NPASS Compound

Natural Product: NPC40085

Natural Product ID	NPC40085
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Pachyelaside D
IUPAC Name	(3S,4aR,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4S,5R,6R)-4-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-3-[(E)-3-phenylprop-2-enoyl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2252209
PubChem CID	76311927
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 199209 0 0 0 0 0 0 0 0999 V2000 -0.1759 -4.2762 -1.1693 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8663 -5.1156 -0.3274 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0920 -4.4355 0.3027 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7521 -3.3527 1.0453 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7544 -2.1277 0.4525 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6657 -1.8334 -0.3451 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1091 -0.7708 0.1111 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4223 -1.3141 0.6548 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3529 -1.6675 -0.4482 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7526 -0.4541 -1.3020 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8300 0.6534 -0.9056 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3726 0.2920 -0.8962 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2129 0.0369 -2.2483 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3381 1.5607 -0.3724 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1291 1.9602 -1.5712 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4939 2.3975 -1.0735 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5291 1.3250 -1.3028 C 0 0 2 0 0 0 0 0 0 0 0 0 4.1169 -0.0130 -0.8034 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1887 -1.0120 -0.8386 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4921 -0.4231 -1.2396 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8445 0.8571 -1.1140 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7731 1.7244 -0.5003 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5964 1.4650 0.9720 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1258 3.1537 -0.6767 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4860 3.4654 -0.1636 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5807 2.5565 -0.6341 C 0 0 2 0 0 0 0 0 0 0 0 0 8.0922 1.4610 -1.5376 C 0 0 1 0 0 0 0 0 0 0 0 0 9.1956 0.5519 -1.9653 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1693 0.1077 -0.9474 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5745 -0.0124 -1.5847 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8296 -1.3201 -0.5530 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2855 0.9176 0.2838 C 0 0 2 0 0 0 0 0 0 0 0 0 9.2661 1.9434 0.5362 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5697 1.5112 0.3324 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5471 1.2647 1.2493 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2936 0.4242 2.1624 O 0 0 0 0 0 0 0 0 0 0 0 0 13.8539 1.9319 1.2030 C 0 0 0 0 0 0 0 0 0 0 0 0 14.8167 1.7178 2.0614 C 0 0 0 0 0 0 0 0 0 0 0 0 16.1085 2.3527 2.0461 C 0 0 0 0 0 0 0 0 0 0 0 0 17.0512 2.0462 3.0084 C 0 0 0 0 0 0 0 0 0 0 0 0 18.2971 2.6334 3.0213 C 0 0 0 0 0 0 0 0 0 0 0 0 18.6678 3.5489 2.0848 C 0 0 0 0 0 0 0 0 0 0 0 0 17.7323 3.8784 1.0984 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4744 3.2723 1.1021 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5283 3.3982 -1.4447 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7008 3.5029 -1.0868 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0520 4.0261 -2.5633 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8317 1.3222 -2.7605 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6970 -0.8974 -2.7108 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0742 -1.7970 -0.2196 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6868 -2.9180 -0.9692 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2004 -4.2868 -0.6798 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3275 -5.0720 -0.3050 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5665 -6.0763 -1.2047 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8411 -6.0907 -1.7514 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7896 -7.0546 -2.7867 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6904 -8.4552 -2.2301 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5463 -8.3494 -0.7312 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3906 -7.3997 -0.4514 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2050 -8.0186 -0.8133 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7056 -7.8982 -0.1095 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5458 -9.1280 -2.6972 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5371 -2.6362 -2.3479 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9981 -1.3563 0.7582 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3711 -0.0371 0.5911 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7999 0.6925 1.6438 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2700 0.3580 2.8867 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3985 -0.6849 3.5470 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9020 -1.0042 4.8200 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6841 -0.1838 2.8466 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.4959 0.5134 1.7703 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8442 0.1894 0.4460 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0585 1.2079 -0.4835 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7973 0.0836 1.7528 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7211 1.0905 1.9267 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.3353 0.9063 3.1486 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1719 -0.1628 3.2655 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.4780 -1.4813 3.5522 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4693 -2.4518 3.6434 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1386 -0.3704 2.1455 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.6272 -0.0284 0.7852 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.7531 1.2192 0.8471 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.5808 2.2790 1.2248 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7059 3.2661 0.2490 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.0144 4.4301 0.6530 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7486 5.0991 -0.5628 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7443 6.1952 -0.4244 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1911 7.1576 0.4799 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0232 5.6332 -1.1442 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.1945 4.7270 -1.0731 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.1061 3.6149 -0.0692 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.7826 2.4915 -0.5622 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.3410 5.5213 -0.8350 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7714 5.9637 -2.4846 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0019 -1.0769 0.1329 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.3089 0.3757 2.3842 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2594 0.0692 4.0881 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7604 -4.5705 -1.2936 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2333 -5.5143 0.5179 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1761 -6.0099 -0.9048 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4468 -5.2186 1.0517 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6975 -1.3818 1.3074 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4135 -0.3898 1.0457 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1377 -2.2958 1.1355 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8414 -0.7154 1.4680 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2473 -2.1325 0.0123 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8820 -2.4616 -1.0653 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0742 0.8495 0.1874 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3150 0.2886 -2.1812 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1779 0.7978 -2.9539 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1631 -0.9921 -2.6021 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5678 2.2406 -1.2172 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2477 2.0545 0.4178 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3204 1.2873 0.0628 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0059 1.9884 -2.6459 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4079 2.7092 -1.1334 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3840 2.7180 -0.0343 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7859 3.2801 -1.6753 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8997 0.1375 0.3079 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0226 -1.8615 -1.5400 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3890 -1.5265 0.1425 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2697 -1.0525 -1.6927 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2196 2.1971 1.5733 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9827 0.4799 1.2960 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5663 1.6895 1.3309 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4093 3.7457 -0.0321 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0201 3.5785 -1.6747 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5444 3.5745 0.9608 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6868 4.5326 -0.4956 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8010 2.0537 -2.4907 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7813 -0.2280 -2.6295 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8095 1.1738 -2.7102 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1094 0.9389 -1.5187 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4279 -0.3389 -2.6339 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1770 -0.7777 -1.0899 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9532 -1.2957 0.1557 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6974 -1.8204 -0.0499 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5007 -1.9284 -1.4145 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2914 0.2314 1.1900 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6847 2.8178 1.1275 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4724 1.5542 1.2280 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0119 2.6392 0.4061 H 0 0 0 0 0 0 0 0 0 0 0 0 14.5897 0.9860 2.8499 H 0 0 0 0 0 0 0 0 0 0 0 0 16.8336 1.3266 3.7874 H 0 0 0 0 0 0 0 0 0 0 0 0 19.0203 2.3602 3.8048 H 0 0 0 0 0 0 0 0 0 0 0 0 19.6252 4.0478 2.0322 H 0 0 0 0 0 0 0 0 0 0 0 0 17.9890 4.5958 0.3445 H 0 0 0 0 0 0 0 0 0 0 0 0 15.8099 3.5731 0.3173 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6211 4.5536 -3.2146 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8787 1.5558 -3.3180 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4789 2.2034 -3.0553 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3346 0.4560 -3.1708 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0701 -1.8361 -2.8240 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6853 -1.2459 -3.1162 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2839 -0.2091 -3.4448 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9115 -0.9271 -0.8860 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8056 -2.8877 -0.7692 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8239 -4.7300 -1.6635 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8066 -6.0373 -2.0145 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8309 -6.8417 -3.3186 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6200 -6.9699 -3.4903 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5538 -9.0786 -2.5302 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2308 -9.3325 -0.3098 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3718 -7.2405 0.6485 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9654 -8.6598 -0.0862 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5079 -8.3169 -0.4796 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4719 -9.9319 -2.0954 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2369 -3.1378 -2.8355 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8652 0.3533 -0.3217 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2363 1.2828 3.5046 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3455 -0.3573 3.5798 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4895 -1.6379 2.9713 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1157 -0.1971 5.3411 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6692 -1.2681 2.6835 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3861 1.6074 1.9240 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2788 -0.7467 -0.0054 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9286 0.8968 -1.4047 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2154 2.0983 2.0158 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8055 0.0386 4.1811 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7763 -1.7836 2.7589 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9763 -1.4648 4.5644 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3101 -3.1589 2.9927 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4368 -1.4412 2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5373 0.2024 0.1595 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3654 1.4187 -0.1546 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1598 2.9195 -0.6464 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3098 4.2962 -1.2252 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6928 6.7327 -1.4150 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7470 5.8014 -0.1888 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6541 7.9806 0.4030 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2441 6.5896 -0.6169 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3892 4.2625 -2.0857 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6234 3.9123 0.8800 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.6203 2.3211 -0.0532 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0524 6.2526 -0.2019 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3355 6.7479 -2.7419 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1101 -1.2955 0.4446 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0580 -0.2193 2.6407 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4735 -0.7671 4.5782 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 12 14 1 0 11 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 21 22 1 0 22 23 1 1 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 29 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 35 36 2 0 35 37 1 0 37 38 2 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 2 0 42 43 1 0 43 44 2 0 26 45 1 6 45 46 2 0 45 47 1 0 17 48 1 6 10 49 1 6 5 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 58 61 1 0 57 62 1 0 51 63 1 0 50 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 67 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 71 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 78 79 1 0 77 80 1 0 80 81 1 0 81 82 1 0 82 83 1 0 83 84 1 0 84 85 1 0 85 86 1 0 86 87 1 0 87 88 1 0 86 89 1 0 89 90 1 0 90 91 1 0 91 92 1 0 90 93 1 0 89 94 1 0 81 95 1 0 80 96 1 0 70 97 1 0 52 3 1 0 59 54 1 0 72 65 1 0 82 75 1 0 91 84 1 0 12 7 1 0 22 17 1 0 33 26 1 0 44 39 1 0 18 10 1 0 27 21 1 0 1 98 1 0 2 99 1 0 2100 1 0 3101 1 1 5102 1 1 7103 1 1 8104 1 0 8105 1 0 9106 1 0 9107 1 0 11108 1 1 13109 1 0 13110 1 0 13111 1 0 14112 1 0 14113 1 0 14114 1 0 15115 1 0 15116 1 0 16117 1 0 16118 1 0 18119 1 1 19120 1 0 19121 1 0 20122 1 0 23123 1 0 23124 1 0 23125 1 0 24126 1 0 24127 1 0 25128 1 0 25129 1 0 27130 1 6 28131 1 0 28132 1 0 30133 1 0 30134 1 0 30135 1 0 31136 1 0 31137 1 0 31138 1 0 32139 1 1 33140 1 0 33141 1 0 37142 1 0 38143 1 0 40144 1 0 41145 1 0 42146 1 0 43147 1 0 44148 1 0 47149 1 0 48150 1 0 48151 1 0 48152 1 0 49153 1 0 49154 1 0 49155 1 0 50156 1 6 51157 1 1 52158 1 6 54159 1 6 56160 1 0 56161 1 0 57162 1 1 58163 1 1 59164 1 1 60165 1 0 61166 1 0 62167 1 0 63168 1 0 65169 1 6 67170 1 1 68171 1 0 68172 1 0 69173 1 0 70174 1 6 71175 1 1 72176 1 6 73177 1 0 75178 1 1 77179 1 1 78180 1 0 78181 1 0 79182 1 0 80183 1 6 81184 1 6 82185 1 6 84186 1 6 86187 1 6 87188 1 0 87189 1 0 88190 1 0 89191 1 1 90192 1 6 91193 1 1 92194 1 0 93195 1 0 94196 1 0 95197 1 0 96198 1 0 97199 1 0 M END

Standard InCHIKey	VNNUFEHEJUQXMG-FRMOVGHQSA-N
Standard InCHI	InChI=1S/C68H102O29/c1-63(2)23-32-31-14-15-39-65(5)19-18-40(64(3,4)38(65)17-20-67(39,7)66(31,6)21-22-68(32,62(85)86)24-41(63)92-42(74)16-13-30-11-9-8-10-12-30)93-60-56(51(83)53(37(28-72)91-60)94-57-49(81)43(75)33(73)29-87-57)97-59-52(84)54(46(78)36(27-71)89-59)95-61-55(48(80)45(77)35(26-70)90-61)96-58-50(82)47(79)44(76)34(25-69)88-58/h8-14,16,32-41,43-61,69-73,75-84H,15,17-29H2,1-7H3,(H,85,86)/b16-13+/t32-,33+,34+,35+,36+,37+,38-,39+,40-,41-,43-,44+,45+,46+,47-,48-,49+,50+,51-,52+,53+,54-,55+,56+,57-,58-,59-,60-,61-,65-,66+,67+,68+/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)[C@H](C2)OC(=O)/C=C/c2ccccc2)C(=O)O)C)C)[C@@H]([C@H]([C@@H]1O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1382.65	Volume:	1327.024 ? Van der Waals volume.
Dense:	1.042	LogP:	0.722 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.935 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.681 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	19.0	Rigid Bonds:	65.0
TPSA:	459.35 ? Topological Polar Surface Area.	H-Bond Acceptor:	29.0
H-Bond Donor:	16.0	Rings:	11.0
Heavy Atoms:	29.0

MedChem Properties

QED Drug-Likeness Score:	0.033	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.597	Fsp³:	0.824
MCE-18:	312.968 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.932	Fluc inhibitor:	0.313 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.06 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.082 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.308	Promiscuous compounds:	0.021

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.203	MDCK Permeability:	-5.095
Pgp-inhibitor:	0.0	Pgp-substrate:	0.258
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.745
20% Bioavailability (F20%):	0.056	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	0.998

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.022
Plasma Protein Binding (PPB):	70.123%	Volume Distribution (VD):	-0.513
Fu:	20.299% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.001
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.992

Half-life (T1/2):

4.349

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.875	Drug-induced Liver Injury (DILI):	0.997
AMES Toxicity:	0.985	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.013	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.737	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.255	RPMI-8226 Immunitoxicity:	0.155
A549 Cytotoxicity:	0.81	Hek293 Cytotoxicity:	0.227
BCF:	0.427 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.406 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.155 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.986 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO5418	Pachyelasma tessmannii	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[15686409]
NPO5418	Pachyelasma tessmannii	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference
-	Biomphalaria glabrata	LD50	=	8.0	ug ml-1	PMID[20329739]

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC40085 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	17659
0.1-0.2	27725
0.2-0.3	3208
0.3-0.4	819
0.4-0.5	383
0.5-0.6	52
0.6-0.7	3
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.938	High Similarity	NPC264270
0.879	High Similarity	NPC111466
0.791	Intermediate Similarity	NPC488210
0.7273	Intermediate Similarity	NPC488211
0.7101	Intermediate Similarity	NPC488212
0.6357	Remote Similarity	NPC114304
0.6124	Remote Similarity	NPC488561
0.6071	Remote Similarity	NPC166422
0.5957	Remote Similarity	NPC251263
0.5926	Remote Similarity	NPC79718
0.5894	Remote Similarity	NPC120667
0.5894	Remote Similarity	NPC278272
0.5839	Remote Similarity	NPC324875
0.5839	Remote Similarity	NPC292677
0.5822	Remote Similarity	NPC475513
0.5782	Remote Similarity	NPC471385
0.5775	Remote Similarity	NPC471384
0.5764	Remote Similarity	NPC54636
0.5736	Remote Similarity	NPC164194
0.5683	Remote Similarity	NPC488209
0.5664	Remote Similarity	NPC323341
0.5625	Remote Similarity	NPC219180
0.562	Remote Similarity	NPC481082
0.562	Remote Similarity	NPC164419
0.5615	Remote Similarity	NPC488215
0.5606	Remote Similarity	NPC25605
0.5602	Remote Similarity	NPC482013
0.5564	Remote Similarity	NPC127056
0.5556	Remote Similarity	NPC133818
0.5556	Remote Similarity	NPC469945
0.5467	Remote Similarity	NPC161717
0.5429	Remote Similarity	NPC276093
0.5419	Remote Similarity	NPC69425
0.5396	Remote Similarity	NPC257468
0.5362	Remote Similarity	NPC180550
0.5362	Remote Similarity	NPC35405
0.5352	Remote Similarity	NPC488564
0.5333	Remote Similarity	NPC109079
0.5329	Remote Similarity	NPC329657
0.5299	Remote Similarity	NPC488214
0.5298	Remote Similarity	NPC470876
0.5208	Remote Similarity	NPC475486
0.5185	Remote Similarity	NPC12288
0.5182	Remote Similarity	NPC472949
0.5149	Remote Similarity	NPC270667
0.5147	Remote Similarity	NPC56713
0.5147	Remote Similarity	NPC59804
0.5143	Remote Similarity	NPC104400
0.5143	Remote Similarity	NPC10320
0.5137	Remote Similarity	NPC288205
0.5137	Remote Similarity	NPC51465
0.5115	Remote Similarity	NPC469778
0.5114	Remote Similarity	NPC481324
0.5102	Remote Similarity	NPC473824
0.5069	Remote Similarity	NPC291903
0.5068	Remote Similarity	NPC62725
0.5067	Remote Similarity	NPC475140
0.5066	Remote Similarity	NPC57484
0.5036	Remote Similarity	NPC22956
0.5034	Remote Similarity	NPC475119

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC40085 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4802
0.1-0.2	4293
0.2-0.3	51
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data