NPASS Compound

Natural Product: NPC488526

Natural Product ID	NPC488526
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	AYERTEPRWNKDLO-CISDWVLOSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	10843445
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 140147 0 0 0 0 0 0 0 0999 V2000 -9.6777 -2.4045 2.0067 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3392 -1.0712 2.6905 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6798 -1.2981 4.1671 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2156 -0.0208 2.1335 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6792 0.7275 0.9552 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1911 0.9773 1.0720 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5557 -0.3829 1.2318 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8622 -0.8812 2.5873 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1504 -0.2231 0.8631 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2342 -0.1583 1.7691 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7878 0.0076 1.4738 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5567 -0.3625 0.0471 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0900 -0.3674 -0.3465 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3736 0.8741 -0.0090 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3939 -1.5045 0.4088 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0297 -1.6998 0.0266 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3971 -1.2950 -1.3820 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7531 -1.3122 -2.3087 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9076 -2.7969 -2.7534 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4809 -0.6126 -3.6219 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0407 -0.8117 -1.7770 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.6695 0.2879 -2.6011 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1580 0.1924 -2.3349 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4709 0.3511 -0.8615 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4505 1.8680 -0.6799 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8820 -0.1384 -0.5989 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0374 -1.5127 -1.2102 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9860 0.7047 -1.1526 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6315 1.6206 -0.1626 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.7302 2.2129 -0.8324 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1285 -0.1314 -1.4369 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3994 -0.2440 -1.9125 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8672 0.8632 -2.7890 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0284 0.3007 -3.5978 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7905 -0.6197 -2.7084 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5989 -0.3968 -1.2503 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6034 0.6260 -0.7401 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8547 0.3575 -1.3419 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8413 1.2280 -0.9661 C 0 0 1 0 0 0 0 0 0 0 0 0 9.0936 0.6036 -0.4160 C 0 0 1 0 0 0 0 0 0 0 0 0 10.2202 1.0021 -1.3907 C 0 0 2 0 0 0 0 0 0 0 0 0 9.7137 0.4933 -2.7532 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5300 1.3465 -3.1884 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0859 2.0589 -2.0776 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2379 -0.8088 -2.6174 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4034 0.3608 -1.1401 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3310 1.0822 0.8398 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5205 0.0880 1.8018 C 0 0 1 0 0 0 0 0 0 0 0 0 10.9042 0.0738 2.3575 C 0 0 1 0 0 0 0 0 0 0 0 0 11.0509 0.0112 3.8220 C 0 0 2 0 0 0 0 0 0 0 0 0 9.7851 0.0848 4.6194 C 0 0 1 0 0 0 0 0 0 0 0 0 8.7056 -0.6343 3.8366 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4998 0.1478 2.7013 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9405 -0.4592 5.8956 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8995 1.0221 4.3323 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6889 -0.9403 1.7821 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3194 -0.2064 -0.8021 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6720 -1.9764 -3.0543 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7947 1.3042 -4.1557 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9569 1.4516 -3.6141 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0077 1.8877 2.2143 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3755 2.9911 2.0554 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4608 1.6850 3.5025 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2486 2.6091 4.5527 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6674 -2.3114 0.9081 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6960 -2.7393 2.2980 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9747 -3.2060 2.2998 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9790 -0.7410 4.8192 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6992 -0.9022 4.3909 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5807 -2.3766 4.4479 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4962 0.6833 2.9569 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1768 -0.4824 1.8225 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1759 1.7238 0.9136 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8962 0.2159 -0.0045 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1099 -1.0621 0.5251 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4160 -1.9329 2.6593 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4434 -0.3055 3.4291 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5102 -0.2259 2.8253 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1545 -0.5713 2.1824 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5752 1.0749 1.7241 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8243 -1.4622 -0.0105 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4494 0.7013 0.6285 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9928 1.4935 0.6721 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9975 1.4610 -0.8735 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4267 -1.3645 1.5028 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9779 -2.4373 0.1603 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2697 -2.7862 0.2137 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7450 -1.1514 0.7063 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1284 -2.0834 -1.7438 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8777 -2.8547 -3.2448 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9543 -3.3701 -1.8090 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0419 -3.0771 -3.3787 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1107 -1.0883 -4.4363 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5661 -0.8429 -3.9765 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5861 0.4684 -3.5696 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7596 -1.6802 -1.8141 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5748 0.0817 -3.7077 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2639 1.2821 -2.4378 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6166 1.0063 -2.9344 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4437 -0.8180 -2.7362 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5767 2.1894 0.3480 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4594 2.2813 -1.0300 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1636 2.3193 -1.4024 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7046 -2.1648 -0.5626 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6468 -1.4489 -2.1656 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1282 -2.0848 -1.3376 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7582 1.2862 -2.0489 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8404 0.0343 -1.4883 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9880 2.4738 0.1378 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8022 3.1702 -0.6395 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6142 -1.2849 -2.3052 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2433 1.6953 -2.1143 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5793 -0.2879 -4.4210 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8854 -0.3974 -2.9112 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9365 -1.3660 -0.7570 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2875 1.6640 -0.8653 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7855 0.4783 0.3659 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4196 1.9330 -0.1932 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0800 -0.5064 -0.4807 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3126 2.1039 -1.3931 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5123 0.4977 -3.5072 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9428 2.1147 -3.8889 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7617 0.8058 -3.7345 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5038 -1.3375 -3.4239 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9884 0.4835 -1.9295 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3994 -0.8793 1.2385 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3941 1.0267 1.9948 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5619 -0.9491 4.1416 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4352 1.1478 4.6995 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0868 -1.6225 3.4861 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7574 -0.7153 4.3823 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9324 -0.4735 6.0696 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5132 1.3404 3.6243 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2230 -1.8079 1.7534 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0151 -2.4875 -2.2557 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4247 2.1764 -3.8119 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1599 1.2085 -4.5520 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1769 2.7404 4.7132 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7861 3.5395 4.2604 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7998 2.2225 5.4353 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 6 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 18 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 1 24 26 1 0 26 27 1 6 26 28 1 0 28 29 1 0 29 30 1 0 17 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 41 46 1 0 40 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 51 54 1 0 50 55 1 0 49 56 1 0 36 57 1 0 35 58 1 0 34 59 1 0 33 60 1 0 6 61 1 1 61 62 2 0 61 63 1 0 63 64 1 0 8 2 1 0 26 9 1 0 57 32 1 0 29 6 1 0 44 39 1 0 53 48 1 0 24 12 1 0 21 13 1 0 1 65 1 0 1 66 1 0 1 67 1 0 3 68 1 0 3 69 1 0 3 70 1 0 4 71 1 0 4 72 1 0 5 73 1 0 5 74 1 0 7 75 1 6 8 76 1 0 8 77 1 0 10 78 1 0 11 79 1 0 11 80 1 0 12 81 1 1 14 82 1 0 14 83 1 0 14 84 1 0 15 85 1 0 15 86 1 0 16 87 1 0 16 88 1 0 17 89 1 6 19 90 1 0 19 91 1 0 19 92 1 0 20 93 1 0 20 94 1 0 20 95 1 0 21 96 1 1 22 97 1 0 22 98 1 0 23 99 1 0 23100 1 0 25101 1 0 25102 1 0 25103 1 0 27104 1 0 27105 1 0 27106 1 0 28107 1 0 28108 1 0 29109 1 1 30110 1 0 32111 1 6 33112 1 1 34113 1 6 35114 1 1 36115 1 1 37116 1 0 37117 1 0 39118 1 1 40119 1 1 41120 1 6 42121 1 6 43122 1 0 43123 1 0 45124 1 0 46125 1 0 48126 1 6 49127 1 6 50128 1 6 51129 1 1 52130 1 0 52131 1 0 54132 1 0 55133 1 0 56134 1 0 58135 1 0 59136 1 0 60137 1 0 64138 1 0 64139 1 0 64140 1 0 M END

Standard InCHIKey	AYERTEPRWNKDLO-CISDWVLOSA-N
Standard InCHI	InChI=1S/C47H76O17/c1-42(2)15-16-47(41(57)58-8)23(17-42)22-9-10-28-44(5)13-12-30(43(3,4)27(44)11-14-45(28,6)46(22,7)18-29(47)50)63-39-36(56)34(54)33(53)26(62-39)21-61-40-37(32(52)25(49)20-60-40)64-38-35(55)31(51)24(48)19-59-38/h9,23-40,48-56H,10-21H2,1-8H3/t23-,24-,25+,26-,27+,28-,29-,30+,31+,32+,33-,34+,35-,36-,37-,38+,39+,40+,44+,45-,46-,47-/m1/s1
SMILES	CC1(C)CC[C@]2([C@H](C1)C1=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)C[C@H]2O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@H](CO2)O)O)O[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)O1)O)O)O)C(=O)OC

Calculated Properties

Physi-Chem Properties

Molecular Weight:	912.51	Volume:	897.177 ? Van der Waals volume.
Dense:	1.017	LogP:	2.412 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.059 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.939 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	45.0
TPSA:	263.75 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	8.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.094	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.297	Fsp³:	0.936
MCE-18:	171.692 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.845	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.176	Promiscuous compounds:	0.071

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.984	MDCK Permeability:	-5.171
Pgp-inhibitor:	0.002	Pgp-substrate:	0.087
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.014
20% Bioavailability (F20%):	0.163	30% Bioavailability (F30%):	0.96
50% Bioavailability (F50%):	0.997

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.006	MRP1:	0.216
Plasma Protein Binding (PPB):	70.415%	Volume Distribution (VD):	-0.464
Fu:	20.923% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.014
BSEP inhibitor:	0.034

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.006	CYP3A4-substrate:	0.117
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.043
HLM stability:	0.017 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.219

Half-life (T1/2):

2.325

ADMET: Toxicity

hERG Blockers:	0.012	hERG Blockers (10um):	0.02
Human Hepatotoxicity (H-HT):	0.617	Drug-induced Liver Injury (DILI):	0.638
AMES Toxicity:	0.822	Rat Oral Acute Toxicity:	0.005
Maximum Recommended Daily Dose:	0.028	Skin Sensitization:	1.0
Carcinogencity:	0.102	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.008
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.996
Hematotoxicity:	0.33	Drug-induced Nephrotoxicity:	0.986
Genotoxicity:	0.071	RPMI-8226 Immunitoxicity:	0.203
A549 Cytotoxicity:	0.618	Hek293 Cytotoxicity:	0.393
BCF:	1.485 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.739 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.294 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.415 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27443	Gymnocladus chinensis	Species	Fabaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[7494144]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[7494144]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO27443	Gymnocladus chinensis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7631	Gleditsia japonica	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	1
IC50	1

Activity Type	# Activity
Cell line	1
Organism	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT759	Cell line	H9	Homo sapiens	IC50	=	22000.0	nM	PMID[7494144]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	EC50	=	9900.0	nM	PMID[7494144]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC488526 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20825
0.1-0.2	24489
0.2-0.3	3314
0.3-0.4	666
0.4-0.5	338
0.5-0.6	133
0.6-0.7	54
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8144	Intermediate Similarity	NPC232237
0.7477	Intermediate Similarity	NPC13998
0.7429	Intermediate Similarity	NPC104137
0.7429	Intermediate Similarity	NPC26626
0.7426	Intermediate Similarity	NPC164389
0.7353	Intermediate Similarity	NPC105800
0.7265	Intermediate Similarity	NPC102505
0.7265	Intermediate Similarity	NPC488514
0.7216	Intermediate Similarity	NPC1046
0.7143	Intermediate Similarity	NPC8524
0.71	Intermediate Similarity	NPC480420
0.7083	Intermediate Similarity	NPC33012
0.6887	Remote Similarity	NPC488515
0.6842	Remote Similarity	NPC85154
0.6814	Remote Similarity	NPC283417
0.6814	Remote Similarity	NPC200049
0.6792	Remote Similarity	NPC488517
0.678	Remote Similarity	NPC309223
0.6762	Remote Similarity	NPC104400
0.6762	Remote Similarity	NPC10320
0.6727	Remote Similarity	NPC210729
0.6727	Remote Similarity	NPC82931
0.6724	Remote Similarity	NPC286457
0.6698	Remote Similarity	NPC63159
0.6696	Remote Similarity	NPC123522
0.6696	Remote Similarity	NPC4749
0.6667	Remote Similarity	NPC480423
0.6667	Remote Similarity	NPC220160
0.6486	Remote Similarity	NPC207738
0.6356	Remote Similarity	NPC21691
0.6328	Remote Similarity	NPC489208
0.6311	Remote Similarity	NPC70809
0.6306	Remote Similarity	NPC481079
0.6296	Remote Similarity	NPC305267
0.6293	Remote Similarity	NPC123199
0.6273	Remote Similarity	NPC64715
0.626	Remote Similarity	NPC224381
0.6216	Remote Similarity	NPC37134
0.6204	Remote Similarity	NPC23020
0.6204	Remote Similarity	NPC117714
0.6196	Remote Similarity	NPC488520
0.6174	Remote Similarity	NPC60557
0.6174	Remote Similarity	NPC67857
0.6167	Remote Similarity	NPC473452
0.6154	Remote Similarity	NPC48499
0.614	Remote Similarity	NPC11242
0.614	Remote Similarity	NPC815
0.6121	Remote Similarity	NPC79643
0.6116	Remote Similarity	NPC470876
0.6111	Remote Similarity	NPC489209
0.6106	Remote Similarity	NPC295823
0.6106	Remote Similarity	NPC174720
0.6106	Remote Similarity	NPC475467
0.6087	Remote Similarity	NPC172365
0.6087	Remote Similarity	NPC185466
0.6087	Remote Similarity	NPC288205
0.6087	Remote Similarity	NPC51465
0.6071	Remote Similarity	NPC472270
0.6071	Remote Similarity	NPC112492
0.6064	Remote Similarity	NPC488522
0.6055	Remote Similarity	NPC30289
0.6036	Remote Similarity	NPC297263
0.6019	Remote Similarity	NPC469946
0.6017	Remote Similarity	NPC135904
0.6016	Remote Similarity	NPC236638
0.6016	Remote Similarity	NPC294453
0.5982	Remote Similarity	NPC484832
0.5963	Remote Similarity	NPC112352
0.5948	Remote Similarity	NPC475119
0.5938	Remote Similarity	NPC488524
0.5926	Remote Similarity	NPC295371
0.5926	Remote Similarity	NPC488516
0.5913	Remote Similarity	NPC481078
0.5897	Remote Similarity	NPC610204
0.5873	Remote Similarity	NPC482010
0.5854	Remote Similarity	NPC475514
0.5846	Remote Similarity	NPC480421
0.584	Remote Similarity	NPC302543
0.5833	Remote Similarity	NPC173583
0.5821	Remote Similarity	NPC297950
0.5778	Remote Similarity	NPC472268
0.575	Remote Similarity	NPC475209
0.575	Remote Similarity	NPC480419
0.5727	Remote Similarity	NPC263756
0.5726	Remote Similarity	NPC41061
0.5726	Remote Similarity	NPC227551
0.5692	Remote Similarity	NPC480422
0.5691	Remote Similarity	NPC473386
0.569	Remote Similarity	NPC69811
0.5656	Remote Similarity	NPC488560
0.5645	Remote Similarity	NPC265841
0.5645	Remote Similarity	NPC480418
0.5641	Remote Similarity	NPC31838
0.5635	Remote Similarity	NPC305981
0.5635	Remote Similarity	NPC481081
0.563	Remote Similarity	NPC475287
0.563	Remote Similarity	NPC76972
0.563	Remote Similarity	NPC200788
0.563	Remote Similarity	NPC469782
0.563	Remote Similarity	NPC204414
0.562	Remote Similarity	NPC603137
0.561	Remote Similarity	NPC481080
0.5603	Remote Similarity	NPC301449
0.5603	Remote Similarity	NPC601290
0.5603	Remote Similarity	NPC606145
0.5593	Remote Similarity	NPC280941
0.5593	Remote Similarity	NPC235772
0.5591	Remote Similarity	NPC261506
0.5591	Remote Similarity	NPC4328
0.5588	Remote Similarity	NPC484831
0.5586	Remote Similarity	NPC213674
0.5581	Remote Similarity	NPC250247
0.5574	Remote Similarity	NPC475140
0.5565	Remote Similarity	NPC57484
0.5556	Remote Similarity	NPC241909
0.5528	Remote Similarity	NPC25663
0.5528	Remote Similarity	NPC471577
0.5514	Remote Similarity	NPC214484
0.5512	Remote Similarity	NPC202828
0.5512	Remote Similarity	NPC119592
0.55	Remote Similarity	NPC473824
0.55	Remote Similarity	NPC607904
0.55	Remote Similarity	NPC610461
0.5495	Remote Similarity	NPC470512
0.5493	Remote Similarity	NPC485563
0.5484	Remote Similarity	NPC488519
0.5478	Remote Similarity	NPC475504
0.5474	Remote Similarity	NPC484830
0.5446	Remote Similarity	NPC76497
0.5446	Remote Similarity	NPC80843
0.5439	Remote Similarity	NPC2370
0.5431	Remote Similarity	NPC471435
0.5431	Remote Similarity	NPC471434
0.5413	Remote Similarity	NPC475208
0.541	Remote Similarity	NPC165204
0.5398	Remote Similarity	NPC469945
0.5397	Remote Similarity	NPC488308
0.5379	Remote Similarity	NPC472269
0.5378	Remote Similarity	NPC187290
0.537	Remote Similarity	NPC90856
0.5357	Remote Similarity	NPC484829
0.5354	Remote Similarity	NPC471580
0.5354	Remote Similarity	NPC271610
0.5354	Remote Similarity	NPC312650
0.5349	Remote Similarity	NPC144644
0.5349	Remote Similarity	NPC170407
0.5345	Remote Similarity	NPC470513
0.5339	Remote Similarity	NPC291903
0.5323	Remote Similarity	NPC470218
0.5319	Remote Similarity	NPC233223
0.5319	Remote Similarity	NPC183816
0.5319	Remote Similarity	NPC43589
0.5315	Remote Similarity	NPC56713
0.5304	Remote Similarity	NPC173859
0.5304	Remote Similarity	NPC148603
0.5304	Remote Similarity	NPC480475
0.5299	Remote Similarity	NPC302887
0.5294	Remote Similarity	NPC160452
0.5283	Remote Similarity	NPC242611
0.5276	Remote Similarity	NPC110633
0.5268	Remote Similarity	NPC480424
0.5268	Remote Similarity	NPC127056
0.5267	Remote Similarity	NPC142151
0.5263	Remote Similarity	NPC223301
0.5263	Remote Similarity	NPC171544
0.525	Remote Similarity	NPC609281
0.5234	Remote Similarity	NPC128925
0.5231	Remote Similarity	NPC37860
0.5221	Remote Similarity	NPC39211
0.5214	Remote Similarity	NPC470514
0.5214	Remote Similarity	NPC481082
0.5214	Remote Similarity	NPC222580
0.5214	Remote Similarity	NPC164419
0.5214	Remote Similarity	NPC123796
0.52	Remote Similarity	NPC475160
0.52	Remote Similarity	NPC473714
0.5197	Remote Similarity	NPC488204
0.5194	Remote Similarity	NPC293330
0.5194	Remote Similarity	NPC43550
0.5188	Remote Similarity	NPC68767
0.5179	Remote Similarity	NPC475516
0.5175	Remote Similarity	NPC475584
0.5175	Remote Similarity	NPC475152
0.5172	Remote Similarity	NPC44716
0.5172	Remote Similarity	NPC251768
0.5172	Remote Similarity	NPC311178
0.5167	Remote Similarity	NPC470477
0.5161	Remote Similarity	NPC284449
0.5161	Remote Similarity	NPC243680
0.5152	Remote Similarity	NPC267694
0.5152	Remote Similarity	NPC488309
0.5149	Remote Similarity	NPC153673
0.5149	Remote Similarity	NPC51099
0.5143	Remote Similarity	NPC283849
0.5141	Remote Similarity	NPC475394
0.5133	Remote Similarity	NPC249848
0.5133	Remote Similarity	NPC107966
0.512	Remote Similarity	NPC166422
0.512	Remote Similarity	NPC219180

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC488526 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7277
0.1-0.2	1827
0.2-0.3	42
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data