Drug Information| Drug ID:   | NPD6016 |
| Drug Name:   | Flunisolide |
| Molecular Formula:   | C24H31FO6 |
| Canonical SMILES:   | OCC(=O)[C@@]12OC(O[C@@H]1C[C@@H]1[C@]2(C)C[C@H](O)[C@H]2[C@H]1C[C@@H](C1=CC(=O)C=C[C@]21C)F)(C)C |
| Standard InCHI:   | "InChI=1S/C24H31FO6/c1-21(2)30-19-9-14-13-8-16(25)15-7-12(27)5-6-22(15,3)20(13)17(28)10-23(14,4)24(19,31-21)18(29)11-26/h5-7,13-14,16-17,19-20,26,28H,8-11H2,1-4H3/t13-,14-,16-,17-,19+,20+,22-,23-,24+/m0/s1" |
| Standard InCHIKey:   | XSFJVAJPIHIPKU-XWCQMRHXSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD6016Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6711 | NPC313528 |
| Molecular Weight   | 434.21 |
| ALogP   | -0.5221 |
| MLogP   | 3.33 |
| XLogP   | 1.122 |
| HDA   | 6 |
| HBD   | 2 |
| Rotatable Bonds   | 9 |
| TPSA   | 93.06 |
| RO5 Violation   | 0 |