NPASS Compound

Natural Product: NPC488209

Natural Product ID	NPC488209
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	FKHSISJCYMSTTH-CCKAVJAYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 140147 0 0 0 0 0 0 0 0999 V2000 -10.2775 -0.2930 0.3807 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3672 0.7577 0.9661 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.8808 2.1317 0.5955 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7663 3.0259 0.1061 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4875 2.8479 0.8865 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2534 1.4419 1.3278 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.0649 0.5982 0.5514 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9466 1.0053 1.2355 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4062 0.5740 2.4272 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1529 1.3327 2.8175 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3567 1.9907 4.1696 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4776 2.8109 4.0848 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0395 0.5001 2.8501 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8636 0.0019 1.5359 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8793 -1.0985 1.3632 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0150 -0.8910 2.3848 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6808 -1.3468 3.6358 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5442 -1.0320 0.1198 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5900 -2.2304 -0.5454 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0276 -2.6715 -0.7388 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1300 -3.4461 -2.0464 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7855 -2.5195 -3.1807 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6912 -1.5637 -2.7646 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9269 -2.1065 -1.7616 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3394 -3.3150 -4.2470 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4843 -3.7999 -2.1817 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4585 -3.5060 0.3201 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5435 -0.4201 1.3953 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8341 0.2840 0.4266 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1497 1.1524 1.1553 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4622 0.5773 1.4907 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9660 -0.5344 0.5962 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7079 -1.8061 1.3500 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2562 -0.3912 -0.6892 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8301 -1.1813 -1.8409 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1622 -0.4701 -2.1319 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0141 -0.7274 -0.9238 C 0 0 2 0 0 0 0 0 0 0 0 0 4.5381 -2.1429 -1.0314 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4442 -0.3562 0.3853 C 0 0 2 0 0 0 0 0 0 0 0 0 4.2914 -1.0160 1.4463 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7182 -0.8395 1.0964 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1999 -0.3185 -0.0232 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6977 -0.2260 -0.1890 C 0 0 2 0 0 0 0 0 0 0 0 0 8.1982 0.3200 1.1284 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5277 0.9820 1.1032 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6455 0.0551 1.5850 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4995 2.1063 2.1575 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8953 1.6518 -0.1838 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6018 1.9081 -0.9432 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1459 0.4986 -1.3878 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1951 0.6579 -2.5225 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8915 -0.0318 -2.4262 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2670 0.1571 -1.0873 C 0 0 1 0 0 0 0 0 0 0 0 0 4.9440 1.6152 -0.8835 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3994 -0.1294 -1.8854 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8651 -1.1234 -1.3157 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0282 0.4103 -2.9831 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2425 -0.5782 -0.6240 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6470 -2.0189 -0.5964 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7419 -0.0221 -1.9738 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3597 2.2906 0.3521 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4538 3.3564 0.0931 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5692 2.7338 -1.2527 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5703 2.7284 1.6483 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0693 -0.5695 1.1267 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6853 -1.2201 0.2151 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7527 0.0777 -0.5379 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3870 0.6705 2.0679 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6090 2.0279 -0.2437 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1303 4.0727 0.1508 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5602 3.5639 1.7563 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5749 1.3371 2.3943 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1436 0.6765 3.2217 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9466 2.1072 2.0548 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4615 2.5514 4.4870 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6111 1.1802 4.9071 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5182 3.2390 3.1737 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1310 0.8226 0.8408 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4999 -2.1088 1.5797 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9057 -1.4373 2.0201 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9175 -2.3284 3.6686 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0881 -3.0561 0.0155 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7092 -1.8096 -0.8157 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5068 -4.3552 -2.0132 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6985 -1.9581 -3.4543 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0158 -1.4408 -3.6534 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0886 -0.5428 -2.5378 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8202 -4.1836 -4.1808 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6558 -4.6545 -1.7177 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7572 -4.1178 0.6236 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5913 1.0108 -0.0043 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3906 1.5770 2.0577 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4072 0.1946 2.5441 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2033 1.4302 1.5120 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6601 -1.9883 1.5969 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1147 -2.7165 0.9406 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2019 -1.6530 2.3593 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3784 0.6934 -0.9987 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1430 -1.0193 -2.7093 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9637 -2.2421 -1.6376 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6480 -0.9063 -3.0050 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9045 0.5691 -2.3201 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6470 -2.2061 -0.9656 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1648 -2.6061 -1.9774 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1709 -2.8226 -0.2433 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6281 0.7539 0.5281 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1300 -0.4048 2.3854 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0313 -2.0798 1.6302 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4294 -1.1924 1.8710 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1090 -1.2831 -0.2314 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2969 -0.5312 1.8700 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4547 1.0467 1.5663 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4323 -1.0069 1.3690 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6283 0.4004 1.2043 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7351 0.1048 2.7104 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6488 2.7745 2.0131 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3888 1.5820 3.1276 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4902 2.6175 2.1788 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6085 1.0503 -0.7652 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3693 2.6506 -0.0330 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8566 2.5146 -1.8325 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8909 2.3724 -0.2631 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6837 0.2494 -3.4612 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1019 1.7528 -2.7813 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1998 0.4565 -3.1744 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0002 -1.0678 -2.7571 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2164 1.9665 0.1552 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9024 1.8846 -1.1379 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5716 2.2727 -1.5490 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9057 0.0825 -3.3649 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3278 -2.2364 0.2512 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2226 -2.3349 -1.5177 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2396 -2.7093 -0.6293 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0442 0.6826 -2.4208 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9090 -0.8397 -2.6945 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7154 0.4851 -1.8400 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7237 3.0369 0.8603 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7910 4.0193 -0.5607 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2640 3.1365 -1.8187 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1871 3.5832 1.8987 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 10 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 15 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 22 25 1 0 21 26 1 0 20 27 1 0 14 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 1 32 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 1 37 39 1 0 39 40 1 0 40 41 1 0 41 42 2 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 45 47 1 0 45 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 1 50 55 1 6 55 56 2 0 55 57 1 0 34 58 1 0 58 59 1 0 58 60 1 0 30 61 1 0 5 62 1 0 4 63 1 0 3 64 1 0 7 2 1 0 16 9 1 0 24 19 1 0 58 29 1 0 39 32 1 0 53 42 1 0 53 37 1 0 50 43 1 0 1 65 1 0 1 66 1 0 1 67 1 0 2 68 1 1 3 69 1 6 4 70 1 6 5 71 1 1 6 72 1 1 9 73 1 1 10 74 1 6 11 75 1 0 11 76 1 0 12 77 1 0 14 78 1 6 15 79 1 1 16 80 1 6 17 81 1 0 19 82 1 1 20 83 1 6 21 84 1 1 22 85 1 6 23 86 1 0 23 87 1 0 25 88 1 0 26 89 1 0 27 90 1 0 29 91 1 6 30 92 1 1 31 93 1 0 31 94 1 0 33 95 1 0 33 96 1 0 33 97 1 0 34 98 1 6 35 99 1 0 35100 1 0 36101 1 0 36102 1 0 38103 1 0 38104 1 0 38105 1 0 39106 1 1 40107 1 0 40108 1 0 41109 1 0 43110 1 6 44111 1 0 44112 1 0 46113 1 0 46114 1 0 46115 1 0 47116 1 0 47117 1 0 47118 1 0 48119 1 0 48120 1 0 49121 1 0 49122 1 0 51123 1 0 51124 1 0 52125 1 0 52126 1 0 54127 1 0 54128 1 0 54129 1 0 57130 1 0 59131 1 0 59132 1 0 59133 1 0 60134 1 0 60135 1 0 60136 1 0 61137 1 0 62138 1 0 63139 1 0 64140 1 0 M END

Standard InCHIKey	FKHSISJCYMSTTH-CCKAVJAYSA-N
Standard InCHI	InChI=1S/C47H76O17/c1-21-29(51)31(53)33(55)39(60-21)62-35-26(19-48)61-40(36(34(35)56)63-38-32(54)30(52)25(50)20-59-38)64-37-24(49)18-44(6)27(43(37,4)5)11-12-46(8)28(44)10-9-22-23-17-42(2,3)13-15-47(23,41(57)58)16-14-45(22,46)7/h9,21,23-40,48-56H,10-20H2,1-8H3,(H,57,58)/t21-,23+,24-,25-,26-,27+,28-,29-,30+,31+,32-,33+,34+,35-,36-,37+,38+,39+,40+,44+,45-,46-,47+/m1/s1
SMILES	C[C@@H]1[C@H]([C@@H]([C@@H]([C@@H](O1)O[C@@H]1[C@@H](CO)O[C@H]([C@@H]([C@H]1O)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O[C@H]1[C@@H](C[C@@]2(C)[C@@H](CC[C@]3(C)[C@@H]2CC=C2[C@@H]4CC(C)(C)CC[C@@]4(CC[C@@]32C)C(=O)O)C1(C)C)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	912.51	Volume:	897.177 ? Van der Waals volume.
Dense:	1.017	LogP:	0.788 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.537 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.641 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	45.0
TPSA:	274.75 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	10.0	Rings:	8.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.122	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.31	Fsp³:	0.936
MCE-18:	174.462 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.855	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.207	Promiscuous compounds:	0.158

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.033	MDCK Permeability:	-5.146
Pgp-inhibitor:	0.0	Pgp-substrate:	0.008
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.204
20% Bioavailability (F20%):	0.463	30% Bioavailability (F30%):	0.806
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.015	MRP1:	0.069
Plasma Protein Binding (PPB):	75.406%	Volume Distribution (VD):	-0.428
Fu:	16.392% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.001
BSEP inhibitor:	0.073

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.11
HLM stability:	0.003 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.249

Half-life (T1/2):

3.555

ADMET: Toxicity

hERG Blockers:	0.005	hERG Blockers (10um):	0.026
Human Hepatotoxicity (H-HT):	0.654	Drug-induced Liver Injury (DILI):	0.828
AMES Toxicity:	0.4	Rat Oral Acute Toxicity:	0.005
Maximum Recommended Daily Dose:	0.008	Skin Sensitization:	1.0
Carcinogencity:	0.029	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.011
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.297	Drug-induced Nephrotoxicity:	0.981
Genotoxicity:	0.025	RPMI-8226 Immunitoxicity:	0.145
A549 Cytotoxicity:	0.109	Hek293 Cytotoxicity:	0.091
BCF:	1.313 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.9 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.739 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.785 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO28138	Burkea africana	Species	Fabaceae	Eukaryota	Bark	n.a.	n.a.	PMID[29394063]
NPO28138	Burkea africana	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO28138	Burkea africana	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1
Ratio CC50/IC50	1
CC50	1

Activity Type	# Activity
Cell line	1
Organism	1
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT616	Cell line	MDCK	Canis lupus familiaris	CC50	=	15500.0	nM	PMID[29394063]
NPT339	Organism	Influenza A virus H3N2	Influenza A virus H3N2	IC50	=	1700.0	nM	PMID[29394063]
NPT2	Others	Unspecified	n.a.	Ratio CC50/IC50	=	9.0	n.a.	PMID[29394063]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC488209 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23407
0.1-0.2	22472
0.2-0.3	2660
0.3-0.4	871
0.4-0.5	358
0.5-0.6	48
0.6-0.7	39
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7355	Intermediate Similarity	NPC488210
0.6818	Remote Similarity	NPC488206
0.6792	Remote Similarity	NPC488561
0.6762	Remote Similarity	NPC174679
0.6762	Remote Similarity	NPC279554
0.6762	Remote Similarity	NPC56713
0.6667	Remote Similarity	NPC79718
0.6604	Remote Similarity	NPC25605
0.6577	Remote Similarity	NPC257468
0.6557	Remote Similarity	NPC471385
0.6525	Remote Similarity	NPC166422
0.6509	Remote Similarity	NPC12288
0.65	Remote Similarity	NPC283849
0.65	Remote Similarity	NPC28198
0.65	Remote Similarity	NPC476123
0.6486	Remote Similarity	NPC139044
0.6441	Remote Similarity	NPC323341
0.6429	Remote Similarity	NPC481082
0.6429	Remote Similarity	NPC164419
0.6423	Remote Similarity	NPC161717
0.6396	Remote Similarity	NPC104400
0.6396	Remote Similarity	NPC10320
0.6389	Remote Similarity	NPC127056
0.6387	Remote Similarity	NPC251263
0.6364	Remote Similarity	NPC469945
0.6339	Remote Similarity	NPC471383
0.6303	Remote Similarity	NPC133818
0.6296	Remote Similarity	NPC59804
0.6261	Remote Similarity	NPC324875
0.6261	Remote Similarity	NPC292677
0.6239	Remote Similarity	NPC480424
0.6174	Remote Similarity	NPC276093
0.6168	Remote Similarity	NPC127853
0.6168	Remote Similarity	NPC164194
0.6148	Remote Similarity	NPC54636
0.6121	Remote Similarity	NPC323359
0.6068	Remote Similarity	NPC488564
0.6019	Remote Similarity	NPC606107
0.6018	Remote Similarity	NPC114304
0.6	Remote Similarity	NPC100383
0.5984	Remote Similarity	NPC219180
0.5946	Remote Similarity	NPC109079
0.5922	Remote Similarity	NPC204407
0.5917	Remote Similarity	NPC288205
0.5917	Remote Similarity	NPC51465
0.5893	Remote Similarity	NPC472949
0.5849	Remote Similarity	NPC242611
0.5841	Remote Similarity	NPC80843
0.5841	Remote Similarity	NPC22956
0.5812	Remote Similarity	NPC488515
0.5766	Remote Similarity	NPC136877
0.5752	Remote Similarity	NPC6377
0.5752	Remote Similarity	NPC208381
0.575	Remote Similarity	NPC475486
0.5702	Remote Similarity	NPC280941
0.5702	Remote Similarity	NPC62725
0.5702	Remote Similarity	NPC235772
0.5683	Remote Similarity	NPC40085
0.5664	Remote Similarity	NPC114441
0.5614	Remote Similarity	NPC488516
0.5603	Remote Similarity	NPC264270
0.5593	Remote Similarity	NPC73829
0.5586	Remote Similarity	NPC270667
0.5556	Remote Similarity	NPC473383
0.5547	Remote Similarity	NPC57484
0.552	Remote Similarity	NPC471384
0.5463	Remote Similarity	NPC31839
0.5462	Remote Similarity	NPC470876
0.5455	Remote Similarity	NPC475633
0.5424	Remote Similarity	NPC180550
0.5424	Remote Similarity	NPC35405
0.5417	Remote Similarity	NPC119794
0.536	Remote Similarity	NPC473824
0.5315	Remote Similarity	NPC284807
0.5246	Remote Similarity	NPC37134
0.5229	Remote Similarity	NPC177246
0.5203	Remote Similarity	NPC291903
0.5182	Remote Similarity	NPC286347
0.5172	Remote Similarity	NPC488205
0.5159	Remote Similarity	NPC475119
0.5159	Remote Similarity	NPC476992
0.5156	Remote Similarity	NPC475899
0.5088	Remote Similarity	NPC171007
0.5088	Remote Similarity	NPC190849
0.5085	Remote Similarity	NPC488207
0.5081	Remote Similarity	NPC75318
0.5077	Remote Similarity	NPC475140
0.5041	Remote Similarity	NPC484832

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC488209 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7058
0.1-0.2	2028
0.2-0.3	60
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data