Natural Product: NPC331613| Natural Product ID | NPC331613 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| UREBDLICKHMUKA-CXSFZGCWSA-N |
| IUPAC Name | n.a. |
| Synonyms | |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | n.a. |
| PubChem CID |
5743 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | UREBDLICKHMUKA-CXSFZGCWSA-N |
| Standard InCHI | InChI=1S/C22H29FO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,9,12,15-17,24,26,28H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,17+,19+,20+,21+,22+/m1/s1 |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@]3([C@H](C[C@]2(C)[C@]1(C(=O)CO)O)O)F |
  Calculated Properties| Molecular Weight:   | 392.2 | Volume:   | 394.315 Van der Waals volume.
|
| Dense:   | 0.995 | LogP:   | 1.321 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 1.779 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -3.509 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 2.0 | Rigid Bonds:   | 22.0 |
| TPSA:   | 94.83 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 5.0 |
| H-Bond Donor:   | 3.0 | Rings:   | 4.0 |
| Heavy Atoms:   | 6.0 |
| QED Drug-Likeness Score:   | 0.667 | GASA:   | 1.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 4.635 | Fsp3:   | 0.727 |
| MCE-18:   | 81.579 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Rejected | GSK Rule:   | Rejected |
| Golden Triangle Rule:   | Rejected | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.36 | Fluc inhibitor:   | 0.045 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.014 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.0 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.267 | Promiscuous compounds:   | 0.985 |
| Caco-2 Permeability:   | -4.911 | MDCK Permeability:   | -4.715 |
| Pgp-inhibitor:   | 0.187 | Pgp-substrate:   | 0.101 |
| PAMPA:   |
0.325 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.0 |
| 20% Bioavailability (F20%):   | 0.013 | 30% Bioavailability (F30%):   | 0.022 |
| 50% Bioavailability (F50%):   | 0.816 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.991 | MRP1:   | 0.85 |
| Plasma Protein Binding (PPB):   | 70.678% | Volume Distribution (VD):   | -0.002 |
| Fu: |
28.219% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.926 |
| OATP1B3 inhibitor:   | 0.978 | BCRP inhibitor:   | 0.199 |
| BSEP inhibitor:   | 0.996 |
| CYP1A2-inhibitor:   | 0.0 | CYP1A2-substrate:   | 0.0 |
| CYP2C19-inhibitor:   | 0.01 | CYP2C19-substrate:   | 0.007 |
| CYP2C9-inhibitor:   | 0.0 | CYP2C9-substrate:   | 0.0 |
| CYP2D6-inhibitor:   | 0.0 | CYP2D6-substrate:   | 0.307 |
| CYP3A4-inhibitor:   | 1.0 | CYP3A4-substrate:   | 0.018 |
| CYP2B6-substrate:   | 0.0 | CYP2C8-inhibitor:   | 1.0 |
| HLM stability:   |
0.004 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 2.677 | Half-life (T1/2):   | 2.43 |
| hERG Blockers:   | 0.04 | hERG Blockers (10um):   | 0.102 |
| Human Hepatotoxicity (H-HT):   | 0.501 | Drug-induced Liver Injury (DILI):   | 0.01 |
| AMES Toxicity:   | 0.102 | Rat Oral Acute Toxicity:   | 0.822 |
| Maximum Recommended Daily Dose:   | 0.999 | Skin Sensitization:   | 0.766 |
| Carcinogencity:   | 0.515 | Eye Corrosion:   | 0.001 |
| Eye Irritation:   | 0.472 | Respiratory Toxicity:   | 0.986 |
| Drug-induced Neurotoxicity:   | 0.088 | Ototoxicity:   | 0.85 |
| Hematotoxicity:   | 0.064 | Drug-induced Nephrotoxicity:   | 0.465 |
| Genotoxicity:   | 0.987 | RPMI-8226 Immunitoxicity:   | 0.329 |
| A549 Cytotoxicity:   | 0.0 | Hek293 Cytotoxicity:   | 0.104 |
| BCF:   |
0.661 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
3.357 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
4.994 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
4.269 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | n.a. | seed | n.a. | DOI[10.1016/0031-9422(96)00258-0] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | Seeds | Anhui province, China | DOI[10.1016/j.foodres.2020.109416] | |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | Seeds | Gansu province, China | DOI[10.1016/j.foodres.2020.109416] | |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | Seeds | Henan province, China | DOI[10.1016/j.foodres.2020.109416] | |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | Seeds | Shandong province, China | DOI[10.1016/j.foodres.2020.109416] | |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | Seeds | Shanxi province, China | DOI[10.1016/j.foodres.2020.109416] | |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | n.a. | fruit | n.a. | DOI[10.1016/S1383-5769(99)00023-9] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | root | n.a. | DOI[10.2174/092986712800229032] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[10086989] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | seeds | n.a. | n.a. |
PMID[11087592] |
| NPO29042 | Vincetoxicum atratum | Species | Apocynaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[11374953] |
| NPO520 | Euphorbia lathyris | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[12542364] |
| NPO30165 | Pongamia pinnata | Species | Fabaceae | Eukaryota | stem bark | Indonesia | 1999-SEP |
PMID[14510596] |
| NPO30165 | Pongamia pinnata | Species | Fabaceae | Eukaryota | n.a. | stem | n.a. |
PMID[14510596] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[1512598] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | Seeds | n.a. | n.a. |
PMID[15165151] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | seeds | n.a. | n.a. |
PMID[15730242] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | n.a. | bark | n.a. |
PMID[1593281] |
| NPO25980 | Rhododendron molle | Species | Ericaceae | Eukaryota | flowers | n.a. | n.a. |
PMID[15974620] |
| NPO17799 | Siraitia grosvenorii | Species | Cucurbitaceae | Eukaryota | n.a. | fruit | n.a. |
PMID[16268506] |
| NPO29530 | Kaempferia marginata | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[16309313] |
| NPO29417 | Fallopia multiflora | Species | Polygonaceae | Eukaryota | n.a. | root | n.a. |
PMID[16564530] |
| NPO1680 | Physalis angulata | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[17580910] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | fruit | Indonesia | n.a. |
PMID[17896817] |
| NPO12682 | Euphorbia helioscopia | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18321057] |
| NPO3821 | Sinularia flexibilis | Species | Alcyoniidae | Eukaryota | n.a. | chinese soft coral | n.a. |
PMID[18553926] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | n.a. | Vietnam | n.a. |
PMID[19026551] |
| NPO12682 | Euphorbia helioscopia | Species | Euphorbiaceae | Eukaryota | n.a. | whole plant | n.a. |
PMID[19099222] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[19402674] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | root | n.a. |
PMID[19721258] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | root | n.a. |
PMID[19772486] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | seeds | n.a. | n.a. |
PMID[20050684] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[20806783] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | root | n.a. |
PMID[21782011] |
| NPO17799 | Siraitia grosvenorii | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[21893415] |
| NPO1680 | Physalis angulata | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[21954931] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | root | n.a. |
PMID[22190295] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | Seeds | n.a. | n.a. |
PMID[22506620] |
| NPO23548 | Leonurus heterophyllus | Species | Lamiaceae | Eukaryota | Fruits | n.a. | n.a. |
PMID[22703163] |
| NPO1680 | Physalis angulata | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[23270478] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | seed | n.a. |
PMID[23497864] |
| NPO23548 | Leonurus heterophyllus | Species | Lamiaceae | Eukaryota | Fruits | n.a. | n.a. |
PMID[24328283] |
| NPO23548 | Leonurus heterophyllus | Species | Lamiaceae | Eukaryota | n.a. | aerial part | n.a. |
PMID[24704554] |
| NPO1680 | Physalis angulata | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[25396337] |
| NPO30165 | Pongamia pinnata | Species | Fabaceae | Eukaryota | dry stem | n.a. | n.a. |
PMID[25466192] |
| NPO25980 | Rhododendron molle | Species | Ericaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[26599832] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | root | n.a. |
PMID[26838074] |
| NPO1680 | Physalis angulata | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27295506] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | root | n.a. |
PMID[27313650] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | root | n.a. |
PMID[27429639] |
| NPO4734 | Syzygium nervosum | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27797185] |
| NPO17799 | Siraitia grosvenorii | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28448136] |
| NPO40871 | Laserpitium zernyi | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[28489375] |
| NPO27950 | Aspergillus ochraceopetaliformis | Species | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28598633] |
| NPO28734 | Physalis peruviana | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28617598] |
| NPO25980 | Rhododendron molle | Species | Ericaceae | Eukaryota | Leaves | n.a. | n.a. |
PMID[29272126] |
| NPO29417 | Fallopia multiflora | Species | Polygonaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[29359942] |
| NPO40105 | Dietes bicolor | Species | Iridaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29381070] |
| NPO40980 | Penicillium chrysogenum J08NF-4 | Strain | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29389121] |
| NPO30165 | Pongamia pinnata | Species | Fabaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[29482940] |
| NPO40028 | Artemisia freyniana | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29518326] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[29741372] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30028612] |
| NPO40356 | Spondias pinnata | Species | Anacardiaceae | Eukaryota | Bark | n.a. | n.a. |
PMID[30215255] |
| NPO3821 | Sinularia flexibilis | Species | Alcyoniidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30528697] |
| NPO28734 | Physalis peruviana | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30649869] |
| NPO12682 | Euphorbia helioscopia | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30724086] |
| NPO520 | Euphorbia lathyris | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30817151] |
| NPO28688 | Aster tataricus | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30931559] |
| NPO40479 | Colletotrichum sp. S8. | Strain | Glomerellaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31181925] |
| NPO8622 | Stauntonia hexaphylla | Species | Lardizabalaceae | Eukaryota | Fruits | n.a. | n.a. |
PMID[31301930] |
| NPO12682 | Euphorbia helioscopia | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31550154] |
| NPO22224 | Caragana jubata | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31577434] |
| NPO14563 | Kalimeris shimadae | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31804830] |
| NPO29530 | Kaempferia marginata | Species | Zingiberaceae | Eukaryota | Rhizomes | n.a. | n.a. |
PMID[31873014] |
| NPO29417 | Fallopia multiflora | Species | Polygonaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[31944695] |
| NPO40401 | Xylaria longipes | Species | Xylariaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31961677] |
| NPO28734 | Physalis peruviana | Species | Solanaceae | Eukaryota | Whole Fruits | n.a. | n.a. |
PMID[32159343] |
| NPO40847 | Evolvulus linarioides | Species | n.a. | n.a. | Aerial Parts | n.a. | n.a. |
PMID[32364737] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | Seeds | HeZe, ShanDong, China | early autumn (from August to the beginning of September |
PMID[32545196] |
| NPO23548 | Leonurus heterophyllus | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32935986] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[32951423] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | Seeds | Xinjiang,China |
PMID[33063333] |
|
| NPO26657 | Conocephalum conicum | Species | Conocephalaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[33264011] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[6481366] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[7561896] |
| NPO29417 | Fallopia multiflora | Species | Polygonaceae | Eukaryota | Roots; Tubers | n.a. | n.a. |
PMID[7714535] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | seeds | n.a. | n.a. |
PMID[8676130] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[8946743] |
| NPO3821 | Sinularia flexibilis | Species | Alcyoniidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[9644083] |
| NPO8622 | Stauntonia hexaphylla | Species | Lardizabalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[Article] |
| NPO26657 | Conocephalum conicum | Species | Conocephalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[Article] |
| NPO29530 | Kaempferia marginata | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29417 | Fallopia multiflora | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO26657 | Conocephalum conicum | Species | Conocephalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO30165 | Pongamia pinnata | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO12682 | Euphorbia helioscopia | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO520 | Euphorbia lathyris | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO28688 | Aster tataricus | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO3821 | Sinularia flexibilis | Species | Alcyoniidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO14563 | Kalimeris shimadae | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO28734 | Physalis peruviana | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29042 | Vincetoxicum atratum | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO22224 | Caragana jubata | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO1680 | Physalis angulata | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40980 | Penicillium chrysogenum J08NF-4 | Strain | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO25980 | Rhododendron molle | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO17799 | Siraitia grosvenorii | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40401 | Xylaria longipes | Species | Xylariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO27950 | Aspergillus ochraceopetaliformis | Species | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40479 | Colletotrichum sp. S8. | Strain | Glomerellaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO8622 | Stauntonia hexaphylla | Species | Lardizabalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO26657 | Conocephalum conicum | Species | Conocephalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO28688 | Aster tataricus | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO25980 | Rhododendron molle | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO12682 | Euphorbia helioscopia | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO8622 | Stauntonia hexaphylla | Species | Lardizabalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO520 | Euphorbia lathyris | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO30165 | Pongamia pinnata | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO22224 | Caragana jubata | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO29417 | Fallopia multiflora | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO25980 | Rhododendron molle | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO28688 | Aster tataricus | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO23548 | Leonurus heterophyllus | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO12682 | Euphorbia helioscopia | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO22224 | Caragana jubata | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO26657 | Conocephalum conicum | Species | Conocephalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO28734 | Physalis peruviana | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO29042 | Vincetoxicum atratum | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO17799 | Siraitia grosvenorii | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO520 | Euphorbia lathyris | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO29530 | Kaempferia marginata | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO8622 | Stauntonia hexaphylla | Species | Lardizabalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO28688 | Aster tataricus | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO12682 | Euphorbia helioscopia | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO23548 | Leonurus heterophyllus | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO520 | Euphorbia lathyris | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO26657 | Conocephalum conicum | Species | Conocephalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO25980 | Rhododendron molle | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO22224 | Caragana jubata | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO29417 | Fallopia multiflora | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO23548 | Leonurus heterophyllus | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO25980 | Rhododendron molle | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO28688 | Aster tataricus | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO29042 | Vincetoxicum atratum | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO520 | Euphorbia lathyris | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO29530 | Kaempferia marginata | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO22224 | Caragana jubata | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO14948 | Brucea javanica | Species | Simaroubaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO29042 | Vincetoxicum atratum | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4734 | Syzygium nervosum | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO520 | Euphorbia lathyris | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO28688 | Aster tataricus | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO23548 | Leonurus heterophyllus | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO14563 | Kalimeris shimadae | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9798 | Paeonia lactiflora | Species | Paeoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO12682 | Euphorbia helioscopia | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1680 | Physalis angulata | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO8622 | Stauntonia hexaphylla | Species | Lardizabalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO27950 | Aspergillus ochraceopetaliformis | Species | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17799 | Siraitia grosvenorii | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO25980 | Rhododendron molle | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO28734 | Physalis peruviana | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT183 | Individual protein | Arachidonate 5-lipoxygenase | Rattus norvegicus | IC50 | > | 25000.0 | nM | DOI[10.1016/S0960-894X(01)81260-9] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 5.5 | nM | PMID[8627601] |
| NPT2945 | Individual protein | Phospholipase A2 group 1B | Sus scrofa | IC50 | > | 750000.0 | nM | DOI[10.1016/S0960-894X(01)81022-2] |
| NPT183 | Individual protein | Arachidonate 5-lipoxygenase | Rattus norvegicus | IC50 | = | 120000.0 | nM | DOI[10.1016/S0960-894X(01)81022-2] |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[12699389] |
| NPT1455 | Individual protein | P-glycoprotein 3 | Mus musculus | IC50 | > | 50000.0 | nM | PMID[12699389] |
| NPT1456 | Individual protein | P-glycoprotein 1 | Mus musculus | IC50 | > | 50000.0 | nM | PMID[12699389] |
| NPT1455 | Individual protein | P-glycoprotein 3 | Mus musculus | Ratio | = | 0.8 | n.a. | PMID[12699389] |
| NPT1455 | Individual protein | P-glycoprotein 3 | Mus musculus | Ratio | = | 2.3 | n.a. | PMID[12699389] |
| NPT1455 | Individual protein | P-glycoprotein 3 | Mus musculus | Ratio | = | 5.2 | n.a. | PMID[12699389] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | < | 10000.0 | nM | PMID[15999989] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 1.0 | nM | PMID[16112571] |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | IC50 | = | 81283.05 | nM | PMID[16134935] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 5.012 | nM | PMID[16821781] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[16821781] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 1.175 | nM | PMID[16821781] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 7.943 | nM | PMID[16821781] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 3.0 | nM | PMID[17181172] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 0.2 | nM | PMID[17705362] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 1.4 | nM | PMID[17705362] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 2.1 | nM | PMID[17705362] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 3.4 | nM | PMID[17118655] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 7.586 | nM | PMID[17616395] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 1.0 | nM | PMID[17616395] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Activity | = | 102.0 | % | PMID[17616395] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 5.37 | nM | PMID[17616395] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | < | 1000.0 | nM | PMID[17616395] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Inhibition | = | 7.0 | % | PMID[17616395] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 3.0 | nM | PMID[17692519] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 7.943 | nM | PMID[18038970] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 5.012 | nM | PMID[18038970] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 1.175 | nM | PMID[18038970] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Activity | = | 110.0 | % | PMID[18038970] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Activity | = | 102.0 | % | PMID[18038970] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[18038970] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | ED50 | = | 0.1 | nM | PMID[18032610] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ratio | = | 2.56 | n.a. | PMID[18177009] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 5.0 | nM | PMID[18490170] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 5.0 | nM | PMID[18412397] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 3.0 | nM | PMID[18983139] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 6.0 | nM | PMID[18983139] |
| NPT3031 | Individual protein | Estrogen receptor alpha | Rattus norvegicus | Activity | = | 0.0 | % | PMID[18472187] |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | Activity | = | 0.0 | % | PMID[18472187] |
| NPT3036 | Individual protein | Progesterone receptor | Rattus norvegicus | Activity | = | 0.0 | % | PMID[18472187] |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | Activity | = | 66.0 | % | PMID[18472187] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 1.1 | nM | PMID[19321341] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 2.5 | nM | PMID[19321341] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 1.1 | nM | PMID[19321341] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 4.2 | nM | PMID[19321341] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ratio | = | 1.99 | n.a. | PMID[17067160] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 1.0 | nM | PMID[16643060] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 5.0 | nM | PMID[19610652] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 1.0 | nM | PMID[19592247] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 1.2 | nM | PMID[20047280] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 2.5 | nM | PMID[20047280] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 1.1 | nM | PMID[20047280] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 4.5 | nM | PMID[20047280] |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | IC50 | > | 4000.0 | nM | PMID[20047280] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 7.2 | nM | PMID[19863083] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 1.1 | nM | PMID[20334371] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Activity | = | 87.0 | % | PMID[20334371] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 11.4 | nM | PMID[20334371] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Kd | = | 19.0 | nM | PMID[20355713] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Activity | = | 100.0 | % | PMID[20427184] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Activity | = | 50.0 | % | PMID[20427184] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 0.51 | nM | PMID[20735001] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 3.4 | nM | PMID[20735001] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | < | 15848.93 | nM | PMID[20812681] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 0.5082 | nM | PMID[20812681] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 7.943 | nM | PMID[20727743] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 12.59 | nM | PMID[20727743] |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[20727743] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 2.512 | nM | PMID[20727743] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 1.585 | nM | PMID[20727743] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 5.0 | nM | PMID[20875743] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 12.59 | nM | PMID[21257309] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 1.0 | nM | PMID[21257309] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Activity | = | 102.0 | % | PMID[21257309] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 3.981 | nM | PMID[21257309] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Activity | = | 99.0 | % | PMID[21257309] |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | IC50 | = | 22.0 | nM | PMID[21349712] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 1.1 | nM | PMID[21073190] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 2.5 | nM | PMID[21073190] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 1.1 | nM | PMID[21073190] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 4.2 | nM | PMID[21073190] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 5.0 | nM | PMID[21073190] |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | IC50 | = | 22.0 | nM | PMID[21944856] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 3.0 | nM | PMID[21963986] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 0.51 | nM | PMID[21963986] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 1.8 | nM | PMID[21963986] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 17.0 | nM | PMID[21963986] |
| NPT1733 | Individual protein | Solute carrier organic anion transporter family member 1A2 | Homo sapiens | Inhibition | = | 97.3 | % | PMID[9539145] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | FC | = | 10.0 | n.a. | PMID[21800856] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 9.7 | nM | PMID[23199485] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 12.5 | nM | PMID[23199485] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 3.7 | nM | PMID[23199485] |
| NPT3087 | Individual protein | Transcription factor p65 | Mus musculus | Activity | = | 100.0 | % | PMID[23219855] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 2.5 | nM | PMID[23582449] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 2.2 | nM | PMID[23403082] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 4.1 | nM | PMID[23403082] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Inhibition | = | 21.0 | % | PMID[23403082] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 1.5 | nM | PMID[23466604] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 3.0 | nM | PMID[23466604] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 4.2 | nM | PMID[24011644] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 2.5 | nM | PMID[24011644] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 1.1 | nM | PMID[24011644] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 4.5 | nM | PMID[23916594] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 1.1 | nM | PMID[23916594] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 2.5 | nM | PMID[23916594] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 1.2 | nM | PMID[23916594] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 4.5 | nM | PMID[23953070] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 2.5 | nM | PMID[23953070] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 1.2 | nM | PMID[23953070] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 1.1 | nM | PMID[23953070] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 3.5 | nM | PMID[24215891] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 0.5 | nM | PMID[24215891] |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | Ki | = | 1410.0 | nM | PMID[24446728] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 0.69 | nM | PMID[24446728] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 3.0 | nM | PMID[24656565] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 0.5 | nM | PMID[24656565] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 17.0 | nM | PMID[24656565] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 1.0 | nM | PMID[25516791] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 1.2 | nM | PMID[24980053] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 2.5 | nM | PMID[24980053] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 1.1 | nM | PMID[24980053] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 4.5 | nM | PMID[24980053] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 6.9 | nM | PMID[24980053] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 1.3 | nM | PMID[25305688] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 3.5 | nM | PMID[25706100] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 1.8 | nM | PMID[25706100] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 21.0 | nM | PMID[25706100] |
| NPT1463 | Individual protein | Cytochrome P450 2J2 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[23033255] |
| NPT158 | Individual protein | Nuclear receptor subfamily 1 group I member 2 | Rattus norvegicus | FC | = | 4.0 | n.a. | PMID[22019630] |
| NPT158 | Individual protein | Nuclear receptor subfamily 1 group I member 2 | Rattus norvegicus | FC | = | 5.0 | n.a. | PMID[22019630] |
| NPT158 | Individual protein | Nuclear receptor subfamily 1 group I member 2 | Rattus norvegicus | EC50 | = | 2600.0 | nM | PMID[20966043] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Activity | = | 200.0 | % | PMID[25978072] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 3.8 | nM | PMID[26988801] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 6.1 | nM | PMID[27810243] |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | IC50 | > | 20000.0 | nM | PMID[27810243] |
| NPT1459 | Individual protein | Glucocorticoid receptor | Mus musculus | FC | > | 50.0 | n.a. | PMID[27919657] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 3.8 | nM | PMID[27876250] |
| NPT1249 | Individual protein | Canalicular multispecific organic anion transporter 2 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT1028 | Individual protein | Multidrug resistance-associated protein 4 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 12.59 | nM | PMID[28043796] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 2.512 | nM | PMID[28043796] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 7.943 | nM | PMID[28043796] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 1.585 | nM | PMID[28043796] |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[28043796] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Activity | = | 55.6 | % | PMID[28489375] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Activity | = | 55.0 | % | PMID[28489375] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Activity | = | 35.7 | % | PMID[28489375] |
| NPT1618 | Individual protein | Peroxisome proliferator-activated receptor gamma | Mus musculus | FC | = | 2.3 | n.a. | PMID[29389121] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 2.35 | nM | PMID[30144697] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Kd | = | 19.0 | nM | PMID[31188592] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 0.1 | nM | PMID[30359818] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Kd | = | 2.0 | nM | PMID[30929949] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Kd | = | 2.8 | nM | PMID[34046609] |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | Emax | = | 85.5 | % | PMID[34676039] |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | %max | = | 113.0 | % | PMID[36105346] |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | AC50 | = | 1.9 | nM | PMID[37468498] |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | = | 2900.0 | nM | PMID[36379105] |
| NPT267 | Individual protein | Neuropeptide Y receptor type 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1464 | Individual protein | Phosphodiesterase 4D | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT252 | Individual protein | Histamine H2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT3172 | Individual protein | Phospholipase A2 group IIA | Homo sapiens | IC50 | = | 590.0 | nM | PMID[36325400] |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1410 | Individual protein | GABA receptor alpha-1 subunit | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | %Inhib (Mean) | = | 17.89 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | %max | = | 100.0 | % | PMID[36105346] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | %Inhib (Mean) | = | -44.32 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[36399795] |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT259 | Individual protein | Melanocortin receptor 4 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 3.0 | nM | PMID[36399795] |
| NPT1109 | Individual protein | Apelin receptor | Homo sapiens | %Inhib (Mean) | = | 3.55 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | %Inhib (Mean) | = | 1.23 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT239 | Individual protein | Cholecystokinin A receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1109 | Individual protein | Apelin receptor | Homo sapiens | %Inhib (Mean) | = | 49.02 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | %Inhib (Mean) | = | -6.33 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | Efficacy | = | 103.3 | % | PMID[34676039] |
| NPT2879 | Individual protein | Equilibrative nucleoside transporter 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | IC50 | > | 10000.0 | nM | PMID[33515864] |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | %Inhib (Mean) | = | 3.2 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT101 | Individual protein | Glucagon-like peptide 1 receptor | Homo sapiens | %Inhib (Mean) | = | 3.22 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | Emax | = | 7.2 | % | PMID[36105346] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | %Inhib (Mean) | = | -1.82 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | %max | = | 94.4 | % | PMID[36105346] |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | EC50 | = | 1.995 | nM | PMID[34676039] |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | Efficacy | = | 113.8 | % | PMID[34676039] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | %Max (Mean) | = | 2.4 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT101 | Individual protein | Glucagon-like peptide 1 receptor | Homo sapiens | %Max (Mean) | = | -0.36 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT1109 | Individual protein | Apelin receptor | Homo sapiens | %Max (Mean) | = | -1.079 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | Emax | = | 10.9 | % | PMID[34676039] |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1163 | Individual protein | Glutamate (NMDA) receptor subunit zeta 1 | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | AC50 | = | 4800.0 | nM | PMID[37468498] |
| NPT2769 | Individual protein | Thromboxane A2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[36399795] |
| NPT272 | Individual protein | Kappa opioid receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 4.0 | nM | PMID[36399795] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[35483323] |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1788 | Individual protein | Alpha-1a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT101 | Individual protein | Glucagon-like peptide 1 receptor | Homo sapiens | %Inhib (Mean) | = | 4.72 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 14.0 | nM | PMID[36399795] |
| NPT1627 | Individual protein | G-protein coupled receptor 35 | Homo sapiens | %Max (Mean) | = | 15.26 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT1627 | Individual protein | G-protein coupled receptor 35 | Homo sapiens | %Inhib (Mean) | = | -7.14 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | IC50 | = | 1.259 | nM | PMID[36105346] |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | EC50 | = | 3.162 | nM | PMID[36105346] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | %Inhib (Mean) | = | -2.6 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | Emax | = | 81.9 | % | PMID[36105346] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | %Max (Mean) | = | -2.59 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | = | 5.0 | nM | PMID[36399795] |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | %Inhib (Mean) | = | 1.33 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT101 | Individual protein | Glucagon-like peptide 1 receptor | Homo sapiens | %Inhib (Mean) | = | -1.16 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT230 | Individual protein | Bradykinin B2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT303 | Individual protein | Vasopressin V1a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT264 | Individual protein | Muscarinic acetylcholine receptor M3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2719 | Individual protein | Voltage-gated L-type calcium channel alpha-1C subunit | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT1454 | Individual protein | Glucocorticoid receptor | Rattus norvegicus | IC50 | = | 6.31 | nM | PMID[34676039] |
| NPT1647 | Individual protein | Vasopressin V2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT101 | Individual protein | Glucagon-like peptide 1 receptor | Homo sapiens | %Inhib (Mean) | = | 15.29 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1109 | Individual protein | Apelin receptor | Homo sapiens | %Inhib (Mean) | = | 27.19 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT1109 | Individual protein | Apelin receptor | Homo sapiens | %Inhib (Mean) | = | 33.17 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | EC50 | = | 30.0 | nM | PMID[35797110] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 34.2 | % | PMID[22541068] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 103.89 | % | PMID[23571415] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | = | 137400.0 | nM | PMID[21965623] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | > | 135000.0 | nM | PMID[20829430] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | = | 101700.0 | nM | PMID[22961681] |
| NPT862 | Individual protein | Epoxide hydratase | Homo sapiens | Inhibition | = | 59.4 | % | PMID[28845983] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT27233 | Single protein | Peroxisome proliferator-activated receptor gamma coactivator 1-alpha | Homo sapiens | Activity | = | 172.36 | % | PMID[28448136] |
| NPT27233 | Single protein | Peroxisome proliferator-activated receptor gamma coactivator 1-alpha | Homo sapiens | FC | = | 2.0 | n.a. | PMID[28448136] |
| NPT26694 | Single protein | Lipoxin A4 receptor | Homo sapiens | Activity | = | 53.2 | % | PMID[30419493] |
| NPT26694 | Single protein | Lipoxin A4 receptor | Homo sapiens | Activity | = | 13.6 | % | PMID[30419493] |
| NPT26694 | Single protein | Lipoxin A4 receptor | Homo sapiens | Activity | = | 1.5 | % | PMID[30419493] |
| NPT26694 | Single protein | Lipoxin A4 receptor | Homo sapiens | Activity | = | 62.6 | % | PMID[30419493] |
| NPT26694 | Single protein | Lipoxin A4 receptor | Homo sapiens | Activity | = | 45.1 | % | PMID[30419493] |
| NPT26694 | Single protein | Lipoxin A4 receptor | Homo sapiens | Activity | = | 58.1 | % | PMID[30419493] |
| NPT30125 | Single protein | C5a anaphylatoxin chemotactic receptor | Homo sapiens | %Inhib (Mean) | = | 7.02 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT26694 | Single protein | Lipoxin A4 receptor | Homo sapiens | %Inhib (Mean) | = | -10.68 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT30125 | Single protein | C5a anaphylatoxin chemotactic receptor | Homo sapiens | %Inhib (Mean) | = | -76.79 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT26694 | Single protein | Lipoxin A4 receptor | Homo sapiens | %Inhib (Mean) | = | -7.73 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT30125 | Single protein | C5a anaphylatoxin chemotactic receptor | Homo sapiens | %Inhib (Mean) | = | 2.31 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT26694 | Single protein | Lipoxin A4 receptor | Homo sapiens | %Inhib (Mean) | = | -4.06 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT30125 | Single protein | C5a anaphylatoxin chemotactic receptor | Homo sapiens | %Inhib (Mean) | = | 11.7 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT26694 | Single protein | Lipoxin A4 receptor | Homo sapiens | %Inhib (Mean) | = | -17.07 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT987 | Individual protein | Histamine H3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5301 | Individual protein | Motilin receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30125 | Single protein | C5a anaphylatoxin chemotactic receptor | Homo sapiens | %Max (Mean) | = | -2.607 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT26694 | Single protein | Lipoxin A4 receptor | Homo sapiens | %Max (Mean) | = | -3.73 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | IC50 | > | 2000.0 | nM | PMID[17181172] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | IC50 | > | 2000.0 | nM | PMID[17118655] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | IC50 | > | 2000.0 | nM | PMID[17692519] |
| NPT5538 | Individual protein | Fatty acid-binding protein, liver | Rattus norvegicus | Ki | = | 22100.0 | nM | PMID[18533710] |
| NPT5538 | Individual protein | Fatty acid-binding protein, liver | Rattus norvegicus | Ki | = | 41300.0 | nM | PMID[18533710] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | IC50 | > | 2000.0 | nM | PMID[20735001] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[20727743] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | IC50 | > | 2000.0 | nM | PMID[21963986] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 10.7 | % | PMID[22541068] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | IC50 | > | 2000.0 | nM | PMID[24215891] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | Ki | = | 561.0 | nM | PMID[24446728] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | IC50 | > | 2000.0 | nM | PMID[24656565] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | Ki | = | 778.0 | nM | PMID[24980053] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | IC50 | = | 440.0 | nM | PMID[27810243] |
| NPT516 | Individual protein | TNF-alpha | Homo sapiens | Inhibition | = | 49.9 | % | PMID[27847171] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[28043796] |
| NPT29430 | Single protein | Neuronal acetylcholine receptor protein alpha-4 subunit | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT23094 | Single protein | C-X3-C chemokine receptor 1 | Homo sapiens | %Inhib (Mean) | = | -7.197 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT4358 | Individual protein | Type-1 angiotensin II receptor | Homo sapiens | %Inhib (Mean) | = | 16.58 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT23094 | Single protein | C-X3-C chemokine receptor 1 | Homo sapiens | %Inhib (Mean) | = | -19.1 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT4358 | Individual protein | Type-1 angiotensin II receptor | Homo sapiens | %Inhib (Mean) | = | 1.75 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -18.79 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[35483323] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | 0.53 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT4358 | Individual protein | Type-1 angiotensin II receptor | Homo sapiens | %Max (Mean) | = | -5.841 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT4358 | Individual protein | Type-1 angiotensin II receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT23094 | Single protein | C-X3-C chemokine receptor 1 | Homo sapiens | %Max (Mean) | = | 0.4783 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT4729 | Individual protein | Cholecystokinin B receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT4358 | Individual protein | Type-1 angiotensin II receptor | Homo sapiens | %Inhib (Mean) | = | 1.067 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT23094 | Single protein | C-X3-C chemokine receptor 1 | Homo sapiens | %Inhib (Mean) | = | -14.31 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[36399795] |
| NPT23094 | Single protein | C-X3-C chemokine receptor 1 | Homo sapiens | %Inhib (Mean) | = | -12.91 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT98 | Individual protein | HERG | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT4358 | Individual protein | Type-1 angiotensin II receptor | Homo sapiens | %Inhib (Mean) | = | 3.84 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | AC50 | = | 200.0 | nM | PMID[37468498] |
| NPT4316 | Individual protein | Phospholipase A2 group 1B | Rattus norvegicus | IC50 | > | 750000.0 | nM | DOI[10.1016/S0960-894X(01)81260-9] |
| NPT752 | Individual protein | Solute carrier organic anion transporter family member 1A1 | Rattus norvegicus | Activity | = | 26.0 | % | PMID[8786566] |
| NPT622 | Individual protein | Solute carrier organic anion transporter family member 2B1 | Homo sapiens | Inhibition | = | -12.5 | % | PMID[22541068] |
| NPT24057 | Single protein | Transcription factor AP-1 | Mus musculus | Ratio | = | 2.33 | n.a. | PMID[24831826] |
| NPT712 | Individual protein | Bile salt export pump | Rattus norvegicus | IC50 | = | 231900.0 | nM | PMID[21965623] |
| NPT28814 | Single protein | Ghrelin receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT6197 | Individual protein | Glucose-dependent insulinotropic receptor | Homo sapiens | %Inhib (Mean) | = | -26.71 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT6035 | Individual protein | Sphingosine 1-phosphate receptor Edg-1 | Homo sapiens | %Inhib (Mean) | = | -13.6 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT6035 | Individual protein | Sphingosine 1-phosphate receptor Edg-1 | Homo sapiens | %Inhib (Mean) | = | -18.09 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT4003 | Individual protein | G-protein coupled receptor 120 | Homo sapiens | %Inhib (Mean) | = | -20.01 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT6035 | Individual protein | Sphingosine 1-phosphate receptor Edg-1 | Homo sapiens | %Inhib (Mean) | = | -13.47 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT6197 | Individual protein | Glucose-dependent insulinotropic receptor | Homo sapiens | %Inhib (Mean) | = | 4.873 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT29660 | Single protein | Adhesion G-protein coupled receptor F1 | Homo sapiens | %Inhib (Mean) | = | 22.84 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT5104 | Individual protein | Phosphodiesterase 3A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT92 | Individual protein | Serotonin 1a (5-HT1a) receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT4003 | Individual protein | G-protein coupled receptor 120 | Homo sapiens | %Inhib (Mean) | = | -40.79 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT5975 | Individual protein | Cyclooxygenase-1 | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT4003 | Individual protein | G-protein coupled receptor 120 | Homo sapiens | %Inhib (Mean) | = | -32.71 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT29660 | Single protein | Adhesion G-protein coupled receptor F1 | Homo sapiens | %Inhib (Mean) | = | -18.7 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT29660 | Single protein | Adhesion G-protein coupled receptor F1 | Homo sapiens | %Max (Mean) | = | 2.379 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT6197 | Individual protein | Glucose-dependent insulinotropic receptor | Homo sapiens | %Max (Mean) | = | 3.118 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT6035 | Individual protein | Sphingosine 1-phosphate receptor Edg-1 | Homo sapiens | %Inhib (Mean) | = | -12.55 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT4003 | Individual protein | G-protein coupled receptor 120 | Homo sapiens | %Max (Mean) | = | -1.7 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT29660 | Single protein | Adhesion G-protein coupled receptor F1 | Homo sapiens | %Inhib (Mean) | = | -10.27 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT4003 | Individual protein | G-protein coupled receptor 120 | Homo sapiens | %Inhib (Mean) | = | -20.1 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT29660 | Single protein | Adhesion G-protein coupled receptor F1 | Homo sapiens | %Inhib (Mean) | = | -6.03 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT6035 | Individual protein | Sphingosine 1-phosphate receptor Edg-1 | Homo sapiens | %Max (Mean) | = | 12.28 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT6197 | Individual protein | Glucose-dependent insulinotropic receptor | Homo sapiens | %Inhib (Mean) | = | -30.06 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT6197 | Individual protein | Glucose-dependent insulinotropic receptor | Homo sapiens | %Inhib (Mean) | = | -1.83 | % | GPCR results for EUbOPEN Chemogenomics Library 3 |
| NPT4866 | Protein family | Prostaglandin G/H synthase (cyclooxygenase) | Ovis aries | IC50 | > | 25000.0 | nM | DOI[10.1016/S0960-894X(01)81260-9] |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | Activity | = | 4.0 | nM/mg*min | PMID[12699389] |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | Inhibition | = | 0.0 | % | PMID[12699389] |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[12699389] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | IC50 | = | 33.0 | nM | PMID[17181172] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | Ki | = | 7.2 | nM | PMID[17705362] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | IC50 | = | 33.0 | nM | PMID[17118655] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | IC50 | = | 33.0 | nM | PMID[17692519] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | Inhibition | = | 30.0 | % | PMID[20047280] |
| NPT74 | Individual protein | Proto-oncogene c-JUN | Homo sapiens | Activity | = | 2.33 | % | PMID[19648015] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | IC50 | = | 33.0 | nM | PMID[20735001] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[20727743] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | IC50 | = | 33.0 | nM | PMID[21963986] |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | Activity | = | 0.0 | % | PMID[12699389] |
| NPT4037 | Individual protein | Multidrug and toxin extrusion protein 1 | Homo sapiens | Inhibition | = | 30.0 | % | PMID[23241029] |
| NPT4037 | Individual protein | Multidrug and toxin extrusion protein 1 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[23241029] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | IC50 | = | 33.0 | nM | PMID[24215891] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | Ki | = | 0.36 | nM | PMID[24446728] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | IC50 | = | 33.0 | nM | PMID[24656565] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | IC50 | = | 40.0 | nM | PMID[27810243] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[28043796] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[35483323] |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | Ratio | = | 7.449 | n.a. | PMID[33619967] |
| NPT543 | Individual protein | Pregnane X receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT425 | Individual protein | Serotonin 3a (5-HT3a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT541 | Individual protein | Mineralocorticoid receptor | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[36399795] |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 420.0 | nM | PMID[12361395] |
| NPT848 | Cell line | N9 | Homo sapiens | IC50 | = | 74.0 | nM | PMID[12361395] |
| NPT1886 | Cell line | J774 | Mus musculus | IC50 | = | 169500.0 | nM | PMID[12467611] |
| NPT2246 | Cell line | T-cells | n.a. | IC50 | = | 5.0 | nM | PMID[11229767] |
| NPT859 | Cell line | HFF | Homo sapiens | IC50 | = | 0.51 | nM | PMID[17181172] |
| NPT859 | Cell line | HFF | Homo sapiens | EC50 | = | 1.9 | nM | PMID[17181172] |
| NPT165 | Cell line | HeLa | Homo sapiens | EC50 | = | 17.0 | nM | PMID[17181172] |
| NPT2735 | Cell line | RAW | Mus musculus | IC50 | = | 20.0 | nM | PMID[17367124] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 3.4 | ng/ml | PMID[17407277] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 0.21 | ng/ml | PMID[17407277] |
| NPT389 | Cell line | RPMI-8226 | Homo sapiens | IC50 | = | 6.5 | nM | PMID[17705362] |
| NPT859 | Cell line | HFF | Homo sapiens | EC50 | = | 2.0 | nM | PMID[17692519] |
| NPT859 | Cell line | HFF | Homo sapiens | EC50 | = | 0.5 | nM | PMID[17692519] |
| NPT1182 | Cell line | J774.A1 | Mus musculus | IC50 | = | 48.0 | nM | PMID[17892941] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 49.9 | % | PMID[11374953] |
| NPT848 | Cell line | N9 | Homo sapiens | Inhibition | = | 82.0 | % | PMID[11374953] |
| NPT1135 | Cell line | Hepatocyte | Rattus norvegicus | Activity | = | 96.0 | IU/L | PMID[6677713] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 36.0 | ug.mL-1 | PMID[15165136] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | > | 25.0 | ug.mL-1 | PMID[15165136] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 700.0 | nM | PMID[11908984] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | IC50 | = | 50.0 | nM | PMID[18625560] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | IC50 | = | 7.0 | nM | PMID[18625560] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[18625560] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 72.0 | % | PMID[18625560] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 94.0 | % | PMID[18625560] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 0.0 | % | PMID[18625560] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 0.0 | % | PMID[19896853] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 90.0 | % | PMID[19896853] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 69.0 | % | PMID[19896853] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 84.0 | % | PMID[20064725] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 73.0 | % | PMID[20064725] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 89.0 | % | PMID[20056549] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 73.0 | % | PMID[20138527] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 84.0 | % | PMID[20138527] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Activity | = | 0.0 | % | PMID[20138527] |
| NPT927 | Cell line | PBMC | Homo sapiens | Inhibition | = | 32.0 | % | PMID[19835377] |
| NPT927 | Cell line | PBMC | Homo sapiens | Inhibition | = | 25.0 | % | PMID[19835377] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Activity | = | 73.0 | % | PMID[20207143] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 69.0 | % | PMID[20171758] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 90.0 | % | PMID[20171758] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 69.0 | % | PMID[20430485] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 90.0 | % | PMID[20430485] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Activity | = | 71.0 | % | PMID[20638287] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Activity | = | 85.0 | % | PMID[20638287] |
| NPT306 | Cell line | PC-3 | Homo sapiens | FC | = | 1.127 | n.a. | PMID[16680159] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 860.0 | nM | PMID[21288727] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 800.0 | nM | PMID[21353543] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 10.0 | nM | PMID[21353543] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 1.54 | uM | PMID[21353543] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 27.01 | ng/ml | PMID[21353543] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 20.0 | nM | PMID[21361338] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 71.0 | % | PMID[21737269] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 84.0 | % | PMID[21737269] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | FC | = | 0.16 | n.a. | PMID[21598928] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 72.0 | % | PMID[22520258] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 86.0 | % | PMID[22520258] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 470.0 | nM | PMID[22372956] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 980.0 | nM | PMID[22537362] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 71.0 | % | PMID[22981334] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 84.0 | % | PMID[22981334] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 84.0 | % | PMID[23026000] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 76.0 | % | PMID[23026000] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 94.0 | % | DOI[10.1007/s00044-011-9856-1] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 72.0 | % | DOI[10.1007/s00044-011-9856-1] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 94.0 | % | DOI[10.1007/s00044-011-9834-7] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 72.0 | % | DOI[10.1007/s00044-011-9834-7] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 84.0 | % | DOI[10.1007/s00044-011-9943-3] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 71.0 | % | DOI[10.1007/s00044-011-9943-3] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 86.0 | % | DOI[10.1007/s00044-012-0144-5] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 72.0 | % | DOI[10.1007/s00044-012-0144-5] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 80.0 | % | DOI[10.1007/s00044-012-0109-8] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 71.0 | % | DOI[10.1007/s00044-012-0109-8] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 355140.0 | nM | DOI[10.1007/s00044-013-0504-9] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 5.5 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 1.0 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 3.5 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 3.6 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | > | 200.0 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 2.4 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 1.2 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 0.92 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 7.6 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 130.0 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 88.0 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 82.0 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 9.4 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 6.1 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 0.47 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 4.1 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 2.1 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 1.9 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 66.0 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 72.0 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 55.0 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 14.0 | nM | PMID[23199485] |
| NPT927 | Cell line | PBMC | Homo sapiens | EC50 | = | 10.0 | nM | PMID[23199485] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 1430.0 | nM | PMID[23373965] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 98.24 | % | PMID[23373965] |
| NPT927 | Cell line | PBMC | Homo sapiens | Inhibition | = | 43.0 | % | PMID[23411072] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 70.4 | % | PMID[23268606] |
| NPT927 | Cell line | PBMC | Homo sapiens | Inhibition | = | 80.0 | % | PMID[23411072] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | = | 9.5 | nM | PMID[23411072] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | = | 17.0 | nM | PMID[23411072] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 72.0 | % | DOI[10.1007/s00044-013-0825-8] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 85.0 | % | DOI[10.1007/s00044-013-0825-8] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Activity | = | 0.0 | % | DOI[10.1007/s00044-013-0825-8] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | > | 15000.0 | nM | PMID[24992071] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | > | 15000.0 | nM | PMID[24992071] |
| NPT1161 | Cell line | CHO | Cricetulus griseus | IC50 | > | 20000.0 | nM | PMID[24992071] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | IC50 | > | 20000.0 | nM | PMID[24992071] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Activity | = | 1.3 | % | PMID[24992071] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Activity | = | 3.7 | % | PMID[24992071] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Activity | = | 0.8 | % | PMID[24992071] |
| NPT169 | Cell line | B16-F10 | Mus musculus | Activity | = | 94.1 | % | PMID[24992071] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 9.5 | % | PMID[24992071] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 5.9 | % | PMID[24992071] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 2.4 | % | PMID[24992071] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 82.8 | % | PMID[24992071] |
| NPT1161 | Cell line | CHO | Cricetulus griseus | Activity | = | 4.2 | % | PMID[24992071] |
| NPT1161 | Cell line | CHO | Cricetulus griseus | Activity | = | 0.0 | % | PMID[24992071] |
| NPT1161 | Cell line | CHO | Cricetulus griseus | Activity | = | 95.8 | % | PMID[24992071] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Activity | = | 0.4 | % | PMID[24992071] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Activity | = | 0.1 | % | PMID[24992071] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Activity | = | 94.4 | % | PMID[24992071] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 800.0 | nM | PMID[25499882] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 0.016 | ug.mL-1 | PMID[25113933] |
| NPT1182 | Cell line | J774.A1 | Mus musculus | IC50 | = | 0.165 | ug.mL-1 | PMID[25113933] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 1.84 | ug.mL-1 | PMID[25113933] |
| NPT1182 | Cell line | J774.A1 | Mus musculus | IC50 | = | 9.09 | ug.mL-1 | PMID[25113933] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 0.016 | % | PMID[24909081] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 1.84 | % | PMID[24909081] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | = | 8.0 | nM | PMID[25338180] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | = | 9.0 | nM | PMID[25338180] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | = | 2.0 | nM | PMID[25338180] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 40.0 | nM | PMID[25824662] |
| NPT1182 | Cell line | J774.A1 | Mus musculus | IC50 | = | 400.0 | nM | PMID[25824662] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 4700.0 | nM | PMID[25824662] |
| NPT1182 | Cell line | J774.A1 | Mus musculus | IC50 | = | 22000.0 | nM | PMID[25824662] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 630.0 | nM | PMID[26087384] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 800.0 | nM | PMID[26305406] |
| NPT1886 | Cell line | J774 | Mus musculus | Inhibition | = | 85.0 | % | PMID[26915998] |
| NPT1886 | Cell line | J774 | Mus musculus | Inhibition | = | 90.0 | % | PMID[26915998] |
| NPT1886 | Cell line | J774 | Mus musculus | Inhibition | = | 86.0 | % | PMID[26915998] |
| NPT1886 | Cell line | J774 | Mus musculus | Inhibition | = | 38.0 | % | PMID[26915998] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 9.6 | % | PMID[27217003] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 1.7 | % | PMID[27217003] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 84.9 | % | PMID[27797185] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 80.4 | % | PMID[27797185] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 75.9 | % | PMID[27797185] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 86.1 | % | PMID[27797185] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 79.2 | % | PMID[27797185] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 71.8 | % | PMID[27797185] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 7000.0 | nM | PMID[28499733] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 97.2 | % | PMID[28489375] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 800.0 | nM | PMID[29272126] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 60.9 | % | PMID[29359942] |
| NPT521 | Cell line | RBL-2H3 | Rattus norvegicus | Inhibition | = | 80.7 | % | PMID[29381070] |
| NPT521 | Cell line | RBL-2H3 | Rattus norvegicus | Inhibition | = | 79.7 | % | PMID[29381070] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 8300.0 | nM | PMID[29741372] |
| NPT34 | Cell line | BV-2 | Mus musculus | IC50 | = | 9500.0 | nM | PMID[29482940] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 2500.0 | nM | PMID[28598633] |
| NPT1886 | Cell line | J774 | Mus musculus | Inhibition | = | 69.8 | % | PMID[29523468] |
| NPT4137 | Cell line | Splenocytes | Mus musculus | IC50 | = | 1.0 | nM | PMID[29523468] |
| NPT1597 | Cell line | J774.2 | n.a. | Inhibition | = | 62.0 | % | PMID[29903412] |
| NPT1597 | Cell line | J774.2 | n.a. | Inhibition | = | 40.0 | % | PMID[29903412] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 10700.0 | nM | PMID[29518326] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 40.0 | % | PMID[29541375] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Inhibition | = | 58.0 | % | PMID[29541375] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Activity | = | 0.0 | % | PMID[29541375] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 2660.0 | nM | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 100.2 | % | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 2655.0 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 3219.4 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 3671.8 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 4056.3 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 3393.5 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 4063.6 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 4455.7 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 4810.1 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 6458.3 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 7533.7 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 8187.9 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 8748.1 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 269.5 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 332.8 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 393.4 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 422.7 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 791.0 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 927.7 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 1120.3 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 1240.5 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 924.1 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 1336.5 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 1594.9 | pg/ml | PMID[30108912] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 1770.4 | pg/ml | PMID[30108912] |
| NPT4137 | Cell line | Splenocytes | Mus musculus | Inhibition | = | 74.6 | % | PMID[30293795] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 9400.0 | nM | PMID[30579802] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 1200.0 | nM | PMID[30579802] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 10.0 | nM | PMID[30931559] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 34.25 | % | PMID[31550154] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 18400.0 | nM | PMID[31181925] |
| NPT519 | Cell line | SH-SY5Y | Homo sapiens | Activity | = | 16.0 | % | PMID[30929949] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 5500.0 | nM | PMID[31873014] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 5020.0 | nM | PMID[31260892] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 159200.0 | nM | PMID[31260892] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Ratio IC50 | = | 31.9 | n.a. | PMID[31260892] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 8700.0 | nM | PMID[30528697] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Ratio CC50/IC50 | > | 5.7 | n.a. | PMID[30528697] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | FC | = | 1.3 | n.a. | PMID[30419493] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 10.0 | nM | PMID[31301930] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 130.0 | nM | PMID[30808589] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 6000.0 | nM | PMID[31577434] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 8400.0 | nM | PMID[31577434] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 6100.0 | nM | PMID[31577434] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 7900.0 | nM | PMID[30817151] |
| NPT2246 | Cell line | T-cells | n.a. | IC50 | = | 1600.0 | nM | PMID[31961677] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | IC50 | = | 2.512 | nM | PMID[32631518] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | = | 6.4 | nM | PMID[32631518] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | = | 4.3 | nM | PMID[32631518] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | = | 4.6 | nM | PMID[32631518] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | = | 3.8 | nM | PMID[32631518] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | = | 2.3 | nM | PMID[32631518] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 32500.0 | nM | PMID[32070636] |
| NPT1886 | Cell line | J774 | Mus musculus | IC50 | = | 5200.0 | nM | PMID[32364737] |
| NPT1886 | Cell line | J774 | Mus musculus | Inhibition | = | 87.1 | % | PMID[32364737] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 4160.0 | nM | PMID[32738985] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 24300.0 | nM | PMID[32935986] |
| NPT2142 | Cell line | REH | Homo sapiens | EC50 | = | 6.7 | nM | PMID[34046609] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 580.0 | nM | PMID[34333975] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[34333975] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[35707966] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 6700.0 | nM | PMID[38117952] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 8280.0 | nM | PMID[33667092] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 55.0 | % | PMID[37336771] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Inhibition | = | 98.87 | % | PMID[37939268] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 6900.0 | nM | PMID[33914536] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Imax | = | 47.9 | % | PMID[35998343] |
| NPT34 | Cell line | BV-2 | Mus musculus | IC50 | = | 2830.0 | nM | PMID[37530709] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 22200.0 | nM | PMID[35007071] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 50.0 | % | PMID[37589086] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | n.a. | n.a. | n.a. | PMID[35998343] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 2600.0 | nM | PMID[37369059] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 65.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 16.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 76.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 3.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 9.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[37736179] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Total Cells | = | 45535.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 41.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Healthy Nuclei (%) | = | 78.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 24.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Total Cells | = | 101135.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 0.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Pyknosed Nuclei (%) | = | 7.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 2.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Healthy Nuclei (%) | = | 61.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 27.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 0.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Total Cells | = | 22878.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Normal (%) | = | 93.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitotic Cells (%) | = | 62.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Fragmented Nuclei (%) | = | 23.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 14.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Fragmented Nuclei (%) | = | 16.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 2.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 2.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 4.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Total Cells | = | 20657.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 45.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Fragmented Nuclei (%) | = | 9.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Fragmented Nuclei (%) | = | 4.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 6.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 8.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Membrane Permeable-Phenotype Cells (%) | = | 5.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.65 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Fragmented Nuclei (%) | = | 20.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 2.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 20.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 6.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 9.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Fragmented Nuclei (%) | = | 15.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 1.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 15.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 26.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 16.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.99 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Healthy Nuclei (%) | = | 79.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Apoptotic (%) | = | 64.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 32.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Apoptotic (%) | = | 30.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 15.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Pyknosed Nuclei (%) | = | 48.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 5.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 83.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 51.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 5.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Fragmented Nuclei (%) | = | 16.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Normal (%) | = | 98.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 0.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Apoptotic (%) | = | 90.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Pyknosed Nuclei (%) | = | 5.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 5.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 74.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 82.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 72.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Membrane Permeable-Phenotype Cells (%) | = | 6.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 79.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 17.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Healthy Nuclei (%) | = | 71.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 6.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 3.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 4.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 24.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Apoptotic (%) | = | 31.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 9.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 6.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 75.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Normal (%) | = | 99.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 9.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Apoptotic (%) | = | 71.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.07 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.4 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 60.3 | % | PMID[37043994] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[36399795] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | FC | = | 2.5 | n.a. | PMID[34138563] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 7900.0 | nM | PMID[37002536] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 106.73 | % | PMID[37852423] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[34138563] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 620.0 | nM | PMID[32795767] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 51.81 | % | PMID[33515864] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Total Cells | = | 60692.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Normal (%) | = | 91.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Pyknosed Nuclei (%) | = | 6.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 238.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 121.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 18.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Pyknosed Nuclei (%) | = | 4.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Pyknosed Nuclei (%) | = | 41.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Pyknosed Nuclei (%) | = | 12.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Apoptotic (%) | = | 65.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Normal (%) | = | 97.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitotic Cells (%) | = | 60.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Total Cells | = | 26450.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 12.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Normal (%) | = | 98.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 65.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 499.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | > | 50000.0 | nM | PMID[33515864] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Healthy Nuclei (%) | = | 76.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[33933753] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 10.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 2.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 80.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 77.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 7.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitotic Cells (%) | = | 49.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Healthy Nuclei (%) | = | 50.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Membrane Permeable-Phenotype Cells (%) | = | 0.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Pyknosed Nuclei (%) | = | 16.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitotic Cells (%) | = | 68.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 17.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 14.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 3.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Normal (%) | = | 94.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 33.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 378.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 288.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Fragmented Nuclei (%) | = | 19.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Pyknosed Nuclei (%) | = | 10.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 1.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.95 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Fragmented Nuclei (%) | = | 8.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 26.88 | % | PMID[37852423] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 40.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 61.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Apoptotic (%) | = | 56.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 25.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Total Cells | = | 35035.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 59.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 63.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Normal (%) | = | 84.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 22.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 43.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 45.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Pyknosed Nuclei (%) | = | 7.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Total Cells | = | 8571.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 98.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Normal (%) | = | 100.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 3.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Total Cells | = | 11828.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Healthy Nuclei (%) | = | 75.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Apoptotic (%) | = | 75.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 14.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Healthy Nuclei (%) | = | 73.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Fragmented Nuclei (%) | = | 18.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 4.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | n.a. | n.a. | % | PMID[35483323] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Pyknosed Nuclei (%) | = | 13.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 0.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 1.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitotic Cells (%) | = | 57.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 256.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Total Cells | = | 20807.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 12.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Healthy Nuclei (%) | = | 70.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Pyknosed Nuclei (%) | = | 8.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 5020.0 | nM | PMID[35567964] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | > | 50000.0 | nM | PMID[37852423] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 8710.0 | nM | PMID[33515864] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 18.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 19.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitotic Cells (%) | = | 72.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 55.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 18.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[37337963] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[35483323] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Healthy Nuclei (%) | = | 81.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[35483323] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 93.62 | % | PMID[33933753] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 12.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 26.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 6.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 27.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Total Cells | = | 68271.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 9.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 569.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 1.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 915.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 15.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 71.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 175.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 25.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 9.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Imax | = | 98.0 | % | PMID[34138563] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 11500.0 | nM | PMID[37043994] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Imax | = | 56.0 | % | PMID[34138563] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 453.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Healthy Nuclei (%) | = | 72.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 13.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 4.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 14750.0 | nM | PMID[33933753] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 56.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Apoptotic (%) | = | 39.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Apoptotic (%) | = | 37.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 7.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Fragmented Nuclei (%) | = | 17.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | -1.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 620.0 | nM | PMID[32485533] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 68.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Normal (%) | = | 83.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Apoptotic (%) | = | 50.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 4.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Membrane Permeable-Phenotype Cells (%) | = | 1.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 19.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 1.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 7.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitotic Cells (%) | = | 35.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Healthy Nuclei (%) | = | 59.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Total Cells | = | 31171.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 15.05 | uM | PMID[37852423] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Normal (%) | = | 85.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Apoptotic (%) | = | 84.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Total Cells | = | 29842.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 46.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 28.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 10.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Healthy Nuclei (%) | = | 74.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 23.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Apoptotic (%) | = | 44.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Total Cells | = | 45150.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Apoptotic (%) | = | 80.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Total Cells | = | 14221.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 8.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Healthy Nuclei (%) | = | 76.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 13.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Total Cells | = | 44507.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 16.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Apoptotic (%) | = | 77.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 7.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 85.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitotic Cells (%) | = | 43.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 39.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Apoptotic (%) | = | 42.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.7 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Apoptotic (%) | = | 36.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Healthy Nuclei (%) | = | 74.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 8.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 44.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 15.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Fragmented Nuclei (%) | = | 14.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Pyknosed Nuclei (%) | = | 11.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 82.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Normal (%) | = | 96.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Apoptotic (%) | = | 82.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 47000.0 | nM | PMID[33454546] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 3.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 30.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 14.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitotic Cells (%) | = | 63.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Pyknosed Nuclei (%) | = | 9.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Pyknosed Nuclei (%) | = | 8.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 7.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 22.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Fragmented Nuclei (%) | = | 7.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 374.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Healthy Nuclei (%) | = | 77.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Membrane Permeable-Phenotype Cells (%) | = | 7.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 3.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 17.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 13.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Pyknosed Nuclei (%) | = | 32.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 685.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 63.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 420.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 760.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 18.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 28.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Fragmented Nuclei (%) | = | 5.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Pyknosed Nuclei (%) | = | 6.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Healthy Nuclei (%) | = | 77.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 5.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitotic Cells (%) | = | 46.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 81.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitotic Cells (%) | = | 55.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.86 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Imax | = | 86.0 | % | PMID[34138563] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 20.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 1.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 33.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 148.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 69.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 372.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Fragmented Nuclei (%) | = | 12.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Healthy Nuclei (%) | = | 42.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 189.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 33.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Healthy Nuclei (%) | = | 57.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 290.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.98 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 513.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 19.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 756.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 7900.0 | nM | PMID[35063896] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 391.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 242.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 12.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 294.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Apoptotic (%) | = | 86.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 159200.0 | nM | PMID[35567964] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 319.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Pyknosed Nuclei (%) | = | 35.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Apoptotic (%) | = | 66.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 0.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Apoptotic (%) | = | 53.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Healthy Nuclei (%) | = | 80.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 62.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 36.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Normal (%) | = | 92.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Normal (%) | = | 95.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 16.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 66.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 2.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 22.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 436.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 2000.0 | nM | PMID[37856864] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 15.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Healthy Nuclei (%) | = | 79.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Apoptotic (%) | = | 92.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 219.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 58.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Normal (%) | = | 97.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Fragmented Nuclei (%) | = | 32.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 14.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 186.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 29.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 263.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 5.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Fragmented Nuclei (%) | = | 31.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Healthy Nuclei (%) | = | 69.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Fragmented Nuclei (%) | = | 21.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 28.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitotic Cells (%) | = | 75.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitotic Cells (%) | = | 69.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 35.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Apoptotic (%) | = | 96.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Mitotic Cells (%) | = | 4.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Total Cell Count | = | 264.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Apoptotic (%) | = | 25.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 497.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Total Cell Count | = | 124.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Mitotic Cells (%) | = | 56.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Population Apoptotic (%) | = | 27.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1045 | Cell line | U2OS | Homo sapiens | Population Apoptotic (%) | = | 100.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT1886 | Cell line | J774 | Mus musculus | CC50 | = | 91100.0 | nM | PMID[29523468] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | CC50 | > | 50000.0 | nM | PMID[30528697] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | CC50 | = | 4400.0 | nM | PMID[35998343] |
| NPT433 | Subcellular | Liver microsomes | Homo sapiens | Activity | = | 445.0 | pmol | PMID[22931300] |
| NPT27699 | Cell line | B-cell line | Mus musculus | IC50 | = | 800.0 | nM | PMID[31961677] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 20000.0 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 19952.62 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | = | 98.27 | % | PMID[37939268] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 920.0 | nM | PMID[33744436] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 40.5 | % | PMID[37146520] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 632.0 | pg/ml | PMID[36379105] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | = | 81.0 | % | PMID[34355886] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | = | 68.0 | % | PMID[34355886] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | n.a. | n.a. | n.a. | PMID[36399795] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 52.82 | % | PMID[37146520] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 3.6 | nM | PMID[35870364] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 40.0 | % | PMID[33360800] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 60.0 | % | PMID[33360800] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | n.a. | n.a. | n.a. | PMID[35483323] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 1792.75 | pg/ml | PMID[37146520] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 581.27 | pg/ml | PMID[37146520] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | > | 50.0 | % | PMID[37314941] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 0.631 | nM | PMID[20469868] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 0.5012 | nM | PMID[20469868] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 0.3162 | nM | PMID[20469868] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IZ | = | 9.0 | mm | PMID[20739103] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IZ | = | 0.0 | mm | PMID[20739103] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 74.7 | % | PMID[21473609] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 83.0 | % | PMID[21766854] |
| NPT1308 | Tissue | Blood | Homo sapiens | EC50 | = | 6.9 | nM | PMID[21899328] |
| NPT1308 | Tissue | Blood | Homo sapiens | EC50 | = | 5.1 | nM | PMID[21899328] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 2.3 | nM | PMID[22506620] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 20.0 | % | PMID[23758110] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 20000.0 | nM | PMID[24992071] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 0.165 | % | PMID[24909081] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 9.09 | % | PMID[24909081] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 25.0 | nM | PMID[26110443] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 48.0 | % | PMID[27227459] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 42.0 | % | PMID[27227459] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 630.0 | nM | PMID[27825545] |
| NPT21752 | Cell line | Peritoneal macrophage cells | n.a. | IC50 | = | 150.0 | nM | PMID[31358465] |
| NPT20 | Organism | Candida albicans | Candida albicans | Inhibition | = | 1.68 | % | DOI[10.6019/CHEMBL4296181] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Inhibition | = | -0.78 | % | DOI[10.6019/CHEMBL4296181] |
| NPT2688 | Organism | Sus scrofa | Sus scrofa | Inhibition | = | 32.0 | % | PMID[15125973] |
| NPT2688 | Organism | Sus scrofa | Sus scrofa | Inhibition | = | 35.0 | % | PMID[15125973] |
| NPT2688 | Organism | Sus scrofa | Sus scrofa | Inhibition | = | 20.0 | % | PMID[15125973] |
| NPT20763 | Cell line | J774.1 | Mus musculus | IC50 | = | 170000.0 | nM | PMID[12608860] |
| NPT85 | Organism | Filobasidiella neoformans | Cryptococcus neoformans | Inhibition | = | -1.2 | % | DOI[10.6019/CHEMBL4296181] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Inhibition | = | 5.83 | % | DOI[10.6019/CHEMBL4296181] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | Inhibition | = | 2.35 | % | DOI[10.6019/CHEMBL4296181] |
| NPT2922 | Organism | Staphylococcus aureus subsp. aureus | Staphylococcus aureus subsp. aureus | Inhibition | = | -14.23 | % | DOI[10.6019/CHEMBL4296181] |
| NPT29108 | Cell line | Peritoneal macrophage | Mus musculus | Inhibition | = | 17.0 | % | PMID[34450495] |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 15.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 9.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 14.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 156.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 0.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Membrane Permeable-Phenotype Cells (%) | = | 0.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Apoptotic (%) | = | 35.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 4.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitotic Cells (%) | = | 37.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 6.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 151.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Healthy Nuclei (%) | = | 68.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 26.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitotic Cells (%) | = | 64.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 28.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 15.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 2.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 25.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Healthy Nuclei (%) | = | 65.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Pyknosed Nuclei (%) | = | 22.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 42.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 61.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Healthy Nuclei (%) | = | 52.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Pyknosed Nuclei (%) | = | 23.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 22.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 53.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Healthy Nuclei (%) | = | 46.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 1.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Healthy Nuclei (%) | = | 43.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 41.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 24.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 7.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 46.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Normal (%) | = | 95.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 4.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Membrane Permeable-Phenotype Cells (%) | = | 7.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitotic Cells (%) | = | 69.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitotic Cells (%) | = | 61.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 52.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 168.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Fragmented Nuclei (%) | = | 30.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Membrane Permeable-Phenotype Cells (%) | = | 4.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Normal (%) | = | 92.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitotic Cells (%) | = | 62.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Apoptotic (%) | = | 30.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitotic Cells (%) | = | 65.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 9.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Pyknosed Nuclei (%) | = | 24.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Total Cells | = | 17835.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Pyknosed Nuclei (%) | = | 20.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 5.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Normal (%) | = | 93.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Healthy Nuclei (%) | = | 50.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Total Cells | = | 16485.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 56.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitotic Cells (%) | = | 57.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 2.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Total Cells | = | 15057.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 3.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Apoptotic (%) | = | 37.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT21742 | Cell line | L02 | Homo sapiens | IC50 | = | 4620580.0 | nM | PMID[33515864] |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 10.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 0.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Growth Rate | = | 0.88 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Total Cells | = | 14985.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 4.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 66.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 69.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Normal (%) | = | 94.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Pyknosed Nuclei (%) | = | 17.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 3.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 13.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Fragmented Nuclei (%) | = | 22.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 184.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Mitochondria Different-Phenotype Cells (%) | = | 6.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Membrane Permeable-Phenotype Cells (%) | = | 5.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Healthy Nuclei (%) | = | 64.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 13.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 67.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 18.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 19.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 23.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 60.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 5.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Total Cells | = | 15078.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitotic Cells (%) | = | 73.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Growth Rate | = | 0.73 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Incucyte) |
| NPT29108 | Cell line | Peritoneal macrophage | Mus musculus | Inhibition | = | 62.8 | % | PMID[34450495] |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 23.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 3.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Pyknosed Nuclei (%) | = | 14.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Apoptotic (%) | = | 31.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 45.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Total Cells | = | 16657.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 54.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Fragmented Nuclei (%) | = | 20.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 51.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Fragmented Nuclei (%) | = | 24.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Normal (%) | = | 96.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 194.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 55.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Membrane Permeable-Phenotype Cells (%) | = | 6.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Hoechst High Intensity Objects (%) | = | 6.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Pyknosed Nuclei (%) | = | 19.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 1.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 53.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Healthy Nuclei (%) | = | 44.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 175.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitotic Cells (%) | = | 68.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Apoptotic (%) | = | 26.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Fragmented Nuclei (%) | = | 29.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 30.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 3.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Pyknosed Nuclei (%) | = | 26.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Apoptotic (%) | = | 62.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 12.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 19.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Healthy Nuclei (%) | = | 48.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Total Cells | = | 16285.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 4.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 16.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Membrane Permeable-Phenotype (%) | = | 2.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 167.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Healthy Nuclei (%) | = | 55.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Apoptotic (%) | = | 38.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Fragmented Nuclei (%) | = | 36.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Healthy Nuclei (%) | = | 58.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Total Cells | = | 15171.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 7.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitotic Cells (%) | = | 53.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 68.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Pyknosed Nuclei (%) | = | 21.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 25.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Healthy Nuclei (%) | = | 62.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 21.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Pyknosed Nuclei (%) | = | 13.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Pyknosed Nuclei (%) | = | 15.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Apoptotic (%) | = | 42.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Pyknosed Nuclei (%) | = | 25.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 21.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 173.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 149.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 40.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitotic Cells (%) | = | 50.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Mitotic Cells (%) | = | 47.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Pyknosed Nuclei (%) | = | 18.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Apoptotic (%) | = | 34.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 35.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 39.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 140.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 166.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Fragmented Nuclei (%) | = | 18.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 24.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Fragmented Nuclei (%) | = | 14.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Apoptotic (%) | = | 48.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Apoptotic (%) | = | 50.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Fragmented Nuclei (%) | = | 15.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 22.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 172.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Pyknosed Nuclei (%) | = | 18.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Fragmented Nuclei (%) | = | 38.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 180.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Fragmented Nuclei % | = | 13.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Normal (%) | = | 97.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Healthy Nuclei (%) | = | 66.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitotic Cells (%) | = | 52.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Control DMSO Tubulin Phenotype Different Cells (%) | = | 24.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Mitochondria Different-Phenotype (%) | = | 5.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Fragmented Nuclei (%) | = | 26.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 150.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 27.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Total Cell Count | = | 142.0 | n.a. | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Normal (%) | = | 98.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Apoptotic (%) | = | 46.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Population Tubulin-Different-Phenotype (%) | = | 34.0 | % | Tm Shift (DSF) assay results for EUbOPEN Chemogenomis Library 2 (Multiplex) |
| NPT27 | Others | Unspecified | n.a. | IC50 | = | 10.0 | nM | PMID[11229767] |
| NPT27 | Others | Unspecified | n.a. | IC50 | = | 40.0 | nM | PMID[11229767] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 7.943 | nM | PMID[15999989] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 3.2 | % | PMID[16789751] |
| NPT27 | Others | Unspecified | n.a. | Activity | < | 1.0 | % | PMID[16789751] |
| NPT2 | Others | Unspecified | n.a. | Ratio | > | 0.69 | n.a. | PMID[15165136] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 5.0 | nM | PMID[19323483] |
| NPT2 | Others | Unspecified | n.a. | Activity | > | 80.0 | % | PMID[19323483] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 0.13 | % | PMID[19648015] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 0.0 | % | PMID[20064725] |
| NPT27 | Others | Unspecified | n.a. | FC | = | 0.4 | n.a. | PMID[20469868] |
| NPT27 | Others | Unspecified | n.a. | FC | = | 7.0 | n.a. | PMID[20469868] |
| NPT27 | Others | Unspecified | n.a. | FC | = | 8.0 | n.a. | PMID[20469868] |
| NPT27 | Others | Unspecified | n.a. | FC | = | 40.0 | n.a. | PMID[20469868] |
| NPT27 | Others | Unspecified | n.a. | FC | = | 86.0 | n.a. | PMID[20469868] |
| NPT27 | Others | Unspecified | n.a. | FC | = | 300.0 | n.a. | PMID[20469868] |
| NPT27 | Others | Unspecified | n.a. | FC | = | 870.0 | n.a. | PMID[20469868] |
| NPT27 | Others | Unspecified | n.a. | FC | = | 2944.0 | n.a. | PMID[20469868] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 0.0 | % | PMID[20430485] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 0.0 | % | PMID[20638287] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 61.6 | % | PMID[21469695] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 0.0 | % | DOI[10.1007/s00044-011-9856-1] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 0.0 | % | DOI[10.1007/s00044-011-9834-7] |
| NPT27 | Others | Unspecified | n.a. | IC50 | > | 15000.0 | nM | PMID[24992071] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 610.0 | nM | PMID[24938495] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 100.0 | pg/ml | PMID[28799755] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 7.8 | nM | PMID[30108696] |
| NPT26631 | Cell line | Multiple myeloma cancer stem cell | n.a. | IC50 | > | 100000.0 | nM | PMID[30108696] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 1.6 | % | PMID[30419493] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 82.5 | % | PMID[31473042] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 134.0 | nM | PMID[31473042] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | Inhibition | = | 8.59 | % | DOI[10.6019/CHEMBL4296181] |
| NPT2 | Others | Unspecified | n.a. | EC50 | = | 7.943 | nM | PMID[32631518] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 92.74 | % | PMID[30905542] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 65.0 | % | PMID[33264011] |
| NPT20632 | Organism | Chikungunya virus | Chikungunya virus | Activity | = | 70.9 | % | PMID[36940609] |
| NPT21769 | Cell line | GES1 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[36399795] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT113 | Cell line | RAW264.7 | Mus musculus | Survival | = | 91.0 | % | PMID[26087384] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Survival | = | 100.0 | % | PMID[26087384] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Survival | = | 97.7 | % | PMID[29272126] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Survival | = | 97.1 | % | PMID[29272126] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 42.0 | % | PMID[15125973] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 35.0 | % | PMID[15125973] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 41.0 | % | PMID[15125973] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 16.0 | % | PMID[15125973] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 4.7 | nM | PMID[10052971] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 3.5 | nM | PMID[10052971] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 35800.0 | nM | PMID[10579834] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 1000.0 | nM | PMID[10579834] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 0.1 | nM | PMID[11909709] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 0.1 | nM | PMID[10617085] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 0.3 | cm | PMID[3494125] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 0.3 | nM | PMID[9873608] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | > | 100.0 | ug ear-1 | DOI[10.1016/S0960-894X(01)81022-2] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 0.5 | ug ear-1 | DOI[10.1016/S0960-894X(01)81022-2] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 0.7 | ug ear-1 | DOI[10.1016/S0960-894X(01)81022-2] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 0.1 | nM | PMID[11063620] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 82.0 | % | PMID[15454241] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 96.0 | % | PMID[15454241] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 0.27 | ug | PMID[16821781] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 71.0 | % | PMID[16697190] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 54.0 | % | PMID[16697190] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 42.0 | % | PMID[17608466] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 44.0 | % | PMID[17608466] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 14.0 | % | PMID[17608466] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 62.0 | % | PMID[17608466] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 36.0 | % | PMID[17608466] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | -86.0 | % | PMID[17095218] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 72.0 | % | PMID[19303290] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 81.0 | % | PMID[9392883] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 76.0 | % | PMID[9392883] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 89.0 | % | PMID[9392883] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 93.0 | % | PMID[9392883] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 84.0 | % | PMID[9392883] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 82.0 | % | PMID[7760072] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 92.0 | % | PMID[10217718] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 1.75 | % | PMID[19362486] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 20.0 | % | PMID[19362486] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 81.0 | % | PMID[19362486] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 35.0 | % | PMID[19362486] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 22.0 | million | PMID[19394230] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 18.5 | million | PMID[19394230] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 1404.0 | million | PMID[19394230] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 0.003 | mg.kg-1 | PMID[19425597] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 90.0 | % | PMID[19425597] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 24.0 | % | PMID[19425597] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 31.0 | % | PMID[19425597] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 33.0 | % | PMID[19425597] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 69.0 | % | PMID[19425597] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 75.0 | % | PMID[19425597] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 84.0 | % | PMID[19425597] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 87.0 | % | PMID[19425597] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 88.0 | % | PMID[19425597] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 0.54 | % | PMID[20099827] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 0.77 | % | PMID[20099827] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 68.0 | % | PMID[20188549] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 24.0 | % | PMID[20469868] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 67.0 | % | PMID[20469868] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 88.0 | % | PMID[20469868] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 83.0 | % | PMID[20469868] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 60.0 | % | PMID[20666458] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 90.0 | % | PMID[20086156] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 90.0 | % | PMID[21916510] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 78.0 | % | PMID[21469692] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 83.0 | % | PMID[21469692] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 65.0 | % | PMID[21469692] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 50.0 | % | PMID[21469692] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 69.0 | % | PMID[21469692] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 81.0 | % | PMID[21469692] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 43.0 | % | PMID[21469692] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 48.0 | % | PMID[21469692] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 63.0 | % | PMID[22339472] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 83.0 | % | PMID[24900359] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 102.0 | % | PMID[22682057] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 70.0 | % | PMID[22924688] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 83.0 | % | PMID[25479567] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 97.0 | % | PMID[25479567] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 70.5 | % | PMID[26110443] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 506.3 | mg/cm3 | DOI[10.1039/C5MD00215J] |
| NPT32 | Organism | Mus musculus | Mus musculus | Survival | = | 91.0 | % | PMID[27825545] |
| NPT32 | Organism | Mus musculus | Mus musculus | Survival | = | 100.0 | % | PMID[27825545] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 59.0 | % | PMID[30106292] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 10.1 | % | PMID[30106292] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 43.0 | % | PMID[30106292] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 90.0 | % | PMID[30193941] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 51.0 | % | PMID[31272795] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 46.8 | % | PMID[31299586] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 45.0 | % | PMID[32150408] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 72.0 | % | PMID[32150408] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 82.0 | % | PMID[32150408] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 45.0 | % | PMID[32676146] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 37.0 | % | PMID[32676146] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 1.53 | mm | PMID[30905542] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 2.32 | pg | PMID[30905542] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 0.63 | pg | PMID[30905542] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 2.17 | pg | PMID[30905542] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 0.86 | pg | PMID[30905542] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 1.99 | pg | PMID[30905542] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 0.39 | pg | PMID[30905542] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 1.5 | pg | PMID[30905542] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 2.96 | pg | PMID[30905542] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 0.85 | pg | PMID[30905542] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 17.19 | g | PMID[31881455] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 72.9 | % | PMID[33360197] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 40.9 | % | PMID[33360197] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 30.6 | % | PMID[33360197] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 66.9 | % | PMID[33360197] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 75.1 | % | PMID[33360197] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 46.1 | % | PMID[33360197] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 55.9 | % | PMID[33360197] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 58.7 | % | PMID[33360197] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[34283606] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 3.7 | n.a. | PMID[36908007] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[34315041] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[37948340] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[33933753] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[36708679] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[37314941] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[36655121] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[37257256] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 33.5 | % | PMID[34138563] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 59.0 | % | US-20210017201-A1 |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[34138563] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 46.9 | % | PMID[33706515] |
| NPT32 | Organism | Mus musculus | Mus musculus | Survival | = | 100.0 | % | PMID[34218083] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[36462751] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[35576655] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[36394994] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 72.1 | % | PMID[33706515] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[36689364] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 2.4 | 10^6/ml | PMID[34138563] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 51.0 | % | PMID[34138563] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 37.0 | % | US-20210017201-A1 |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Inhibition | = | 45.0 | % | PMID[25102418] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Inhibition | = | 88.0 | % | PMID[25102418] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Activity | = | 1.14 | mg/ml | PMID[25102418] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Potency | = | 1.0 | n.a. | PMID[6827553] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Activity | = | 0.8 | % | PMID[20022146] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 95.0 | % | PMID[9685237] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED30 | < | 2.5 | uM kg-1 | DOI[10.1016/S0960-894X(01)81260-9] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 99.0 | % | PMID[15109623] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Potency | = | 200.0 | n.a. | PMID[6827553] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 69.0 | % | PMID[6094808] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | IC50 | = | 20.0 | nM | PMID[12039573] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.12 | mg.kg-1 | PMID[12039573] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 95.0 | % | PMID[8709136] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | IC50 | = | 20.0 | nM | PMID[12113803] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 95.0 | % | PMID[1995900] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 98.0 | % | PMID[1995900] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 71.0 | % | PMID[3681891] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 80.0 | % | PMID[3681891] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 89.0 | % | PMID[17467123] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 96.0 | % | PMID[17467123] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 92.0 | % | PMID[17467123] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 70.0 | % | PMID[17467123] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 85.0 | % | PMID[17467123] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 94.0 | % | PMID[17467123] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | FC | = | 2.13 | n.a. | PMID[22497764] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 40.0 | % | DOI[10.1007/s00044-009-9190-z] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 30.0 | % | DOI[10.1007/s00044-009-9190-z] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 23.0 | % | DOI[10.1007/s00044-009-9190-z] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 89.0 | % | DOI[10.1007/s00044-012-0406-2] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 87.0 | % | DOI[10.1007/s00044-012-0406-2] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 71.0 | % | DOI[10.1007/s00044-012-0406-2] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 45.0 | % | DOI[10.1007/s00044-012-0406-2] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 33.0 | % | DOI[10.1007/s00044-012-0406-2] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 29.0 | % | DOI[10.1007/s00044-012-0406-2] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 17.0 | % | PMID[71349] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 25.0 | % | PMID[71349] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 30.0 | % | PMID[71349] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 53.0 | % | PMID[71349] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 76.0 | % | PMID[71349] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 16.0 | % | PMID[71349] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 28.0 | % | PMID[71349] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 34.0 | % | PMID[71349] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 49.0 | % | PMID[71349] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 100.0 | % | PMID[25690784] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 73.4 | % | PMID[25824662] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 62.5 | % | PMID[25824662] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 18.46 | % | PMID[25874339] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 4.49 | % | PMID[25874339] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 11.8 | % | PMID[25874339] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.76 | micrometer/day | PMID[25874339] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 6.58 | 10'9/L | PMID[25874339] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 25.77 | % | PMID[25874339] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 53.03 | % | PMID[25874339] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 213.0 | U/L | PMID[25874339] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 63.64 | U/L | PMID[25874339] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.63 | mmol/L | PMID[25874339] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.6 | % | PMID[28410442] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 6.7 | ng/mg | PMID[28410442] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 2.2 | pg/mg | PMID[28410442] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 86.0 | % | PMID[28501511] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.03 | U/L | PMID[28613871] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 65.0 | % | PMID[28689977] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 59.2 | g | PMID[29395981] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 91.0 | % | PMID[30114661] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 79.1 | % | PMID[27713015] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | n.a. | n.a. | n.a. | PMID[34491054] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | n.a. | n.a. | n.a. | PMID[35985062] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 97.6 | % | PMID[36912866] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Rattus norvegicus | Brain | Fu | = | 0.238 | n.a. | PMID[33619967] |
| Rattus norvegicus | Brain/Plasma | K(p,uu,brain) | = | 0.081 | n.a. | PMID[33619967] |
| Rattus norvegicus | Plasma | Fu | = | 0.159 | n.a. | PMID[33619967] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC331613 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 0.5467 | Remote Similarity | NPC481929 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC331613 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| 1.0 | High Similarity | NPD5216 | Phase 2 |
| 1.0 | High Similarity | NPD5217 | Approved |
| 1.0 | High Similarity | NPD5225 | Phase 4 |
| 1.0 | High Similarity | NPD5226 | Phase 4 |
| 0.8475 | Intermediate Similarity | NPD5167 | Pre-clinical |
| 0.8475 | Intermediate Similarity | NPD5169 | Approved |
| 0.7692 | Intermediate Similarity | NPD6013 | Phase 4 |
| 0.7463 | Intermediate Similarity | NPD5247 | Approved |
| 0.7463 | Intermediate Similarity | NPD5249 | Phase 3 |
| 0.7353 | Intermediate Similarity | NPD5250 | Phase 4 |
| 0.7353 | Intermediate Similarity | NPD5251 | Phase 4 |
| 0.7246 | Intermediate Similarity | NPD5248 | Approved |
| 0.7188 | Intermediate Similarity | NPD4634 | Phase 4 |
| 0.7077 | Intermediate Similarity | NPD5141 | Phase 2 |
| 0.7077 | Intermediate Similarity | NPD5174 | Approved |
| 0.7077 | Intermediate Similarity | NPD5175 | Phase 2 |
| 0.7042 | Intermediate Similarity | NPD8130 | Phase 1 |
| 0.6615 | Remote Similarity | NPD5222 | Phase 4 |
| 0.6143 | Remote Similarity | NPD6014 | Approved |
| 0.597 | Remote Similarity | NPD5091 | Approved |
| 0.5942 | Remote Similarity | NPD5127 | Approved |
| 0.5733 | Remote Similarity | NPD6319 | Phase 4 |
| 0.5733 | Remote Similarity | NPD6883 | Phase 4 |
| 0.5694 | Remote Similarity | NPD6335 | Phase 4 |
| 0.5556 | Remote Similarity | NPD5128 | Phase 2 |
| 0.5556 | Remote Similarity | NPD5290 | Phase 2 |
| 0.5526 | Remote Similarity | NPD6015 | Phase 4 |
| 0.5467 | Remote Similarity | NPD7101 | Phase 4 |
| 0.5467 | Remote Similarity | NPD7102 | Phase 4 |
| 0.5362 | Remote Similarity | NPD5210 | Phase 4 |
| 0.5352 | Remote Similarity | NPD5215 | Approved |
| 0.5325 | Remote Similarity | NPD6869 | Phase 4 |
| 0.5256 | Remote Similarity | NPD7290 | Pre-clinical |
| 0.5244 | Remote Similarity | NPD7236 | Phase 4 |
| 0.5132 | Remote Similarity | NPD5134 | Clinical (unspecified phase) |
| 0.5132 | Remote Similarity | NPD5135 | Approved |
| 0.507 | Remote Similarity | NPD5223 | Phase 4 |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
