Drug Information| Drug ID:   | NPD5290 |
| Drug Name:   | tipredane |
| Molecular Formula:   | C22H31FO2S2 |
| Canonical SMILES:   | CCS[C@]1(SC)CC[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2CCC2=CC(=O)C=C[C@]12C)F |
| Standard InCHI:   | "InChI=1S/C22H31FO2S2/c1-5-27-21(26-4)11-9-16-17-7-6-14-12-15(24)8-10-19(14,2)22(17,23)18(25)13-20(16,21)3/h8,10,12,16-18,25H,5-7,9,11,13H2,1-4H3/t16-,17-,18-,19-,20-,21+,22-/m0/s1" |
| Standard InCHIKey:   | DXEXNWDGDYUITL-FXSSSKFRSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD5290Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5556 | NPC331613 |
| Remote Similarity | 0.5556 | NPC599856 |
| Remote Similarity | 0.5526 | NPC481929 |
| Remote Similarity | 0.5526 | NPC608433 |
| Molecular Weight   | 410.17 |
| ALogP   | 2.1551 |
| MLogP   | 3.33 |
| XLogP   | 4.639 |
| HDA   | 2 |
| HBD   | 1 |
| Rotatable Bonds   | 9 |
| TPSA   | 87.9 |
| RO5 Violation   | 0 |