NPASS Compound

Natural Product: NPC471550

Natural Product ID	NPC471550
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	2-O-Methyl 4A-O-[(2S,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)Oxan-2-Yl] (2S,4Ar,6Ar,6As,6Br,8Ar,9R,10S,12Ar,14Bs)-10-[(2S,3R,4S,5R)-4-[(2S,3R,4S,5R)-3-[(2S,3R,4S,5S,6R)-4,5-Dihydroxy-6-(Hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-Trihydroxy-6-Methyloxan-2-Yl]Oxyoxan-2-Yl]Oxy-4,5-Dihydroxyoxan-2-Yl]Oxy-3,5-Dihydroxyoxan-2-Yl]Oxy-9-(Hydroxymethyl)-2,6A,6B,9,12A-Pentamethyl-1,3,4,5,6,6A,7,8,8A,10,11,12,13,14B-Tetradecahydropicene-2,4A-Dicarboxylate
IUPAC Name	2-O-methyl 4a-O-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (2S,4aR,6aR,6aS,6bR,8aR,9R,10S,12aR,14bS)-10-[(2S,3R,4S,5R)-4-[(2S,3R,4S,5R)-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl]oxy-3,5-dihydroxyoxan-2-yl]oxy-9-(hydroxymethyl)-2,6a,6b,9,12a-pentamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2,4a-dicarboxylate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL256355
PubChem CID	44448291
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 181190 0 0 0 0 0 0 0 0999 V2000 9.3201 1.8449 4.2930 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9691 1.7807 2.9422 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3789 0.4223 2.6310 C 0 0 1 0 0 0 0 0 0 0 0 0 8.0179 0.2899 1.3165 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4755 -0.9567 0.7897 C 0 0 1 0 0 0 0 0 0 0 0 0 7.9764 -1.0739 -0.4667 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0346 -2.0512 -0.6930 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8661 -1.4213 -1.3933 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3724 -2.3751 -2.3223 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1837 -3.6174 -1.7155 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5377 -4.2768 -1.4927 C 0 0 2 0 0 0 0 0 0 0 0 0 7.5536 -3.1405 -1.6665 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7830 -3.6247 -1.3327 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7220 -5.2884 -2.4227 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7878 -1.0763 -0.6402 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4469 0.2392 -0.6209 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2736 0.5203 -1.6005 C 0 0 2 0 0 0 0 0 0 0 0 0 3.5252 -0.1106 -2.8156 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2248 1.9910 -1.8075 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3596 2.6834 -0.6559 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0867 1.9612 0.5431 C 0 0 2 0 0 0 0 0 0 0 0 0 4.1395 0.8778 0.6873 C 0 0 2 0 0 0 0 0 0 0 0 0 5.2645 1.5597 1.2080 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8078 1.6129 0.4324 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8170 2.1223 1.1821 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1434 3.0648 0.5495 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4024 2.5332 -0.0119 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4286 1.0044 -0.1193 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0929 0.5338 1.2698 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1387 1.0013 1.9240 C 0 0 1 0 0 0 0 0 0 0 0 0 1.1268 -0.0822 2.3222 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2653 1.5591 3.3276 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8297 1.9854 4.0331 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4891 -0.8825 1.5178 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1346 -1.6218 0.4078 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1101 -0.8867 -0.4812 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8670 0.5551 -0.2849 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6926 1.3639 -1.2341 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0733 1.1401 -0.6974 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4832 -0.0260 -0.2635 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5682 -1.1778 -0.2952 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.6497 -2.1401 0.8690 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2231 -1.9953 -1.4259 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6296 -1.6634 -1.7296 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5520 -1.1077 -0.7229 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8970 -0.1179 0.2051 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1351 -0.2293 1.6436 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2597 -1.0831 2.1021 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7818 -2.1546 3.0969 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0955 -1.7525 1.0848 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3170 -2.2117 -0.0797 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2492 -0.2791 2.9376 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0301 0.9346 3.1417 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3447 -0.9308 3.4327 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3137 -0.2360 4.2239 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6395 -0.3682 -1.4860 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5155 -0.3244 -2.7325 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7119 0.2370 -0.9301 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7182 0.9322 -1.6450 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.7378 2.2163 -1.1751 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.7601 3.0193 -1.5868 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.5562 4.3751 -0.8921 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.5905 4.2078 0.4930 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.0665 2.4372 -1.0728 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.2180 1.0723 -1.7121 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.0304 0.1967 -1.4914 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.0481 -0.7956 -2.5021 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.3618 0.4755 -1.1584 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.1030 3.2436 -1.4965 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7332 -1.4488 -1.8598 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5859 0.6887 -1.2634 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0002 -0.8116 0.8573 C 0 0 1 0 0 0 0 0 0 0 0 0 10.3880 -1.0660 2.2845 C 0 0 2 0 0 0 0 0 0 0 0 0 9.2731 -0.6348 3.1807 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5690 -1.7304 3.7369 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5984 -0.4294 2.6169 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6263 -1.5908 -0.0784 O 0 0 0 0 0 0 0 0 0 0 0 0 11.1623 -0.7896 -1.0666 C 0 0 2 0 0 0 0 0 0 0 0 0 10.5066 -0.9915 -2.2945 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5106 0.2144 -2.9939 C 0 0 1 0 0 0 0 0 0 0 0 0 9.4024 1.1462 -2.5562 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8272 0.9423 -2.8199 C 0 0 1 0 0 0 0 0 0 0 0 0 12.9671 0.0376 -2.4591 C 0 0 2 0 0 0 0 0 0 0 0 0 12.6216 -0.9210 -1.3101 C 0 0 1 0 0 0 0 0 0 0 0 0 13.3602 -0.5045 -0.1972 O 0 0 0 0 0 0 0 0 0 0 0 0 14.0558 0.8331 -2.1213 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1169 1.5252 -4.0539 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2955 1.9128 4.4230 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2048 2.5617 2.7297 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8880 1.9688 2.3559 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4179 0.3596 3.2249 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1636 -1.7578 1.4505 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7564 -2.5486 0.2583 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3115 -0.5583 -1.9518 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7468 -3.4098 -0.7336 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5003 -4.2572 -2.2720 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5723 -4.6314 -0.4572 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4511 -2.7479 -2.6876 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7576 -3.9624 -0.4021 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8360 -6.1867 -2.0129 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2580 0.7981 -1.1218 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3479 0.1249 -1.2168 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3357 0.2653 -3.2224 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2185 2.2530 -2.2266 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9292 2.3306 -2.6141 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2003 2.7320 1.3316 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8540 0.1138 1.4138 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4007 2.4154 0.7349 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3602 2.7549 1.9391 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4810 3.8004 1.3447 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4011 3.7068 -0.1691 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3325 2.8040 0.5271 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5001 2.9129 -1.0750 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9394 1.0907 1.8365 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7321 -0.7562 3.1080 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5330 -0.6664 1.5156 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9899 0.4961 2.7848 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7565 0.7523 3.9053 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9455 2.4094 3.1308 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8964 2.9906 4.0492 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0258 -1.0257 2.5089 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5281 -1.4359 1.7539 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2445 -1.9912 -0.2161 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4821 -2.5756 0.8151 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3343 0.7784 0.7334 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4127 2.4329 -1.1968 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6080 1.0504 -2.2906 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7105 2.0429 -0.7036 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1302 -1.8565 1.7678 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6736 -2.4314 1.1580 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2977 -3.1311 0.4225 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1068 -3.0875 -1.2609 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7250 -1.8121 -2.4156 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1207 -2.6128 -2.1193 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7189 -1.0002 -2.6524 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3983 0.8809 -0.0547 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2284 -0.4885 2.2616 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3411 0.7991 2.1165 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6157 -2.4329 3.7677 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9418 -1.7899 3.7121 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4796 -3.0682 2.5536 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5122 -2.6988 1.5675 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0260 -1.1989 0.8242 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9688 -2.6489 -0.8917 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6664 -3.0570 0.2084 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3013 -0.6778 5.2411 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3285 -0.4181 3.7954 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1309 0.8518 4.2587 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4256 0.8929 -2.7133 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7445 3.2071 -2.6625 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3664 5.0470 -1.1749 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5596 4.7439 -1.2072 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1044 4.9238 0.9744 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9789 2.4042 0.0246 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4168 1.2456 -2.7877 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1047 -0.3593 -0.5335 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8629 -0.2782 -3.3459 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.1959 -0.4958 -1.1990 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7764 3.9350 -2.1373 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0619 -2.5300 -1.7981 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6152 -1.6269 -1.9288 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0103 -0.8877 -2.7080 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0547 -0.1727 -1.2178 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0616 1.5501 -1.6243 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2903 0.6833 -2.1620 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1669 0.2730 0.6013 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5717 -2.1681 2.4246 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7728 -0.1756 4.0903 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2400 -2.1959 4.3072 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0706 -0.9243 3.3373 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9668 0.2998 -0.8326 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3322 0.0026 -4.0636 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4254 0.8848 -3.0597 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6110 2.1769 -2.8822 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2666 1.1810 -1.4567 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6973 1.7893 -2.0876 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2277 -0.5289 -3.3846 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9155 -1.9383 -1.6519 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3348 -0.6347 -0.3596 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8883 0.3089 -2.1576 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1638 2.5144 -4.0042 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 11 14 1 0 8 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 1 30 32 1 0 32 33 1 0 29 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 1 1 41 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 1 48 50 1 0 50 51 1 0 48 52 1 0 52 53 2 0 52 54 1 0 54 55 1 0 45 56 1 6 56 57 2 0 56 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 61 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 65 68 1 0 64 69 1 0 36 70 1 6 28 71 1 6 5 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 73 76 1 0 72 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 80 82 1 0 82 83 1 0 83 84 1 0 84 85 1 0 83 86 1 0 82 87 1 0 74 3 1 0 84 78 1 0 12 7 1 0 22 16 1 0 30 25 1 0 41 36 1 0 51 45 1 0 66 59 1 0 37 28 1 0 46 40 1 0 1 88 1 0 2 89 1 0 2 90 1 0 3 91 1 1 5 92 1 1 7 93 1 1 8 94 1 6 10 95 1 0 10 96 1 0 11 97 1 1 12 98 1 6 13 99 1 0 14100 1 0 16101 1 6 17102 1 1 18103 1 0 19104 1 0 19105 1 0 21106 1 1 22107 1 1 23108 1 0 25109 1 1 26110 1 0 26111 1 0 27112 1 0 27113 1 0 29114 1 1 31115 1 0 31116 1 0 31117 1 0 32118 1 0 32119 1 0 33120 1 0 34121 1 0 34122 1 0 35123 1 0 35124 1 0 37125 1 1 38126 1 0 38127 1 0 39128 1 0 42129 1 0 42130 1 0 42131 1 0 43132 1 0 43133 1 0 44134 1 0 44135 1 0 46136 1 6 47137 1 0 47138 1 0 49139 1 0 49140 1 0 49141 1 0 50142 1 0 50143 1 0 51144 1 0 51145 1 0 55146 1 0 55147 1 0 55148 1 0 59149 1 6 61150 1 6 62151 1 0 62152 1 0 63153 1 0 64154 1 1 65155 1 6 66156 1 1 67157 1 0 68158 1 0 69159 1 0 70160 1 0 70161 1 0 70162 1 0 71163 1 0 71164 1 0 71165 1 0 72166 1 6 73167 1 6 74168 1 1 75169 1 0 76170 1 0 78171 1 1 80172 1 6 81173 1 0 81174 1 0 81175 1 0 82176 1 1 83177 1 6 84178 1 6 85179 1 0 86180 1 0 87181 1 0 M END

Standard InCHIKey	NBNAOSJJHSGRFO-QBGVXYMISA-N
Standard InCHI	InChI=1S/C59H94O28/c1-24-34(65)38(69)41(72)48(80-24)85-46-40(71)37(68)30(20-61)82-51(46)86-45-35(66)27(63)21-79-50(45)84-44-28(64)22-78-47(43(44)74)83-33-11-12-55(3)31(56(33,4)23-62)10-13-58(6)32(55)9-8-25-26-18-54(2,52(75)77-7)14-16-59(26,17-15-57(25,58)5)53(76)87-49-42(73)39(70)36(67)29(19-60)81-49/h8,24,26-51,60-74H,9-23H2,1-7H3/t24-,26-,27+,28+,29+,30+,31+,32+,33-,34-,35-,36+,37+,38+,39-,40-,41+,42+,43+,44-,45+,46+,47-,48-,49-,50-,51-,54-,55-,56-,57+,58+,59-/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@@H](OC[C@H]([C@@H]2O)O)O[C@H]2[C@H](O)CO[C@H]([C@@H]2O)O[C@H]2CC[C@]3([C@H]([C@]2(C)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3C[C@](C)(CC2)C(=O)OC)C(=O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1250.59	Volume:	1181.672 ? Van der Waals volume.
Dense:	1.058	LogP:	-1.012 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.462 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.197 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	58.0
TPSA:	439.12 ? Topological Polar Surface Area.	H-Bond Acceptor:	28.0
H-Bond Donor:	15.0	Rings:	10.0
Heavy Atoms:	28.0

MedChem Properties

QED Drug-Likeness Score:	0.045	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.358	Fsp³:	0.932
MCE-18:	217.579 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.752	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.308	Promiscuous compounds:	0.078

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.763	MDCK Permeability:	-5.019
Pgp-inhibitor:	0.0	Pgp-substrate:	0.881
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.313
20% Bioavailability (F20%):	0.37	30% Bioavailability (F30%):	0.992
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.069
Plasma Protein Binding (PPB):	57.609%	Volume Distribution (VD):	-0.356
Fu:	31.481% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.001
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.009	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.004
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.73

Half-life (T1/2):

3.998

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.789	Drug-induced Liver Injury (DILI):	0.849
AMES Toxicity:	0.95	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.022	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.468	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.149	RPMI-8226 Immunitoxicity:	0.251
A549 Cytotoxicity:	0.689	Hek293 Cytotoxicity:	0.172
BCF:	0.496 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.32 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.971 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.87 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO17551	Phytolacca americana	Species	Phytolaccaceae	Eukaryota	roots	n.a.	n.a.	PMID[18177012]
NPO17551	Phytolacca americana	Species	Phytolaccaceae	Eukaryota	Seeds	n.a.	n.a.	PMID[26595875]
NPO17551	Phytolacca americana	Species	Phytolaccaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO17551	Phytolacca americana	Species	Phytolaccaceae	Eukaryota	Fruit	n.a.	n.a.	Database[FooDB]
NPO17551	Phytolacca americana	Species	Phytolaccaceae	Eukaryota	Shoot	n.a.	n.a.	Database[FooDB]
NPO17551	Phytolacca americana	Species	Phytolaccaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO17551	Phytolacca americana	Species	Phytolaccaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO17551	Phytolacca americana	Species	Phytolaccaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO17551	Phytolacca americana	Species	Phytolaccaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO17551	Phytolacca americana	Species	Phytolaccaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO17551	Phytolacca americana	Species	Phytolaccaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	5
IC50	3

Activity Type	# Activity
Cell line	5
Individual protein	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	Activity	=	94.0	%	PMID[19901088]
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	Activity	=	68.0	%	PMID[16417306]
NPT668	Individual protein	P-glycoprotein 1	Homo sapiens	Activity	=	93.0	%	PubChem BioAssay data set

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT81	Cell line	A549	Homo sapiens	Activity	>	89.0	uM	PMID[7783146]
NPT65	Cell line	HepG2	Homo sapiens	IC50	>	89000.0	nM	PMID[23659371]
NPT1475	Cell line	WI-38 VA13	Homo sapiens	IC50	>	89000.0	nM	PMID[17958396]
NPT1374	Cell line	WI-38	Homo sapiens	IC50	>	89000.0	nM	Open TG-GATES in vivo data: Pathology

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC471550 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23526
0.1-0.2	22427
0.2-0.3	2657
0.3-0.4	743
0.4-0.5	321
0.5-0.6	137
0.6-0.7	42
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7143	Intermediate Similarity	NPC475504
0.7027	Intermediate Similarity	NPC309714
0.6964	Remote Similarity	NPC480475
0.6937	Remote Similarity	NPC112352
0.6818	Remote Similarity	NPC473373
0.6667	Remote Similarity	NPC293330
0.6577	Remote Similarity	NPC475516
0.6562	Remote Similarity	NPC298034
0.6562	Remote Similarity	NPC71065
0.6555	Remote Similarity	NPC481078
0.6525	Remote Similarity	NPC486564
0.6429	Remote Similarity	NPC139894
0.6404	Remote Similarity	NPC469946
0.6393	Remote Similarity	NPC76972
0.6393	Remote Similarity	NPC469782
0.6393	Remote Similarity	NPC204414
0.6357	Remote Similarity	NPC202828
0.6357	Remote Similarity	NPC119592
0.6341	Remote Similarity	NPC79643
0.6271	Remote Similarity	NPC297263
0.626	Remote Similarity	NPC70809
0.624	Remote Similarity	NPC123199
0.6218	Remote Similarity	NPC486563
0.6198	Remote Similarity	NPC480474
0.619	Remote Similarity	NPC475160
0.619	Remote Similarity	NPC473714
0.6186	Remote Similarity	NPC63159
0.6174	Remote Similarity	NPC295371
0.6154	Remote Similarity	NPC160415
0.6129	Remote Similarity	NPC475287
0.6121	Remote Similarity	NPC473343
0.6116	Remote Similarity	NPC481079
0.6111	Remote Similarity	NPC135904
0.6107	Remote Similarity	NPC305981
0.6102	Remote Similarity	NPC46665
0.6066	Remote Similarity	NPC480473
0.6063	Remote Similarity	NPC100639
0.6061	Remote Similarity	NPC261506
0.6061	Remote Similarity	NPC4328
0.605	Remote Similarity	NPC162574
0.6047	Remote Similarity	NPC476068
0.6031	Remote Similarity	NPC65105
0.6016	Remote Similarity	NPC488560
0.6	Remote Similarity	NPC313110
0.597	Remote Similarity	NPC224381
0.5954	Remote Similarity	NPC41061
0.5954	Remote Similarity	NPC227551
0.5935	Remote Similarity	NPC241909
0.5932	Remote Similarity	NPC223301
0.5932	Remote Similarity	NPC171544
0.5929	Remote Similarity	NPC90856
0.5873	Remote Similarity	NPC60557
0.5873	Remote Similarity	NPC67857
0.5865	Remote Similarity	NPC236638
0.5865	Remote Similarity	NPC294453
0.5812	Remote Similarity	NPC58448
0.5804	Remote Similarity	NPC256798
0.5802	Remote Similarity	NPC57484
0.5797	Remote Similarity	NPC480422
0.5789	Remote Similarity	NPC214484
0.576	Remote Similarity	NPC31838
0.575	Remote Similarity	NPC109588
0.5746	Remote Similarity	NPC481081
0.5738	Remote Similarity	NPC222580
0.5736	Remote Similarity	NPC155410
0.5702	Remote Similarity	NPC164389
0.5693	Remote Similarity	NPC250247
0.5682	Remote Similarity	NPC21691
0.568	Remote Similarity	NPC187618
0.5678	Remote Similarity	NPC150400
0.5652	Remote Similarity	NPC189884
0.5652	Remote Similarity	NPC138334
0.5645	Remote Similarity	NPC114484
0.5635	Remote Similarity	NPC36831
0.5625	Remote Similarity	NPC268184
0.562	Remote Similarity	NPC30735
0.5583	Remote Similarity	NPC161674
0.5581	Remote Similarity	NPC192600
0.5573	Remote Similarity	NPC191827
0.5556	Remote Similarity	NPC43550
0.5556	Remote Similarity	NPC48499
0.5538	Remote Similarity	NPC165204
0.5532	Remote Similarity	NPC33012
0.5524	Remote Similarity	NPC475368
0.5522	Remote Similarity	NPC473452
0.5522	Remote Similarity	NPC110633
0.552	Remote Similarity	NPC114692
0.552	Remote Similarity	NPC104372
0.552	Remote Similarity	NPC276093
0.55	Remote Similarity	NPC473884
0.5489	Remote Similarity	NPC85154
0.5489	Remote Similarity	NPC481080
0.5476	Remote Similarity	NPC301449
0.5476	Remote Similarity	NPC218954
0.5476	Remote Similarity	NPC601290
0.5461	Remote Similarity	NPC8524
0.5447	Remote Similarity	NPC473401
0.5447	Remote Similarity	NPC10607
0.544	Remote Similarity	NPC95437
0.5433	Remote Similarity	NPC295823
0.5433	Remote Similarity	NPC174720
0.5433	Remote Similarity	NPC475467
0.542	Remote Similarity	NPC475899
0.5417	Remote Similarity	NPC249848
0.5417	Remote Similarity	NPC107966
0.5409	Remote Similarity	NPC469777
0.5404	Remote Similarity	NPC469772
0.5403	Remote Similarity	NPC68175
0.5397	Remote Similarity	NPC236657
0.5372	Remote Similarity	NPC39211
0.536	Remote Similarity	NPC131469
0.535	Remote Similarity	NPC469778
0.5333	Remote Similarity	NPC174679
0.5333	Remote Similarity	NPC279554
0.5333	Remote Similarity	NPC59804
0.5328	Remote Similarity	NPC471547
0.5323	Remote Similarity	NPC251768
0.5323	Remote Similarity	NPC159309
0.5323	Remote Similarity	NPC148603
0.5323	Remote Similarity	NPC86222
0.5312	Remote Similarity	NPC120116
0.529	Remote Similarity	NPC136768
0.529	Remote Similarity	NPC469775
0.529	Remote Similarity	NPC477463
0.5287	Remote Similarity	NPC469774
0.5286	Remote Similarity	NPC220160
0.5285	Remote Similarity	NPC192791
0.5283	Remote Similarity	NPC100925
0.5271	Remote Similarity	NPC187290
0.5259	Remote Similarity	NPC4749
0.5259	Remote Similarity	NPC128925
0.525	Remote Similarity	NPC12288
0.5244	Remote Similarity	NPC469773
0.5242	Remote Similarity	NPC471548
0.5238	Remote Similarity	NPC123796
0.5231	Remote Similarity	NPC75287
0.5227	Remote Similarity	NPC123522
0.5221	Remote Similarity	NPC237191
0.5221	Remote Similarity	NPC237503
0.521	Remote Similarity	NPC78046
0.5207	Remote Similarity	NPC235405
0.52	Remote Similarity	NPC11551
0.5194	Remote Similarity	NPC470477
0.5188	Remote Similarity	NPC133818
0.5179	Remote Similarity	NPC167383
0.5175	Remote Similarity	NPC153673
0.5159	Remote Similarity	NPC475591
0.5159	Remote Similarity	NPC236870
0.5159	Remote Similarity	NPC118440
0.5145	Remote Similarity	NPC258617
0.5145	Remote Similarity	NPC475514
0.5143	Remote Similarity	NPC144644
0.5143	Remote Similarity	NPC170407
0.5133	Remote Similarity	NPC472268
0.513	Remote Similarity	NPC68419
0.5126	Remote Similarity	NPC204458
0.5116	Remote Similarity	NPC324875
0.5116	Remote Similarity	NPC292677
0.5109	Remote Similarity	NPC484545
0.5105	Remote Similarity	NPC102505
0.5105	Remote Similarity	NPC488514
0.5103	Remote Similarity	NPC477464
0.5083	Remote Similarity	NPC29069
0.5081	Remote Similarity	NPC263756
0.5079	Remote Similarity	NPC173859
0.5077	Remote Similarity	NPC80986
0.5075	Remote Similarity	NPC470911
0.5072	Remote Similarity	NPC286457
0.507	Remote Similarity	NPC142151
0.5069	Remote Similarity	NPC110385
0.5068	Remote Similarity	NPC275225
0.5067	Remote Similarity	NPC297950
0.5066	Remote Similarity	NPC45606
0.5041	Remote Similarity	NPC173583
0.5041	Remote Similarity	NPC475208
0.5041	Remote Similarity	NPC179434
0.5039	Remote Similarity	NPC148417
0.5039	Remote Similarity	NPC235438
0.5035	Remote Similarity	NPC37860
0.5033	Remote Similarity	NPC220838
0.503	Remote Similarity	NPC295941

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC471550 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7634
0.1-0.2	1472
0.2-0.3	40
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data