Drug Information| Drug ID:   | NPD5210 |
| Drug Name:   | Meprednisone |
| Molecular Formula:   | C22H28O5 |
| Canonical SMILES:   | OCC(=O)[C@@]1(O)[C@@H](C)C[C@@H]2[C@]1(C)CC(=O)[C@H]1[C@H]2CCC2=CC(=O)C=C[C@]12C |
| Standard InCHI:   | "InChI=1S/C22H28O5/c1-12-8-16-15-5-4-13-9-14(24)6-7-20(13,2)19(15)17(25)10-21(16,3)22(12,27)18(26)11-23/h6-7,9,12,15-16,19,23,27H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,19+,20-,21-,22-/m0/s1" |
| Standard InCHIKey:   | PIDANAQULIKBQS-RNUIGHNZSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD5210Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5362 | NPC331613 |
| Remote Similarity | 0.5362 | NPC599856 |
| Remote Similarity | 0.5231 | NPC62180 |
| Remote Similarity | 0.5075 | NPC334061 |
| Remote Similarity | 0.5075 | NPC611819 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 372.19 |
| ALogP   | -1.0642 |
| MLogP   | 3.33 |
| XLogP   | 0.905 |
| HDA   | 5 |
| HBD   | 2 |
| Rotatable Bonds   | 7 |
| TPSA   | 91.67 |
| RO5 Violation   | 0 |