NPASS Compound

Natural Product: NPC475209

Natural Product ID	NPC475209
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Tauroside H1
IUPAC Name	[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (4aR,5R,6aS,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2,2,6a,9,9,12a-hexamethyl-3,4,5,6,6a,6b,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylate
Synonyms	Tauroside H1
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL501058
PubChem CID	44559149
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 178187 0 0 0 0 0 0 0 0999 V2000 11.2368 -3.7026 -3.4898 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3267 -2.2892 -3.4544 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6537 -1.8973 -2.1200 C 0 0 1 0 0 0 0 0 0 0 0 0 9.3820 -2.3516 -2.2038 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7884 -2.6335 -0.9402 C 0 0 1 0 0 0 0 0 0 0 0 0 7.5199 -2.8280 -1.1368 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3798 -2.3831 -0.7708 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9761 -0.9135 -0.9800 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6338 -0.7694 -0.6250 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2527 0.4968 -0.4232 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8922 0.7701 -0.2375 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2637 1.8413 -0.8614 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9854 2.5611 -1.5816 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8095 2.1909 -0.7344 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7538 3.6690 -1.1321 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0947 4.5623 -0.1559 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6528 4.2886 1.2021 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1731 2.9275 1.6164 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3465 1.8529 0.6047 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9349 1.0506 0.6838 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2074 0.5279 1.8607 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4357 -0.3050 2.1439 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4125 0.0321 1.0839 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7852 -0.2566 -0.2472 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8118 0.8753 -0.5047 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8485 0.4260 -1.5673 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1876 1.4528 -1.9083 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.2247 2.2867 -2.9477 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5892 2.0897 -0.8519 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6518 -0.5453 -1.3867 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1196 -0.6804 -1.2045 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5423 0.0256 0.0414 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7578 -0.6342 1.1590 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5269 -2.1082 0.9513 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4988 -0.4635 2.4291 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7896 -1.2810 2.2823 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6768 -0.7413 1.1739 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9923 0.2127 0.2823 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2225 1.6178 0.8902 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6978 0.2707 -1.0592 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3807 -1.7668 0.5150 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7067 -1.8305 0.8344 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.9573 -3.1294 1.2928 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2861 -4.0163 0.4891 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3297 -3.7384 -0.9755 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.3554 -2.7372 -1.4083 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.6258 -1.6838 -0.3855 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.9576 -1.7592 0.0333 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.6565 -0.5762 -0.0853 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.0715 -0.2378 1.2136 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.6637 0.9962 1.3049 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.6853 2.1340 1.2886 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.7840 1.2322 0.3231 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.4826 0.7239 -1.0478 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.9077 -0.6802 -0.9190 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.6324 -1.1094 -2.2172 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.6434 1.5832 -1.7510 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.9859 0.6822 0.7650 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9414 -2.0936 -2.5921 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0706 -3.4169 -1.5064 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0999 4.5194 1.4020 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0648 5.2983 2.1331 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9467 0.9243 0.9043 C 0 0 1 0 0 0 0 0 0 0 0 0 6.3583 1.1528 0.4836 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9016 -0.0104 -0.2659 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9819 0.3946 -1.1033 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1782 1.5681 1.5279 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3321 2.0393 1.4253 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5625 -3.9175 -0.5337 C 0 0 1 0 0 0 0 0 0 0 0 0 10.9339 -3.4586 -0.1493 C 0 0 2 0 0 0 0 0 0 0 0 0 11.5305 -2.4244 -1.0513 C 0 0 2 0 0 0 0 0 0 0 0 0 11.9147 -1.3336 -0.2425 O 0 0 0 0 0 0 0 0 0 0 0 0 13.2967 -1.1926 -0.1547 C 0 0 2 0 0 0 0 0 0 0 0 0 13.6635 -1.1212 1.1621 O 0 0 0 0 0 0 0 0 0 0 0 0 14.4067 -0.0367 1.5443 C 0 0 1 0 0 0 0 0 0 0 0 0 14.9794 -0.2259 2.9591 C 0 0 0 0 0 0 0 0 0 0 0 0 15.5678 0.3032 0.6696 C 0 0 1 0 0 0 0 0 0 0 0 0 15.1635 0.3461 -0.7839 C 0 0 2 0 0 0 0 0 0 0 0 0 13.6666 0.1096 -0.8364 C 0 0 1 0 0 0 0 0 0 0 0 0 13.1917 0.1936 -2.1426 O 0 0 0 0 0 0 0 0 0 0 0 0 15.8503 -0.6615 -1.4542 O 0 0 0 0 0 0 0 0 0 0 0 0 15.9985 1.5946 1.0429 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7329 -4.6214 -0.1243 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9760 -4.5149 0.5587 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1083 -4.1202 -3.2769 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3907 -2.0445 -3.4718 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7771 -1.9020 -4.3233 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6515 -0.7656 -2.1432 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1724 -1.8326 -0.2752 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5601 -2.9265 -1.3734 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0312 -2.6619 0.2883 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0381 -0.7311 -2.0660 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6989 1.1740 -1.2174 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8074 4.1011 -1.2193 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4013 3.8206 -2.1825 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 4.4463 -0.0661 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3608 5.6090 -0.4110 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9145 3.0855 1.9055 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6585 2.7160 2.6016 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0999 1.1362 1.0661 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5489 0.6649 2.7349 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1822 -1.3876 2.2131 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8297 -0.0349 3.1485 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6346 1.1343 1.2164 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0934 -1.1474 -0.0640 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3032 -0.4582 -1.1291 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3545 0.1531 -2.5080 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9649 0.8235 -2.4652 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7962 1.8402 -3.6013 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9805 2.6429 0.0265 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9324 2.7586 -1.4842 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4647 1.9519 -1.5093 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3099 -1.5410 -1.8403 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4788 0.1427 -2.2793 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6260 -0.2930 -2.1218 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3854 -1.7635 -1.1991 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1429 1.0786 -0.1046 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3202 -2.5200 1.9874 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3714 -2.6789 0.5822 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6474 -2.3707 0.3678 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9681 -0.9690 3.2894 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7400 0.5516 2.7318 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2662 -1.2128 3.2941 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5634 -2.3580 2.1615 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4964 -0.2062 1.7499 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7118 1.5696 1.8642 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2257 2.1236 0.9996 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8128 2.2654 0.2457 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6545 0.8548 -0.9002 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0881 1.0038 -1.6752 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8361 -0.6863 -1.5502 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0296 -1.0681 1.5763 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7030 -5.0363 0.7523 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2121 -4.0479 0.7969 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5884 -4.7205 -1.4769 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3109 -3.3100 -1.6079 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4779 -0.6547 -0.7494 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0331 0.2381 -0.4886 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.1672 1.0124 2.3187 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0890 2.9435 1.9288 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7512 1.7474 1.7707 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4978 2.5256 0.2759 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.9320 2.3326 0.2618 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.4577 0.7018 -1.6135 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.6805 -1.3206 -0.4951 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.4286 -1.3309 -2.7227 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2171 1.1585 -2.5247 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.6920 1.0043 0.1432 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6711 -1.5608 -2.9888 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2083 -3.3018 -2.4818 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7650 4.2841 0.5537 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4556 3.8541 2.2455 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3220 5.5526 1.7945 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2533 5.1353 3.1718 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3559 6.2838 1.8145 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1397 5.2895 1.9607 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9114 0.0496 1.5800 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3347 2.0215 -0.2406 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4076 -0.6363 0.5330 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8129 1.3097 -1.4643 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8392 0.8627 1.6778 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0487 1.9629 2.3656 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5981 -4.5402 -1.4362 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8926 -3.1185 0.9170 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5010 -2.8585 -1.4269 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8273 -1.9932 -0.7152 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7835 0.9015 1.6421 H 0 0 0 0 0 0 0 0 0 0 0 0 15.4680 -1.1947 3.0339 H 0 0 0 0 0 0 0 0 0 0 0 0 14.2069 -0.0204 3.7227 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7769 0.5624 3.0612 H 0 0 0 0 0 0 0 0 0 0 0 0 16.4552 -0.3475 0.8222 H 0 0 0 0 0 0 0 0 0 0 0 0 15.4130 1.3223 -1.2287 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1821 0.9289 -0.2760 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1649 1.1355 -2.4437 H 0 0 0 0 0 0 0 0 0 0 0 0 16.0138 -1.3963 -0.8384 H 0 0 0 0 0 0 0 0 0 0 0 0 16.0905 2.1809 0.2418 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4567 -4.5585 0.5467 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2813 -4.0679 1.3981 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 2 0 14 12 1 1 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 25 29 1 6 24 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 6 33 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 38 40 1 0 37 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 51 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 54 57 1 0 53 58 1 0 46 59 1 0 45 60 1 0 17 61 1 0 17 62 1 0 10 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 64 67 1 0 63 68 1 0 5 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 75 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 78 81 1 0 77 82 1 0 70 83 1 0 69 84 1 0 71 3 1 0 79 73 1 0 65 8 1 0 27 14 1 0 38 32 1 0 47 42 1 0 55 49 1 0 19 14 1 0 25 20 1 0 33 23 1 0 1 85 1 0 2 86 1 0 2 87 1 0 3 88 1 1 5 89 1 1 7 90 1 0 7 91 1 0 8 92 1 6 10 93 1 6 15 94 1 0 15 95 1 0 16 96 1 0 16 97 1 0 18 98 1 0 18 99 1 0 19100 1 1 21101 1 0 22102 1 0 22103 1 0 23104 1 6 24105 1 1 26106 1 0 26107 1 0 27108 1 6 28109 1 0 29110 1 0 29111 1 0 29112 1 0 30113 1 0 30114 1 0 31115 1 0 31116 1 0 32117 1 6 34118 1 0 34119 1 0 34120 1 0 35121 1 0 35122 1 0 36123 1 0 36124 1 0 37125 1 1 39126 1 0 39127 1 0 39128 1 0 40129 1 0 40130 1 0 40131 1 0 42132 1 1 44133 1 0 44134 1 0 45135 1 6 46136 1 6 47137 1 6 49138 1 6 51139 1 1 52140 1 0 52141 1 0 52142 1 0 53143 1 6 54144 1 6 55145 1 1 56146 1 0 57147 1 0 58148 1 0 59149 1 0 60150 1 0 61151 1 0 61152 1 0 61153 1 0 62154 1 0 62155 1 0 62156 1 0 63157 1 1 64158 1 6 65159 1 1 66160 1 0 67161 1 0 68162 1 0 69163 1 6 70164 1 1 71165 1 6 73166 1 6 75167 1 1 76168 1 0 76169 1 0 76170 1 0 77171 1 6 78172 1 6 79173 1 1 80174 1 0 81175 1 0 82176 1 0 83177 1 0 84178 1 0 M END

Standard InCHIKey	ZEZRJEPDVLDYDU-FEOFZAIJSA-N
Standard InCHI	InChI=1S/C58H94O26/c1-22-34(62)38(66)42(70)49(77-22)82-46-29(19-59)79-48(45(73)41(46)69)76-21-30-37(65)40(68)44(72)51(80-30)84-53(74)58-16-15-54(3,4)17-27(58)26-10-9-24-25(57(26,8)18-32(58)61)11-12-31-55(5,6)33(13-14-56(24,31)7)81-52-47(36(64)28(60)20-75-52)83-50-43(71)39(67)35(63)23(2)78-50/h10,22-25,27-52,59-73H,9,11-21H2,1-8H3/t22-,23-,24-,25+,27-,28-,29+,30+,31-,32+,33-,34-,35-,36-,37+,38+,39+,40-,41+,42+,43+,44+,45+,46+,47+,48+,49-,50-,51-,52-,56+,57-,58+/m0/s1
SMILES	OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CCC(C[C@H]4C4=CC[C@H]5[C@H]([C@@]4(C[C@H]3O)C)CC[C@@H]3[C@]5(C)CC[C@@H](C3(C)C)O[C@@H]3OC[C@@H]([C@@H]([C@H]3O[C@@H]3O[C@@H](C)[C@@H]([C@H]([C@H]3O)O)O)O)O)(C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1206.6	Volume:	1149.432 ? Van der Waals volume.
Dense:	1.05	LogP:	0.844 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.509 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.32 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	57.0
TPSA:	412.82 ? Topological Polar Surface Area.	H-Bond Acceptor:	26.0
H-Bond Donor:	15.0	Rings:	10.0
Heavy Atoms:	26.0

MedChem Properties

QED Drug-Likeness Score:	0.053	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.282	Fsp³:	0.948
MCE-18:	215.327 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.717	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.315	Promiscuous compounds:	0.104

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.494	MDCK Permeability:	-4.987
Pgp-inhibitor:	0.0	Pgp-substrate:	0.849
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.996
20% Bioavailability (F20%):	0.814	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.024	MRP1:	0.003
Plasma Protein Binding (PPB):	54.126%	Volume Distribution (VD):	-0.274
Fu:	24.863% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.001
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.898
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.945
HLM stability:	0.024 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.844

Half-life (T1/2):

5.533

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.014
Human Hepatotoxicity (H-HT):	0.565	Drug-induced Liver Injury (DILI):	0.975
AMES Toxicity:	0.97	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.003	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.613	Drug-induced Nephrotoxicity:	0.996
Genotoxicity:	0.278	RPMI-8226 Immunitoxicity:	0.477
A549 Cytotoxicity:	0.921	Hek293 Cytotoxicity:	0.452
BCF:	1.778 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.782 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.273 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.452 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO31494	Acanthopanax senticosus	n.a.	n.a.	n.a.	n.a.	leaf	n.a.	PMID[11816040]
NPO31494	Acanthopanax senticosus	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[17125224]
NPO31494	Acanthopanax senticosus	n.a.	n.a.	n.a.	Barks	Iksan, Chunbuk, Korea	n.a.	PMID[3127544]
NPO31494	Acanthopanax senticosus	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[COCONUT]
NPO31494	Acanthopanax senticosus	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[HerDing]
NPO31494	Acanthopanax senticosus	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[TCM_Taiwan]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	1

Activity Type	# Activity
Individual protein	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2797	Individual protein	Pancreatic lipase	Homo sapiens	Inhibition	=	38.3	%	PMID[12828466]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC475209 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22921
0.1-0.2	23088
0.2-0.3	2639
0.3-0.4	820
0.4-0.5	289
0.5-0.6	72
0.6-0.7	24
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7317	Intermediate Similarity	NPC220160
0.7009	Intermediate Similarity	NPC60557
0.7009	Intermediate Similarity	NPC67857
0.6833	Remote Similarity	NPC135904
0.6752	Remote Similarity	NPC473826
0.6694	Remote Similarity	NPC309907
0.6535	Remote Similarity	NPC236638
0.6535	Remote Similarity	NPC294453
0.6446	Remote Similarity	NPC76972
0.6446	Remote Similarity	NPC469782
0.6446	Remote Similarity	NPC204414
0.6406	Remote Similarity	NPC305981
0.6357	Remote Similarity	NPC261506
0.6357	Remote Similarity	NPC4328
0.6341	Remote Similarity	NPC165204
0.625	Remote Similarity	NPC295823
0.625	Remote Similarity	NPC174720
0.625	Remote Similarity	NPC41061
0.625	Remote Similarity	NPC475467
0.625	Remote Similarity	NPC227551
0.625	Remote Similarity	NPC475514
0.6047	Remote Similarity	NPC286457
0.6045	Remote Similarity	NPC102505
0.6045	Remote Similarity	NPC488514
0.6031	Remote Similarity	NPC202828
0.6031	Remote Similarity	NPC119592
0.6017	Remote Similarity	NPC164389
0.597	Remote Similarity	NPC250247
0.5968	Remote Similarity	NPC114287
0.5938	Remote Similarity	NPC488560
0.5923	Remote Similarity	NPC110633
0.5923	Remote Similarity	NPC13998
0.5878	Remote Similarity	NPC258617
0.5865	Remote Similarity	NPC309223
0.5865	Remote Similarity	NPC298034
0.5865	Remote Similarity	NPC71065
0.5833	Remote Similarity	NPC63159
0.5833	Remote Similarity	NPC43550
0.5806	Remote Similarity	NPC104137
0.5806	Remote Similarity	NPC26626
0.5758	Remote Similarity	NPC470876
0.575	Remote Similarity	NPC488526
0.5748	Remote Similarity	NPC123522
0.5736	Remote Similarity	NPC475160
0.5736	Remote Similarity	NPC283417
0.5736	Remote Similarity	NPC200049
0.5736	Remote Similarity	NPC473714
0.5726	Remote Similarity	NPC241909
0.5725	Remote Similarity	NPC21691
0.5659	Remote Similarity	NPC155410
0.5634	Remote Similarity	NPC489208
0.5625	Remote Similarity	NPC79643
0.5597	Remote Similarity	NPC161717
0.5583	Remote Similarity	NPC112352
0.5564	Remote Similarity	NPC473452
0.5538	Remote Similarity	NPC123199
0.553	Remote Similarity	NPC85154
0.553	Remote Similarity	NPC481080
0.5508	Remote Similarity	NPC475296
0.5496	Remote Similarity	NPC100639
0.5489	Remote Similarity	NPC476068
0.5441	Remote Similarity	NPC136768
0.5429	Remote Similarity	NPC489209
0.5426	Remote Similarity	NPC475287
0.5425	Remote Similarity	NPC469776
0.5414	Remote Similarity	NPC4749
0.541	Remote Similarity	NPC104071
0.5401	Remote Similarity	NPC302543
0.539	Remote Similarity	NPC8524
0.5373	Remote Similarity	NPC57484
0.5368	Remote Similarity	NPC65105
0.5366	Remote Similarity	NPC102439
0.5352	Remote Similarity	NPC33012
0.5324	Remote Similarity	NPC224381
0.5323	Remote Similarity	NPC148417
0.5321	Remote Similarity	NPC32723
0.5287	Remote Similarity	NPC481323
0.5287	Remote Similarity	NPC469778
0.5267	Remote Similarity	NPC192600
0.5263	Remote Similarity	NPC480423
0.525	Remote Similarity	NPC474589
0.5238	Remote Similarity	NPC64715
0.522	Remote Similarity	NPC135334
0.5217	Remote Similarity	NPC481081
0.5208	Remote Similarity	NPC480421
0.5207	Remote Similarity	NPC480420
0.5188	Remote Similarity	NPC481324
0.5156	Remote Similarity	NPC481079
0.5126	Remote Similarity	NPC1046
0.512	Remote Similarity	NPC232237
0.5079	Remote Similarity	NPC105800
0.5077	Remote Similarity	NPC481078
0.5061	Remote Similarity	NPC295941
0.5038	Remote Similarity	NPC815
0.5036	Remote Similarity	NPC293330
0.5036	Remote Similarity	NPC237191
0.5035	Remote Similarity	NPC70809
0.5032	Remote Similarity	NPC469775
0.5032	Remote Similarity	NPC485563

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC475209 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7197
0.1-0.2	1899
0.2-0.3	52
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data