Drug Information| Drug ID:   | NPD5175 |
| Drug Name:   | Flumethasone |
| Molecular Formula:   | C22H28F2O5 |
| Canonical SMILES:   | OCC(=O)[C@@]1(O)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F)F |
| Standard InCHI:   | "InChI=1S/C22H28F2O5/c1-11-6-13-14-8-16(23)15-7-12(26)4-5-19(15,2)21(14,24)17(27)9-20(13,3)22(11,29)18(28)10-25/h4-5,7,11,13-14,16-17,25,27,29H,6,8-10H2,1-3H3/t11-,13+,14+,16+,17+,19+,20+,21+,22+/m1/s1" |
| Standard InCHIKey:   | WXURHACBFYSXBI-GQKYHHCASA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD5175Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7077 | NPC331613 |
| Intermediate Similarity | 0.7077 | NPC599856 |
| Remote Similarity | 0.5513 | NPC313528 |
| TTD   | DAP000814 |
| DrugBank   | DB00663 |
| ChEMBL   | CHEMBL1201392 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA164749388 |
| KEGG Drug   | D04208 |
| PubChem CID   | 0 |
| ChEBI   | 34764 |
| CAS Number   | 2135-17-3 |
| Molecular Weight   | 410.19 |
| ALogP   | -0.5771 |
| MLogP   | 3.11 |
| XLogP   | 1.067 |
| HDA   | 5 |
| HBD   | 3 |
| Rotatable Bonds   | 10 |
| TPSA   | 94.83 |
| RO5 Violation   | 0 |