NPASS Compound

Natural Product: NPC109079

Natural Product ID	NPC109079
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Anchusosid 2
IUPAC Name	(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2R,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3,4-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]oxan-2-yl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
Synonyms	anchusosid 2
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL500964
PubChem CID	21609765
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 144151 0 0 0 0 0 0 0 0999 V2000 -6.5980 0.3730 4.9960 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3334 -0.1261 4.7025 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9727 0.2446 3.3089 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7326 -0.2525 2.8930 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2874 0.4156 1.7495 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.1226 -0.0915 1.2118 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0019 0.7276 1.3847 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1083 0.1163 2.1588 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9747 -0.8653 1.4427 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4263 -0.4263 0.0631 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0054 1.0094 -0.0709 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4522 1.2925 0.1077 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4995 2.8349 0.2556 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3077 0.9603 -1.0562 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5138 1.6536 -1.3428 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0255 1.6565 -1.2019 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5941 0.2752 -1.0685 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9449 -0.4537 0.0569 C 0 0 2 0 0 0 0 0 0 0 0 0 3.5168 -1.8022 0.3198 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9717 -1.8298 0.1657 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6990 -0.8435 -0.3170 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0671 0.4121 -0.7538 C 0 0 2 0 0 0 0 0 0 0 0 0 5.3241 1.5481 0.2175 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8411 0.8071 -2.0243 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2570 1.1332 -1.5613 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9705 -0.1355 -1.1481 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1794 -1.0979 -0.3823 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6148 -1.4058 1.0209 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0193 -1.1318 1.3753 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2044 0.0869 2.2496 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5961 -2.3266 2.1328 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8677 -0.9235 0.1272 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2666 0.3204 -0.5071 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3930 -0.7839 -2.4456 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9982 -1.9265 -2.7829 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2441 -0.1279 -3.3184 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4562 -0.3962 -2.4064 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7979 -1.3429 -0.9361 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4040 0.5517 0.7273 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4523 -0.5353 1.0286 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0815 -0.0840 2.3400 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8440 1.0316 2.1146 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8440 -1.7548 1.1660 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2475 -2.6865 0.2805 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9792 -3.6495 1.1405 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7692 -4.3939 0.2774 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9445 -4.9652 0.9909 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7266 -5.7468 0.1323 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9886 -5.3484 -0.5576 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9635 -4.5099 -1.3287 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2544 -3.5469 -0.3902 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3290 -2.8660 -1.1639 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0378 -5.3581 -1.9573 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8580 -5.9131 -1.4944 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0097 1.7591 0.8500 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9783 2.5986 -0.2490 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0869 3.6634 -0.0238 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9360 4.3672 -1.1882 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.0305 5.5812 -0.9540 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5769 6.4231 0.0202 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2105 4.8802 -1.7632 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.3542 3.9299 -1.7926 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3515 3.0518 -0.5862 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0968 1.8623 -0.8462 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5450 4.6760 -1.7412 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9630 5.2534 -3.0936 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7369 0.5007 5.9687 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6392 0.4807 5.3705 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2399 -1.2008 4.9278 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8414 1.3607 3.2777 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0481 1.4403 2.1362 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4034 1.5841 2.0240 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3684 -0.4673 3.0081 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6810 0.9095 2.6826 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8174 -1.0952 2.1328 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4019 -1.8327 1.3891 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5246 1.5501 0.7506 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4205 3.2071 0.7316 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4118 3.0495 0.8695 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6890 3.2632 -0.7469 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7672 -0.0482 -1.0092 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1860 1.6766 -1.0150 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8520 1.1963 -2.0372 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1824 2.7044 -1.3396 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1682 1.1573 -2.2471 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4951 2.1787 -2.0866 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2405 2.3289 -0.3432 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2068 0.1492 0.9876 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3206 -2.1511 1.3801 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0526 -2.6175 -0.2903 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4538 -2.7856 0.4973 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5774 1.6418 1.0151 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2761 1.2854 0.7647 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3991 2.5308 -0.2821 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9594 -0.1144 -2.6412 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3947 1.6592 -2.5456 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7521 1.5508 -2.4908 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3254 1.9355 -0.8377 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2298 -2.1029 -0.9082 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9686 -0.7940 1.7229 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3611 -2.4539 1.3005 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3848 0.8245 2.1217 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2988 -0.2345 3.3059 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1563 0.5920 1.9788 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5788 -2.1509 3.2242 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6304 -2.5204 1.8240 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0044 -3.2385 1.8977 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9401 -0.8202 0.3465 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6300 -1.7774 -0.5306 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1059 1.1254 0.2275 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9492 0.6273 -1.3250 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6472 -0.6167 -4.1004 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4227 -0.3636 -2.8024 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0299 0.2502 -3.1349 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8785 -1.3987 -2.4483 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4657 -2.1096 -1.3625 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0526 -1.9298 -0.4744 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3283 -0.8497 -1.8068 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9758 0.3229 -0.2432 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2062 -0.4683 0.2465 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7032 -0.8601 2.7917 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9914 1.6186 2.8758 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0644 -2.3805 -0.4337 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1851 -3.6232 -0.4507 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7208 -5.4518 1.9474 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5968 -4.0841 1.2694 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6579 -5.6909 0.5204 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5133 -6.1699 -0.0059 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5196 -3.9944 -2.1291 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7350 -4.2367 0.3441 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4346 -3.2795 -0.9895 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9581 -6.2197 -1.4738 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1239 -6.8412 -1.2744 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5322 2.0449 -1.0939 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4438 3.7281 -1.9463 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0254 5.2956 -0.5895 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9541 6.1972 -1.8889 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1490 7.1244 -0.3621 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5435 5.8058 -1.2038 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3650 3.2708 -2.7032 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8930 3.5061 0.2736 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6440 2.0218 -1.6828 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6007 5.0089 -0.7879 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5937 4.4194 -3.5306 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 12 14 1 0 11 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 21 22 1 0 22 23 1 1 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 29 32 1 0 32 33 1 0 26 34 1 6 34 35 2 0 34 36 1 0 17 37 1 6 10 38 1 6 5 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 50 53 1 0 49 54 1 0 39 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 58 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 62 65 1 0 61 66 1 0 41 3 1 0 51 44 1 0 63 56 1 0 12 7 1 0 22 17 1 0 33 26 1 0 18 10 1 0 27 21 1 0 1 67 1 0 2 68 1 0 2 69 1 0 3 70 1 1 5 71 1 1 7 72 1 1 8 73 1 0 8 74 1 0 9 75 1 0 9 76 1 0 11 77 1 1 13 78 1 0 13 79 1 0 13 80 1 0 14 81 1 0 14 82 1 0 14 83 1 0 15 84 1 0 15 85 1 0 16 86 1 0 16 87 1 0 18 88 1 1 19 89 1 0 19 90 1 0 20 91 1 0 23 92 1 0 23 93 1 0 23 94 1 0 24 95 1 0 24 96 1 0 25 97 1 0 25 98 1 0 27 99 1 6 28100 1 0 28101 1 0 30102 1 0 30103 1 0 30104 1 0 31105 1 0 31106 1 0 31107 1 0 32108 1 0 32109 1 0 33110 1 0 33111 1 0 36112 1 0 37113 1 0 37114 1 0 37115 1 0 38116 1 0 38117 1 0 38118 1 0 39119 1 6 40120 1 6 41121 1 1 42122 1 0 44123 1 6 46124 1 6 47125 1 0 47126 1 0 48127 1 0 49128 1 1 50129 1 6 51130 1 1 52131 1 0 53132 1 0 54133 1 0 56134 1 6 58135 1 6 59136 1 0 59137 1 0 60138 1 0 61139 1 1 62140 1 6 63141 1 1 64142 1 0 65143 1 0 66144 1 0 M END

Standard InCHIKey	OGKRHYLZKFTGGO-RWKYVBNUSA-N
Standard InCHI	InChI=1S/C48H78O18/c1-43(2)14-16-48(42(59)60)17-15-46(6)22(23(48)18-43)8-9-28-45(5)12-11-29(44(3,4)27(45)10-13-47(28,46)7)64-41-38(66-40-36(58)34(56)31(53)25(20-50)62-40)37(32(54)26(21-51)63-41)65-39-35(57)33(55)30(52)24(19-49)61-39/h8,23-41,49-58H,9-21H2,1-7H3,(H,59,60)/t23-,24+,25+,26+,27-,28+,29-,30+,31+,32+,33-,34-,35+,36+,37-,38+,39-,40-,41-,45-,46+,47+,48-/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)CC2)C(=O)O)C)C)[C@@H]([C@H]([C@@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	942.52	Volume:	923.263 ? Van der Waals volume.
Dense:	1.021	LogP:	1.064 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.948 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.581 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	45.0
TPSA:	294.98 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	11.0	Rings:	8.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.106	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.239	Fsp³:	0.938
MCE-18:	173.419 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.916	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.237	Promiscuous compounds:	0.148

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.358	MDCK Permeability:	-5.182
Pgp-inhibitor:	0.0	Pgp-substrate:	0.002
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.282
20% Bioavailability (F20%):	0.024	30% Bioavailability (F30%):	0.937
50% Bioavailability (F50%):	0.988

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.14
Plasma Protein Binding (PPB):	75.848%	Volume Distribution (VD):	-0.514
Fu:	16.074% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.022	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.136	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.024 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.088

Half-life (T1/2):

3.201

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.847	Drug-induced Liver Injury (DILI):	0.971
AMES Toxicity:	0.931	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.304	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.741	Drug-induced Nephrotoxicity:	0.995
Genotoxicity:	0.304	RPMI-8226 Immunitoxicity:	0.07
A549 Cytotoxicity:	0.477	Hek293 Cytotoxicity:	0.102
BCF:	0.812 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.403 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.816 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.929 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29483	Swartzia schomburgkii	Species	Fabaceae	Eukaryota	n.a.	suriname rainforest	n.a.	PMID[11087583]
NPO29483	Swartzia schomburgkii	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC12	3

Activity Type	# Activity
Organism	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	IC12	=	120.0	ug ml-1	PMID[23910596]
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	IC12	=	200.0	ug ml-1	PMID[15921404]
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	IC12	=	270.0	ug ml-1	PMID[21616566]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC109079 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23243
0.1-0.2	22132
0.2-0.3	3018
0.3-0.4	857
0.4-0.5	432
0.5-0.6	104
0.6-0.7	37
0.7-0.8	0
0.8-0.85	4
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9121	High Similarity	NPC79718
0.8462	Intermediate Similarity	NPC22956
0.8333	Intermediate Similarity	NPC606107
0.8202	Intermediate Similarity	NPC164194
0.8081	Intermediate Similarity	NPC62725
0.7895	Intermediate Similarity	NPC114304
0.7849	Intermediate Similarity	NPC127056
0.7742	Intermediate Similarity	NPC25605
0.7586	Intermediate Similarity	NPC204407
0.7579	Intermediate Similarity	NPC472949
0.7353	Intermediate Similarity	NPC488564
0.73	Intermediate Similarity	NPC257468
0.7255	Intermediate Similarity	NPC324875
0.7255	Intermediate Similarity	NPC292677
0.7234	Intermediate Similarity	NPC270667
0.7216	Intermediate Similarity	NPC488561
0.7188	Intermediate Similarity	NPC59804
0.71	Intermediate Similarity	NPC180550
0.71	Intermediate Similarity	NPC35405
0.7083	Intermediate Similarity	NPC12288
0.7037	Intermediate Similarity	NPC251263
0.7021	Intermediate Similarity	NPC191410
0.701	Intermediate Similarity	NPC56713
0.6957	Remote Similarity	NPC31839
0.6893	Remote Similarity	NPC119794
0.68	Remote Similarity	NPC213674
0.6757	Remote Similarity	NPC54636
0.6739	Remote Similarity	NPC283849
0.6735	Remote Similarity	NPC136877
0.6727	Remote Similarity	NPC219180
0.6699	Remote Similarity	NPC139044
0.6667	Remote Similarity	NPC276093
0.6634	Remote Similarity	NPC80843
0.6596	Remote Similarity	NPC286347
0.6577	Remote Similarity	NPC166422
0.6574	Remote Similarity	NPC480939
0.65	Remote Similarity	NPC174679
0.65	Remote Similarity	NPC279554
0.6486	Remote Similarity	NPC133818
0.6449	Remote Similarity	NPC323359
0.6442	Remote Similarity	NPC104400
0.6442	Remote Similarity	NPC10320
0.6436	Remote Similarity	NPC114441
0.6429	Remote Similarity	NPC475472
0.6346	Remote Similarity	NPC30289
0.6321	Remote Similarity	NPC481082
0.6321	Remote Similarity	NPC164419
0.625	Remote Similarity	NPC469945
0.6211	Remote Similarity	NPC28198
0.6211	Remote Similarity	NPC476123
0.619	Remote Similarity	NPC480947
0.6186	Remote Similarity	NPC161717
0.6182	Remote Similarity	NPC475486
0.6132	Remote Similarity	NPC44716
0.6075	Remote Similarity	NPC475591
0.6075	Remote Similarity	NPC236870
0.6075	Remote Similarity	NPC471383
0.6053	Remote Similarity	NPC323341
0.6042	Remote Similarity	NPC57362
0.6019	Remote Similarity	NPC73829
0.5981	Remote Similarity	NPC10607
0.5981	Remote Similarity	NPC2370
0.5963	Remote Similarity	NPC302887
0.5946	Remote Similarity	NPC488209
0.5929	Remote Similarity	NPC288205
0.5929	Remote Similarity	NPC51465
0.5917	Remote Similarity	NPC471385
0.5905	Remote Similarity	NPC6377
0.5905	Remote Similarity	NPC208381
0.5888	Remote Similarity	NPC605226
0.5882	Remote Similarity	NPC76999
0.5859	Remote Similarity	NPC100383
0.5856	Remote Similarity	NPC23275
0.5849	Remote Similarity	NPC263756
0.5843	Remote Similarity	NPC120840
0.5841	Remote Similarity	NPC280941
0.5841	Remote Similarity	NPC235772
0.5804	Remote Similarity	NPC160452
0.5789	Remote Similarity	NPC476992
0.5755	Remote Similarity	NPC603026
0.5752	Remote Similarity	NPC469947
0.5752	Remote Similarity	NPC480948
0.5752	Remote Similarity	NPC187290
0.5743	Remote Similarity	NPC294112
0.5743	Remote Similarity	NPC475633
0.5743	Remote Similarity	NPC284807
0.5738	Remote Similarity	NPC111466
0.57	Remote Similarity	NPC242611
0.5664	Remote Similarity	NPC80986
0.5648	Remote Similarity	NPC256133
0.5631	Remote Similarity	NPC473481
0.5607	Remote Similarity	NPC488516
0.5588	Remote Similarity	NPC473538
0.5545	Remote Similarity	NPC46665
0.5536	Remote Similarity	NPC488515
0.5508	Remote Similarity	NPC471384
0.5506	Remote Similarity	NPC480946
0.5506	Remote Similarity	NPC130577
0.5506	Remote Similarity	NPC142415
0.5506	Remote Similarity	NPC102683
0.5505	Remote Similarity	NPC192791
0.5455	Remote Similarity	NPC117714
0.5444	Remote Similarity	NPC270768
0.5444	Remote Similarity	NPC59263
0.5444	Remote Similarity	NPC210106
0.5421	Remote Similarity	NPC108748
0.5405	Remote Similarity	NPC251768
0.5385	Remote Similarity	NPC25998
0.5372	Remote Similarity	NPC47995
0.5351	Remote Similarity	NPC281148
0.5339	Remote Similarity	NPC609119
0.5333	Remote Similarity	NPC40085
0.5333	Remote Similarity	NPC480938
0.5328	Remote Similarity	NPC181066
0.5304	Remote Similarity	NPC291903
0.5294	Remote Similarity	NPC151543
0.5275	Remote Similarity	NPC275809
0.5273	Remote Similarity	NPC161674
0.5268	Remote Similarity	NPC40775
0.5268	Remote Similarity	NPC473383
0.5254	Remote Similarity	NPC475119
0.5221	Remote Similarity	NPC258885
0.5217	Remote Similarity	NPC231063
0.5217	Remote Similarity	NPC282395
0.5217	Remote Similarity	NPC158141
0.5217	Remote Similarity	NPC110308
0.5214	Remote Similarity	NPC329976
0.5197	Remote Similarity	NPC302543
0.5189	Remote Similarity	NPC475611
0.5182	Remote Similarity	NPC157868
0.5172	Remote Similarity	NPC75318
0.5169	Remote Similarity	NPC605294
0.5164	Remote Similarity	NPC283417
0.5164	Remote Similarity	NPC200049
0.5164	Remote Similarity	NPC602995
0.5161	Remote Similarity	NPC484061
0.5161	Remote Similarity	NPC484062
0.5161	Remote Similarity	NPC298554
0.5158	Remote Similarity	NPC296164
0.5149	Remote Similarity	NPC274507
0.5145	Remote Similarity	NPC264270
0.5138	Remote Similarity	NPC235405
0.5133	Remote Similarity	NPC159309
0.5133	Remote Similarity	NPC86222
0.513	Remote Similarity	NPC64715
0.5109	Remote Similarity	NPC84319
0.5109	Remote Similarity	NPC52021
0.5109	Remote Similarity	NPC599947
0.5104	Remote Similarity	NPC96580
0.5091	Remote Similarity	NPC249848
0.5091	Remote Similarity	NPC107966
0.5089	Remote Similarity	NPC112352
0.5089	Remote Similarity	NPC478066
0.5088	Remote Similarity	NPC68175
0.5083	Remote Similarity	NPC473824
0.5081	Remote Similarity	NPC329828
0.5081	Remote Similarity	NPC488211
0.5047	Remote Similarity	NPC214484
0.5043	Remote Similarity	NPC301449
0.5043	Remote Similarity	NPC601290
0.5042	Remote Similarity	NPC480936
0.5041	Remote Similarity	NPC475140
0.5039	Remote Similarity	NPC484059
0.5039	Remote Similarity	NPC484060

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC109079 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6926
0.1-0.2	2144
0.2-0.3	71
0.3-0.4	8
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data