Drug Information| Drug ID:   | NPD5091 |
| Drug Name:   | Clobetasone |
| Molecular Formula:   | C22H26ClFO4 |
| Canonical SMILES:   | ClCC(=O)[C@@]1(O)[C@@H](C)C[C@@H]2[C@]1(C)CC(=O)[C@]1([C@H]2CCC2=CC(=O)C=C[C@]12C)F |
| Standard InCHI:   | "InChI=1S/C22H26ClFO4/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,24)17(26)10-20(16,3)22(12,28)18(27)11-23/h6-7,9,12,15-16,28H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,19-,20-,21-,22-/m0/s1" |
| Standard InCHIKey:   | XXIFVOHLGBURIG-OZCCCYNHSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | DrugBank; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD5091Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 408.15 |
| ALogP   | 0.4799 |
| MLogP   | 3.22 |
| XLogP   | 1.376 |
| HDA   | 4 |
| HBD   | 1 |
| Rotatable Bonds   | 8 |
| TPSA   | 71.44 |
| RO5 Violation   | 0 |