Drug Information| Drug ID:   | NPD5223 |
| Drug Name:   | Fluorometholone |
| Molecular Formula:   | C22H29FO4 |
| Canonical SMILES:   | O=C1C=C[C@]2(C(=C1)[C@@H](C)C[C@@H]1[C@]2(F)[C@@H](O)C[C@]2([C@H]1CC[C@]2(O)C(=O)C)C)C |
| Standard InCHI:   | "InChI=1S/C22H29FO4/c1-12-9-17-15-6-8-21(27,13(2)24)20(15,4)11-18(26)22(17,23)19(3)7-5-14(25)10-16(12)19/h5,7,10,12,15,17-18,26-27H,6,8-9,11H2,1-4H3/t12-,15-,17-,18-,19-,20-,21-,22-/m0/s1" |
| Standard InCHIKey:   | FAOZLTXFLGPHNG-KNAQIMQKSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD5223Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DAP001047 |
| DrugBank   | DB00324 |
| ChEMBL   | CHEMBL1200600 |
| IUPHAR/BPS   | 7079 |
| PharmaGKB   | PA164781355 |
| KEGG Drug   | D01367 |
| PubChem CID   | 9878 |
| ChEBI   | 31625 |
| CAS Number   | 426-13-1 |
| Molecular Weight   | 376.2 |
| ALogP   | -0.0788 |
| MLogP   | 3.33 |
| XLogP   | 1.953 |
| HDA   | 4 |
| HBD   | 2 |
| Rotatable Bonds   | 8 |
| TPSA   | 74.6 |
| RO5 Violation   | 0 |