NPASS Compound

Natural Product: NPC25663

Natural Product ID	NPC25663
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Dianversicoside A
IUPAC Name	(3S)-5-[[(2R,3S,4S,5R,6R)-6-[[(2R,3S,4S,5R,6S)-6-[(4aR,5R,6aR,6aS,6bR,8aR,9S,10S,12aR,14bS)-5,10-dihydroxy-2,2,6a,6b,9,12a-hexamethyl-9-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbonyl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3,4-dihydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methoxy]-3-hydroxy-3-methyl-5-oxopentanoic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL554394
PubChem CID	42639817
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 184192 0 0 0 0 0 0 0 0999 V2000 10.1297 3.9674 -2.3658 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2137 3.4595 -1.4561 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4796 4.6394 -0.8498 C 0 0 1 0 0 0 0 0 0 0 0 0 7.5330 4.2787 0.0749 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0142 3.7452 1.2448 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2102 2.3716 1.2196 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3784 1.6971 2.1295 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5482 0.6791 1.4204 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4622 1.2104 0.7641 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4877 0.8196 -0.5485 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4294 1.3633 -1.4333 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1400 1.0624 -1.0096 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2902 1.2294 -2.0793 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9699 0.7429 -1.8683 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4368 -0.2588 -2.6803 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1637 -0.7116 -3.5695 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9718 -0.7768 -2.4951 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.1546 -1.8196 -3.5353 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2649 -1.1482 -4.8763 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5181 -0.3218 -4.8666 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6617 0.6238 -3.7500 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9344 0.3451 -2.4694 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8694 0.3722 -1.2899 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2479 1.5530 -0.8178 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1624 1.7894 0.3309 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8725 0.5149 0.5762 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8970 -0.6283 0.7374 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3648 -0.9052 -0.6685 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.2299 -1.9061 -0.6744 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9082 -1.3878 -1.0845 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0341 -2.4879 -1.1169 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4694 -1.5062 -1.5157 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8046 -0.2099 1.6878 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4968 -1.8826 1.2523 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8985 -1.9172 1.6922 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7386 -0.7577 1.2960 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9687 0.5064 1.5872 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5039 0.6470 2.9997 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9055 1.6516 1.2745 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0723 1.6878 2.2287 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7221 0.3678 2.4364 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.1634 -0.7785 1.6777 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4041 -2.0152 2.5641 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0399 -1.0375 0.4882 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4868 -1.2415 -0.6120 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.4242 -1.0618 0.5383 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2128 -1.3089 -0.6161 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.9182 -0.1898 -0.9376 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.9937 0.1491 -0.1856 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.6947 1.5187 0.4468 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.7698 1.9453 1.2394 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.3615 -0.7767 0.9156 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.1054 -2.2173 0.6338 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.1407 -2.4807 -0.4788 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.8916 -2.5285 -1.6758 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.6117 -2.8024 1.8264 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.7530 -0.6339 1.1296 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9536 0.0659 3.8033 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4489 0.4736 -6.1966 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6933 -1.2558 -5.0570 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1734 2.6856 -2.4216 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2252 3.5212 -1.7592 C 0 0 2 0 0 0 0 0 0 0 0 0 4.5793 2.8340 -1.7642 C 0 0 2 0 0 0 0 0 0 0 0 0 5.2044 3.0433 -2.9874 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8988 3.7881 -0.4206 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2440 2.8717 -3.8029 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0881 -0.2387 2.3994 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1649 -1.1465 2.5204 C 0 0 1 0 0 0 0 0 0 0 0 0 8.3936 -0.4441 2.9964 C 0 0 2 0 0 0 0 0 0 0 0 0 8.1962 1.0350 3.2174 C 0 0 2 0 0 0 0 0 0 0 0 0 7.5527 1.1925 4.4360 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4703 -0.5862 2.1045 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8181 -2.3850 3.2767 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9458 -3.1967 3.3713 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6443 -3.7387 2.3108 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2837 -3.5278 1.1448 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8247 -4.5667 2.6018 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5457 -5.0826 1.3999 C 0 0 2 0 0 0 0 0 0 0 0 0 9.7221 -5.9593 0.5181 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2669 -7.1560 1.2380 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4269 -7.9341 0.6937 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7156 -7.4740 2.4873 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6757 -5.7921 1.8673 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0958 -3.8823 0.6381 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2752 4.4112 1.7337 C 0 0 1 0 0 0 0 0 0 0 0 0 9.4246 5.7895 1.1721 C 0 0 2 0 0 0 0 0 0 0 0 0 9.4337 5.6876 -0.3300 C 0 0 2 0 0 0 0 0 0 0 0 0 9.1178 6.9670 -0.8228 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6918 6.2583 1.5501 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3012 4.4794 3.1289 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8726 3.7675 -3.3145 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7494 2.8667 -0.7044 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4809 2.8503 -1.9866 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9175 5.1206 -1.7036 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2185 3.9433 2.0240 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7500 2.4593 2.6327 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1745 0.1053 0.6702 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4411 -0.3081 -0.5382 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5005 1.0323 -1.0047 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5102 0.8480 -2.4463 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7493 0.7109 -2.9761 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0104 -2.4932 -3.4245 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2055 -2.4192 -3.5504 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3860 -1.8940 -5.7011 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4372 -0.4743 -5.1233 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4828 1.6647 -4.1414 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7641 0.6674 -3.4944 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2919 1.2725 -2.3063 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8563 2.4556 -1.3094 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9100 2.5455 -0.0756 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7196 2.3048 1.1771 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4230 0.3338 -0.4028 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4412 -2.7802 -1.3678 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1586 -2.4352 0.3212 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4226 -0.6355 -0.4794 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5391 -2.4969 -0.2875 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1939 -2.1259 -1.0099 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0624 -2.1568 -2.3406 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0537 -0.7326 -2.0665 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9687 0.7571 2.1942 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7642 -0.9674 2.5146 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7988 -0.1881 1.2902 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8877 -2.2156 2.1749 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2590 -2.7791 0.5839 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9544 -2.1455 2.7836 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3715 -2.8367 1.2050 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7393 -0.8110 0.1522 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8262 -0.1323 3.3606 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9739 1.6276 3.1704 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3320 0.6853 3.7339 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2768 1.4652 0.2370 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4261 2.6386 1.2820 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7311 2.0666 3.2187 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7609 2.4903 1.8358 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7906 0.5180 2.0679 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2405 -2.9524 2.0033 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9002 -1.9461 3.5306 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5134 -2.0193 2.7921 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5011 -1.4808 -1.4816 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.8935 0.3547 -0.8353 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7696 1.4049 1.0567 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5087 2.2511 -0.3527 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.1070 2.8345 0.9248 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9105 -0.4484 1.8928 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.0544 -2.7444 0.3601 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6011 -3.4434 -0.3667 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.6958 -1.9405 -1.6122 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6339 -2.9116 1.8094 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.9561 0.0201 1.8333 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8099 -0.3544 3.9698 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4586 0.8892 -6.3727 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1516 1.3197 -6.0329 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8473 -0.1250 -7.0333 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5422 -0.9873 -4.3786 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0656 -1.2740 -6.1190 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4385 -2.3125 -4.8411 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1633 3.0874 -2.1082 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3654 4.5026 -2.2590 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1941 3.3060 -0.9802 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0888 2.2370 -3.5408 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3185 4.6351 -0.1690 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4610 2.4126 -4.1979 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3773 -1.4589 1.4550 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7471 -0.8756 3.9560 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2283 1.4755 3.2755 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1982 1.4091 5.1495 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5842 0.2580 1.5622 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4389 -2.1769 4.2965 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0075 -2.9095 2.6917 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5352 -3.9143 3.1829 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5003 -5.3659 3.3207 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8214 -5.4767 0.0837 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3612 -6.2451 -0.3548 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6725 -8.4170 2.8719 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5124 -5.4605 1.4602 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9746 -4.2106 0.0697 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3695 -3.1031 1.3608 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3411 -3.4512 -0.0394 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1931 3.8402 1.4423 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6085 6.4409 1.5294 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4734 5.4091 -0.6485 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9193 6.8455 -1.7877 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3381 5.7854 0.9501 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0351 5.1400 3.3413 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 2 0 17 15 1 6 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 2 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 28 32 1 6 27 33 1 1 27 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 1 37 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 1 42 44 1 0 44 45 2 0 44 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 49 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 53 56 1 0 52 57 1 0 41 58 1 0 20 59 1 0 20 60 1 0 13 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 62 65 1 0 61 66 1 0 8 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 69 72 1 0 68 73 1 0 73 74 1 0 74 75 1 0 75 76 2 0 75 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 80 81 2 0 80 82 1 0 78 83 1 1 78 84 1 0 5 85 1 0 85 86 1 0 86 87 1 0 87 88 1 0 86 89 1 0 85 90 1 0 87 3 1 0 70 7 1 0 63 11 1 0 30 17 1 0 42 36 1 0 54 47 1 0 22 17 1 0 28 23 1 0 37 26 1 0 1 91 1 0 2 92 1 0 2 93 1 0 3 94 1 6 5 95 1 1 7 96 1 1 8 97 1 6 10 98 1 0 10 99 1 0 11100 1 6 13101 1 6 18102 1 0 18103 1 0 19104 1 0 19105 1 0 21106 1 0 21107 1 0 22108 1 1 24109 1 0 25110 1 0 25111 1 0 26112 1 6 29113 1 0 29114 1 0 30115 1 1 31116 1 0 32117 1 0 32118 1 0 32119 1 0 33120 1 0 33121 1 0 33122 1 0 34123 1 0 34124 1 0 35125 1 0 35126 1 0 36127 1 6 38128 1 0 38129 1 0 38130 1 0 39131 1 0 39132 1 0 40133 1 0 40134 1 0 41135 1 6 43136 1 0 43137 1 0 43138 1 0 47139 1 6 49140 1 6 50141 1 0 50142 1 0 51143 1 0 52144 1 1 53145 1 6 54146 1 1 55147 1 0 56148 1 0 57149 1 0 58150 1 0 59151 1 0 59152 1 0 59153 1 0 60154 1 0 60155 1 0 60156 1 0 61157 1 1 62158 1 6 63159 1 1 64160 1 0 65161 1 0 66162 1 0 68163 1 6 69164 1 1 70165 1 1 71166 1 0 72167 1 0 73168 1 0 73169 1 0 77170 1 0 77171 1 0 79172 1 0 79173 1 0 82174 1 0 83175 1 0 84176 1 0 84177 1 0 84178 1 0 85179 1 6 86180 1 6 87181 1 6 88182 1 0 89183 1 0 90184 1 0 M END

Standard InCHIKey	IJSZPFMPQUDYPI-FYIVALIFSA-N
Standard InCHI	InChI=1S/C60H94O30/c1-54(2)14-15-60(25(16-54)24-8-9-30-56(4)12-11-32(63)59(7,31(56)10-13-57(30,5)58(24,6)17-33(60)64)52(79)89-49-45(77)41(73)37(69)27(21-62)85-49)53(80)90-50-46(78)42(74)38(70)29(86-50)23-83-51-47(88-48-44(76)40(72)36(68)26(20-61)84-48)43(75)39(71)28(87-51)22-82-35(67)19-55(3,81)18-34(65)66/h8,25-33,36-51,61-64,68-78,81H,9-23H2,1-7H3,(H,65,66)/t25-,26+,27+,28+,29+,30+,31+,32-,33+,36+,37+,38+,39+,40-,41-,42-,43-,44+,45+,46+,47+,48-,49-,50-,51+,55-,56+,57+,58+,59-,60+/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@H](OC[C@H]3O[C@@H](OC(=O)[C@@]45CCC(C[C@H]5C5=CC[C@H]6[C@@]([C@@]5(C[C@H]4O)C)(C)CC[C@@H]4[C@]6(C)CC[C@@H]([C@@]4(C)C(=O)O[C@@H]4O[C@H](CO)[C@H]([C@@H]([C@H]4O)O)O)O)(C)C)[C@@H]([C@H]([C@@H]3O)O)O)O[C@@H]([C@H]([C@@H]2O)O)COC(=O)C[C@](CC(=O)O)(O)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1294.58	Volume:	1219.832 ? Van der Waals volume.
Dense:	1.061	LogP:	-1.298 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.396 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.141 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	20.0	Rigid Bonds:	54.0
TPSA:	495.26 ? Topological Polar Surface Area.	H-Bond Acceptor:	30.0
H-Bond Donor:	17.0	Rings:	9.0
Heavy Atoms:	30.0

MedChem Properties

QED Drug-Likeness Score:	0.037	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.405	Fsp³:	0.9
MCE-18:	210.737 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.666	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.011 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.165	Promiscuous compounds:	0.615

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.673	MDCK Permeability:	-5.088
Pgp-inhibitor:	0.0	Pgp-substrate:	0.007
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.994
20% Bioavailability (F20%):	0.998	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.214	MRP1:	0.001
Plasma Protein Binding (PPB):	62.807%	Volume Distribution (VD):	-0.309
Fu:	25.959% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.002
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.691

Half-life (T1/2):

5.093

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.956	Drug-induced Liver Injury (DILI):	0.845
AMES Toxicity:	0.936	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.098	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.781	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.971	RPMI-8226 Immunitoxicity:	0.309
A549 Cytotoxicity:	0.519	Hek293 Cytotoxicity:	0.045
BCF:	0.409 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.21 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.96 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.766 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	n.a.	whole plant	n.a.	PMID[19290648]
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	aerial parts	Changqing, Shangdong Province, China	2004-JUN	PMID[19290648]
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO27907	Dianthus versicolor	Species	Caryophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4

Activity Type	# Activity
Cell line	3
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1855	Cell line	HFL1	Homo sapiens	IC50	=	2800.0	nM	PMID[19290648]
NPT83	Cell line	MCF7	Homo sapiens	IC50	>	10000.0	nM	PMID[19290648]
NPT65	Cell line	HepG2	Homo sapiens	IC50	>	10000.0	nM	PMID[19290648]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	6200.0	nM	PMID[19290648]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC25663 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21576
0.1-0.2	23817
0.2-0.3	3333
0.3-0.4	699
0.4-0.5	369
0.5-0.6	52
0.6-0.7	5
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9189	High Similarity	NPC476991
0.819	Intermediate Similarity	NPC305267
0.7623	Intermediate Similarity	NPC51564
0.7434	Intermediate Similarity	NPC69811
0.6562	Remote Similarity	NPC135849
0.6303	Remote Similarity	NPC64715
0.6129	Remote Similarity	NPC476992
0.6016	Remote Similarity	NPC283417
0.6016	Remote Similarity	NPC200049
0.5878	Remote Similarity	NPC21691
0.5802	Remote Similarity	NPC4749
0.5776	Remote Similarity	NPC475208
0.569	Remote Similarity	NPC1046
0.5656	Remote Similarity	NPC164389
0.563	Remote Similarity	NPC480420
0.5591	Remote Similarity	NPC207738
0.558	Remote Similarity	NPC220160
0.5556	Remote Similarity	NPC29069
0.5547	Remote Similarity	NPC11242
0.5528	Remote Similarity	NPC488526
0.536	Remote Similarity	NPC63159
0.5351	Remote Similarity	NPC48249
0.5349	Remote Similarity	NPC104137
0.5349	Remote Similarity	NPC26626
0.5328	Remote Similarity	NPC475514
0.5324	Remote Similarity	NPC302543
0.5308	Remote Similarity	NPC75287
0.5299	Remote Similarity	NPC470218
0.5278	Remote Similarity	NPC33012
0.525	Remote Similarity	NPC48499
0.5238	Remote Similarity	NPC105800
0.521	Remote Similarity	NPC238935
0.5208	Remote Similarity	NPC8524
0.5191	Remote Similarity	NPC815
0.5188	Remote Similarity	NPC123522
0.5185	Remote Similarity	NPC475140
0.5161	Remote Similarity	NPC485563
0.5159	Remote Similarity	NPC251768
0.5159	Remote Similarity	NPC473459
0.5152	Remote Similarity	NPC288205
0.5152	Remote Similarity	NPC51465
0.5135	Remote Similarity	NPC489208
0.5133	Remote Similarity	NPC167383
0.5113	Remote Similarity	NPC473824
0.5108	Remote Similarity	NPC258617
0.5106	Remote Similarity	NPC309223
0.5096	Remote Similarity	NPC23020
0.5081	Remote Similarity	NPC295371
0.5077	Remote Similarity	NPC301449
0.5077	Remote Similarity	NPC481079
0.5077	Remote Similarity	NPC601290
0.5074	Remote Similarity	NPC191827
0.5072	Remote Similarity	NPC473386
0.5069	Remote Similarity	NPC102505
0.5069	Remote Similarity	NPC488514
0.5043	Remote Similarity	NPC237503
0.5039	Remote Similarity	NPC232237
0.5038	Remote Similarity	NPC160452
0.5038	Remote Similarity	NPC213952
0.5038	Remote Similarity	NPC185466
0.5035	Remote Similarity	NPC482010

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC25663 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6583
0.1-0.2	2514
0.2-0.3	51
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data