Drug Information| Drug ID:   | NPD6319 |
| Drug Name:   | Triamcinolone Diacetate |
| Molecular Formula:   | C25H31FO8 |
| Canonical SMILES:   | CC(=O)O[C@@H]1C[C@@H]2[C@]([C@@]1(O)C(=O)COC(=O)C)(C)C[C@@H]([C@]1([C@H]2CCC2=CC(=O)C=C[C@]12C)F)O |
| Standard InCHI:   | "InChI=1S/C25H31FO8/c1-13(27)33-12-20(31)25(32)21(34-14(2)28)10-18-17-6-5-15-9-16(29)7-8-22(15,3)24(17,26)19(30)11-23(18,25)4/h7-9,17-19,21,30,32H,5-6,10-12H2,1-4H3/t17-,18-,19-,21+,22-,23-,24-,25+/m0/s1" |
| Standard InCHIKey:   | XGMPVBXKDAHORN-RBWIMXSLSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6319Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5733 | NPC331613 |
| Remote Similarity | 0.5733 | NPC599856 |
| Remote Similarity | 0.5696 | NPC481929 |
| Remote Similarity | 0.5696 | NPC608433 |
| Remote Similarity | 0.5375 | NPC2766 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 478.2 |
| ALogP   | -0.6367 |
| MLogP   | 3.22 |
| XLogP   | 0.862 |
| HDA   | 8 |
| HBD   | 2 |
| Rotatable Bonds   | 13 |
| TPSA   | 127.2 |
| RO5 Violation   | 0 |