Drug Information| Drug ID:   | NPD5135 |
| Drug Name:   | fluticasone |
| Molecular Formula:   | C22H27F3O4S |
| Canonical SMILES:   | FCSC(=O)[C@@]1(O)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F)F |
| Standard InCHI:   | "InChI=1S/C22H27F3O4S/c1-11-6-13-14-8-16(24)15-7-12(26)4-5-19(15,2)21(14,25)17(27)9-20(13,3)22(11,29)18(28)30-10-23/h4-5,7,11,13-14,16-17,27,29H,6,8-10H2,1-3H3/t11-,13+,14+,16+,17+,19+,20+,21+,22+/m1/s1" |
| Standard InCHIKey:   | MGNNYOODZCAHBA-GQKYHHCASA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD5135Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 444.16 |
| ALogP   | 1.0572 |
| MLogP   | 3 |
| XLogP   | 2.396 |
| HDA   | 4 |
| HBD   | 2 |
| Rotatable Bonds   | 11 |
| TPSA   | 99.9 |
| RO5 Violation   | 0 |