NPASS Compound

Natural Product: NPC144644

Natural Product ID	NPC144644
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Polygalacin D
IUPAC Name	[(2S,3R,4S,5S)-3-[(2S,3R,4S,5R,6S)-5-[(2S,3R,4S,5R)-4-[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-3,5-dihydroxyoxan-2-yl]oxy-3,4-dihydroxy-6-methyloxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl] (4aR,5R,6aR,6aS,6bR,8aR,9R,10R,11S,12aR,14bS)-5,11-dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Synonyms	Polygalacin D
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1641863
PubChem CID	53325780
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 176185 0 0 0 0 0 0 0 0999 V2000 -11.9122 1.3420 4.2313 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.9118 1.6552 3.3036 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3412 2.0438 1.9796 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.5655 1.0029 1.4147 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9134 1.5755 0.3180 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.7139 0.9306 0.0448 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6111 1.7574 0.2623 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8751 1.1366 1.4310 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.7222 1.0401 2.5303 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1998 -0.1436 1.0941 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3652 -0.1162 -0.1570 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4356 1.2399 -0.7676 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7981 1.8208 -0.9764 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5183 1.3236 -2.1828 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5662 3.3273 -1.2324 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8105 3.9640 -1.3842 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5743 1.2411 -1.9840 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1257 1.2586 -1.4713 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8595 0.0140 -0.6697 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9378 -0.3893 0.2464 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7089 -1.8006 0.6952 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2565 -1.9858 0.9398 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2987 -1.0940 0.7460 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6231 0.2683 0.2290 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.9892 1.2378 1.3330 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4850 0.8640 -0.5300 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1578 0.6700 0.0978 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1634 -0.7612 0.4214 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9191 -1.5393 1.0668 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6986 -1.5178 2.5662 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4466 -2.4941 2.8448 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0156 -3.8794 2.4117 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7416 -2.5748 4.3239 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6117 -2.0382 2.0230 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3848 -0.6970 1.3594 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6678 -1.3889 -0.8308 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7982 -0.7434 -1.9084 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0360 -2.7472 -0.9076 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5103 -3.3049 -2.1176 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6392 -4.2772 -2.6106 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6887 -5.4430 -1.8490 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0058 -6.1665 -2.0418 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0659 -5.2031 -2.5559 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9144 -3.8786 -1.8881 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7989 -2.9243 -2.3228 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6116 -2.3735 -1.3480 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3041 -1.0138 -1.1515 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2759 -0.1554 -1.5950 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7326 1.2612 -1.4104 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5403 -0.3109 -0.8121 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0048 -1.7230 -0.8664 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0478 -2.5431 -1.7387 C 0 0 1 0 0 0 0 0 0 0 0 0 6.4361 -3.8718 -1.5498 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0663 -2.2483 0.4176 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5252 0.5999 -1.1961 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9162 1.4665 -0.2076 C 0 0 2 0 0 0 0 0 0 0 0 0 7.7832 2.8161 -0.5362 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2939 3.1087 -1.7762 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7791 2.9742 -1.7625 C 0 0 2 0 0 0 0 0 0 0 0 0 10.2472 2.4140 -0.4196 C 0 0 1 0 0 0 0 0 0 0 0 0 9.4042 1.2453 0.0181 C 0 0 1 0 0 0 0 0 0 0 0 0 9.6676 1.0539 1.3839 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5366 1.9287 -0.6653 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5159 2.5235 0.0927 C 0 0 2 0 0 0 0 0 0 0 0 0 13.4167 3.2583 -0.6749 O 0 0 0 0 0 0 0 0 0 0 0 0 14.5977 3.3761 -0.0194 C 0 0 0 0 0 0 0 0 0 0 0 0 14.6678 2.2813 0.9968 C 0 0 2 0 0 0 0 0 0 0 0 0 13.3324 1.6066 0.9344 C 0 0 1 0 0 0 0 0 0 0 0 0 12.8319 1.4832 2.2353 O 0 0 0 0 0 0 0 0 0 0 0 0 14.9284 2.7718 2.2835 O 0 0 0 0 0 0 0 0 0 0 0 0 15.8048 1.3108 0.7024 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8413 0.2841 1.6173 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4280 4.1880 -2.0068 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2830 -5.8323 -2.3503 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4414 -6.6411 -0.8057 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1040 1.4282 1.2246 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3741 -1.0459 -1.6258 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8642 -1.2286 -1.0446 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8726 1.6490 -0.8188 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.2838 1.7215 -0.3095 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.4100 2.4798 0.9989 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.4294 3.8466 0.7802 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.8018 0.4332 -0.0477 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6584 2.7811 -1.6103 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6005 2.1613 4.7051 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.6378 0.8166 3.2337 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4568 2.5327 3.7049 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6513 2.8966 2.1180 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6487 2.6219 0.6231 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9653 2.7623 0.5801 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0873 1.8638 1.7134 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9763 0.0815 2.7167 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9899 -0.9275 1.0606 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5575 -0.4162 1.9537 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9371 1.9348 -0.0235 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3842 0.6996 -1.8844 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8575 0.8042 -2.9112 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9844 2.1559 -2.7945 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0908 3.4076 -2.2292 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9248 3.7795 -0.4791 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0249 4.2069 -2.2983 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6629 2.1005 -2.6436 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7202 0.3389 -2.6154 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9178 2.1990 -0.9702 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5033 1.2372 -2.4033 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8124 0.2178 1.2008 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0302 -2.5789 -0.0238 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2461 -1.9352 1.6607 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0040 -2.9944 1.3245 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1874 0.7257 2.3016 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1293 1.9307 1.5810 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7928 1.9543 1.0387 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6530 1.9802 -0.5982 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4213 0.5402 -1.5917 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6204 0.9995 -0.6567 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7640 -2.6176 0.7597 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5736 -1.8899 3.1233 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4508 -0.5188 2.9471 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3895 -4.6534 3.1124 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1019 -3.9780 2.4313 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4324 -4.1508 1.4038 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1767 -3.0135 4.7943 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5490 -3.3073 4.4570 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9646 -1.5714 4.7422 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4796 -1.8930 2.7090 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9386 -2.7769 1.2718 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2635 -0.4939 0.7170 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2935 0.1139 2.0804 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5437 -2.5141 -2.8795 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1512 -6.0938 -2.1568 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5563 -5.2090 -0.7737 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9361 -6.9952 -2.7726 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8838 -5.0553 -3.6597 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0712 -4.0091 -0.7947 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4634 -2.8281 -0.3392 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4506 -0.3181 -2.6877 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7328 1.2960 -1.8885 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3564 1.9927 -1.9668 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6852 1.4725 -0.3311 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3155 -0.0544 0.2545 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9983 -1.8440 -1.3529 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1876 -2.2380 -2.7986 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7218 -4.2329 -2.4204 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7653 -3.2079 0.4361 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4043 1.3303 0.7615 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0613 4.1848 -1.9885 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8553 2.4713 -2.5832 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0966 2.2614 -2.5555 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2335 3.2003 0.3616 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7686 0.3326 -0.5126 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8705 0.0936 1.5714 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0244 3.2733 0.7611 H 0 0 0 0 0 0 0 0 0 0 0 0 14.6588 4.3435 0.5505 H 0 0 0 0 0 0 0 0 0 0 0 0 15.4937 3.2658 -0.6793 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4954 0.6008 0.4920 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0461 2.0730 2.3723 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3546 3.5550 2.5053 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7998 0.9417 -0.3257 H 0 0 0 0 0 0 0 0 0 0 0 0 16.7518 1.9067 0.8424 H 0 0 0 0 0 0 0 0 0 0 0 0 16.2774 0.5637 2.4546 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0584 4.0994 -2.7389 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1829 -6.8184 -2.2927 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6239 -5.8987 -0.1915 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3964 2.3494 1.0116 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4888 -0.6876 -2.6922 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9112 -1.9965 -1.5955 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3009 -1.2906 -1.5397 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8781 -1.0763 -1.4311 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9649 -2.1269 -0.3632 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2252 -1.4886 -1.8809 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8364 0.7290 -1.4665 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.9993 2.1817 -1.0222 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.3887 2.1957 1.4395 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0173 4.3376 1.5177 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.7213 0.5388 0.2638 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5126 3.1379 -1.9219 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 6 13 15 1 0 15 16 1 0 12 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 2 0 23 24 1 0 24 25 1 1 24 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 31 34 1 0 34 35 1 0 28 36 1 6 36 37 2 0 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 48 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 51 54 1 0 50 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 60 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 67 70 1 1 67 71 1 0 71 72 1 0 59 73 1 0 43 74 1 0 42 75 1 0 27 76 1 0 19 77 1 6 11 78 1 6 5 79 1 0 79 80 1 0 80 81 1 0 81 82 1 0 80 83 1 0 79 84 1 0 81 3 1 0 13 7 1 0 24 19 1 0 35 28 1 0 44 39 1 0 52 46 1 0 61 56 1 0 68 64 1 0 20 11 1 0 29 23 1 0 1 85 1 0 2 86 1 0 2 87 1 0 3 88 1 1 5 89 1 1 7 90 1 1 8 91 1 1 9 92 1 0 10 93 1 0 10 94 1 0 12 95 1 1 14 96 1 0 14 97 1 0 14 98 1 0 15 99 1 0 15100 1 0 16101 1 0 17102 1 0 17103 1 0 18104 1 0 18105 1 0 20106 1 1 21107 1 0 21108 1 0 22109 1 0 25110 1 0 25111 1 0 25112 1 0 26113 1 0 26114 1 0 27115 1 6 29116 1 6 30117 1 0 30118 1 0 32119 1 0 32120 1 0 32121 1 0 33122 1 0 33123 1 0 33124 1 0 34125 1 0 34126 1 0 35127 1 0 35128 1 0 39129 1 6 41130 1 0 41131 1 0 42132 1 6 43133 1 6 44134 1 1 46135 1 1 48136 1 6 49137 1 0 49138 1 0 49139 1 0 50140 1 1 51141 1 6 52142 1 6 53143 1 0 54144 1 0 56145 1 1 58146 1 0 58147 1 0 59148 1 6 60149 1 1 61150 1 6 62151 1 0 64152 1 1 66153 1 0 66154 1 0 68155 1 6 69156 1 0 70157 1 0 71158 1 0 71159 1 0 72160 1 0 73161 1 0 74162 1 0 75163 1 0 76164 1 0 77165 1 0 77166 1 0 77167 1 0 78168 1 0 78169 1 0 78170 1 0 79171 1 6 80172 1 6 81173 1 1 82174 1 0 83175 1 0 84176 1 0 M END

Standard InCHIKey	BDCUGHMNUOTFKX-YJGMJMKZSA-N
Standard InCHI	InChI=1S/C57H92O27/c1-23-40(80-45-39(71)41(28(63)19-75-45)81-49-43(72)56(74,21-60)22-77-49)36(68)38(70)46(78-23)82-42-33(65)27(62)18-76-48(42)84-50(73)57-13-12-51(2,3)14-25(57)24-8-9-31-52(4)15-26(61)44(83-47-37(69)35(67)34(66)29(17-58)79-47)53(5,20-59)30(52)10-11-54(31,6)55(24,7)16-32(57)64/h8,23,25-49,58-72,74H,9-22H2,1-7H3/t23-,25-,26-,27-,28+,29+,30+,31+,32+,33-,34+,35-,36-,37+,38+,39+,40-,41-,42+,43-,44-,45-,46-,47-,48-,49-,52-,53-,54+,55+,56+,57+/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@@H](O)C[C@]3([C@H]([C@]2(C)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)C[C@H]([C@@]2([C@H]3CC(C)(C)CC2)C(=O)O[C@@H]2OC[C@@H]([C@@H]([C@H]2O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O[C@@H]2OC[C@H]([C@@H]([C@H]2O)O[C@@H]2OC[C@]([C@H]2O)(O)CO)O)O)O)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1208.58	Volume:	1140.926 ? Van der Waals volume.
Dense:	1.059	LogP:	0.316 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.244 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.169 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	14.0	Rigid Bonds:	56.0
TPSA:	433.05 ? Topological Polar Surface Area.	H-Bond Acceptor:	27.0
H-Bond Donor:	16.0	Rings:	10.0
Heavy Atoms:	27.0

MedChem Properties

QED Drug-Likeness Score:	0.047	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.406	Fsp³:	0.947
MCE-18:	220.631 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.667	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.229	Promiscuous compounds:	0.367

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.055	MDCK Permeability:	-4.964
Pgp-inhibitor:	0.0	Pgp-substrate:	0.979
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.96
20% Bioavailability (F20%):	0.679	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.02	MRP1:	0.036
Plasma Protein Binding (PPB):	61.265%	Volume Distribution (VD):	-0.347
Fu:	23.523% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.004
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.031
HLM stability:	0.026 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.671

Half-life (T1/2):

3.817

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.853	Drug-induced Liver Injury (DILI):	0.926
AMES Toxicity:	0.986	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.09	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.741	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.441	RPMI-8226 Immunitoxicity:	0.414
A549 Cytotoxicity:	0.983	Hek293 Cytotoxicity:	0.654
BCF:	0.88 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.323 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.886 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.834 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	root	n.a.	PMID[17851435]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	Roots	n.a.	n.a.	PMID[20939516]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	root	n.a.	PMID[20939516]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO214	Platycodon grandiflorus	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO29808	Platycodon grandiflorum	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO214	Platycodon grandiflorus	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO214	Platycodon grandiflorus	Species	Campanulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4

Activity Type	# Activity
Cell line	1
Non-molecular	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT148	Cell line	HCT-15	Homo sapiens	IC50	=	8500.0	nM	PMID[20939516]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	5000.0	nM	PMID[20939516]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	7700.0	nM	PMID[20939516]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	>	10000.0	nM	PMID[20939516]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC144644 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24774
0.1-0.2	21547
0.2-0.3	2648
0.3-0.4	498
0.4-0.5	282
0.5-0.6	62
0.6-0.7	21
0.7-0.8	0
0.8-0.85	2
0.85-0.9	5
0.9-0.95	1
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC170407
0.9649	High Similarity	NPC68767
0.9298	High Similarity	NPC37860
0.8983	High Similarity	NPC293031
0.8974	High Similarity	NPC142151
0.8908	High Similarity	NPC153673
0.875	High Similarity	NPC51099
0.8689	High Similarity	NPC275225
0.8347	Intermediate Similarity	NPC267694
0.8293	Intermediate Similarity	NPC110385
0.7917	Intermediate Similarity	NPC237191
0.7833	Intermediate Similarity	NPC85154
0.7759	Intermediate Similarity	NPC815
0.7674	Intermediate Similarity	NPC480421
0.7143	Intermediate Similarity	NPC13998
0.7083	Intermediate Similarity	NPC104137
0.7083	Intermediate Similarity	NPC26626
0.7008	Intermediate Similarity	NPC473452
0.6693	Remote Similarity	NPC480423
0.6615	Remote Similarity	NPC286457
0.6593	Remote Similarity	NPC102505
0.6593	Remote Similarity	NPC488514
0.6569	Remote Similarity	NPC33012
0.6512	Remote Similarity	NPC471577
0.6496	Remote Similarity	NPC8524
0.6418	Remote Similarity	NPC309223
0.6412	Remote Similarity	NPC473386
0.6379	Remote Similarity	NPC475208
0.6351	Remote Similarity	NPC485563
0.6241	Remote Similarity	NPC480418
0.623	Remote Similarity	NPC164389
0.6194	Remote Similarity	NPC471580
0.6154	Remote Similarity	NPC475899
0.6131	Remote Similarity	NPC70809
0.6122	Remote Similarity	NPC475394
0.6115	Remote Similarity	NPC478825
0.604	Remote Similarity	NPC475584
0.604	Remote Similarity	NPC475152
0.6028	Remote Similarity	NPC480422
0.5971	Remote Similarity	NPC220160
0.5963	Remote Similarity	NPC488513
0.5956	Remote Similarity	NPC470876
0.5948	Remote Similarity	NPC23020
0.5935	Remote Similarity	NPC472270
0.5935	Remote Similarity	NPC112492
0.5845	Remote Similarity	NPC489209
0.5839	Remote Similarity	NPC475514
0.582	Remote Similarity	NPC480420
0.5775	Remote Similarity	NPC480417
0.5748	Remote Similarity	NPC488517
0.5746	Remote Similarity	NPC480419
0.5714	Remote Similarity	NPC489208
0.5691	Remote Similarity	NPC150400
0.5636	Remote Similarity	NPC476113
0.5634	Remote Similarity	NPC224381
0.5634	Remote Similarity	NPC482010
0.562	Remote Similarity	NPC4749
0.562	Remote Similarity	NPC1046
0.5597	Remote Similarity	NPC123522
0.5588	Remote Similarity	NPC283417
0.5588	Remote Similarity	NPC200049
0.558	Remote Similarity	NPC21691
0.5573	Remote Similarity	NPC69811
0.5468	Remote Similarity	NPC57484
0.5461	Remote Similarity	NPC472268
0.5455	Remote Similarity	NPC475892
0.5455	Remote Similarity	NPC475527
0.5395	Remote Similarity	NPC297950
0.539	Remote Similarity	NPC484942
0.5385	Remote Similarity	NPC302543
0.5385	Remote Similarity	NPC475504
0.5352	Remote Similarity	NPC293330
0.5349	Remote Similarity	NPC488526
0.5349	Remote Similarity	NPC305267
0.5338	Remote Similarity	NPC485562
0.5278	Remote Similarity	NPC298034
0.5278	Remote Similarity	NPC71065
0.5259	Remote Similarity	NPC11242
0.5217	Remote Similarity	NPC472269
0.5208	Remote Similarity	NPC202828
0.5208	Remote Similarity	NPC119592
0.52	Remote Similarity	NPC179434
0.5182	Remote Similarity	NPC475287
0.5172	Remote Similarity	NPC33068
0.5161	Remote Similarity	NPC238935
0.5154	Remote Similarity	NPC117714
0.5143	Remote Similarity	NPC471550
0.5132	Remote Similarity	NPC475368
0.5118	Remote Similarity	NPC139894
0.5118	Remote Similarity	NPC475516
0.5113	Remote Similarity	NPC64715
0.5103	Remote Similarity	NPC477463
0.5102	Remote Similarity	NPC478824
0.5074	Remote Similarity	NPC481078
0.5069	Remote Similarity	NPC41061
0.5069	Remote Similarity	NPC227551
0.5068	Remote Similarity	NPC476991
0.5066	Remote Similarity	NPC478822
0.5035	Remote Similarity	NPC475160
0.5035	Remote Similarity	NPC473714
0.5033	Remote Similarity	NPC477464

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC144644 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7787
0.1-0.2	1321
0.2-0.3	42
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data