Drug Information| Drug ID:   | NPD5226 |
| Drug Name:   | Dexamethasone |
| Molecular Formula:   | C22H29FO5 |
| Canonical SMILES:   | OCC(=O)[C@@]1(O)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2CCC2=CC(=O)C=C[C@]12C)F |
| Standard InCHI:   | "InChI=1S/C22H29FO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,9,12,15-17,24,26,28H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,17+,19+,20+,21+,22+/m1/s1" |
| Standard InCHIKey:   | UREBDLICKHMUKA-CXSFZGCWSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD5226Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC331613 |
| High Similarity | 1.0 | NPC599856 |
| Remote Similarity | 0.5467 | NPC481929 |
| Remote Similarity | 0.5467 | NPC608433 |
| Molecular Weight   | 392.2 |
| ALogP   | -0.944 |
| MLogP   | 3.22 |
| XLogP   | 1.138 |
| HDA   | 5 |
| HBD   | 3 |
| Rotatable Bonds   | 9 |
| TPSA   | 94.83 |
| RO5 Violation   | 0 |