC161674
0.5868	Remote Similarity	NPC213674
0.5865	Remote Similarity	NPC4749
0.5859	Remote Similarity	NPC75287
0.5852	Remote Similarity	NPC470876
0.5839	Remote Similarity	NPC309223
0.5833	Remote Similarity	NPC283417
0.5833	Remote Similarity	NPC200049
0.5802	Remote Similarity	NPC471384
0.5794	Remote Similarity	NPC276093
0.5745	Remote Similarity	NPC489209
0.5726	Remote Similarity	NPC40775
0.5726	Remote Similarity	NPC488526
0.5726	Remote Similarity	NPC101744
0.5726	Remote Similarity	NPC173859
0.5726	Remote Similarity	NPC148603
0.5725	Remote Similarity	NPC123522
0.569	Remote Similarity	NPC128925
0.5682	Remote Similarity	NPC470911
0.568	Remote Similarity	NPC68175
0.5662	Remote Similarity	NPC473452
0.5656	Remote Similarity	NPC470512
0.5656	Remote Similarity	NPC157868
0.5655	Remote Similarity	NPC475368
0.5635	Remote Similarity	NPC481082
0.5635	Remote Similarity	NPC164419
0.561	Remote Similarity	NPC473343
0.5574	Remote Similarity	NPC173583
0.5564	Remote Similarity	NPC323341
0.5563	Remote Similarity	NPC480417
0.5556	Remote Similarity	NPC477464
0.5548	Remote Similarity	NPC23020
0.5538	Remote Similarity	NPC36831
0.5526	Remote Similarity	NPC237503
0.5497	Remote Similarity	NPC45606
0.5487	Remote Similarity	NPC167383
0.5484	Remote Similarity	NPC76497
0.5469	Remote Similarity	NPC134835
0.5462	Remote Similarity	NPC69811
0.5447	Remote Similarity	NPC58448
0.5447	Remote Similarity	NPC127056
0.5433	Remote Similarity	NPC470515
0.5429	Remote Similarity	NPC135849
0.542	Remote Similarity	NPC473826
0.5417	Remote Similarity	NPC204458
0.5414	Remote Similarity	NPC268184
0.5407	Remote Similarity	NPC309907
0.5397	Remote Similarity	NPC117714
0.5397	Remote Similarity	NPC30289
0.5379	Remote Similarity	NPC470915
0.5372	Remote Similarity	NPC1046
0.5372	Remote Similarity	NPC78046
0.5359	Remote Similarity	NPC220838
0.5349	Remote Similarity	NPC64715
0.5346	Remote Similarity	NPC472270
0.5346	Remote Similarity	NPC112492
0.5344	Remote Similarity	NPC488564

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC41061 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7814
0.1-0.2	1281
0.2-0.3	48
0.3-0.4	7
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data