Drug Information| Drug ID:   | NPD6015 |
| Drug Name:   | Triamcinolone Acetonide |
| Molecular Formula:   | C24H31FO6 |
| Canonical SMILES:   | OCC(=O)[C@@]12OC(O[C@@H]1C[C@@H]1[C@]2(C)C[C@H](O)[C@]2([C@H]1CCC1=CC(=O)C=C[C@]21C)F)(C)C |
| Standard InCHI:   | "InChI=1S/C24H31FO6/c1-20(2)30-19-10-16-15-6-5-13-9-14(27)7-8-21(13,3)23(15,25)17(28)11-22(16,4)24(19,31-20)18(29)12-26/h7-9,15-17,19,26,28H,5-6,10-12H2,1-4H3/t15-,16-,17-,19+,21-,22-,23-,24+/m0/s1" |
| Standard InCHIKey:   | YNDXUCZADRHECN-JNQJZLCISA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6015Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7534 | NPC313528 |
| Remote Similarity | 0.5526 | NPC331613 |
| Remote Similarity | 0.5526 | NPC599856 |
| Remote Similarity | 0.5309 | NPC481929 |
| Remote Similarity | 0.5309 | NPC608433 |
| Remote Similarity | 0.5091 | NPC68903 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 434.21 |
| ALogP   | -0.6599 |
| MLogP   | 3.33 |
| XLogP   | 1.224 |
| HDA   | 6 |
| HBD   | 2 |
| Rotatable Bonds   | 9 |
| TPSA   | 93.06 |
| RO5 Violation   | 0 |