Drug Information| Drug ID:   | NPD4633 |
| Drug Name:   | Fluprednisolone |
| Molecular Formula:   | C21H27FO5 |
| Canonical SMILES:   | OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F |
| Standard InCHI:   | "InChI=1S/C21H27FO5/c1-19-5-3-11(24)7-14(19)15(22)8-12-13-4-6-21(27,17(26)10-23)20(13,2)9-16(25)18(12)19/h3,5,7,12-13,15-16,18,23,25,27H,4,6,8-10H2,1-2H3/t12-,13-,15-,16-,18+,19-,20-,21-/m0/s1" |
| Standard InCHIKey:   | MYYIMZRZXIQBGI-HVIRSNARSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD4633Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6885 | NPC334061 |
| Remote Similarity | 0.6885 | NPC611819 |
| Remote Similarity | 0.6774 | NPC144956 |
| Remote Similarity | 0.6774 | NPC608439 |
| Remote Similarity | 0.5303 | NPC62180 |
| Remote Similarity | 0.5211 | NPC44063 |
| Remote Similarity | 0.5211 | NPC235800 |
| Remote Similarity | 0.5211 | NPC611921 |
| Remote Similarity | 0.5147 | NPC530777 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 378.18 |
| ALogP   | -0.4908 |
| MLogP   | 3.11 |
| XLogP   | 0.739 |
| HDA   | 5 |
| HBD   | 3 |
| Rotatable Bonds   | 8 |
| TPSA   | 94.83 |
| RO5 Violation   | 0 |