Drug Information| Drug ID:   | NPD7101 |
| Drug Name:   | Beclometasone Dipropionate |
| Molecular Formula:   | C28H37ClO7 |
| Canonical SMILES:   | CCC(=O)O[C@@]1([C@@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2CCC2=CC(=O)C=C[C@]12C)Cl)C(=O)COC(=O)CC |
| Standard InCHI:   | "InChI=1S/C28H37ClO7/c1-6-23(33)35-15-22(32)28(36-24(34)7-2)16(3)12-20-19-9-8-17-13-18(30)10-11-25(17,4)27(19,29)21(31)14-26(20,28)5/h10-11,13,16,19-21,31H,6-9,12,14-15H2,1-5H3/t16-,19-,20-,21-,25-,26-,27-,28-/m0/s1" |
| Standard InCHIKey:   | KUVIULQEHSCUHY-XYWKZLDCSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD7101Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC481929 |
| High Similarity | 1.0 | NPC608433 |
| Remote Similarity | 0.5467 | NPC331613 |
| Remote Similarity | 0.5467 | NPC599856 |
| Molecular Weight   | 520.22 |
| ALogP   | 0.2312 |
| MLogP   | 3.66 |
| XLogP   | 2.832 |
| HDA   | 7 |
| HBD   | 1 |
| Rotatable Bonds   | 15 |
| TPSA   | 106.97 |
| RO5 Violation   | 0 |