Drug Information| Drug ID:   | NPD5701 |
| Drug Name:   | Fludrocortisone Acetate |
| Molecular Formula:   | C23H31FO6 |
| Canonical SMILES:   | CC(=O)OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2CCC2=CC(=O)CC[C@]12C)F |
| Standard InCHI:   | "InChI=1S/C23H31FO6/c1-13(25)30-12-19(28)22(29)9-7-16-17-5-4-14-10-15(26)6-8-20(14,2)23(17,24)18(27)11-21(16,22)3/h10,16-18,27,29H,4-9,11-12H2,1-3H3/t16-,17-,18-,20-,21-,22-,23-/m0/s1" |
| Standard InCHIKey:   | SYWHXTATXSMDSB-GSLJADNHSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD5701Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 422.21 |
| ALogP   | -0.5134 |
| MLogP   | 3.22 |
| XLogP   | 0.684 |
| HDA   | 6 |
| HBD   | 2 |
| Rotatable Bonds   | 10 |
| TPSA   | 100.9 |
| RO5 Violation   | 0 |