NPASS Compound

Natural Product: NPC480473

Natural Product ID	NPC480473
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	MLMKXNMNIVAPBP-QLXNBZJSSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 143150 0 0 0 0 0 0 0 0999 V2000 3.2839 -3.3172 -2.0377 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8249 -1.9022 -1.6124 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0266 -1.0423 -2.8421 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3917 -2.0622 -1.2113 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5489 -2.5625 -2.3593 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8319 -2.9656 -1.8710 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5027 -1.7350 -1.1983 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.4300 -0.7521 -2.3353 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6465 -1.4922 -0.0220 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2051 -0.6892 1.0851 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6512 -0.8502 1.1397 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4871 -1.4417 0.3188 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9163 -1.4003 0.7175 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3415 -2.4517 1.6626 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8483 -2.4192 1.7621 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2023 -3.6687 2.6057 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5256 -2.6175 0.4485 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7339 -2.3040 -0.7638 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7805 -1.1680 -0.4850 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9406 -0.8458 -1.7051 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8965 -1.8924 -1.9900 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9335 -2.1036 -0.8696 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9223 -3.6355 -0.6733 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6436 0.0386 -0.3521 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8853 -0.0464 -0.4699 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0161 1.2570 -0.0918 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8331 2.3993 0.0374 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.5037 3.4652 -0.9769 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5431 4.5648 -0.7829 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7070 4.9762 0.6426 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5164 3.8887 1.6486 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8409 3.2729 2.0696 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6146 2.4373 3.1557 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5937 2.9321 1.2888 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8856 6.0546 0.9529 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7725 4.1405 -1.3250 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2561 4.0393 -0.7395 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3791 -1.2521 2.4888 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6897 -0.4064 2.9904 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7897 -1.0689 -0.3385 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8004 0.3701 -0.5792 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6350 -1.2058 0.9577 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0422 -0.8152 0.6691 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7190 -1.4936 -0.4673 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8222 -0.7352 -0.8565 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0340 -1.3179 -0.6328 C 0 0 2 0 0 0 0 0 0 0 0 0 7.0183 -0.6315 0.2242 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2501 -1.5678 0.2820 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9843 -2.9046 -0.3548 C 0 0 2 0 0 0 0 0 0 0 0 0 7.3738 -2.7927 -1.7020 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7158 -1.5786 -1.8411 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3888 -3.8247 0.5001 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5889 -1.8157 1.6109 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5118 0.5383 -0.3302 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4979 1.6240 0.5462 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9279 2.8566 -0.0489 C 0 0 1 0 0 0 0 0 0 0 0 0 7.9875 3.9378 -0.2618 C 0 0 2 0 0 0 0 0 0 0 0 0 8.6282 4.2085 1.1096 C 0 0 1 0 0 0 0 0 0 0 0 0 9.0693 2.8947 1.7174 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5463 2.6654 3.1042 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1745 1.5131 3.5947 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8507 1.8939 0.8210 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7115 5.0447 0.8457 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3201 5.1078 -0.6103 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1973 2.7142 -1.1973 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6954 3.4531 -1.1139 S 0 0 0 0 0 0 0 0 0 0 0 0 4.3475 3.9185 0.2499 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5943 4.6096 -2.0664 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5489 2.3284 -1.5945 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5006 -3.3924 -3.0987 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5749 -4.0991 -1.7049 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2345 -3.5937 -1.4875 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1104 -0.6454 -3.2724 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6984 -0.1827 -2.6610 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5347 -1.6022 -3.6841 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4171 -3.0261 -0.5840 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9320 -3.5548 -2.7375 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5516 -1.9555 -3.2645 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7210 -3.7628 -1.1501 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3526 -3.2186 -2.8144 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4376 -0.3575 -2.5538 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1470 0.0525 -2.3242 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6367 -1.3131 -3.3062 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4454 -2.5122 0.4673 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8779 0.3765 1.1019 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7416 -1.0648 2.0660 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1022 -0.3697 2.0690 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0839 -0.4520 1.3447 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9456 -2.2215 2.6767 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0728 -3.4852 1.4550 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2410 -4.5374 1.8931 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3830 -3.8992 3.3134 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1876 -3.5812 3.0624 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8691 -3.6982 0.3200 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4975 -2.0594 0.4096 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1978 -3.1955 -1.1720 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4273 -1.9225 -1.5569 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4809 0.1406 -1.5338 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6273 -0.7574 -2.5614 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4834 -1.6072 -2.9658 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4980 -2.8226 -2.2352 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2700 -3.9742 0.1071 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9847 -4.0014 -0.5761 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6544 -4.0695 -1.6472 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9051 2.1310 -0.0963 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6109 3.1186 -2.0187 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1439 5.4398 -1.3574 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7613 5.3628 0.7587 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1163 4.3809 2.5858 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4940 4.1115 2.4398 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3054 2.7237 1.2500 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2056 1.6194 3.0931 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8667 6.1367 1.9590 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4354 4.8526 -1.1308 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5732 3.3551 -0.4718 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4437 -1.1525 2.5748 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1882 0.8920 -0.6520 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3646 0.7234 -1.4619 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2476 1.0135 0.2504 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2471 -0.5416 1.7392 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5440 -2.2448 1.3379 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0996 0.2889 0.5755 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6074 -1.0176 1.6336 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1877 -2.4233 -0.0339 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8242 -2.3090 -0.1704 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6558 -0.4659 1.2608 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0977 -1.1300 -0.2872 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0257 -3.3408 -0.5274 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1223 -2.8548 -2.5223 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5908 -3.5960 -1.8225 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6727 -3.5980 1.4131 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8112 -1.7205 2.2146 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0190 1.2763 1.4839 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2338 3.3264 0.7125 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7636 3.6300 -0.9602 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9496 4.7508 1.7773 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1933 2.9658 1.8247 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4659 2.6757 3.2193 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9726 3.5027 3.7333 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6526 1.0107 2.8839 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5102 4.4982 0.6275 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9774 5.8572 -0.4649 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6544 2.7481 -1.4293 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 6 7 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 1 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 1 19 24 1 1 24 25 2 0 24 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 31 34 1 0 30 35 1 0 29 36 1 0 28 37 1 0 15 38 1 0 38 39 2 0 9 40 1 0 40 41 1 6 40 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 49 52 1 0 48 53 1 0 47 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 59 62 1 0 58 63 1 0 57 64 1 0 56 65 1 0 65 66 1 0 66 67 2 0 66 68 2 0 66 69 1 0 44 2 1 0 51 46 1 0 62 55 1 0 40 4 1 0 22 7 1 0 34 27 1 0 22 12 1 0 19 13 1 0 1 70 1 0 1 71 1 0 1 72 1 0 3 73 1 0 3 74 1 0 3 75 1 0 4 76 1 1 5 77 1 0 5 78 1 0 6 79 1 0 6 80 1 0 8 81 1 0 8 82 1 0 8 83 1 0 9 84 1 1 10 85 1 0 10 86 1 0 11 87 1 0 13 88 1 1 14 89 1 0 14 90 1 0 16 91 1 0 16 92 1 0 16 93 1 0 17 94 1 0 17 95 1 0 18 96 1 0 18 97 1 0 20 98 1 0 20 99 1 0 21100 1 0 21101 1 0 23102 1 0 23103 1 0 23104 1 0 27105 1 1 28106 1 6 29107 1 6 30108 1 6 31109 1 1 32110 1 0 32111 1 0 33112 1 0 35113 1 0 36114 1 0 37115 1 0 38116 1 0 41117 1 0 41118 1 0 41119 1 0 42120 1 0 42121 1 0 43122 1 0 43123 1 0 44124 1 1 46125 1 1 47126 1 1 48127 1 6 49128 1 6 50129 1 0 50130 1 0 52131 1 0 53132 1 0 55133 1 1 56134 1 1 57135 1 6 58136 1 1 59137 1 1 60138 1 0 60139 1 0 61140 1 0 63141 1 0 64142 1 0 69143 1 0 M END

Standard InCHIKey	MLMKXNMNIVAPBP-QLXNBZJSSA-N
Standard InCHI	InChI=1S/C47H74O21S/c1-42(2)27-9-12-46(6)28(8-7-22-23-17-43(3,21-50)13-15-47(23,16-14-45(22,46)5)41(58)67-38-35(57)33(55)31(53)25(18-48)63-38)44(27,4)11-10-29(42)65-39-36(30(52)24(51)20-62-39)66-40-37(68-69(59,60)61)34(56)32(54)26(19-49)64-40/h7,21,23-40,48-49,51-57H,8-20H2,1-6H3,(H,59,60,61)/t23-,24-,25+,26+,27-,28+,29-,30-,31+,32+,33-,34-,35+,36+,37+,38+,39+,40+,43-,44-,45+,46+,47-/m0/s1
SMILES	CC1(C)[C@@H]2CC[C@]3(C)[C@H](CC=C4[C@@H]5C[C@](C)(CC[C@@]5(CC[C@@]34C)C(=O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)C=O)[C@@]2(C)CC[C@@H]1O[C@@H]1[C@@H]([C@H]([C@H](CO1)O)O)O[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)OS(=O)(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1006.44	Volume:	948.211 ? Van der Waals volume.
Dense:	1.061	LogP:	-0.861 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.913 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.548 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	48.0
TPSA:	335.19 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	10.0	Rings:	8.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.042	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.553	Fsp³:	0.915
MCE-18:	180.556 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.982	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.003 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.243	Promiscuous compounds:	0.211

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.441	MDCK Permeability:	-5.074
Pgp-inhibitor:	0.0	Pgp-substrate:	0.025
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.06
20% Bioavailability (F20%):	0.285	30% Bioavailability (F30%):	0.992
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.015
Plasma Protein Binding (PPB):	52.48%	Volume Distribution (VD):	-0.632
Fu:	49.786% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.008
BSEP inhibitor:	0.235

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.992
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.86
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.01

Half-life (T1/2):

3.002

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.007
Human Hepatotoxicity (H-HT):	0.759	Drug-induced Liver Injury (DILI):	0.885
AMES Toxicity:	0.746	Rat Oral Acute Toxicity:	0.003
Maximum Recommended Daily Dose:	0.043	Skin Sensitization:	1.0
Carcinogencity:	0.062	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.003
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.684	Drug-induced Nephrotoxicity:	0.987
Genotoxicity:	0.993	RPMI-8226 Immunitoxicity:	0.083
A549 Cytotoxicity:	0.1	Hek293 Cytotoxicity:	0.148
BCF:	0.445 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.605 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.633 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.578 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40039	Atriplex tatarica	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[31181926]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	4
MBC	4
Inhibition	3

Activity Type	# Activity
Organism	11

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT3888	Organism	Micrococcus flavus	Micrococcus flavus	MIC	=	596400.0	nM	PMID[31181926]
NPT3888	Organism	Micrococcus flavus	Micrococcus flavus	MBC	=	1192.8	uM	PMID[31181926]
NPT564	Organism	Listeria monocytogenes	Listeria monocytogenes	MIC	=	1988100.0	nM	PMID[31181926]
NPT564	Organism	Listeria monocytogenes	Listeria monocytogenes	MBC	=	2485.1	uM	PMID[31181926]
NPT18	Organism	Pseudomonas aeruginosa	Pseudomonas aeruginosa	MIC	=	994000.0	nM	PMID[31181926]
NPT18	Organism	Pseudomonas aeruginosa	Pseudomonas aeruginosa	MBC	=	1192.8	uM	PMID[31181926]
NPT19	Organism	Escherichia coli	Escherichia coli	MIC	=	497000.0	nM	PMID[31181926]
NPT19	Organism	Escherichia coli	Escherichia coli	MBC	=	596.4	uM	PMID[31181926]
NPT18	Organism	Pseudomonas aeruginosa	Pseudomonas aeruginosa	Inhibition	=	56.6	%	PMID[31181926]
NPT18	Organism	Pseudomonas aeruginosa	Pseudomonas aeruginosa	Inhibition	=	45.9	%	PMID[31181926]
NPT18	Organism	Pseudomonas aeruginosa	Pseudomonas aeruginosa	Inhibition	=	7.2	%	PMID[31181926]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC480473 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21803
0.1-0.2	23737
0.2-0.3	3126
0.3-0.4	635
0.4-0.5	377
0.5-0.6	131
0.6-0.7	33
0.7-0.8	0
0.8-0.85	0
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.899	High Similarity	NPC480474
0.8571	High Similarity	NPC480475
0.7308	Intermediate Similarity	NPC112352
0.7103	Intermediate Similarity	NPC63159
0.7048	Intermediate Similarity	NPC469946
0.6847	Remote Similarity	NPC301449
0.6847	Remote Similarity	NPC601290
0.6726	Remote Similarity	NPC481078
0.6697	Remote Similarity	NPC251768
0.6667	Remote Similarity	NPC192791
0.6636	Remote Similarity	NPC475591
0.6636	Remote Similarity	NPC236870
0.6579	Remote Similarity	NPC187290
0.6538	Remote Similarity	NPC90856
0.6496	Remote Similarity	NPC79643
0.6455	Remote Similarity	NPC160415
0.6429	Remote Similarity	NPC297263
0.6387	Remote Similarity	NPC135904
0.6387	Remote Similarity	NPC123199
0.633	Remote Similarity	NPC157868
0.6262	Remote Similarity	NPC48499
0.625	Remote Similarity	NPC46665
0.6154	Remote Similarity	NPC31838
0.614	Remote Similarity	NPC222580
0.6134	Remote Similarity	NPC60557
0.6134	Remote Similarity	NPC67857
0.6106	Remote Similarity	NPC40775
0.6106	Remote Similarity	NPC159309
0.6106	Remote Similarity	NPC86222
0.608	Remote Similarity	NPC41061
0.608	Remote Similarity	NPC227551
0.6075	Remote Similarity	NPC214484
0.6066	Remote Similarity	NPC470218
0.6066	Remote Similarity	NPC471550
0.6033	Remote Similarity	NPC165204
0.6019	Remote Similarity	NPC78046
0.6	Remote Similarity	NPC475287
0.6	Remote Similarity	NPC475516
0.5984	Remote Similarity	NPC305981
0.5965	Remote Similarity	NPC10607
0.5946	Remote Similarity	NPC127056
0.5943	Remote Similarity	NPC128925
0.5938	Remote Similarity	NPC261506
0.5938	Remote Similarity	NPC4328
0.5935	Remote Similarity	NPC283417
0.5935	Remote Similarity	NPC200049
0.5929	Remote Similarity	NPC242840
0.5897	Remote Similarity	NPC281148
0.5897	Remote Similarity	NPC114484
0.5893	Remote Similarity	NPC39211
0.5877	Remote Similarity	NPC309714
0.5862	Remote Similarity	NPC31193
0.5862	Remote Similarity	NPC475504
0.5856	Remote Similarity	NPC235405
0.5847	Remote Similarity	NPC481079
0.5827	Remote Similarity	NPC258617
0.5804	Remote Similarity	NPC249848
0.5804	Remote Similarity	NPC107966
0.5798	Remote Similarity	NPC80986
0.5794	Remote Similarity	NPC57484
0.5789	Remote Similarity	NPC223301
0.5789	Remote Similarity	NPC171544
0.578	Remote Similarity	NPC204458
0.5752	Remote Similarity	NPC295371
0.5752	Remote Similarity	NPC473884
0.5739	Remote Similarity	NPC30735
0.5714	Remote Similarity	NPC4749
0.5702	Remote Similarity	NPC161674
0.5702	Remote Similarity	NPC80843
0.569	Remote Similarity	NPC11551
0.5669	Remote Similarity	NPC21691
0.5652	Remote Similarity	NPC75417
0.5641	Remote Similarity	NPC235438
0.563	Remote Similarity	NPC104372
0.5615	Remote Similarity	NPC236638
0.5615	Remote Similarity	NPC294453
0.5615	Remote Similarity	NPC481081
0.561	Remote Similarity	NPC76972
0.561	Remote Similarity	NPC469782
0.561	Remote Similarity	NPC204414
0.561	Remote Similarity	NPC268184
0.5596	Remote Similarity	NPC209894
0.5577	Remote Similarity	NPC167383
0.5556	Remote Similarity	NPC164389
0.5546	Remote Similarity	NPC64715
0.5538	Remote Similarity	NPC293330
0.5537	Remote Similarity	NPC160452
0.553	Remote Similarity	NPC70809
0.5526	Remote Similarity	NPC473373
0.5508	Remote Similarity	NPC68175
0.5492	Remote Similarity	NPC36831
0.5484	Remote Similarity	NPC313110
0.5472	Remote Similarity	NPC237503
0.5455	Remote Similarity	NPC298034
0.5455	Remote Similarity	NPC71065
0.5455	Remote Similarity	NPC324875
0.5455	Remote Similarity	NPC292677
0.5448	Remote Similarity	NPC250247
0.5439	Remote Similarity	NPC59804
0.5433	Remote Similarity	NPC191827
0.5431	Remote Similarity	NPC263756
0.5431	Remote Similarity	NPC213674
0.542	Remote Similarity	NPC43550
0.5417	Remote Similarity	NPC302887
0.541	Remote Similarity	NPC295823
0.541	Remote Similarity	NPC187618
0.541	Remote Similarity	NPC174720
0.541	Remote Similarity	NPC475467
0.5364	Remote Similarity	NPC256798
0.5349	Remote Similarity	NPC481080
0.5345	Remote Similarity	NPC488561
0.531	Remote Similarity	NPC164194
0.531	Remote Similarity	NPC1046
0.531	Remote Similarity	NPC29069
0.5304	Remote Similarity	NPC139894
0.5304	Remote Similarity	NPC56713
0.5294	Remote Similarity	NPC44716
0.5276	Remote Similarity	NPC284449
0.5267	Remote Similarity	NPC265841
0.5267	Remote Similarity	NPC488308
0.5267	Remote Similarity	NPC110633
0.5259	Remote Similarity	NPC58448
0.5242	Remote Similarity	NPC104137
0.5242	Remote Similarity	NPC475486
0.5242	Remote Similarity	NPC26626
0.5229	Remote Similarity	NPC68419
0.5227	Remote Similarity	NPC271610
0.5227	Remote Similarity	NPC312650
0.5221	Remote Similarity	NPC189884
0.5221	Remote Similarity	NPC269095
0.5221	Remote Similarity	NPC138334
0.52	Remote Similarity	NPC11242
0.52	Remote Similarity	NPC75287
0.5194	Remote Similarity	NPC475160
0.5194	Remote Similarity	NPC100639
0.5194	Remote Similarity	NPC473714
0.5191	Remote Similarity	NPC484061
0.5191	Remote Similarity	NPC484062
0.5169	Remote Similarity	NPC475171
0.5167	Remote Similarity	NPC148603
0.5149	Remote Similarity	NPC202828
0.5149	Remote Similarity	NPC119592
0.5128	Remote Similarity	NPC603546
0.5124	Remote Similarity	NPC148417
0.5116	Remote Similarity	NPC219180
0.5116	Remote Similarity	NPC251263
0.5111	Remote Similarity	NPC302543
0.5088	Remote Similarity	NPC473481
0.5086	Remote Similarity	NPC18233
0.5085	Remote Similarity	NPC470512
0.5082	Remote Similarity	NPC123796
0.5081	Remote Similarity	NPC218954
0.5081	Remote Similarity	NPC23275
0.5078	Remote Similarity	NPC151543
0.5076	Remote Similarity	NPC476068
0.5075	Remote Similarity	NPC484059
0.5075	Remote Similarity	NPC484060
0.507	Remote Similarity	NPC475368
0.5043	Remote Similarity	NPC25605
0.5042	Remote Similarity	NPC473343
0.5041	Remote Similarity	NPC79718
0.5041	Remote Similarity	NPC473459
0.5039	Remote Similarity	NPC475119
0.5039	Remote Similarity	NPC288205
0.5039	Remote Similarity	NPC51465
0.5038	Remote Similarity	NPC488560
0.5037	Remote Similarity	NPC136768
0.5036	Remote Similarity	NPC220160
0.5036	Remote Similarity	NPC488309

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC480473 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6726
0.1-0.2	2370
0.2-0.3	49
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data