NPASS Compound

Natural Product: NPC488515

Natural Product ID	NPC488515
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	WGFGSGMOAHUFDZ-GVXYPEJNSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44584166
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 137144 0 0 0 0 0 0 0 0999 V2000 -10.0260 1.8481 1.4496 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0733 0.9049 2.1685 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9753 1.3943 3.6015 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6046 -0.4975 2.2101 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5070 -1.2569 0.9294 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1932 -1.0212 0.2041 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1968 -0.3151 1.0528 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.6910 1.0142 1.5647 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9161 -0.1720 0.3075 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3182 1.0030 0.2357 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0397 1.2164 -0.4972 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2992 -0.0992 -0.5257 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8761 0.0013 -0.9422 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5953 1.2226 -1.7856 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0190 0.1771 0.3234 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3460 -0.3335 0.2638 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9299 -0.5044 -1.1462 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0346 -1.2952 -2.0101 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4308 -2.7980 -1.8594 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1626 -1.0442 -3.4830 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4070 -1.2792 -1.5310 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3245 -1.9134 -2.5271 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5420 -2.3399 -1.6849 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1870 -1.0473 -1.2671 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7850 -0.4540 -2.5162 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3267 -1.4093 -0.3401 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8754 -2.3358 0.7663 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4293 -2.1533 -1.0696 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6111 -2.3855 -0.1617 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3547 -3.1374 0.9535 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3220 0.6875 -1.6597 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6839 0.9213 -1.7765 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0843 1.5079 -3.0581 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4390 2.9852 -3.0157 C 0 0 2 0 0 0 0 0 0 0 0 0 4.2412 3.3786 -1.8108 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3931 2.1420 -0.9681 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3071 2.3166 0.1914 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6354 1.1957 0.9025 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3388 0.2484 0.1774 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7181 -0.0135 0.7852 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5608 -0.5060 -0.4003 C 0 0 2 0 0 0 0 0 0 0 0 0 7.6757 -1.4089 -1.1927 C 0 0 2 0 0 0 0 0 0 0 0 0 6.4587 -1.9106 -0.4903 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6975 -0.9744 0.1548 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4616 -2.4519 -1.6907 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6890 -1.1852 -0.0103 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2318 1.1087 1.3858 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5873 0.7832 2.6960 C 0 0 1 0 0 0 0 0 0 0 0 0 10.0146 1.1701 2.9871 C 0 0 1 0 0 0 0 0 0 0 0 0 10.1974 1.1002 4.5057 C 0 0 2 0 0 0 0 0 0 0 0 0 9.1157 0.2345 5.1240 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7355 0.6864 4.7525 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8093 1.5211 3.6347 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3373 -1.1204 4.8297 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1183 2.3726 5.0607 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9407 0.4194 2.3037 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1162 1.7017 -0.6583 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4407 4.0081 -2.1044 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2767 3.7796 -3.1302 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1363 0.8396 -3.7207 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5338 -0.3659 -1.0680 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1287 0.7982 -1.3040 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3169 -1.0444 -2.0247 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6014 2.4968 2.1436 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7951 1.2674 0.8724 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4654 2.5478 0.7906 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3952 0.7309 4.2513 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5238 2.4235 3.5554 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0176 1.5534 3.9847 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6966 -0.3909 2.4824 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1554 -1.0138 3.0808 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6104 -2.3490 1.1929 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3739 -1.0197 0.2844 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0148 -0.9841 1.9435 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9480 1.3617 2.3080 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7492 1.7700 0.7671 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7776 1.8803 0.7480 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4507 2.0157 -0.0066 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3956 1.5289 -1.5324 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3114 -0.4319 0.5572 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1764 0.9550 -2.7552 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0168 2.0145 -1.2315 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5263 1.8079 -2.0357 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0885 1.2706 0.5640 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6200 -0.3114 1.1476 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4106 -1.3111 0.7804 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0437 0.3472 0.7890 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8707 -1.0945 -0.9462 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1279 -3.3645 -2.7390 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0409 -3.2068 -0.9313 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5308 -2.8648 -1.7030 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8200 -1.1055 -4.0089 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6259 -0.1172 -3.7880 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7714 -1.8481 -4.0107 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4176 -1.9920 -0.6401 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7284 -1.2210 -3.2922 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8345 -2.7972 -2.9706 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1275 -2.9243 -0.8414 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2638 -2.8873 -2.3092 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6877 0.1414 -2.2785 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0212 -1.2583 -3.2741 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1142 0.2336 -3.0677 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7988 -2.3257 0.9710 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0961 -3.4170 0.5142 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4028 -2.1357 1.7144 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8088 -1.5746 -1.9360 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0391 -3.1503 -1.3539 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3960 -2.8559 -0.8148 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7558 -4.0468 0.7882 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1980 -0.0338 -1.5699 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2421 1.4679 -3.8156 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0470 3.2002 -3.9142 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6411 4.1025 -1.1982 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8716 1.3481 -1.6215 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2599 2.7776 -0.1868 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9006 3.0537 0.9436 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5208 0.5604 -0.8699 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6706 -0.8876 1.4625 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8294 0.4094 -1.0032 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3109 -0.8416 -2.0975 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7872 -2.7210 0.2260 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7913 -2.4235 -1.2245 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8960 -2.1315 -2.5208 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4732 -1.0425 -0.6148 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4120 -0.3032 2.8728 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0889 2.2566 2.6815 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1602 0.6037 4.6799 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2238 0.3323 6.2328 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2369 1.2790 5.5602 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0646 -0.1786 4.5589 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5281 -1.6273 5.0980 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4679 2.3303 5.9888 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4708 0.9732 1.6735 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2872 4.9847 -2.2967 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1275 4.3000 -2.2963 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9510 0.6322 -4.6481 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2914 -0.6830 -2.9793 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 6 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 18 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 6 24 26 1 0 26 27 1 1 26 28 1 0 28 29 1 0 29 30 1 0 17 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 41 46 1 0 40 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 51 54 1 0 50 55 1 0 49 56 1 0 36 57 1 0 35 58 1 0 34 59 1 0 33 60 1 0 6 61 1 6 61 62 2 0 61 63 1 0 8 2 1 0 26 9 1 0 57 32 1 0 29 6 1 0 44 39 1 0 53 48 1 0 24 12 1 0 21 13 1 0 1 64 1 0 1 65 1 0 1 66 1 0 3 67 1 0 3 68 1 0 3 69 1 0 4 70 1 0 4 71 1 0 5 72 1 0 5 73 1 0 7 74 1 1 8 75 1 0 8 76 1 0 10 77 1 0 11 78 1 0 11 79 1 0 12 80 1 1 14 81 1 0 14 82 1 0 14 83 1 0 15 84 1 0 15 85 1 0 16 86 1 0 16 87 1 0 17 88 1 1 19 89 1 0 19 90 1 0 19 91 1 0 20 92 1 0 20 93 1 0 20 94 1 0 21 95 1 1 22 96 1 0 22 97 1 0 23 98 1 0 23 99 1 0 25100 1 0 25101 1 0 25102 1 0 27103 1 0 27104 1 0 27105 1 0 28106 1 0 28107 1 0 29108 1 6 30109 1 0 32110 1 1 33111 1 6 34112 1 6 35113 1 1 36114 1 6 37115 1 0 37116 1 0 39117 1 6 40118 1 1 41119 1 6 42120 1 6 43121 1 0 43122 1 0 45123 1 0 46124 1 0 48125 1 1 49126 1 6 50127 1 6 51128 1 1 52129 1 0 52130 1 0 54131 1 0 55132 1 0 56133 1 0 58134 1 0 59135 1 0 60136 1 0 63137 1 0 M END

Standard InCHIKey	WGFGSGMOAHUFDZ-GVXYPEJNSA-N
Standard InCHI	InChI=1S/C46H74O17/c1-41(2)14-15-46(40(56)57)22(16-41)21-8-9-27-43(5)12-11-29(42(3,4)26(43)10-13-44(27,6)45(21,7)17-28(46)49)62-38-35(55)33(53)32(52)25(61-38)20-60-39-36(31(51)24(48)19-59-39)63-37-34(54)30(50)23(47)18-58-37/h8,22-39,47-55H,9-20H2,1-7H3,(H,56,57)/t22-,23-,24+,25-,26+,27-,28-,29+,30+,31+,32-,33+,34-,35-,36-,37+,38+,39+,43+,44-,45-,46-/m1/s1
SMILES	CC1(C)CC[C@]2([C@H](C1)C1=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)C[C@H]2O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@H](CO2)O)O)O[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)O1)O)O)O)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	898.49	Volume:	879.881 ? Van der Waals volume.
Dense:	1.021	LogP:	1.838 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.504 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.577 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	45.0
TPSA:	274.75 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	10.0	Rings:	8.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.12	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.273	Fsp³:	0.935
MCE-18:	172.764 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.767	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.179	Promiscuous compounds:	0.107

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.068	MDCK Permeability:	-5.129
Pgp-inhibitor:	0.0	Pgp-substrate:	0.147
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.018
20% Bioavailability (F20%):	0.054	30% Bioavailability (F30%):	0.642
50% Bioavailability (F50%):	0.987

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.49
Plasma Protein Binding (PPB):	68.177%	Volume Distribution (VD):	-0.508
Fu:	23.316% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.001
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.196
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.065
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.083

Half-life (T1/2):

2.496

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.006
Human Hepatotoxicity (H-HT):	0.678	Drug-induced Liver Injury (DILI):	0.787
AMES Toxicity:	0.862	Rat Oral Acute Toxicity:	0.007
Maximum Recommended Daily Dose:	0.01	Skin Sensitization:	1.0
Carcinogencity:	0.152	Eye Corrosion:	0.0
Eye Irritation:	0.004	Respiratory Toxicity:	0.009
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.997
Hematotoxicity:	0.499	Drug-induced Nephrotoxicity:	0.994
Genotoxicity:	0.09	RPMI-8226 Immunitoxicity:	0.106
A549 Cytotoxicity:	0.493	Hek293 Cytotoxicity:	0.232
BCF:	1.031 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.621 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.291 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.279 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27443	Gymnocladus chinensis	Species	Fabaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[7494144]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[7494144]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO27443	Gymnocladus chinensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	1
IC50	1

Activity Type	# Activity
Cell line	1
Organism	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT759	Cell line	H9	Homo sapiens	IC50	=	37000.0	nM	PMID[7494144]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	EC50	>	100000.0	nM	PMID[7494144]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC488515 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22648
0.1-0.2	22874
0.2-0.3	2982
0.3-0.4	805
0.4-0.5	372
0.5-0.6	119
0.6-0.7	32
0.7-0.8	0
0.8-0.85	4
0.85-0.9	3
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8817	High Similarity	NPC488516
0.88	High Similarity	NPC288205
0.88	High Similarity	NPC51465
0.8454	Intermediate Similarity	NPC104400
0.8454	Intermediate Similarity	NPC10320
0.8144	Intermediate Similarity	NPC80843
0.8132	Intermediate Similarity	NPC242611
0.7938	Intermediate Similarity	NPC480424
0.7767	Intermediate Similarity	NPC37134
0.7736	Intermediate Similarity	NPC475119
0.7383	Intermediate Similarity	NPC475486
0.7358	Intermediate Similarity	NPC75318
0.7263	Intermediate Similarity	NPC31839
0.7182	Intermediate Similarity	NPC200788
0.7037	Intermediate Similarity	NPC291903
0.7027	Intermediate Similarity	NPC473824
0.7	Intermediate Similarity	NPC280941
0.7	Intermediate Similarity	NPC235772
0.6893	Remote Similarity	NPC127056
0.6887	Remote Similarity	NPC488526
0.6796	Remote Similarity	NPC56713
0.6701	Remote Similarity	NPC283849
0.6697	Remote Similarity	NPC484832
0.6667	Remote Similarity	NPC488561
0.6606	Remote Similarity	NPC481082
0.6606	Remote Similarity	NPC164419
0.6574	Remote Similarity	NPC232237
0.6552	Remote Similarity	NPC166422
0.6552	Remote Similarity	NPC219180
0.6466	Remote Similarity	NPC243680
0.6389	Remote Similarity	NPC469945
0.6339	Remote Similarity	NPC145899
0.6321	Remote Similarity	NPC59804
0.6306	Remote Similarity	NPC257468
0.6283	Remote Similarity	NPC324875
0.6283	Remote Similarity	NPC292677
0.625	Remote Similarity	NPC79718
0.6179	Remote Similarity	NPC161717
0.6172	Remote Similarity	NPC120667
0.6172	Remote Similarity	NPC278272
0.6168	Remote Similarity	NPC174679
0.6168	Remote Similarity	NPC279554
0.6161	Remote Similarity	NPC73829
0.6087	Remote Similarity	NPC488564
0.6075	Remote Similarity	NPC136877
0.605	Remote Similarity	NPC323341
0.604	Remote Similarity	NPC28198
0.604	Remote Similarity	NPC476123
0.604	Remote Similarity	NPC606107
0.6038	Remote Similarity	NPC164194
0.595	Remote Similarity	NPC475140
0.5929	Remote Similarity	NPC105800
0.5909	Remote Similarity	NPC472949
0.5909	Remote Similarity	NPC6377
0.5909	Remote Similarity	NPC208381
0.5888	Remote Similarity	NPC76999
0.5872	Remote Similarity	NPC25605
0.5868	Remote Similarity	NPC251263
0.5865	Remote Similarity	NPC100383
0.5826	Remote Similarity	NPC119794
0.5816	Remote Similarity	NPC601365
0.5812	Remote Similarity	NPC488209
0.5789	Remote Similarity	NPC63159
0.5789	Remote Similarity	NPC139044
0.5785	Remote Similarity	NPC471384
0.5776	Remote Similarity	NPC276093
0.5739	Remote Similarity	NPC488517
0.5691	Remote Similarity	NPC283417
0.5691	Remote Similarity	NPC200049
0.5669	Remote Similarity	NPC471385
0.5652	Remote Similarity	NPC471383
0.5645	Remote Similarity	NPC54636
0.5635	Remote Similarity	NPC13998
0.563	Remote Similarity	NPC104137
0.563	Remote Similarity	NPC26626
0.5614	Remote Similarity	NPC114304
0.56	Remote Similarity	NPC4749
0.5593	Remote Similarity	NPC323359
0.5583	Remote Similarity	NPC210729
0.5583	Remote Similarity	NPC82931
0.5575	Remote Similarity	NPC22956
0.5565	Remote Similarity	NPC164389
0.5564	Remote Similarity	NPC8524
0.5538	Remote Similarity	NPC70809
0.5536	Remote Similarity	NPC109079
0.553	Remote Similarity	NPC102505
0.553	Remote Similarity	NPC488514
0.5522	Remote Similarity	NPC33012
0.5484	Remote Similarity	NPC123199
0.5481	Remote Similarity	NPC204407
0.5462	Remote Similarity	NPC481079
0.5455	Remote Similarity	NPC480939
0.5431	Remote Similarity	NPC180550
0.5431	Remote Similarity	NPC35405
0.5403	Remote Similarity	NPC133818
0.5398	Remote Similarity	NPC480420
0.5391	Remote Similarity	NPC265841
0.5391	Remote Similarity	NPC488308
0.5379	Remote Similarity	NPC224381
0.5372	Remote Similarity	NPC207738
0.5361	Remote Similarity	NPC228784
0.5361	Remote Similarity	NPC324341
0.5361	Remote Similarity	NPC601810
0.5357	Remote Similarity	NPC12288
0.5349	Remote Similarity	NPC312650
0.5345	Remote Similarity	NPC117714
0.5333	Remote Similarity	NPC301449
0.5333	Remote Similarity	NPC601290
0.5328	Remote Similarity	NPC62725
0.5327	Remote Similarity	NPC286347
0.5323	Remote Similarity	NPC79643
0.5321	Remote Similarity	NPC284807
0.5315	Remote Similarity	NPC1046
0.5312	Remote Similarity	NPC21691
0.5285	Remote Similarity	NPC185466
0.5268	Remote Similarity	NPC48499
0.5263	Remote Similarity	NPC114441
0.5263	Remote Similarity	NPC488212
0.5263	Remote Similarity	NPC488309
0.5242	Remote Similarity	NPC60557
0.5242	Remote Similarity	NPC67857
0.5242	Remote Similarity	NPC610204
0.5238	Remote Similarity	NPC135904
0.5234	Remote Similarity	NPC85154
0.5231	Remote Similarity	NPC271610
0.5217	Remote Similarity	NPC470512
0.5214	Remote Similarity	NPC30289
0.5207	Remote Similarity	NPC23275
0.5207	Remote Similarity	NPC606145
0.52	Remote Similarity	NPC151543
0.5197	Remote Similarity	NPC480423
0.5179	Remote Similarity	NPC127853
0.5179	Remote Similarity	NPC270667
0.5172	Remote Similarity	NPC263756
0.5172	Remote Similarity	NPC469946
0.5169	Remote Similarity	NPC473383
0.5167	Remote Similarity	NPC64715
0.5164	Remote Similarity	NPC295823
0.5164	Remote Similarity	NPC174720
0.5164	Remote Similarity	NPC475467
0.5154	Remote Similarity	NPC286457
0.5152	Remote Similarity	NPC236638
0.5152	Remote Similarity	NPC294453
0.5149	Remote Similarity	NPC220160
0.5128	Remote Similarity	NPC112352
0.5122	Remote Similarity	NPC481078
0.5122	Remote Similarity	NPC187290
0.5118	Remote Similarity	NPC480419
0.5116	Remote Similarity	NPC488211
0.5113	Remote Similarity	NPC309223
0.5093	Remote Similarity	NPC177246
0.5089	Remote Similarity	NPC480938
0.5086	Remote Similarity	NPC295371
0.5081	Remote Similarity	NPC11242
0.5079	Remote Similarity	NPC123522
0.5078	Remote Similarity	NPC470218
0.505	Remote Similarity	NPC222047
0.5043	Remote Similarity	NPC213674
0.5042	Remote Similarity	NPC173859
0.5042	Remote Similarity	NPC148603
0.5041	Remote Similarity	NPC160452
0.5041	Remote Similarity	NPC302887
0.504	Remote Similarity	NPC172365
0.504	Remote Similarity	NPC476992
0.5039	Remote Similarity	NPC284449
0.5038	Remote Similarity	NPC110633
0.5038	Remote Similarity	NPC480418
0.5035	Remote Similarity	NPC297950
0.5035	Remote Similarity	NPC489208

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC488515 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6836
0.1-0.2	2268
0.2-0.3	43
0.3-0.4	2
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data