NPASS Compound

Natural Product: NPC220160

Natural Product ID	NPC220160
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3Beta-O-Glucopyranosyl-(1->3)-Alpha-L-Rhamnopyranosyl-(1->2)-Alpha-L-Arabinopyranosyl]Echinocystic Acid-28-O-[Alpha-L-Rhamnopyranosyl(1->4)-Beta-D-Glucopyranosyl-(1->6)-Beta-D-Glucopyranosyl]Ester
IUPAC Name	[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2S,3R,4S,5S)-3-[(2S,3R,4R,5S,6S)-3,5-dihydroxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl]oxy-5-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL505847
PubChem CID	44575199
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 202212 0 0 0 0 0 0 0 0999 V2000 14.6724 -0.7449 3.4161 C 0 0 0 0 0 0 0 0 0 0 0 0 15.6725 -0.4371 2.3205 C 0 0 1 0 0 0 0 0 0 0 0 0 16.0578 -1.6507 1.5192 C 0 0 1 0 0 0 0 0 0 0 0 0 16.4624 -1.2024 0.1119 C 0 0 2 0 0 0 0 0 0 0 0 0 15.1788 -0.7903 -0.5741 C 0 0 2 0 0 0 0 0 0 0 0 0 14.3130 -0.1020 0.4904 C 0 0 1 0 0 0 0 0 0 0 0 0 15.1179 0.4906 1.4718 O 0 0 0 0 0 0 0 0 0 0 0 0 13.6418 0.9369 -0.1338 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2734 0.7242 -0.0636 C 0 0 2 0 0 0 0 0 0 0 0 0 11.5877 0.9776 -1.3827 C 0 0 1 0 0 0 0 0 0 0 0 0 11.9364 -0.0941 -2.4063 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3558 -1.3148 -2.1310 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2582 1.2416 -1.2997 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6104 1.0189 -0.1213 C 0 0 2 0 0 0 0 0 0 0 0 0 10.2939 1.4462 1.1317 C 0 0 1 0 0 0 0 0 0 0 0 0 11.7284 1.8259 0.8712 C 0 0 1 0 0 0 0 0 0 0 0 0 12.4940 1.9346 2.0062 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7016 2.5977 1.7066 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1571 -0.3071 -0.0951 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7783 -0.2924 -0.1966 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2333 -1.6772 -0.1832 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9638 -2.6585 -1.0693 C 0 0 2 0 0 0 0 0 0 0 0 0 7.2968 -2.7771 -2.4232 C 0 0 1 0 0 0 0 0 0 0 0 0 6.4005 -1.5822 -2.6995 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4171 -1.3405 -1.5802 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8515 -1.7285 -0.3368 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9839 -0.0037 -1.5132 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7010 0.3237 -1.8971 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9784 -0.6297 -2.3171 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1328 1.7075 -1.8484 C 0 0 2 0 0 0 0 0 0 0 0 0 4.1540 2.6404 -2.3743 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1689 2.9858 -1.3399 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6567 3.3879 -0.0015 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0993 2.5584 1.1505 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0356 4.8585 0.2199 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1082 3.4049 -0.1107 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7236 2.0036 -0.4010 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3299 1.6018 -0.2193 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0767 0.6218 0.5822 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2169 0.0090 0.9511 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3157 0.8220 0.4809 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.6751 0.1601 0.6390 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8803 -1.1244 -0.0320 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7288 -0.1543 2.1521 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0405 -0.5480 2.6685 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2618 -0.2378 1.8226 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1002 0.8798 0.8764 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0188 0.7977 -0.3176 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6233 2.1411 1.6267 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6936 1.2179 0.5008 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6045 1.8259 -0.8654 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2648 2.4674 -0.9377 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0829 1.4777 -0.8250 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2180 0.5878 -2.0211 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1971 2.2600 -0.9245 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1198 3.6315 -0.3132 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7530 2.5559 -2.2638 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8827 1.6619 -2.7040 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2775 2.1676 -3.9553 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7418 -1.3451 1.1815 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7962 -2.0033 1.6899 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.9706 -1.9957 0.7599 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8861 -2.9911 -0.3302 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7120 -4.3607 0.3606 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.5059 -4.2924 1.2900 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5749 -3.2664 2.1818 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3877 -5.2759 -0.6417 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8196 -2.7358 -1.1592 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1871 -2.1188 1.4856 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8108 -0.8785 1.6003 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.9702 -0.8132 0.6561 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.3011 -1.2694 1.1375 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.4430 -1.1008 2.6285 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.1485 -1.4773 3.2747 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.1838 -1.5772 4.7648 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1411 -0.5598 2.8883 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.4771 -1.8628 3.1499 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.2535 -0.4951 0.4618 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.1285 -1.2338 -0.3351 C 0 0 1 0 0 0 0 0 0 0 0 0 -15.5364 -1.1318 0.1000 C 0 0 1 0 0 0 0 0 0 0 0 0 -16.4686 -1.2170 -1.0827 C 0 0 2 0 0 0 0 0 0 0 0 0 -16.0802 -0.0303 -1.9786 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.5990 -0.0764 -2.2747 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.0037 1.2669 -2.0011 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.0484 1.5988 -0.6700 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.9388 -1.0834 -1.6536 O 0 0 0 0 0 0 0 0 0 0 0 0 -16.7855 -0.0333 -3.1497 O 0 0 0 0 0 0 0 0 0 0 0 0 -17.7521 -0.9342 -0.5712 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.8303 -2.1260 1.0479 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1580 0.5449 0.2355 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6733 -1.9565 -3.8623 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3149 -2.8495 -3.3678 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0162 -3.9408 -0.4652 O 0 0 0 0 0 0 0 0 0 0 0 0 14.5185 -1.9799 -0.9603 O 0 0 0 0 0 0 0 0 0 0 0 0 17.0181 -2.2486 -0.5890 O 0 0 0 0 0 0 0 0 0 0 0 0 17.1458 -2.2782 2.1249 O 0 0 0 0 0 0 0 0 0 0 0 0 14.0001 -1.5588 3.0989 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0412 0.1412 3.6338 H 0 0 0 0 0 0 0 0 0 0 0 0 15.2635 -1.0489 4.3032 H 0 0 0 0 0 0 0 0 0 0 0 0 16.5862 0.0429 2.7644 H 0 0 0 0 0 0 0 0 0 0 0 0 15.1978 -2.3243 1.4001 H 0 0 0 0 0 0 0 0 0 0 0 0 17.1213 -0.2970 0.1620 H 0 0 0 0 0 0 0 0 0 0 0 0 15.3376 -0.1721 -1.4533 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5804 -0.8125 0.8818 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9848 -0.2121 0.4316 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0715 1.9270 -1.7762 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6653 0.2748 -3.4241 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0321 -0.2247 -2.4335 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9377 -2.0723 -2.4588 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6687 1.6607 -0.1877 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2527 0.6655 1.9311 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7376 2.8091 0.3372 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9757 2.8163 2.0362 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4801 3.2604 0.9881 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4247 0.1941 0.7644 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4085 0.3735 -0.9821 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3978 -2.0753 0.8669 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0192 -2.3453 -1.1527 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7211 -3.7298 -2.4302 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9937 -0.7320 -3.0117 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5291 -1.9662 -1.8528 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7073 2.0892 -3.1915 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7401 3.5235 -2.9043 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8590 2.1228 -1.2454 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8183 3.7940 -1.7954 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9299 3.1037 1.6875 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5066 1.6096 0.8122 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2695 2.4544 1.8888 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9719 5.3333 -0.7899 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3036 5.3817 0.8635 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0722 4.9433 0.5531 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7791 3.7931 0.8520 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0334 4.1257 -0.9522 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4115 1.3771 0.2350 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9634 0.1517 1.0840 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2715 -1.0391 0.5036 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1875 -0.2045 2.0456 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4282 1.7018 1.2061 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9274 -1.5019 -0.4548 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7321 -1.1572 -0.7515 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1464 -1.9823 0.6737 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2546 0.6786 2.7151 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0513 -1.0539 2.2623 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0746 -1.6116 2.9917 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1652 0.0246 3.6364 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0454 -0.0124 2.6167 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7699 1.4852 -1.1417 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0362 1.1080 -0.0053 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0903 -0.2502 -0.6564 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7266 2.9619 0.9093 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9655 2.3961 2.4599 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6370 1.9124 2.0222 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3672 2.0248 1.1967 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3147 2.7103 -0.8520 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8937 1.2147 -1.7005 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2400 3.0114 -1.8894 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2103 3.0886 -0.0222 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2332 0.1136 -2.0997 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2367 1.2393 -2.9230 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5100 -0.2388 -2.0691 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7623 4.3002 -0.3361 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4330 3.5939 0.7183 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8049 4.1203 -1.0366 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2244 3.5918 -2.2927 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0686 2.6277 -3.1118 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5437 0.6231 -2.9164 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8364 1.5376 -4.4471 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1222 -1.4209 2.6142 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0301 -0.9625 0.3696 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8504 -3.0542 -0.8925 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6057 -4.6896 0.8820 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5036 -5.2446 1.8560 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5535 -4.3131 0.6862 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4039 -5.3790 -0.7239 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4041 -3.5211 -1.5681 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1214 -0.0652 1.2097 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7056 -1.3093 -0.3296 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4177 -2.3510 0.8828 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6492 -0.0275 2.8601 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7986 -2.4560 2.8165 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0349 -2.2531 5.0353 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3316 -0.6198 5.2636 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2883 -2.0849 5.1787 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.3192 -1.3632 3.2834 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.8101 -2.3237 -0.1149 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.7701 -0.1185 0.5640 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.4382 -2.1679 -1.6056 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.2691 0.8600 -1.3385 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.5316 -0.2221 -3.4153 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.6340 2.0220 -2.5448 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9580 1.3281 -2.3887 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.4029 2.4921 -0.4931 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.7837 0.9014 -3.5068 H 0 0 0 0 0 0 0 0 0 0 0 0 -18.3646 -1.0663 -1.3376 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.5049 -2.7286 0.6750 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8574 1.1582 0.9369 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2277 -2.8432 -3.7050 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8583 -2.8781 -4.2678 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8579 -3.8392 0.5074 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8382 -2.2510 -0.2705 H 0 0 0 0 0 0 0 0 0 0 0 0 16.6917 -2.2339 -1.5210 H 0 0 0 0 0 0 0 0 0 0 0 0 17.5998 -2.8111 1.4291 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 10 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 15 18 1 0 14 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 25 27 1 0 27 28 1 0 28 29 2 0 30 28 1 1 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 33 35 1 0 33 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 6 42 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 47 49 1 0 47 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 6 53 55 1 0 55 56 1 1 55 57 1 0 57 58 1 0 58 59 1 0 46 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 64 67 1 0 63 68 1 0 62 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 74 76 1 0 73 77 1 0 72 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 81 82 1 0 82 83 1 0 83 84 1 0 84 85 1 0 83 86 1 0 82 87 1 0 81 88 1 0 80 89 1 0 71 90 1 0 24 91 1 0 23 92 1 0 22 93 1 0 5 94 1 0 4 95 1 0 3 96 1 0 7 2 1 0 16 9 1 0 26 21 1 0 37 30 1 0 55 38 1 0 66 61 1 0 76 70 1 0 86 79 1 0 58 30 1 0 53 41 1 0 50 42 1 0 1 97 1 0 1 98 1 0 1 99 1 0 2100 1 1 3101 1 6 4102 1 1 5103 1 6 6104 1 1 9105 1 1 10106 1 6 11107 1 0 11108 1 0 12109 1 0 14110 1 6 15111 1 1 16112 1 6 17113 1 0 18114 1 0 20115 1 0 20116 1 0 21117 1 1 22118 1 6 23119 1 1 24120 1 6 25121 1 6 31122 1 0 31123 1 0 32124 1 0 32125 1 0 34126 1 0 34127 1 0 34128 1 0 35129 1 0 35130 1 0 35131 1 0 36132 1 0 36133 1 0 37134 1 1 39135 1 0 40136 1 0 40137 1 0 41138 1 1 43139 1 0 43140 1 0 43141 1 0 44142 1 0 44143 1 0 45144 1 0 45145 1 0 46146 1 1 48147 1 0 48148 1 0 48149 1 0 49150 1 0 49151 1 0 49152 1 0 50153 1 1 51154 1 0 51155 1 0 52156 1 0 52157 1 0 54158 1 0 54159 1 0 54160 1 0 56161 1 0 56162 1 0 56163 1 0 57164 1 0 57165 1 0 58166 1 6 59167 1 0 61168 1 1 62169 1 6 63170 1 6 64171 1 1 65172 1 0 65173 1 0 67174 1 0 68175 1 0 70176 1 6 71177 1 6 72178 1 1 73179 1 6 74180 1 6 75181 1 0 75182 1 0 75183 1 0 77184 1 0 79185 1 1 80186 1 1 81187 1 6 82188 1 1 83189 1 6 84190 1 0 84191 1 0 85192 1 0 87193 1 0 88194 1 0 89195 1 0 90196 1 0 91197 1 0 92198 1 0 93199 1 0 94200 1 0 95201 1 0 96202 1 0 M END

Standard InCHIKey	OTYZZRSHKOARGC-DVNYEYTMSA-N
Standard InCHI	InChI=1S/C65H106O31/c1-24-36(70)41(75)45(79)54(87-24)93-50-30(21-67)90-53(48(82)44(50)78)86-23-31-40(74)43(77)47(81)56(91-31)96-59(84)65-17-16-60(3,4)18-27(65)26-10-11-33-62(7)14-13-35(61(5,6)32(62)12-15-63(33,8)64(26,9)19-34(65)69)92-58-52(38(72)28(68)22-85-58)95-57-49(83)51(37(71)25(2)88-57)94-55-46(80)42(76)39(73)29(20-66)89-55/h10,24-25,27-58,66-83H,11-23H2,1-9H3/t24-,25-,27-,28-,29+,30+,31+,32-,33+,34+,35-,36-,37-,38-,39+,40+,41+,42-,43-,44+,45+,46+,47+,48+,49+,50+,51+,52+,53+,54-,55-,56-,57-,58-,62-,63+,64+,65+/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@@H](CO)O[C@H]([C@@H]([C@H]1O)O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC(=O)[C@]12CCC(C)(C)C[C@H]1C1=CC[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)C[C@H]2O)O[C@H]1[C@@H]([C@H]([C@H](CO1)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](C)O1)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1382.67	Volume:	1305.899 ? Van der Waals volume.
Dense:	1.059	LogP:	0.313 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.124 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.057 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	63.0
TPSA:	491.97 ? Topological Polar Surface Area.	H-Bond Acceptor:	31.0
H-Bond Donor:	18.0	Rings:	11.0
Heavy Atoms:	31.0

MedChem Properties

QED Drug-Likeness Score:	0.042	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.76	Fsp³:	0.954
MCE-18:	242.504 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.695	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.383	Promiscuous compounds:	0.094

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.132	MDCK Permeability:	-4.905
Pgp-inhibitor:	0.0	Pgp-substrate:	0.904
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	0.933	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.001
Plasma Protein Binding (PPB):	51.716%	Volume Distribution (VD):	-0.28
Fu:	23.919% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.025
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.456

Half-life (T1/2):

5.133

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.762	Drug-induced Liver Injury (DILI):	0.996
AMES Toxicity:	0.992	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.004	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.679	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.307	RPMI-8226 Immunitoxicity:	0.563
A549 Cytotoxicity:	0.977	Hek293 Cytotoxicity:	0.28
BCF:	1.129 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.432 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.944 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.883 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33015	trevesia palmata	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10757708]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3

Activity Type	# Activity
Cell line	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1886	Cell line	J774	Mus musculus	IC50	=	110.0	nM	PMID[15711537]
NPT71	Cell line	HEK293	Homo sapiens	IC50	=	150.0	nM	PMID[24012119]
NPT3470	Cell line	WEHI-164	Mus musculus	IC50	=	240.0	nM	PMID[15568791]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC220160 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25221
0.1-0.2	20715
0.2-0.3	2604
0.3-0.4	677
0.4-0.5	341
0.5-0.6	84
0.6-0.7	69
0.7-0.8	0
0.8-0.85	6
0.85-0.9	3
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8571	High Similarity	NPC305981
0.85	High Similarity	NPC261506
0.85	High Similarity	NPC4328
0.8403	Intermediate Similarity	NPC41061
0.8403	Intermediate Similarity	NPC227551
0.8264	Intermediate Similarity	NPC236638
0.8264	Intermediate Similarity	NPC294453
0.825	Intermediate Similarity	NPC475514
0.8	Intermediate Similarity	NPC250247
0.7903	Intermediate Similarity	NPC298034
0.7903	Intermediate Similarity	NPC71065
0.7899	Intermediate Similarity	NPC135904
0.7886	Intermediate Similarity	NPC43550
0.7731	Intermediate Similarity	NPC79643
0.768	Intermediate Similarity	NPC202828
0.768	Intermediate Similarity	NPC119592
0.7647	Intermediate Similarity	NPC60557
0.7647	Intermediate Similarity	NPC67857
0.7603	Intermediate Similarity	NPC123199
0.7581	Intermediate Similarity	NPC110633
0.7561	Intermediate Similarity	NPC481080
0.75	Intermediate Similarity	NPC475287
0.744	Intermediate Similarity	NPC286457
0.7391	Intermediate Similarity	NPC164389
0.7323	Intermediate Similarity	NPC65105
0.7317	Intermediate Similarity	NPC475209
0.7266	Intermediate Similarity	NPC136768
0.7252	Intermediate Similarity	NPC102505
0.7252	Intermediate Similarity	NPC488514
0.7222	Intermediate Similarity	NPC21691
0.7209	Intermediate Similarity	NPC302543
0.7165	Intermediate Similarity	NPC13998
0.7143	Intermediate Similarity	NPC85154
0.7132	Intermediate Similarity	NPC481081
0.712	Intermediate Similarity	NPC475160
0.712	Intermediate Similarity	NPC473714
0.7109	Intermediate Similarity	NPC470876
0.7107	Intermediate Similarity	NPC104137
0.7107	Intermediate Similarity	NPC26626
0.7107	Intermediate Similarity	NPC481078
0.7087	Intermediate Similarity	NPC476068
0.7077	Intermediate Similarity	NPC309223
0.7073	Intermediate Similarity	NPC76972
0.7073	Intermediate Similarity	NPC469782
0.7073	Intermediate Similarity	NPC204414
0.7016	Intermediate Similarity	NPC123522
0.6963	Remote Similarity	NPC33012
0.6929	Remote Similarity	NPC488560
0.6923	Remote Similarity	NPC293330
0.6923	Remote Similarity	NPC161717
0.6899	Remote Similarity	NPC473452
0.6891	Remote Similarity	NPC63159
0.6889	Remote Similarity	NPC8524
0.6885	Remote Similarity	NPC295823
0.6885	Remote Similarity	NPC174720
0.6885	Remote Similarity	NPC475467
0.6884	Remote Similarity	NPC489208
0.6875	Remote Similarity	NPC4749
0.685	Remote Similarity	NPC283417
0.685	Remote Similarity	NPC200049
0.6846	Remote Similarity	NPC469778
0.6825	Remote Similarity	NPC165204
0.6803	Remote Similarity	NPC469776
0.6779	Remote Similarity	NPC32723
0.6733	Remote Similarity	NPC481323
0.6718	Remote Similarity	NPC258617
0.6691	Remote Similarity	NPC489209
0.6667	Remote Similarity	NPC488526
0.6645	Remote Similarity	NPC135334
0.6645	Remote Similarity	NPC295941
0.6639	Remote Similarity	NPC112352
0.6601	Remote Similarity	NPC481324
0.6512	Remote Similarity	NPC251263
0.648	Remote Similarity	NPC69811
0.6466	Remote Similarity	NPC1046
0.6462	Remote Similarity	NPC100639
0.6439	Remote Similarity	NPC57484
0.6385	Remote Similarity	NPC219180
0.6385	Remote Similarity	NPC155410
0.6371	Remote Similarity	NPC64715
0.6358	Remote Similarity	NPC469775
0.6349	Remote Similarity	NPC241909
0.6346	Remote Similarity	NPC469777
0.634	Remote Similarity	NPC469774
0.6291	Remote Similarity	NPC23020
0.629	Remote Similarity	NPC475504
0.626	Remote Similarity	NPC305267
0.625	Remote Similarity	NPC11242
0.6232	Remote Similarity	NPC224381
0.6226	Remote Similarity	NPC469772
0.6218	Remote Similarity	NPC100925
0.621	Remote Similarity	NPC148417
0.6197	Remote Similarity	NPC480421
0.6172	Remote Similarity	NPC207738
0.6169	Remote Similarity	NPC472270
0.6169	Remote Similarity	NPC112492
0.6165	Remote Similarity	NPC54636
0.6159	Remote Similarity	NPC70809
0.6159	Remote Similarity	NPC478559
0.6159	Remote Similarity	NPC485563
0.6159	Remote Similarity	NPC478560
0.6149	Remote Similarity	NPC469773
0.6142	Remote Similarity	NPC481079
0.6124	Remote Similarity	NPC815
0.6107	Remote Similarity	NPC192600
0.6074	Remote Similarity	NPC237191
0.6061	Remote Similarity	NPC133818
0.6048	Remote Similarity	NPC104071
0.6047	Remote Similarity	NPC475486
0.6028	Remote Similarity	NPC68767
0.6016	Remote Similarity	NPC76497
0.6	Remote Similarity	NPC475208
0.6	Remote Similarity	NPC102439
0.6	Remote Similarity	NPC232237
0.6	Remote Similarity	NPC48499
0.5984	Remote Similarity	NPC480420
0.5971	Remote Similarity	NPC144644
0.5971	Remote Similarity	NPC170407
0.597	Remote Similarity	NPC480423
0.5956	Remote Similarity	NPC473386
0.5952	Remote Similarity	NPC105800
0.5942	Remote Similarity	NPC471385
0.5915	Remote Similarity	NPC293031
0.5891	Remote Similarity	NPC324875
0.5891	Remote Similarity	NPC292677
0.5887	Remote Similarity	NPC482010
0.5873	Remote Similarity	NPC46665
0.5857	Remote Similarity	NPC37860
0.5857	Remote Similarity	NPC476991
0.5855	Remote Similarity	NPC475584
0.5855	Remote Similarity	NPC475152
0.5833	Remote Similarity	NPC480422
0.5809	Remote Similarity	NPC471577
0.58	Remote Similarity	NPC329893
0.5794	Remote Similarity	NPC160415
0.5794	Remote Similarity	NPC117714
0.5794	Remote Similarity	NPC30289
0.5778	Remote Similarity	NPC166422
0.576	Remote Similarity	NPC469946
0.5742	Remote Similarity	NPC311178
0.5735	Remote Similarity	NPC470218
0.5733	Remote Similarity	NPC484831
0.5733	Remote Similarity	NPC484830
0.5724	Remote Similarity	NPC475394
0.5714	Remote Similarity	NPC185466
0.5692	Remote Similarity	NPC104372
0.5686	Remote Similarity	NPC233223
0.5686	Remote Similarity	NPC183816
0.5686	Remote Similarity	NPC43589
0.5664	Remote Similarity	NPC142151
0.5655	Remote Similarity	NPC153673
0.5655	Remote Similarity	NPC51099
0.5646	Remote Similarity	NPC275225
0.5643	Remote Similarity	NPC471580
0.5621	Remote Similarity	NPC329878
0.5621	Remote Similarity	NPC484829
0.5605	Remote Similarity	NPC222951
0.5591	Remote Similarity	NPC223301
0.5591	Remote Similarity	NPC171544
0.559	Remote Similarity	NPC322904
0.5588	Remote Similarity	NPC471384
0.5588	Remote Similarity	NPC470911
0.558	Remote Similarity	NPC25663
0.5574	Remote Similarity	NPC238935
0.5564	Remote Similarity	NPC31838
0.5556	Remote Similarity	NPC295371
0.5556	Remote Similarity	NPC267694
0.5556	Remote Similarity	NPC610204
0.5548	Remote Similarity	NPC110385
0.5548	Remote Similarity	NPC300655
0.5548	Remote Similarity	NPC196874
0.5538	Remote Similarity	NPC123796
0.5538	Remote Similarity	NPC297263
0.552	Remote Similarity	NPC475516
0.5512	Remote Similarity	NPC263756
0.5512	Remote Similarity	NPC213674
0.5504	Remote Similarity	NPC173859
0.5504	Remote Similarity	NPC473459
0.5504	Remote Similarity	NPC148603
0.5504	Remote Similarity	NPC480475
0.5496	Remote Similarity	NPC471435
0.5496	Remote Similarity	NPC471434
0.549	Remote Similarity	NPC472268
0.5476	Remote Similarity	NPC476113
0.5461	Remote Similarity	NPC265841
0.546	Remote Similarity	NPC324933
0.5455	Remote Similarity	NPC276093
0.5448	Remote Similarity	NPC51564
0.5448	Remote Similarity	NPC187290
0.543	Remote Similarity	NPC475177
0.5425	Remote Similarity	NPC297950
0.542	Remote Similarity	NPC481082
0.542	Remote Similarity	NPC222580
0.542	Remote Similarity	NPC164419
0.5414	Remote Similarity	NPC301449
0.5414	Remote Similarity	NPC601290
0.5385	Remote Similarity	NPC101744
0.5373	Remote Similarity	NPC80986
0.5362	Remote Similarity	NPC323341

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC220160 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7868
0.1-0.2	1228
0.2-0.3	49
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data