NPASS Compound

Natural Product: NPC148417

Natural Product ID	NPC148417
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3-O-Beta-D-Glucopyranosyl-(1->4)-Alpha-L-Arabinopyranosyl Siaresinolic Acid 28-O-Alpha-L-Rhamnopyranosyl-(1->4)-Beta-D-Glucopyranosyl-(1->6)-Beta-D-Glucopyranosyl Ester
IUPAC Name	[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1S,4aR,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-1-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2430032
PubChem CID	72189232
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 182191 0 0 0 0 0 0 0 0999 V2000 15.8701 -2.5810 -2.7952 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5808 -2.8743 -2.0259 C 0 0 1 0 0 0 0 0 0 0 0 0 14.5479 -4.3798 -1.7999 C 0 0 1 0 0 0 0 0 0 0 0 0 13.4643 -4.7384 -0.7957 C 0 0 2 0 0 0 0 0 0 0 0 0 13.4983 -3.8006 0.3934 C 0 0 2 0 0 0 0 0 0 0 0 0 13.5967 -2.3587 0.0183 C 0 0 1 0 0 0 0 0 0 0 0 0 14.6576 -2.1743 -0.8500 O 0 0 0 0 0 0 0 0 0 0 0 0 12.3998 -1.8233 -0.4129 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9379 -0.7780 0.4005 C 0 0 2 0 0 0 0 0 0 0 0 0 10.6562 -1.0856 1.1032 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7984 -1.0524 2.6194 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9653 -1.7523 2.9331 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5487 -0.4366 0.6384 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6269 0.9014 0.4141 C 0 0 2 0 0 0 0 0 0 0 0 0 11.0306 1.4699 0.3818 C 0 0 1 0 0 0 0 0 0 0 0 0 11.9371 0.5229 -0.3503 C 0 0 1 0 0 0 0 0 0 0 0 0 13.2352 1.0770 -0.3121 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0215 2.6706 -0.3554 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8369 1.6233 1.3004 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8512 2.2687 0.6004 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9328 3.1342 1.4211 C 0 0 2 0 0 0 0 0 0 0 0 0 6.3375 2.3473 2.5405 C 0 0 2 0 0 0 0 0 0 0 0 0 5.3051 3.1488 3.3113 C 0 0 1 0 0 0 0 0 0 0 0 0 4.9121 4.4023 2.5140 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7817 3.9791 1.0783 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0225 3.6890 0.5687 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8552 2.9070 1.0210 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7271 2.9232 0.2545 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4765 3.9214 -0.4587 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7219 1.7883 0.1988 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5463 0.5394 0.0533 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5233 0.7532 -1.0795 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8256 1.1022 -2.3692 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0828 -0.0838 -3.3175 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4218 2.2965 -3.0727 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3594 1.2505 -2.2484 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8481 1.9244 -0.9991 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5474 1.5055 -0.8308 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3893 1.6640 -1.8381 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8190 1.3107 -1.8700 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3517 1.0563 -0.5019 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8299 1.3341 -0.3405 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2698 2.6996 -0.7009 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5283 0.3491 -1.2555 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2239 -0.7438 -0.4989 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3095 -0.1173 0.3566 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6549 0.8019 1.3394 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7334 0.0728 2.7002 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3798 2.0979 1.5297 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1830 0.9329 1.0704 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4861 1.8144 2.0330 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9968 1.5348 1.9398 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4770 1.6137 0.5447 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.1689 3.0888 0.2487 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1251 0.9043 0.4147 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3709 -0.5908 0.2109 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2341 1.0326 1.5904 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9463 1.9216 1.4516 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1993 0.5075 -0.5191 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4528 -0.0907 -0.5041 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.5703 0.8657 -0.1864 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.7484 0.4459 -1.0654 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.8172 -1.0808 -1.0835 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.6272 -1.5642 -1.8753 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6116 -0.6552 -1.7775 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.9977 -1.5591 -1.6139 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.7158 -2.2878 -0.6910 C 0 0 1 0 0 0 0 0 0 0 0 0 -15.0989 -1.7042 -0.5240 C 0 0 1 0 0 0 0 0 0 0 0 0 -16.1600 -2.7911 -0.6757 C 0 0 2 0 0 0 0 0 0 0 0 0 -15.8065 -3.8891 0.3024 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.4003 -4.3356 -0.0164 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.4312 -5.8184 -0.3025 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.1793 -6.3645 -0.5266 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.8429 -3.6034 -1.0823 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.9306 -3.3815 1.5854 O 0 0 0 0 0 0 0 0 0 0 0 0 -16.1108 -3.3445 -1.9561 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.2024 -1.2134 0.7746 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.4867 0.9225 -2.3456 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9663 0.6492 1.1304 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7888 -0.0386 -2.3898 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9367 5.3291 2.7174 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1591 2.3649 3.4047 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3508 2.0150 3.4371 O 0 0 0 0 0 0 0 0 0 0 0 0 14.6213 -4.1341 1.1516 O 0 0 0 0 0 0 0 0 0 0 0 0 13.7012 -6.0232 -0.3236 O 0 0 0 0 0 0 0 0 0 0 0 0 14.2568 -4.9839 -3.0165 O 0 0 0 0 0 0 0 0 0 0 0 0 16.2542 -1.5714 -2.5202 H 0 0 0 0 0 0 0 0 0 0 0 0 16.6280 -3.3678 -2.5460 H 0 0 0 0 0 0 0 0 0 0 0 0 15.6680 -2.6913 -3.8788 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7001 -2.5687 -2.6018 H 0 0 0 0 0 0 0 0 0 0 0 0 15.5495 -4.7387 -1.4833 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4809 -4.6607 -1.3119 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6128 -4.0325 1.0040 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8921 -1.8076 0.9567 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7178 -0.6684 1.2001 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4614 -2.1919 0.8877 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9212 -0.0378 3.0271 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9095 -1.5843 3.0190 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7161 -2.5494 3.4506 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2078 1.0697 -0.6234 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4099 1.6228 1.3954 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6183 0.3424 -1.3945 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2141 1.9059 -0.8439 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5824 3.3377 0.2214 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2374 1.4716 0.0866 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2542 2.8782 -0.2445 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5934 3.9247 1.8856 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9153 1.3680 2.1795 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6389 3.3913 4.3217 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9581 4.8183 2.9165 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4085 4.8488 0.4740 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1470 0.3697 0.9647 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9771 -0.3662 -0.1493 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2385 1.5750 -0.8635 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1303 -0.1764 -1.1447 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7158 0.1690 -4.3341 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6263 -1.0061 -2.9260 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1955 -0.1597 -3.4048 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6096 2.9889 -3.4443 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1272 2.8561 -2.3982 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0163 2.0391 -3.9732 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9980 1.7996 -3.1591 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8373 3.0292 -1.2516 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9804 2.1121 -2.7708 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9397 0.4118 -2.5403 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3196 2.1971 -2.3807 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3117 -0.0825 -0.3953 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9533 3.0031 -1.7010 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0199 3.5005 0.0161 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4028 2.7030 -0.7647 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2900 0.8439 -1.8992 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8234 -0.1565 -1.9659 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7952 -1.3354 -1.2770 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5911 -1.4606 0.0096 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8655 -0.9502 0.8321 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7422 -0.3716 2.8293 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9572 -0.6817 2.8043 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6296 0.8154 3.5298 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9728 2.1086 2.4929 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7451 2.9794 1.5837 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1843 2.2642 0.7540 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7442 -0.0900 1.2127 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7900 1.5784 3.0917 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6208 2.8902 1.9093 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7614 0.5999 2.4790 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5356 2.3535 2.5711 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7313 3.4278 -0.6485 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5594 3.6794 1.0940 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1096 3.2932 0.1177 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4225 -1.1510 0.5034 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5259 -0.8733 -0.8302 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1183 -0.9921 0.9234 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1788 0.0197 1.9090 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7671 1.3613 2.5217 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6540 1.6446 2.2958 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 3.0005 1.6010 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4426 -0.8938 0.2542 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3333 1.9189 -0.3472 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6974 0.8486 -0.7244 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6656 -1.3848 -0.0243 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8947 -1.8199 -2.9198 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2583 -2.5400 -1.4403 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1334 -2.2820 0.2749 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.3306 -0.9322 -1.2916 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.1340 -2.3056 -0.4629 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.5308 -4.7282 0.1789 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7689 -4.1210 0.8793 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.8122 -6.2971 0.6387 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.1545 -6.0465 -1.0873 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6665 -6.5043 0.3107 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.3859 -3.8258 2.2626 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.2473 -2.6548 -2.6581 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.2690 -0.2190 0.7352 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0855 0.5803 -3.0336 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9438 0.5576 1.2483 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7481 -0.2966 -3.3539 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1650 5.2902 3.7002 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3966 1.4133 3.5484 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6461 1.0748 3.3431 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9845 -3.3426 1.6194 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1920 -6.6974 -0.8453 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0487 -4.3030 -3.7184 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 10 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 15 18 1 0 14 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 25 27 1 0 27 28 1 0 28 29 2 0 30 28 1 6 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 33 35 1 0 33 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 6 42 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 47 49 1 0 47 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 6 53 55 1 0 55 56 1 6 55 57 1 0 57 58 1 0 46 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 63 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 71 74 1 0 70 75 1 0 69 76 1 0 68 77 1 0 62 78 1 0 61 79 1 0 36 80 1 0 24 81 1 0 23 82 1 0 22 83 1 0 5 84 1 0 4 85 1 0 3 86 1 0 7 2 1 0 16 9 1 0 26 21 1 0 58 30 1 0 65 60 1 0 74 67 1 0 37 30 1 0 55 38 1 0 53 41 1 0 50 42 1 0 1 87 1 0 1 88 1 0 1 89 1 0 2 90 1 6 3 91 1 1 4 92 1 6 5 93 1 1 6 94 1 1 9 95 1 1 10 96 1 6 11 97 1 0 11 98 1 0 12 99 1 0 14100 1 6 15101 1 1 16102 1 6 17103 1 0 18104 1 0 20105 1 0 20106 1 0 21107 1 1 22108 1 6 23109 1 1 24110 1 1 25111 1 6 31112 1 0 31113 1 0 32114 1 0 32115 1 0 34116 1 0 34117 1 0 34118 1 0 35119 1 0 35120 1 0 35121 1 0 36122 1 6 37123 1 6 39124 1 0 40125 1 0 40126 1 0 41127 1 1 43128 1 0 43129 1 0 43130 1 0 44131 1 0 44132 1 0 45133 1 0 45134 1 0 46135 1 1 48136 1 0 48137 1 0 48138 1 0 49139 1 0 49140 1 0 49141 1 0 50142 1 1 51143 1 0 51144 1 0 52145 1 0 52146 1 0 54147 1 0 54148 1 0 54149 1 0 56150 1 0 56151 1 0 56152 1 0 57153 1 0 57154 1 0 58155 1 0 58156 1 0 60157 1 1 61158 1 1 62159 1 1 63160 1 1 64161 1 0 64162 1 0 67163 1 1 68164 1 6 69165 1 1 70166 1 1 71167 1 1 72168 1 0 72169 1 0 73170 1 0 75171 1 0 76172 1 0 77173 1 0 78174 1 0 79175 1 0 80176 1 0 81177 1 0 82178 1 0 83179 1 0 84180 1 0 85181 1 0 86182 1 0 M END

Standard InCHIKey	LKXSEJWOAPOCIO-SIOYIREESA-N
Standard InCHI	InChI=1S/C59H96O27/c1-23-33(62)37(66)42(71)50(79-23)85-46-26(20-61)81-48(45(74)40(46)69)77-21-27-35(64)39(68)44(73)52(83-27)86-53(76)59-17-15-54(2,3)47(75)32(59)24-9-10-30-56(6)13-12-31(55(4,5)29(56)11-14-58(30,8)57(24,7)16-18-59)84-49-41(70)36(65)28(22-78-49)82-51-43(72)38(67)34(63)25(19-60)80-51/h9,23,25-52,60-75H,10-22H2,1-8H3/t23-,25+,26+,27+,28-,29-,30+,31-,32+,33-,34+,35+,36-,37+,38-,39-,40+,41+,42+,43+,44+,45+,46+,47-,48+,49-,50-,51-,52-,56-,57+,58+,59-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@@H](CO)O[C@H]([C@@H]([C@H]1O)O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC(=O)[C@@]12CCC(C)(C)[C@H]([C@H]2C2=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]2(C)CC1)O[C@H]1[C@@H]([C@H]([C@H](CO1)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32682	anemone taipaiensis	Species	Ranunculaceae	Eukaryota	rhizomes	n.a.	n.a.	PMID[23992864]
NPO32682	anemone taipaiensis	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	5

Activity Type	# Activity
Cell line	4
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT165	Cell line	HeLa	Homo sapiens	IC50	>	80000.0	nM	PMID[23398362]
NPT81	Cell line	A549	Homo sapiens	IC50	>	80000.0	nM	PMID[7623046]
NPT116	Cell line	HL-60	Homo sapiens	IC50	>	80000.0	nM	PMID[22840694]
NPT65	Cell line	HepG2	Homo sapiens	IC50	>	80000.0	nM	PMID[19331379]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	29040.0	nM	PMID[23992864]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC148417 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22289
0.1-0.2	22910
0.2-0.3	3124
0.3-0.4	994
0.4-0.5	350
0.5-0.6	112
0.6-0.7	49
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7838	Intermediate Similarity	NPC136768
0.7767	Intermediate Similarity	NPC295823
0.7767	Intermediate Similarity	NPC174720
0.7767	Intermediate Similarity	NPC475467
0.7727	Intermediate Similarity	NPC110633
0.7685	Intermediate Similarity	NPC475160
0.7685	Intermediate Similarity	NPC473714
0.7593	Intermediate Similarity	NPC135904
0.7447	Intermediate Similarity	NPC128925
0.74	Intermediate Similarity	NPC161674
0.7387	Intermediate Similarity	NPC481080
0.7321	Intermediate Similarity	NPC476068
0.7315	Intermediate Similarity	NPC60557
0.7315	Intermediate Similarity	NPC67857
0.7245	Intermediate Similarity	NPC48499
0.7193	Intermediate Similarity	NPC258617
0.7182	Intermediate Similarity	NPC165204
0.7155	Intermediate Similarity	NPC261506
0.7155	Intermediate Similarity	NPC4328
0.7143	Intermediate Similarity	NPC488560
0.713	Intermediate Similarity	NPC43550
0.7103	Intermediate Similarity	NPC241909
0.7069	Intermediate Similarity	NPC305981
0.7019	Intermediate Similarity	NPC101744
0.6923	Remote Similarity	NPC104071
0.6903	Remote Similarity	NPC100639
0.6897	Remote Similarity	NPC41061
0.6897	Remote Similarity	NPC227551
0.6857	Remote Similarity	NPC102439
0.6833	Remote Similarity	NPC250247
0.6786	Remote Similarity	NPC192600
0.6735	Remote Similarity	NPC256798
0.6696	Remote Similarity	NPC76972
0.6696	Remote Similarity	NPC469782
0.6696	Remote Similarity	NPC204414
0.6667	Remote Similarity	NPC134835
0.6639	Remote Similarity	NPC236638
0.6639	Remote Similarity	NPC294453
0.6583	Remote Similarity	NPC298034
0.6583	Remote Similarity	NPC71065
0.6555	Remote Similarity	NPC65105
0.6538	Remote Similarity	NPC473373
0.6522	Remote Similarity	NPC155410
0.6514	Remote Similarity	NPC469821
0.6481	Remote Similarity	NPC63159
0.6471	Remote Similarity	NPC475514
0.6455	Remote Similarity	NPC73318
0.6396	Remote Similarity	NPC481079
0.6316	Remote Similarity	NPC191763
0.6286	Remote Similarity	NPC235405
0.6239	Remote Similarity	NPC173859
0.6239	Remote Similarity	NPC148603
0.6239	Remote Similarity	NPC46665
0.623	Remote Similarity	NPC481081
0.6226	Remote Similarity	NPC249848
0.6226	Remote Similarity	NPC107966
0.6216	Remote Similarity	NPC601659
0.621	Remote Similarity	NPC220160
0.6207	Remote Similarity	NPC79643
0.6204	Remote Similarity	NPC112352
0.6182	Remote Similarity	NPC68175
0.6182	Remote Similarity	NPC235438
0.6168	Remote Similarity	NPC295371
0.6154	Remote Similarity	NPC78046
0.6147	Remote Similarity	NPC30735
0.6147	Remote Similarity	NPC160415
0.614	Remote Similarity	NPC473826
0.6098	Remote Similarity	NPC202828
0.6098	Remote Similarity	NPC119592
0.6061	Remote Similarity	NPC116794
0.6058	Remote Similarity	NPC204458
0.6058	Remote Similarity	NPC90856
0.6	Remote Similarity	NPC29069
0.5966	Remote Similarity	NPC123199
0.596	Remote Similarity	NPC605954
0.5917	Remote Similarity	NPC470218
0.5905	Remote Similarity	NPC214484
0.5902	Remote Similarity	NPC57484
0.5872	Remote Similarity	NPC470512
0.5872	Remote Similarity	NPC39211
0.5847	Remote Similarity	NPC475287
0.5833	Remote Similarity	NPC475516
0.5818	Remote Similarity	NPC473343
0.5818	Remote Similarity	NPC76497
0.578	Remote Similarity	NPC58448
0.5739	Remote Similarity	NPC114484
0.5726	Remote Similarity	NPC36831
0.5724	Remote Similarity	NPC469778
0.5676	Remote Similarity	NPC469946
0.5664	Remote Similarity	NPC469776
0.5655	Remote Similarity	NPC32723
0.5635	Remote Similarity	NPC161717
0.5625	Remote Similarity	NPC223301
0.5625	Remote Similarity	NPC171544
0.562	Remote Similarity	NPC470911
0.5616	Remote Similarity	NPC481323
0.5614	Remote Similarity	NPC470515
0.5603	Remote Similarity	NPC281148
0.5603	Remote Similarity	NPC104372
0.5583	Remote Similarity	NPC268184
0.5581	Remote Similarity	NPC224381
0.5575	Remote Similarity	NPC109588
0.5565	Remote Similarity	NPC222580
0.5563	Remote Similarity	NPC295941
0.5546	Remote Similarity	NPC470915
0.5545	Remote Similarity	NPC108748
0.5541	Remote Similarity	NPC135334
0.5526	Remote Similarity	NPC40775
0.5526	Remote Similarity	NPC10607
0.5526	Remote Similarity	NPC251768
0.5526	Remote Similarity	NPC480475
0.5512	Remote Similarity	NPC293330
0.5508	Remote Similarity	NPC80986
0.5504	Remote Similarity	NPC70809
0.5478	Remote Similarity	NPC475591
0.5478	Remote Similarity	NPC236870
0.5463	Remote Similarity	NPC189884
0.5463	Remote Similarity	NPC138334
0.5462	Remote Similarity	NPC481078
0.5462	Remote Similarity	NPC187290
0.5446	Remote Similarity	NPC1876
0.5446	Remote Similarity	NPC157868
0.5439	Remote Similarity	NPC309714
0.5431	Remote Similarity	NPC470513
0.5431	Remote Similarity	NPC297263
0.54	Remote Similarity	NPC481324
0.5391	Remote Similarity	NPC159309
0.5391	Remote Similarity	NPC473459
0.5391	Remote Similarity	NPC86222
0.537	Remote Similarity	NPC161434
0.536	Remote Similarity	NPC54636
0.5354	Remote Similarity	NPC286457
0.5351	Remote Similarity	NPC192791
0.5351	Remote Similarity	NPC75417
0.5333	Remote Similarity	NPC31838
0.5323	Remote Similarity	NPC475209
0.5321	Remote Similarity	NPC269095
0.5319	Remote Similarity	NPC45606
0.5315	Remote Similarity	NPC136877
0.5304	Remote Similarity	NPC137414
0.5299	Remote Similarity	NPC470514
0.5294	Remote Similarity	NPC301449
0.5294	Remote Similarity	NPC601290
0.5285	Remote Similarity	NPC123522
0.5263	Remote Similarity	NPC469777
0.5259	Remote Similarity	NPC164389
0.5246	Remote Similarity	NPC114287
0.5238	Remote Similarity	NPC47995
0.5238	Remote Similarity	NPC469775
0.5235	Remote Similarity	NPC469774
0.5229	Remote Similarity	NPC47063
0.5194	Remote Similarity	NPC470876
0.5189	Remote Similarity	NPC187056
0.5189	Remote Similarity	NPC137917
0.5189	Remote Similarity	NPC606216
0.5189	Remote Similarity	NPC607023
0.5185	Remote Similarity	NPC480422
0.5182	Remote Similarity	NPC473481
0.5172	Remote Similarity	NPC287269
0.5169	Remote Similarity	NPC469822
0.5169	Remote Similarity	NPC257468
0.5161	Remote Similarity	NPC469772
0.5146	Remote Similarity	NPC473844
0.5143	Remote Similarity	NPC237503
0.5135	Remote Similarity	NPC1046
0.5132	Remote Similarity	NPC100925
0.5128	Remote Similarity	NPC473401
0.5124	Remote Similarity	NPC480473
0.5124	Remote Similarity	NPC470516
0.5124	Remote Similarity	NPC480474
0.5096	Remote Similarity	NPC167383
0.5096	Remote Similarity	NPC469773
0.5094	Remote Similarity	NPC37739
0.5088	Remote Similarity	NPC173583
0.5085	Remote Similarity	NPC258885
0.5082	Remote Similarity	NPC104137
0.5082	Remote Similarity	NPC26626
0.5079	Remote Similarity	NPC219180
0.5079	Remote Similarity	NPC251263
0.5076	Remote Similarity	NPC309223
0.5048	Remote Similarity	NPC46388
0.5043	Remote Similarity	NPC471548
0.5042	Remote Similarity	NPC146563
0.5039	Remote Similarity	NPC470517
0.5039	Remote Similarity	NPC471550

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC148417 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7544
0.1-0.2	1537
0.2-0.3	57
0.3-0.4	12
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data