Drug Information| Drug ID:   | NPD5250 |
| Drug Name:   | Betamethasone Phosphoric Acid |
| Molecular Formula:   | C22H30FO8P |
| Canonical SMILES:   | O=C1C=C[C@]2(C(=C1)CC[C@@H]1[C@]2(F)[C@@H](O)C[C@]2([C@H]1C[C@@H]([C@]2(O)C(=O)COP(=O)(O)O)C)C)C |
| Standard InCHI:   | "InChI=1S/C22H30FO8P/c1-12-8-16-15-5-4-13-9-14(24)6-7-19(13,2)21(15,23)17(25)10-20(16,3)22(12,27)18(26)11-31-32(28,29)30/h6-7,9,12,15-17,25,27H,4-5,8,10-11H2,1-3H3,(H2,28,29,30)/t12-,15-,16-,17-,19-,20-,21-,22-/m0/s1" |
| Standard InCHIKey:   | VQODGRNSFPNSQE-DVTGEIKXSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD5250Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7353 | NPC331613 |
| Intermediate Similarity | 0.7353 | NPC599856 |
| Remote Similarity | 0.55 | NPC481929 |
| Remote Similarity | 0.55 | NPC608433 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 472.17 |
| ALogP   | -0.8798 |
| MLogP   | 2.78 |
| XLogP   | -0.52 |
| HDA   | 8 |
| HBD   | 4 |
| Rotatable Bonds   | 12 |
| TPSA   | 151.17 |
| RO5 Violation   | 0 |