NPASS drugs

Drug Information

Drug ID:	NPD3133
Drug Name:	nandrolone
Molecular Formula:	C18H26O2
Canonical SMILES:	O=C1CC[C@H]2C(=C1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C
Standard InCHI:	"InChI=1S/C18H26O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,13-17,20H,2-9H2,1H3/t13-,14+,15+,16-,17-,18-/m0/s1"
Standard InCHIKey:	NPAGDVCDWIYMMC-IZPLOLCNSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	TTD; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD3133

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	53983
0.1-0.2	136149
0.2-0.3	20981
0.3-0.4	559
0.4-0.5	52
0.5-0.6	8
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC321187
High Similarity	1.0	NPC599870
Remote Similarity	0.6863	NPC227064
Remote Similarity	0.6863	NPC329043
Remote Similarity	0.6863	NPC58841
Remote Similarity	0.6863	NPC161423
Remote Similarity	0.6863	NPC612051
Remote Similarity	0.6604	NPC328731
Remote Similarity	0.5926	NPC28159
Remote Similarity	0.5818	NPC6434
Remote Similarity	0.569	NPC108896
Remote Similarity	0.5536	NPC328405
Remote Similarity	0.5455	NPC325293
Remote Similarity	0.5357	NPC307506
Remote Similarity	0.5323	NPC612035
Remote Similarity	0.5263	NPC163511

Drug Structure

NPD3133 OpenBabel08211702562D 21 24 0 0 1 0 0 0 0 0999 V2000 -0.0003 1.0030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6773 -2.9025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1904 -1.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8389 -2.4188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3526 -0.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6750 -0.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6753 -0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6765 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8381 0.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3531 -2.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5154 -2.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1907 -2.4179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5151 -1.4505 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6767 -0.9668 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8386 -1.4510 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0003 -0.9673 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8384 0.4837 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0595 -2.9190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8389 1.4506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5578 2.0971 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 4 1 0 0 0 0 2 11 1 0 0 0 0 3 5 1 0 0 0 0 3 12 1 0 0 0 0 6 7 1 0 0 0 0 6 16 1 0 0 0 0 7 17 1 0 0 0 0 8 9 1 0 0 0 0 9 18 1 0 0 0 0 10 11 2 0 0 0 0 10 12 1 0 0 0 0 11 13 1 0 0 0 0 12 19 2 0 0 0 0 13 5 1 1 0 0 0 13 14 1 0 0 0 0 14 8 1 6 0 0 0 14 15 1 0 0 0 0 15 4 1 1 0 0 0 15 16 1 0 0 0 0 16 18 1 6 0 0 0 17 18 1 6 0 0 0 17 20 1 0 0 0 0 18 1 1 6 0 0 0 20 21 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000903
DrugBank
ChEMBL
IUPHAR/BPS	6949
PharmaGKB
KEGG Drug
PubChem CID	9904
ChEBI
CAS Number

Drug Properties

Molecular Weight	274.19
ALogP	-0.1236
MLogP	3.22
XLogP	3.223
HDA	2
HBD	1
Rotatable Bonds	2
TPSA	37.3
RO5 Violation	0