Drug Information| Drug ID:   | NPD6014 |
| Drug Name:   | Dexamethasone Acetate |
| Molecular Formula:   | C24H31FO6 |
| Canonical SMILES:   | OCC(=O)[C@@]1(OC(=O)C)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2CCC2=CC(=O)C=C[C@]12C)F |
| Standard InCHI:   | "InChI=1S/C24H31FO6/c1-13-9-18-17-6-5-15-10-16(28)7-8-21(15,3)23(17,25)19(29)11-22(18,4)24(13,20(30)12-26)31-14(2)27/h7-8,10,13,17-19,26,29H,5-6,9,11-12H2,1-4H3/t13-,17+,18+,19+,21+,22+,23+,24+/m1/s1" |
| Standard InCHIKey:   | FPVRUILUEYSIMD-RPRRAYFGSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6014Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.75 | NPC481929 |
| Intermediate Similarity | 0.75 | NPC608433 |
| Remote Similarity | 0.6143 | NPC331613 |
| Remote Similarity | 0.6143 | NPC599856 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 434.21 |
| ALogP   | -0.5649 |
| MLogP   | 3.33 |
| XLogP   | 1.449 |
| HDA   | 6 |
| HBD   | 2 |
| Rotatable Bonds   | 11 |
| TPSA   | 100.9 |
| RO5 Violation   | 0 |