NPASS Compound

Natural Product: NPC107966

Natural Product ID	NPC107966
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Araloside A Methyl Ester
IUPAC Name	methyl (2S,3S,4R,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-4,4,6a,6b,11,11,14b-heptamethyl-8a-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxyoxane-2-carboxylate
Synonyms	Araloside A Methyl Ester
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1288837
PubChem CID	52942130
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 142149 0 0 0 0 0 0 0 0999 V2000 -7.6445 3.1057 -0.1754 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4111 2.4199 0.3833 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3934 3.5431 0.4984 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7239 1.9791 1.7741 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8333 0.8968 2.2924 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6924 -0.2546 1.3410 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9018 -1.3589 1.9995 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6537 -1.7643 1.3032 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8521 -0.5785 0.9071 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3265 0.0439 2.1835 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6568 0.4150 0.1318 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9300 1.3606 -0.4872 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4725 1.4993 -0.4726 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7833 0.2650 -0.0059 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5861 0.0399 -0.5932 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6687 0.2843 -2.0463 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4947 1.1097 0.0479 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8989 0.9836 -0.4686 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4959 -0.3765 -0.2957 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5726 -1.5237 -0.4295 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7443 -2.2346 -1.7629 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0287 -2.5541 0.6296 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1462 -1.2420 -0.0772 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2630 -2.4363 -0.2721 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0202 -2.1755 0.4852 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6805 -0.9142 -0.0334 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2513 -1.2440 -1.3793 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4924 -0.4820 -1.2668 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7727 -0.4692 -0.7400 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5152 -1.6755 -1.2658 C 0 0 1 0 0 0 0 0 0 0 0 0 7.9591 -1.6722 -0.8621 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5765 -0.3303 -0.7129 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6458 0.8350 -0.7053 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2742 2.0518 -1.3062 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6826 2.6944 -2.2098 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5132 2.5398 -0.9210 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0717 3.6992 -1.5207 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4310 0.6409 -1.3115 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3305 -0.3145 0.4726 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6795 -0.1542 0.2660 C 0 0 2 0 0 0 0 0 0 0 0 0 11.4199 -1.3776 0.7837 C 0 0 1 0 0 0 0 0 0 0 0 0 12.8130 -0.8161 1.0279 C 0 0 2 0 0 0 0 0 0 0 0 0 12.5879 0.6590 0.8886 C 0 0 2 0 0 0 0 0 0 0 0 0 13.2919 1.4415 1.9990 C 0 0 0 0 0 0 0 0 0 0 0 0 14.6706 1.2759 1.9050 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2291 0.8640 1.0357 O 0 0 0 0 0 0 0 0 0 0 0 0 13.7088 -1.3107 0.0794 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8429 -1.8830 1.9368 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7215 -2.4822 -1.7123 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8721 -2.8528 -0.9499 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1023 0.2667 0.0683 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8924 1.3739 -0.5245 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0357 -0.8366 0.9975 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1636 -2.0804 1.1289 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1318 -0.1536 0.5600 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3683 -0.8069 0.2570 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.3754 -0.4288 1.3102 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.2249 0.6960 0.7885 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.9796 0.1802 -0.4140 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.1148 -0.6977 -1.2869 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.4250 -0.4114 -2.7550 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.7985 -0.5066 -2.9820 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7862 -0.6173 -1.0093 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.1436 -0.4292 -0.0181 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5421 1.8507 0.4965 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2481 -1.5283 1.4701 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3727 3.8980 -0.9073 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3015 3.4933 0.6021 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1678 2.3284 -0.7787 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8077 4.4066 1.0629 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9995 3.8570 -0.4960 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5154 3.1989 1.0906 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7682 1.6596 1.9229 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5959 2.8519 2.4846 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8604 1.3356 2.4921 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2519 0.5100 3.2379 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5297 -2.3017 2.0544 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7833 -1.0909 3.0749 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0393 -2.3353 2.0614 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8903 -2.4706 0.5118 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4409 -0.5244 2.5761 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1656 1.1325 2.1204 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0620 -0.0760 3.0357 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5068 2.0766 -1.0515 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0714 1.8752 -1.4495 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2420 2.3408 0.2499 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5619 0.4451 1.0999 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7282 1.4022 -2.2110 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6157 -0.0882 -2.4836 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1352 -0.0740 -2.6711 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4736 0.9793 1.1532 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1225 2.1114 -0.2016 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9002 1.2917 -1.5348 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5018 1.7510 0.0640 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0506 -0.3396 0.6900 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8209 -2.4480 -2.2913 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2532 -3.2338 -1.6552 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4236 -1.6596 -2.4487 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0295 -3.5768 0.2193 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0325 -2.3172 1.0031 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3615 -2.5324 1.5219 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1573 -1.1012 1.0544 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1063 -2.7660 -1.2923 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7620 -3.2817 0.2588 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7648 -2.1433 1.5489 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7070 -3.0160 0.2206 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2318 -1.7577 -1.2783 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4123 -0.4118 -2.0581 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6324 -1.9834 -1.9566 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7402 -0.3965 0.3478 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5085 -1.6092 -2.3923 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9922 -2.2012 0.1357 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2859 -0.2039 -1.5876 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4232 1.1239 0.3628 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9259 3.3746 -2.1563 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2884 4.2073 -2.1151 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3785 4.3783 -0.7174 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9472 -0.0619 -0.7992 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4463 -2.1686 0.0007 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1493 -1.1112 2.0462 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9586 0.9917 -0.1031 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8869 1.1016 2.9718 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0019 2.5179 1.8627 H 0 0 0 0 0 0 0 0 0 0 0 0 15.0835 1.0769 2.7909 H 0 0 0 0 0 0 0 0 0 0 0 0 14.2365 -2.0497 0.4678 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2461 -1.1932 2.3294 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6840 -2.0817 -2.6111 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3664 -3.5930 -1.3977 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2437 -0.6302 -0.6510 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8184 0.8989 -0.9930 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3772 1.7652 -1.4165 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2250 -1.9282 0.4106 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8886 -0.1779 2.2779 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0116 0.8726 1.5820 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2425 1.0724 -1.0281 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4479 -1.7422 -1.1088 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9509 -1.2147 -3.3709 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1115 0.6030 -3.0489 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2014 0.4059 -3.1256 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4825 0.1009 0.7642 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2003 2.2477 1.3412 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3116 -1.8315 2.3901 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 1 9 11 1 0 11 12 2 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 6 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 20 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 6 19 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 2 0 34 36 1 0 36 37 1 0 33 38 1 0 32 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 43 46 1 0 42 47 1 0 41 48 1 0 31 49 1 0 30 50 1 0 11 51 1 0 51 52 1 0 6 53 1 6 53 54 2 0 53 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 60 63 1 0 59 64 1 0 58 65 1 0 57 66 1 0 52 2 1 0 63 56 1 0 51 6 1 0 26 9 1 0 38 29 1 0 46 40 1 0 26 14 1 0 23 15 1 0 1 67 1 0 1 68 1 0 1 69 1 0 3 70 1 0 3 71 1 0 3 72 1 0 4 73 1 0 4 74 1 0 5 75 1 0 5 76 1 0 7 77 1 0 7 78 1 0 8 79 1 0 8 80 1 0 10 81 1 0 10 82 1 0 10 83 1 0 12 84 1 0 13 85 1 0 13 86 1 0 14 87 1 1 16 88 1 0 16 89 1 0 16 90 1 0 17 91 1 0 17 92 1 0 18 93 1 0 18 94 1 0 19 95 1 1 21 96 1 0 21 97 1 0 21 98 1 0 22 99 1 0 22100 1 0 22101 1 0 23102 1 1 24103 1 0 24104 1 0 25105 1 0 25106 1 0 27107 1 0 27108 1 0 27109 1 0 29110 1 1 30111 1 6 31112 1 1 32113 1 6 33114 1 1 37115 1 0 37116 1 0 37117 1 0 40118 1 6 41119 1 6 42120 1 1 43121 1 6 44122 1 0 44123 1 0 45124 1 0 47125 1 0 48126 1 0 49127 1 0 50128 1 0 51129 1 6 52130 1 0 52131 1 0 56132 1 6 57133 1 1 58134 1 1 59135 1 6 60136 1 1 61137 1 0 61138 1 0 62139 1 0 64140 1 0 65141 1 0 66142 1 0 M END

Standard InCHIKey	WJHDDPVZYYTSCO-PKVDZRLXSA-N
Standard InCHI	InChI=1S/C48H76O18/c1-43(2)15-17-48(42(59)66-40-34(56)31(53)29(51)24(20-49)62-40)18-16-46(6)22(23(48)19-43)9-10-27-45(5)13-12-28(44(3,4)26(45)11-14-47(27,46)7)63-41-35(57)32(54)36(37(65-41)38(58)60-8)64-39-33(55)30(52)25(21-50)61-39/h9,23-37,39-41,49-57H,10-21H2,1-8H3/t23-,24+,25-,26-,27+,28-,29+,30-,31-,32+,33+,34+,35+,36-,37-,39+,40-,41+,45-,46+,47+,48-/m0/s1
SMILES	CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@@]34C)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](C(=O)OC)O3)O[C@@H]3[C@@H]([C@H]([C@H](CO)O3)O)O)O)O)[C@@H]2C1)C(=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	940.5	Volume:	920.627 ? Van der Waals volume.
Dense:	1.022	LogP:	1.963 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.556 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.184 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	45.0
TPSA:	280.82 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	9.0	Rings:	8.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.088	GASA:	0.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.237	Fsp³:	0.917
MCE-18:	172.565 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.972	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.008 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.207	Promiscuous compounds:	0.124

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.343	MDCK Permeability:	-5.185
Pgp-inhibitor:	0.0	Pgp-substrate:	0.002
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.623
20% Bioavailability (F20%):	0.634	30% Bioavailability (F30%):	0.998
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.047	MRP1:	0.007
Plasma Protein Binding (PPB):	72.953%	Volume Distribution (VD):	-0.316
Fu:	20.268% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.013
BSEP inhibitor:	0.051

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.009
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.074 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.071

Half-life (T1/2):

3.817

ADMET: Toxicity

hERG Blockers:	0.013	hERG Blockers (10um):	0.064
Human Hepatotoxicity (H-HT):	0.668	Drug-induced Liver Injury (DILI):	0.886
AMES Toxicity:	0.673	Rat Oral Acute Toxicity:	0.005
Maximum Recommended Daily Dose:	0.01	Skin Sensitization:	1.0
Carcinogencity:	0.062	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.997
Hematotoxicity:	0.353	Drug-induced Nephrotoxicity:	0.978
Genotoxicity:	0.215	RPMI-8226 Immunitoxicity:	0.171
A549 Cytotoxicity:	0.176	Hek293 Cytotoxicity:	0.273
BCF:	1.521 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.267 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.1 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.148 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1994	Panax stipuleanatus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[20951582]
NPO1994	Panax stipuleanatus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	63440.0	nM	PMID[17254669]
NPT393	Cell line	HCT-116	Homo sapiens	IC50	>	100000.0	nM	PMID[10579870]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC107966 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20134
0.1-0.2	24837
0.2-0.3	3556
0.3-0.4	797
0.4-0.5	321
0.5-0.6	111
0.6-0.7	63
0.7-0.8	0
0.8-0.85	0
0.85-0.9	3
0.9-0.95	1
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC249848
0.9412	High Similarity	NPC235405
0.8889	High Similarity	NPC30735
0.8696	High Similarity	NPC235438
0.8506	High Similarity	NPC214484
0.7812	Intermediate Similarity	NPC10607
0.7789	Intermediate Similarity	NPC223301
0.7789	Intermediate Similarity	NPC171544
0.7717	Intermediate Similarity	NPC48499
0.7579	Intermediate Similarity	NPC39211
0.7553	Intermediate Similarity	NPC475516
0.75	Intermediate Similarity	NPC281148
0.7449	Intermediate Similarity	NPC40775
0.7396	Intermediate Similarity	NPC157868
0.7374	Intermediate Similarity	NPC475591
0.7374	Intermediate Similarity	NPC236870
0.7273	Intermediate Similarity	NPC159309
0.7273	Intermediate Similarity	NPC46665
0.7273	Intermediate Similarity	NPC86222
0.7129	Intermediate Similarity	NPC297263
0.71	Intermediate Similarity	NPC251768
0.7071	Intermediate Similarity	NPC192791
0.7071	Intermediate Similarity	NPC112352
0.7019	Intermediate Similarity	NPC80986
0.7	Intermediate Similarity	NPC237503
0.699	Remote Similarity	NPC104372
0.699	Remote Similarity	NPC114484
0.697	Remote Similarity	NPC469946
0.6966	Remote Similarity	NPC167383
0.6961	Remote Similarity	NPC222580
0.6952	Remote Similarity	NPC187290
0.6947	Remote Similarity	NPC90856
0.6863	Remote Similarity	NPC63159
0.6857	Remote Similarity	NPC295823
0.6857	Remote Similarity	NPC174720
0.6857	Remote Similarity	NPC475467
0.6818	Remote Similarity	NPC475160
0.6818	Remote Similarity	NPC473714
0.6727	Remote Similarity	NPC135904
0.67	Remote Similarity	NPC473884
0.6696	Remote Similarity	NPC481080
0.6637	Remote Similarity	NPC476068
0.6606	Remote Similarity	NPC475287
0.6604	Remote Similarity	NPC301449
0.6604	Remote Similarity	NPC601290
0.66	Remote Similarity	NPC473373
0.6569	Remote Similarity	NPC242840
0.6562	Remote Similarity	NPC209894
0.6535	Remote Similarity	NPC295371
0.6522	Remote Similarity	NPC258617
0.6481	Remote Similarity	NPC31838
0.6458	Remote Similarity	NPC128925
0.6455	Remote Similarity	NPC60557
0.6455	Remote Similarity	NPC67857
0.6449	Remote Similarity	NPC481079
0.6379	Remote Similarity	NPC41061
0.6379	Remote Similarity	NPC227551
0.6372	Remote Similarity	NPC470218
0.6364	Remote Similarity	NPC1046
0.6364	Remote Similarity	NPC29069
0.633	Remote Similarity	NPC481078
0.6325	Remote Similarity	NPC43550
0.6316	Remote Similarity	NPC488560
0.6286	Remote Similarity	NPC480475
0.6271	Remote Similarity	NPC305981
0.6263	Remote Similarity	NPC204458
0.625	Remote Similarity	NPC79643
0.6239	Remote Similarity	NPC241909
0.6226	Remote Similarity	NPC148417
0.6218	Remote Similarity	NPC261506
0.6218	Remote Similarity	NPC4328
0.6207	Remote Similarity	NPC57484
0.62	Remote Similarity	NPC78046
0.6134	Remote Similarity	NPC481081
0.6117	Remote Similarity	NPC58448
0.6117	Remote Similarity	NPC150400
0.6095	Remote Similarity	NPC75417
0.6087	Remote Similarity	NPC100639
0.6066	Remote Similarity	NPC250247
0.6042	Remote Similarity	NPC306746
0.6042	Remote Similarity	NPC199457
0.6038	Remote Similarity	NPC104071
0.6038	Remote Similarity	NPC309714
0.6	Remote Similarity	NPC263756
0.6	Remote Similarity	NPC161674
0.6	Remote Similarity	NPC76497
0.6	Remote Similarity	NPC213674
0.6	Remote Similarity	NPC123199
0.5981	Remote Similarity	NPC102439
0.5981	Remote Similarity	NPC2370
0.5979	Remote Similarity	NPC68419
0.5965	Remote Similarity	NPC192600
0.5926	Remote Similarity	NPC68175
0.5902	Remote Similarity	NPC70809
0.5893	Remote Similarity	NPC104137
0.5893	Remote Similarity	NPC26626
0.5877	Remote Similarity	NPC76972
0.5877	Remote Similarity	NPC469782
0.5877	Remote Similarity	NPC204414
0.5872	Remote Similarity	NPC475504
0.5868	Remote Similarity	NPC236638
0.5868	Remote Similarity	NPC294453
0.5849	Remote Similarity	NPC473343
0.5818	Remote Similarity	NPC64715
0.5804	Remote Similarity	NPC480473
0.5804	Remote Similarity	NPC480474
0.58	Remote Similarity	NPC256798
0.5794	Remote Similarity	NPC478066
0.5785	Remote Similarity	NPC65105
0.5747	Remote Similarity	NPC162107
0.5747	Remote Similarity	NPC46912
0.5741	Remote Similarity	NPC160415
0.5726	Remote Similarity	NPC155410
0.5714	Remote Similarity	NPC139894
0.5691	Remote Similarity	NPC298034
0.5691	Remote Similarity	NPC71065
0.5688	Remote Similarity	NPC164389
0.5688	Remote Similarity	NPC11551
0.5688	Remote Similarity	NPC473459
0.5684	Remote Similarity	NPC191763
0.566	Remote Similarity	NPC173583
0.5657	Remote Similarity	NPC604133
0.5631	Remote Similarity	NPC189884
0.5631	Remote Similarity	NPC138334
0.5596	Remote Similarity	NPC109588
0.5586	Remote Similarity	NPC31193
0.5574	Remote Similarity	NPC475514
0.5565	Remote Similarity	NPC11242
0.5556	Remote Similarity	NPC37739
0.5556	Remote Similarity	NPC606107
0.5545	Remote Similarity	NPC44716
0.5534	Remote Similarity	NPC47063
0.5528	Remote Similarity	NPC293330
0.5526	Remote Similarity	NPC96641
0.5526	Remote Similarity	NPC163183
0.551	Remote Similarity	NPC46388
0.5508	Remote Similarity	NPC165204
0.55	Remote Similarity	NPC137917
0.5481	Remote Similarity	NPC473481
0.5481	Remote Similarity	NPC269095
0.5455	Remote Similarity	NPC116794
0.5455	Remote Similarity	NPC85154
0.5455	Remote Similarity	NPC117714
0.5455	Remote Similarity	NPC30289
0.5417	Remote Similarity	NPC283417
0.5417	Remote Similarity	NPC471550
0.5417	Remote Similarity	NPC200049
0.5413	Remote Similarity	NPC475171
0.5405	Remote Similarity	NPC180550
0.5405	Remote Similarity	NPC35405
0.5391	Remote Similarity	NPC481030
0.5385	Remote Similarity	NPC161434
0.5366	Remote Similarity	NPC286457
0.536	Remote Similarity	NPC202828
0.536	Remote Similarity	NPC119592
0.5354	Remote Similarity	NPC224381
0.5354	Remote Similarity	NPC605954
0.5345	Remote Similarity	NPC36831
0.531	Remote Similarity	NPC609763
0.5306	Remote Similarity	NPC473844
0.5294	Remote Similarity	NPC123522
0.5294	Remote Similarity	NPC271138
0.5294	Remote Similarity	NPC31839
0.5294	Remote Similarity	NPC110139
0.5294	Remote Similarity	NPC108709
0.5285	Remote Similarity	NPC21691
0.5281	Remote Similarity	NPC246708
0.5278	Remote Similarity	NPC108748
0.5263	Remote Similarity	NPC475368
0.5246	Remote Similarity	NPC47995
0.5243	Remote Similarity	NPC220984
0.5234	Remote Similarity	NPC475208
0.5234	Remote Similarity	NPC220160
0.5203	Remote Similarity	NPC4749
0.52	Remote Similarity	NPC470876
0.5197	Remote Similarity	NPC302543
0.5196	Remote Similarity	NPC310014
0.5196	Remote Similarity	NPC269315
0.5182	Remote Similarity	NPC470512
0.5179	Remote Similarity	NPC605226
0.5165	Remote Similarity	NPC191965
0.5146	Remote Similarity	NPC102914
0.5139	Remote Similarity	NPC469776
0.5135	Remote Similarity	NPC22956
0.5133	Remote Similarity	NPC488526
0.513	Remote Similarity	NPC302887
0.5128	Remote Similarity	NPC160452
0.5124	Remote Similarity	NPC481031
0.5118	Remote Similarity	NPC136768
0.5102	Remote Similarity	NPC469778
0.5091	Remote Similarity	NPC109079
0.5083	Remote Similarity	NPC300419
0.5083	Remote Similarity	NPC268184
0.5076	Remote Similarity	NPC480422
0.5072	Remote Similarity	NPC472268
0.5049	Remote Similarity	NPC7870
0.5049	Remote Similarity	NPC75747
0.5042	Remote Similarity	NPC75287
0.5041	Remote Similarity	NPC191827

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC107966 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7321
0.1-0.2	1761
0.2-0.3	62
0.3-0.4	5
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data