Drug Information| Drug ID:   | NPD6335 |
| Drug Name:   | Clobetasol Propionate |
| Molecular Formula:   | C25H32ClFO5 |
| Canonical SMILES:   | CCC(=O)O[C@@]1([C@@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2CCC2=CC(=O)C=C[C@]12C)F)C(=O)CCl |
| Standard InCHI:   | "InChI=1S/C25H32ClFO5/c1-5-21(31)32-25(20(30)13-26)14(2)10-18-17-7-6-15-11-16(28)8-9-22(15,3)24(17,27)19(29)12-23(18,25)4/h8-9,11,14,17-19,29H,5-7,10,12-13H2,1-4H3/t14-,17-,18-,19-,22-,23-,24-,25-/m0/s1" |
| Standard InCHIKey:   | CBGUOGMQLZIXBE-XGQKBEPLSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD6335Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.8308 | NPC481929 |
| Intermediate Similarity | 0.8308 | NPC608433 |
| Remote Similarity | 0.5694 | NPC331613 |
| Remote Similarity | 0.5694 | NPC599856 |
| TTD   | DAP001183 |
| DrugBank   | DB01013 |
| ChEMBL   | CHEMBL1159650 |
| IUPHAR/BPS   | 7062 |
| PharmaGKB   | PA164744375 |
| KEGG Drug   | D01272 |
| PubChem CID   | 0 |
| ChEBI   | 31414 |
| CAS Number   | 25122-46-7 |
| Molecular Weight   | 466.19 |
| ALogP   | 0.7159 |
| MLogP   | 3.44 |
| XLogP   | 2.976 |
| HDA   | 5 |
| HBD   | 1 |
| Rotatable Bonds   | 12 |
| TPSA   | 80.67 |
| RO5 Violation   | 0 |